stat940W25: Difference between revisions

From statwiki
Jump to navigation Jump to search
No edit summary
 
Line 33: Line 33:
=== Solution ===
=== Solution ===


==== Step 1: Linear Separability Assumption ====
<b> Step 1: Linear Separability Assumption </b>
If the dataset is linearly separable, there exists a weight vector <math> \mathbf{w}^* </math> and a bias <math> b^* </math> such that:
If the dataset is linearly separable, there exists a weight vector <math> \mathbf{w}^* </math> and a bias <math> b^* </math> such that:
<math>
<math>
Line 40: Line 40:
Without loss of generality, let <math>\| \mathbf{w}^* \| = 1</math> (normalize <math>\mathbf{w}^*</math>).
Without loss of generality, let <math>\| \mathbf{w}^* \| = 1</math> (normalize <math>\mathbf{w}^*</math>).


==== Step 2: Perceptron Update Rule ====
<b> Step 2: Perceptron Update Rule </b>
The Perceptron algorithm updates the weight vector <math> \mathbf{w} </math> and bias <math> b </math> as follows:
The Perceptron algorithm updates the weight vector <math> \mathbf{w} </math> and bias <math> b </math> as follows:
* Initialize <math>\mathbf{w}_0 = 0</math> and <math>b_0 = 0</math>.
* Initialize <math>\mathbf{w}_0 = 0</math> and <math>b_0 = 0</math>.
Line 54: Line 54:
Since the dataset is linearly separable, <math>\gamma > 0</math>.
Since the dataset is linearly separable, <math>\gamma > 0</math>.


==== Step 3: Bounding the Number of Updates ====
<b> Step 3: Bounding the Number of Updates </b>


Let <math>\mathbf{w}_t</math> be the weight vector after <math>t</math>-th update. Define:
Let <math>\mathbf{w}_t</math> be the weight vector after <math>t</math>-th update. Define:
Line 62: Line 62:
the maximum squared norm of any input vector.
the maximum squared norm of any input vector.


===== Growth of <math>\| \mathbf{w}_t \|^2</math> =====
<b> Growth of <math>\| \mathbf{w}_t \|^2</math> </b>
After <math>t</math> updates, the norm of <math>\mathbf{w}_t</math> satisfies:
After <math>t</math> updates, the norm of <math>\mathbf{w}_t</math> satisfies:
<math>
<math>
Line 76: Line 76:
</math>
</math>


===== Lower Bound on <math>\mathbf{w}_t \cdot \mathbf{w}^*</math> =====
<b> Lower Bound on <math>\mathbf{w}_t \cdot \mathbf{w}^*</math> </b>
Let <math>\mathbf{w}_t</math> be the weight vector after <math>t</math>-th update. Each update increases <math>\mathbf{w}_t \cdot \mathbf{w}^*</math> by at least <math>\gamma</math>:
Let <math>\mathbf{w}_t</math> be the weight vector after <math>t</math>-th update. Each update increases <math>\mathbf{w}_t \cdot \mathbf{w}^*</math> by at least <math>\gamma</math>:
<math>
<math>
Line 90: Line 90:
</math>
</math>


===== Combining the Results =====
<b> Combining the Results </b>
The Cauchy-Schwarz inequality gives:
The Cauchy-Schwarz inequality gives:
<math>
<math>
Line 108: Line 108:
</math>
</math>


==== Step 4: Conclusion ====
<b> Step 4: Conclusion </b>
 
The Perceptron Learning Algorithm converges after at most <math>\frac{M}{\gamma^2}</math> updates, which is finite. This proves that the algorithm terminates when the dataset is linearly separable.
The Perceptron Learning Algorithm converges after at most <math>\frac{M}{\gamma^2}</math> updates, which is finite. This proves that the algorithm terminates when the dataset is linearly separable.


</div>
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


== Exercise 1.2 ==
== Exercise 1.2 ==
Line 155: Line 154:
Therefore, in total, the number of parameters is <math>ND+D+(K-1)(D^2+D)+MD+M</math>  
Therefore, in total, the number of parameters is <math>ND+D+(K-1)(D^2+D)+MD+M</math>  


</div>
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


Line 168: Line 165:


This problem modified from the background mathematics problem chap01 Question1.  
This problem modified from the background mathematics problem chap01 Question1.  


=== Question ===
=== Question ===
Line 344: Line 340:
== Exercise 1.5 ==
== Exercise 1.5 ==


<b>Level:</b> * (Esay)   
<b>Level:</b> * (Easy)   


<b>Exercise Types:</b> Novel   
<b>Exercise Types:</b> Novel   
Line 350: Line 346:
=== Question ===
=== Question ===


1.2012: ________'s ImageNet victory brings mainstream attention.
1.2012: ________'s ImageNet victory brings mainstream attention to deep learning.


2.2016: Google's ________ uses deep learning to defeat a Go world champion.
2.2016: Google's ________ uses deep reinforcement learning to defeat a Go world champion.


3.2017: ________ architecture revolutionizes Natural Language Processing.
3.2017: The ________ architecture revolutionizes Natural Language Processing.


=== Solution ===
=== Solution ===
Line 413: Line 409:


==== c) ====
==== c) ====
===== Step 1: XOR Dataset =====
<b> Step 1: XOR Dataset </b>


The XOR problem has the following data points and labels:
The XOR problem has the following data points and labels:
Line 500: Line 496:


=== Solution ===
=== Solution ===
(a) Derivative:
(a) '''Derivative''':
Starting with <math>\sigma(x) = \frac{1}{1 + e^{-x}}</math>:
Starting with <math>\sigma(x) = \frac{1}{1 + e^{-x}}</math>, we compute:
<math> \sigma'(x) = \frac{d}{dx} \left( \frac{1}{1 + e^{-x}} \right) = \frac{e^{-x}}{(1 + e^{-x})^2}. </math>
<math> \sigma'(x)  
Simplifying using <math>\sigma(x) = \frac{1}{1 + e^{-x}}</math> and <math>1 - \sigma(x) = \frac{e^{-x}}{1 + e^{-x}}</math>, we find:
= \frac{d}{dx} \left( \frac{1}{1 + e^{-x}} \right)  
<math> \sigma'(x) = \sigma(x)(1 - \sigma(x)). </math>
= \frac{e^{-x}}{(1 + e^{-x})^2}. </math>
 
By noting that <math>\sigma(x) = \frac{1}{1 + e^{-x}}</math> and <math>1 - \sigma(x) = \frac{e^{-x}}{1 + e^{-x}},</math> we simplify to:
<math> \sigma'(x) = \sigma(x)\bigl(1 - \sigma(x)\bigr). </math>
 
(b) '''Why sigmoid for probabilities''':
The sigmoid function maps any real <math>x</math> into <math>(0,1)</math>, which aligns with the range of valid probabilities in binary classification. Moreover, its derivative <math>\sigma'(x) = \sigma(x)(1 - \sigma(x))</math> makes gradient-based optimization naturally scale updates based on “confidence.” When <math>\sigma(x)</math> is near 0 or 1, the gradient becomes small, preventing large adjustments once the model is fairly certain in its prediction.
 
A closely related function is the '''softmax''', which generalizes the same probabilistic interpretation to multi-class settings. For two classes, softmax is essentially the same as the sigmoid function, so it can also be suitable for binary classification problems.


(b) The sigmoid function outputs values in the range <math>(0, 1)</math>, making it ideal for modeling probabilities. The derivative <math>\sigma'(x) = \sigma(x)(1 - \sigma(x))</math> ensures that gradient updates during optimization are proportional to the confidence of the prediction, preventing drastic updates for very confident predictions.
</div>
</div>


<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


== Exercise 1.8 ==
== Exercise 1.8 ==
Line 549: Line 551:
== Exercise 1.9 ==
== Exercise 1.9 ==


<b>Level:</b> ** (Easy)   
<b>Level:</b> * (Easy)   


<b>Exercise Types:</b> Novel   
<b>Exercise Types:</b> Novel   


=== Question ===
=== Question ===
How are neural networks modeled?
How are neural networks modeled? Using an example to explain it clearly.


=== Solution ===
=== Solution ===
Line 570: Line 572:
<p><math> H_2 = 0.5\times 2.0 + 0.9\times 1.0 + -0.3\times -4.0= 0.96 </math>, </p>
<p><math> H_2 = 0.5\times 2.0 + 0.9\times 1.0 + -0.3\times -4.0= 0.96 </math>, </p>
<p><math> H_3 = 0.5\times 1.0 + 0.9\times -1.0+ -0.3\times 0.0 = 0.40 </math>, </p>
<p><math> H_3 = 0.5\times 1.0 + 0.9\times -1.0+ -0.3\times 0.0 = 0.40 </math>, </p>
which are then processed by the output layer to produce predictions.
which are then processed by the output layer to produce the final predictions.
 
This process demonstrates how neural networks learn and transform input data step by step.


</div>
</div>
Line 604: Line 608:
3. Learning and Adaptation: Biological neurons strengthen or weaken their connections based on experience (neuroplasticity). This is similar to how artificial networks adjust weights during training using backpropagation and optimization algorithms. The dynamic modification of weights allows artificial networks to learn from data.
3. Learning and Adaptation: Biological neurons strengthen or weaken their connections based on experience (neuroplasticity). This is similar to how artificial networks adjust weights during training using backpropagation and optimization algorithms. The dynamic modification of weights allows artificial networks to learn from data.


 
Extra 4. Sparsity of Activation: Biologically, only a small fraction of neurons in the brain are active at specific time, which is energy-efficient and reduces redundancy. RELU attempts to micmic this sparsity so that reducing computational cost and improving generalization becomes feasible.
</div>
</div>


<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


== Exercise 1.11 ==
== Exercise 1.11 ==
Line 696: Line 699:


<b>Exercise Types:</b> Novel   
<b>Exercise Types:</b> Novel   


=== Question ===
=== Question ===
Explain whether this is a classification, regression, or clustering task each time. If the task is either classification or regression, also comment on whether the focus is prediction or explanation.
Explain whether this is a classification, regression, or clustering task each time. If the task is either classification or regression, also comment on whether the focus is prediction or explanation.


1. **Stock Market Trends:** 
1. Stock Market Trends:  
   A financial analyst wants to predict the future stock prices of a company based on historical trends, economic indicators, and company performance metrics.
   A financial analyst wants to predict the future stock prices of a company based on historical trends, economic indicators, and company performance metrics.


2. **Customer Segmentation:** 
2. Customer Segmentation:  
   A retail company wants to group its customers based on their purchasing behaviour, including transaction frequency, product categories, and total spending, to design targeted marketing campaigns.
   A retail company wants to group its customers based on their purchasing behaviour, including transaction frequency, product categories, and total spending, to design targeted marketing campaigns.


3. **Medical Diagnosis:** 
3. Medical Diagnosis:  
   A hospital wants to develop a model to determine whether a patient has a specific disease based on symptoms, medical history, and lab test results.
   A hospital wants to develop a model to determine whether a patient has a specific disease based on symptoms, medical history, and lab test results.


4. **Predicting Car Fuel Efficiency:** 
4. Predicting Car Fuel Efficiency:  
   An automotive researcher wants to understand how engine size, weight, and aerodynamics affect a car's fuel efficiency (miles per gallon).
   An automotive researcher wants to understand how engine size, weight, and aerodynamics affect a car's fuel efficiency (miles per gallon).


=== Solution ===
=== Solution ===


==== **1. Stock Market Trends** ====
==== 1. Stock Market Trends ====
**Task Type:** Regression   
**Task Type: Regression   
**Focus:** Prediction   
**Focus: Prediction   
**Reasoning:** Stock prices are continuous numerical values, making this a regression task. The goal is to predict future prices rather than explain past fluctuations.
**Reasoning: Stock prices are continuous numerical values, making this a regression task. The goal is to predict future prices rather than explain past fluctuations.


==== **2. Customer Segmentation** ====
==== 2. Customer Segmentation ====
**Task Type:** Clustering   
**Task Type: Clustering   
**Focus:** —   
**Focus: —   
**Reasoning:** Customers are grouped based on their purchasing behaviour without predefined labels, making this a clustering task.
**Reasoning: Customers are grouped based on their purchasing behaviour without predefined labels, making this a clustering task.


==== **3. Medical Diagnosis** ====
==== 3. Medical Diagnosis ====
**Task Type:** Classification   
**Task Type: Classification   
**Focus:** Prediction   
**Focus: Prediction   
**Reasoning:** The disease status is a categorical outcome (Has disease: Yes/No), making this a classification problem. The goal is to predict a diagnosis for future patients.
**Reasoning: The disease status is a categorical outcome (Has disease: Yes/No), making this a classification problem. The goal is to predict a diagnosis for future patients.


==== **4. Predicting Car Fuel Efficiency** ====
==== 4. Predicting Car Fuel Efficiency ====
**Task Type:** Regression   
**Task Type: Regression   
**Focus:** Explanation   
**Focus: Explanation   
**Reasoning:** Fuel efficiency (miles per gallon) is a continuous variable. The researcher is interested in understanding how different factors influence efficiency, so the focus is on explanation.
**Reasoning: Fuel efficiency (miles per gallon) is a continuous variable. The researcher is interested in understanding how different factors influence efficiency, so the focus is on explanation.


=== Summary ===
=== Summary ===
Line 777: Line 779:
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


== Exercise 2.1 ==
== Exercise 1.14 ==
 
<b>Level:</b> * (Easy) 
 
<b>Exercise Types:</b> Novel 
 
=== Question ===
You are given a set of real-world scenarios. Your task is to identify the most suitable fundamental machine learning approach for each scenario and justify your choice.
 
**Scenarios:
1. Loan Default Prediction:
  A bank wants to predict whether a loan applicant will default on their loan based on their credit history, income, and employment status.
 
2. House Price Estimation:
  A real estate company wants to estimate the price of a house based on features such as location, size, and number of bedrooms.


'''Level:''' * (Easy)
3. User Grouping for Advertising:
  A social media platform wants to group users with similar interests and online behavior for targeted advertising.


'''Exercise Types:''' Novel
4. Dimensionality Reduction in Medical Data:** 
  A medical researcher wants to reduce the number of variables in a dataset containing hundreds of patient health indicators while retaining the most important information.


'''References:''' Calin, Ovidiu. Deep learning architectures: A mathematical approach. Springer, 2020
**Tasks:
- For each scenario, classify the problem into one of the four fundamental categories: Classification, Regression, Clustering, or Dimensionality Reduction.
- Explain why you selected that category for each scenario.
- Suggest a possible algorithm that could be used to solve each problem.


This problem is coincidentally similar to Exercise 5.10.1 (page 163) in this textbook, although that exercise was not used as the basis for this question.
=== Solution ===


=== Question ===
1. Loan Default Prediction
**Task Type: Classification 
**Reasoning: The target variable (loan default) is categorical (Yes/No), making this a classification problem. The goal is to predict whether an applicant will default based on their financial history. 
**Possible Algorithm: Logistic Regression, Random Forest, or Gradient Boosting.


This problem is about using perceptrons to implement logic functions. Assume a dataset of the form <math>x_1, x_2 \in \{0, 1\}</math>, and a perceptron defined as:
2. House Price Estimation
<math>
**Task Type: Regression 
y = H(\beta_0 + \beta_1 x_1 + \beta_2 x_2),
**Reasoning: House prices are continuous numerical values, making this a regression task. The goal is to estimate a house's price based on features like location and size. 
</math>
**Possible Algorithm:** Linear Regression, Decision Trees, or XGBoost.
where <math>H</math> is the Heaviside step function, defined as:
<math>
H(z) = \begin{cases}
1, & \text{if } z \geq 0, \
0, & \text{if } z < 0.
\end{cases}
</math>


(a)* Find weights <math>\beta_1, \beta_2</math> and bias <math>\beta_0</math> for a single perceptron that implements the '''AND''' function.
3. User Grouping for Advertising
**Task Type: Clustering 
**Reasoning: The goal is to group users based on their behavior without predefined labels, making this a clustering task. 
**Possible Algorithm: K-Means, DBSCAN, or Hierarchical Clustering.


(b)* Find the weights <math>\beta_1, \beta_2</math> and bias <math>\beta_0</math> for a single perceptron that implements the '''OR''' function.
4. Dimensionality Reduction in Medical Data
**Task Type: Dimensionality Reduction 
**Reasoning: The goal is to reduce the number of variables while preserving essential information, making this a dimensionality reduction task. 
**Possible Algorithm: Principal Component Analysis (PCA), t-SNE, or Autoencoders.


(c)** Given the truth table for the '''XOR''' function:


<math>
\begin{array}{|c|c|c|}
\hline
x_1 & x_2 & x_1 \oplus x_2 \
\hline
0 & 0 & 0 \
0 & 1 & 1 \
1 & 0 & 1 \
1 & 1 & 0 \
\hline
\end{array}
</math>


Show that it cannot be learned by a single perceptron. Find a small neural network of multiple perceptrons that can implement the '''XOR''' function. (Hint: a hidden layer with 2 perceptrons).
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 1.15 ==
 
<b>Level:</b> * (Easy) 
 
<b>Exercise Types:</b> Novel
 
=== Question ===
Define what machine learning is and how it is different from classical statistics. Provide the three learning methods used in machine learning, briefly define each and give an example of where each of them can be used. Include some common algorithms for each of the learning methods.


=== Solution ===
=== Solution ===


(a) A perceptron that implements the '''AND''' function:
**Machine learning Definition
<span style="display:inline-block; width: 4em;"></span> – Machine Learning is the ability to teach a computer without explicitly
programming it </br>
<span style="display:inline-block; width: 4em;"></span> – Examples are used to train computers to perform tasks that would be
difficult to program


<math>y = H(-1.5 + x_1 + x_2).</math>
<span style="display:inline-block; width: 4em;"></span>The difference between classical statistics and machine learning is the size of the data that they infer information from.  </br>
<span style="display:inline-block; width: 4em;"></span>In classical statistics, this is usually done from a small dataset(not enough data) while in machine learning it is done from a large dataset(Too many data).


Here:
**Supervised learning
<span style="display:inline-block; width: 4em;"></span>Supervised learning is a type of machine learning where the model is trained on a labeled dataset, meaning each training example has input features and a corresponding correct output. The algorithm learns the relationship <span style="display:inline-block; width: 4em;"></span>between inputs and outputs to make predictions on new, unseen data.


<math>\beta_0 = -1.5, \quad \beta_1 = 1, \quad \beta_2 = 1.</math>. This works because the '''AND''' function returns 1 only when both inputs are 1. For a perceptron, the condition for activation is:
<span style="display:inline-block; width: 4em;"></span>Examples:</br>
<math>
<span style="display:inline-block; width: 4em;"></span>Predicting house prices based on location, size, and other features (Regression).</br>  
\beta_0 + \beta_1 x_1 + \beta_2 x_2 \geq 0.
<span style="display:inline-block; width: 4em;"></span>Identifying whether an email is spam or not (Classification).</br>  
</math>
This must hold for (1, 1) but fail for all other combinations. Substituting values leads to the choice of <math>\beta_0 = -1.5</math> and <math>\beta_1 = \beta_2 = 1</math>.
 
(b) A perceptron that implements the '''OR''' function:


<math>y = H(-0.5 + x_1 + x_2).</math>
<span style="display:inline-block; width: 4em;"></span>Common Algorithms:</br>
<span style="display:inline-block; width: 4em;"></span>Linear Regression, Logistic Regression, Decision Trees, Random Forest, Support Vector Machines (SVM), Neural Networks.


Here:
**Unsupervised Learning


<math>\beta_0 = -0.5, \quad \beta_1 = 1, \quad \beta_2 = 1.</math> This works because the '''OR''' function returns 1 if either or both inputs are 1. Using similar logic to the '''AND''' case, the decision boundary conditions lead to these parameters.
<span style="display:inline-block; width: 4em;"></span>Unsupervised learning involves training a model on data without labeled outputs. The algorithm attempts to discover patterns, structures, or relationships within the data.


[[Image:AND OR perceptrons.png|thumb|200px|left|Perceptrons that implement the '''AND''' and '''OR''' functions respectively.]]
<span style="display:inline-block; width: 4em;"></span>Examples:</br>
<br clear="all">
<span style="display:inline-block; width: 4em;"></span>Grouping customers with similar purchasing behaviors for targeted marketing (Clustering).</br>
<span style="display:inline-block; width: 4em;"></span>Identifying important features in a high-dimensional dataset (Dimensionality Reduction).


(c) '''XOR''' is not linearly separable, so it cannot be implemented by a single perceptron.
<span style="display:inline-block; width: 4em;"></span>Common Algorithms:</br>
<span style="display:inline-block; width: 4em;"></span>K-Means, Hierarchical Clustering, DBSCAN (Clustering).</br>
<span style="display:inline-block; width: 4em;"></span>Principal Component Analysis (PCA), t-SNE, Autoencoders (Dimensionality Reduction).


The '''XOR''' function returns 1 when the following are true:
**Reinforcement Learning
* Either <math> x_1 </math> or <math> x_2 </math> are 1. In other words, the expression <math> x_1</math> '''OR''' <math>x_2 </math> returns 1.
<span style="display:inline-block; width: 4em;"></span>Reinforcement learning (RL) is a type of machine learning where an agent learns to make decisions by performing actions in an environment to maximize cumulative rewards. The agent interacts with the environment, receives <span style="display:inline-block; width: 4em;"></span>feedback in the form of rewards or penalties, and improves its strategy over time.
* <math> x_1 </math> and <math> x_2 </math> are not both 1. In other words, the expression <math> x_1 </math> '''NAND''' <math> x_2 </math> returns 1.


To implement this, the outputs of an '''OR''' and a '''NAND''' perceptron can be taken as inputs to an '''AND''' perceptron. (The '''NAND''' perceptron was derived by multiplying the weights and bias of the '''AND''' perceptron by -1.)
<span style="display:inline-block; width: 4em;"></span>Examples:</br>
<span style="display:inline-block; width: 4em;"></span>Training a robot to walk by rewarding successful movements.</br>
<span style="display:inline-block; width: 4em;"></span>Teaching an AI to play chess or video games by rewarding wins and penalizing losses.


[[Image:XOR NN.png|thumb|200px|left|Neural network that implements the XOR function.]]
<span style="display:inline-block; width: 4em;"></span>Common Algorithms:</br>
<br clear="all">
<span style="display:inline-block; width: 4em;"></span>Q-Learning, Deep Q Networks (DQN), Policy Gradient Methods, Proximal Policy Optimization (PPO).


'''Why can't the perceptron converge in the case of linear non-separability?'''
'''Summary'''


In linearly separable data, there exists a weight vector <math>w</math> and bias <math>b</math> such that:
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
  <table style="width: 100%; border-collapse: collapse;">
    <tr>
      <th style="border: 1px solid #ddd; padding: 8px; text-align: left;">Aspect</th>
      <th style="border: 1px solid #ddd; padding: 8px; text-align: left;">Supervised Learning</th>
      <th style="border: 1px solid #ddd; padding: 8px; text-align: left;">Unsupervised Learning</th>
      <th style="border: 1px solid #ddd; padding: 8px; text-align: left;">Reinforcement Learning</th>
    </tr>
    <tr>
      <td style="border: 1px solid #ddd; padding: 8px;">Definition</td>
      <td style="border: 1px solid #ddd; padding: 8px;">Learning from labeled data where inputs are paired with outputs.</td>
      <td style="border: 1px solid #ddd; padding: 8px;">Learning patterns or structures from unlabeled data.</td>
      <td style="border: 1px solid #ddd; padding: 8px;">Learning by interacting with an environment to maximize cumulative rewards.</td>
    </tr>
    <tr>
      <td style="border: 1px solid #ddd; padding: 8px;">Key Characteristics</td>
      <td style="border: 1px solid #ddd; padding: 8px;">Trains on known inputs and outputs to predict outcomes for unseen data.</td>
      <td style="border: 1px solid #ddd; padding: 8px;">No predefined labels; discovers hidden structures in the data.</td>
      <td style="border: 1px solid #ddd; padding: 8px;">Agent learns through trial and error by receiving rewards or penalties for its actions.</td>
    </tr>
    <tr>
      <td style="border: 1px solid #ddd; padding: 8px;">Examples</td>
      <td style="border: 1px solid #ddd; padding: 8px;">- Predicting house prices (Regression).<br> - Classifying emails as spam or not (Classification).</td>
      <td style="border: 1px solid #ddd; padding: 8px;">- Grouping customers by behavior (Clustering).<br> - Reducing variables in large datasets (Dimensionality Reduction).</td>
      <td style="border: 1px solid #ddd; padding: 8px;">- Training robots to walk.<br> - Teaching AI to play chess or video games.</td>
    </tr>
    <tr>
      <td style="border: 1px solid #ddd; padding: 8px;">Common Algorithms</td>
      <td style="border: 1px solid #ddd; padding: 8px;">- Linear Regression<br> - Logistic Regression<br> - Decision Trees<br> - Random Forest<br> - SVM<br> - Neural Networks</td>
      <td style="border: 1px solid #ddd; padding: 8px;">- K-Means<br> - Hierarchical Clustering<br> - PCA<br> - t-SNE<br> - Autoencoders</td>
      <td style="border: 1px solid #ddd; padding: 8px;">- Q-Learning<br> - Deep Q Networks (DQN)<br> - Policy Gradient Methods<br> - Proximal Policy Optimization (PPO)</td>
    </tr>
  </table>
</div>


<math> y_i(w \cdot x_i + b) > 0 \quad \forall i </math>


But in the case of linear non-separability, w and b satisfying this condition do not exist, so the perceptron cannot satisfy the convergence condition.
</div>
</div>


<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


== Exercise 2.2 ==
== Exercise 1.16 ==
'''Level:''' * (Easy)


'''Exercise Types:''' Novel
<b>Level:</b> * (Easy) 


=== Question ===
<b>Exercise Types:</b> Novel


How do feedforward neural networks utilize backpropagation to adjust weights and improve the accuracy of predictions during training?
=== Question ===


=== Solution ===
Categorize each of these machine learning scenarios into '''supervised learning''', '''unsupervised learning''', or '''reinforcement learning'''. Justify your reasoning for each case.


After a forward pass where inputs are processes to generate an output, the error between the prediction and actual values is calculated. This error is then propagated backward through the network, and the gradients of the loss function with respect to the weights are computed. Using these gradients, the weights are updated with an optimization algorithm like stochastic gradient descent, gradually minimizing the error and improving the networks' performance.
(a) A neural network is trained to classify handwritten digits using the MNIST dataset, which contains 60 000 images of handwritten digits, along with the correct answer for each image.


(b) A robot is programmed to learn how to play a video game. It does not have access to the game’s rules, but it can observe its current score after each action. Over time, it learns to play better by maximizing its score.


</div>
(c) A deep learning model is designed to segment medical images into different sections corresponding to specific organs. The training data consists of medical scans that have been annotated by experts to mark the boundaries of the organs.


<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
(d) A machine learning model is given 100 000 astronomical images of unknown stars and galaxies. Using dimensionality reduction techniques, it groups similar-looking objects based on their features, such as size and shape.


== Exercise 2.3 ==
=== Solution ===
'''Level:''' * (Easy)


'''Exercise Types:''' Modified
(a) '''Supervised learning''': The model is trained with labeled data, where each image has a corresponding digit label.


'''References:''' Simon J.D. Prince. Understanding Deep learning. 2024
(b) '''Reinforcement learning''': The model learns by interacting with an environment and receiving feedback in the form of rewards or penalties. It explores different actions to maximize cumulative rewards over time.


This problem comes from Problem 3.5 in this textbook. In addition to the proof, I explained why this property is important to learning neural networks.  
(c) '''Supervised learning''': The model uses labeled data where professionals annotated each region of the image.


=== Question ===
(d) '''Unsupervised learning''': The model works with unlabeled data to find patterns and group similar objects.


Prove that the following property holds for <math>\alpha \in \mathbb{R}^+ </math>:


<math> \text{ReLU}[\alpha \cdot z] = \alpha \cdot \text{ReLU}[z] </math>
</div>


Explain why this property is important in neural networks.
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


=== Solution ===
== Exercise 1.17 ==


This is known as the '''non-negative homogeneity property''' of the ReLU function.
<b>Level:</b> * (Easy)


Recall the definition of the ReLU function:
<b>Exercise Types:</b> Novel


<MATH>
=== Question ===


\text{ReLU}(z) =
How does the introduction of ReLU as an activation function address the vanishing gradient problem observed in early deep learning models using sigmoid or tanh functions?
\begin{cases}
z & \text{if } z \geq 0, \
0 & \text{if } z < 0.
\end{cases}
</MATH>


We prove the property by considering the two possible cases for <math> z </math>.
=== Solution ===


'''Case 1: <math>z \geq 0 </math>'''
The vanishing gradient problem occurs when activation functions like sigmoid or tanh compress their inputs into small ranges, resulting in gradients that become very small during backpropagation. This hinders learning, particularly in deeper networks.


If <math>z \geq 0 </math>, then by the definition of the ReLU function:
The ReLU (Rectified Linear Unit), defined as <math>f(x) = \max(0, x)</math>, addresses this issue effectively:


<math>\text{ReLU}(z) = z</math>
(a) Non-Saturating Gradients: For positive input values, ReLU's gradient remains constant (equal to 1), preventing gradients from vanishing.


Therefore:
(b) Efficient Computation: The simplicity of the ReLU function makes it computationally faster than the sigmoid or tanh functions, which involve more complex exponential calculations.


<math>\text{ReLU}(\alpha \cdot z) = \alpha \cdot z</math>
(c) Sparse Activations: ReLU outputs zero for negative inputs, leading to sparse activations, which can improve computational efficiency and reduce overfitting.


and:
However, ReLU can experience the "dying ReLU" problem, where neurons output zero for all inputs and effectively become inactive. Variants like Leaky ReLU and Parametric ReLU address this by allowing small, non-zero gradients for negative inputs, ensuring neurons remain active.


<math>\alpha \cdot \text{ReLU}(z) = \alpha \cdot z</math>
</div> <div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


Hence, in this case:
== Exercise 1.18 ==


<math>\text{ReLU}(\alpha \cdot z) = \alpha \cdot \text{ReLU}(z)</math>
<b>Level:</b> * (Easy)


'''Case 2: <math>z<0</math>'''
<b>Exercise Types:</b> Novel


If <math>z < 0</math>, then <math>\alpha \cdot z < 0</math>.
=== Question ===


Therefore:
What is the general concept of text generation in deep learning, and how does it work?


<math>\text{ReLU}(\alpha \cdot z) = \text{ReLU}(z) = 0</math>
=== Solution ===


and:
Text generation in deep learning refers to the process of automatically creating coherent and contextually relevant text based on input data or a learned language model. The goal is to produce text that mimics human-written content, maintaining grammatical structure, logical flow, and contextual relevance.


<math>\alpha \cdot \text{ReLU}(z) = \alpha \cdot 0 = 0</math>
There are five steps.


Hence, in this case:
1. Training on a Language Corpus:
A deep learning model, such as a Recurrent Neural Network (RNN), Long Short-Term Memory (LSTM), or Transformer, is trained on a large dataset of text. During training, the model learns patterns, relationships between words, and context within sentences and across paragraphs.


<math>\text{ReLU}(\alpha \cdot z) = \alpha \cdot \text{ReLU}(z)</math>
2. Tokenization and Embeddings:
Input text is broken into smaller units, such as words or subwords (tokens). These tokens are converted into numerical vectors (embeddings) that capture semantic and syntactic relationships.


Since the property holds in both cases, this completes the proof.
3. The model predicts the probability of the next word or token in a sequence based on the context provided by the preceding words. It uses conditional probability, such as:
<math>
P(w_t \mid w_1, w_2, ..., w_{t-1})
</math>
to determine the likelihood of the next token.


'''Why is this property important in neural networks?'''
4. Once the model generates probabilities for the next token, decoding strategies are used to construct text.


In a neural network, the input to a neuron is often a linear combination of the weights and inputs.  
5. Generated text is evaluated for coherence, fluency, and relevance. Techniques such as fine-tuning on specific domains or datasets improve the model's performance for targeted applications.


When training neural networks, scaling the inputs or weights can affect the activations of neurons. However, because ReLU satisfies the homogeneity property, the output of the ReLU function scales proportionally with the input. This means that scaling the inputs by a positive constant (like a learning rate or normalization factor) does not change the overall pattern of activations — it only scales them. This stability in scaling is important during optimization because it makes the network's output more predictable and ensures that scaling transformations don't break the network's functionality.
</div> <div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


Additionally, because of the non-negative homogeneity property, the gradients also scale proportionally, the scale of the gradient changes proportionally with the input scale, which ensures that the optimization process remains stable. It helps prevent exploding gradients when the inputs are scaled by large positive values.
== Exercise 1.19 ==


The homogeneity property of ReLU also helps the network to perform well on different types of data. By keeping the scaling of activations consistent, it helps maintain the connection between inputs and outputs during training, even when the data is adjusted or scaled. This makes ReLU useful when input values vary a lot, and it simplifies the network's response to changes in input distributions, which is especially valuable when transferring a trained model to new data or domains.
<b>Level:</b> * (Easy)


</div>
<b>Exercise Types:</b> Novel


<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
=== Question ===


== Exercise 2.4 ==
Supervised learning and unsupervised learning are two of the main types of machine learning, and they differ mainly in how the models are trained and the type of data used. Briefly state their differences.
'''Level:''' * (Easy)


'''Exercise Types:''' Novel
=== Solution ===


=== Question ===
====Supervised Learning:====
Train a perceptron on the given dataset using the following initial settings, and ensure it classifies all data points correctly.


* Initial weights: <math>w_0 = 0, w_1 = 0, w_2 = 0</math>
Data: Requires labeled data.
* Learning rate: <math>\eta = 0.1</math>
* Training dataset:
  (x₁ = 1, x₂ = 2, y = 1)
  (x₁ = -1, x₂ = -1, y = -1)
  (x₁ = 2, x₂ = 1, y = 1)


<math> y = 1 </math> if the output <math> z = w_1 \cdot x_1 + w_2 \cdot x_2 + w_0 \geq 0 </math>, otherwise <math> y = -1 </math>.
Goal: The model learns a mapping from inputs to the correct output.


=== Solution ===
Example Tasks: Classification and regression.


==== Iteration 1 ====
Training Process: The model is provided with both input data and corresponding labels during training, allowing it to learn from these examples to make predictions on new, unseen data.
1. First data point (x₁ = 1, x₂ = 2) with label 1:
* Weighted sum: <math>\hat{y} = w_0 + w_1 x_1 + w_2 x_2 = 0 + 0(1) + 0(2) = 0</math>
* Predicted label: <math>\hat{y} = 1</math>
* Actual label: 1 → No misclassification


2. Second data point (x₁ = -1, x₂ = -1) with label -1:
Common Algorithms: Linear regression, decision trees, random forests, support vector machines, and neural networks.
* Weighted sum: <math>\hat{y} = w_0 + w_1 x_1 + w_2 x_2 = 0 + 0(-1) + 0(-1) = 0</math>
* Predicted label: <math>\hat{y} = 1</math>
* Actual label: -1 → Misclassified


3. Third data point (x₁ = 2, x₂ = 1) with label 1:
====Unsupervised Learning:====
* Weighted sum: <math>\hat{y} = w_0 + w_1 x_1 + w_2 x_2 = 0 + 0(2) + 0(1) = 0</math>
* Predicted label: <math>\hat{y} = 1</math>
* Actual label: 1 → No misclassification


==== Update Weights (using the Perceptron rule with the cost as the distance of all misclassified points) ====
Data: Does not require labeled data.
For the misclassified point (x₁ = -1, x₂ = -1):
* Updated weights:
* <math>w_0 = w_0 + \eta y = 0 + 0.1(-1) = -0.1</math>
* <math>w_1 = w_1 + \eta y x_1 = 0 + 0.1(-1)(-1) = 0.1</math>
* <math>w_2 = w_2 + \eta y x_2 = 0 + 0.1(-1)(-1) = 0.1</math>


Updated weights after first iteration: <math>w_0 = -0.1, w_1 = 0.1, w_2 = 0.1</math>
Goal: The model tries to find hidden patterns or structure in the data.


==== Iteration 2 ====
Example Tasks: Clustering and dimensionality reduction.


1. First data point (x₁ = 1, x₂ = 2) with label 1:
Training Process: The model analyzes the input data without being told the correct answer, and it organizes or structures the data in meaningful ways.
* Weighted sum: <math>\hat{y} = -0.1 + 0.1(1) + 0.1(2) = -0.1 + 0.1 + 0.2 = 0.2</math>
* Predicted label: <math>\hat{y} = 1</math>
* Actual label: 1 → No misclassification


2. Second data point (x₁ = -1, x₂ = -1) with label -1:
Common Algorithms: K-means clustering, hierarchical clustering, principal component analysis (PCA), and autoencoders.
* Weighted sum: <math>\hat{y} = -0.1 + 0.1(-1) + 0.1(-1) = -0.1 - 0.1 - 0.1 = -0.3</math>
* Predicted label: <math>\hat{y} = -1</math>
* Actual label: -1 → No misclassification


3. Third data point (x₁ = 2, x₂ = 1) with label 1:
</div>
* Weighted sum: <math>\hat{y} = -0.1 + 0.1(2) + 0.1(1) = -0.1 + 0.2 + 0.1 = 0.2</math>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
* Predicted label: <math>\hat{y} = 1</math>
== Exercise 1.20 ==
* Actual label: 1 → No misclassification


Since there are no misclassifications in the second iteration, the perceptron has converged!
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
 
It was mentioned in lecture that the step function had previously been used as an activation function, but we now commonly use the sigmoid function as an activation function. Highlight the key differences between these functions.
 
=== Solution ===
 
- The step function takes a single real numbered value and outputs 0 if the number is negative and 1 if the number is 0 or positive
 
- The sigmoid activation function is an s shaped curve with the output spanning between 0 and 1 (not inclusive)


==== Final Result ====
- The equation for the sigmoid function is <math> f(x) = \frac{1}{1+ e^{-x}} </math>
* Weights after convergence: <math>w_0 = -0.1, w_1 = 0.1, w_2 = 0.1</math>
* Total cost after convergence: <math>Cost = 0</math>, since no misclassified points.


- The step activation function only produces two values as the output, 0 or 1, whereas the sigmoid activation function produces a continuous range of values between 0 and 1


</div>
- The smoothness of the sigmoid activation function makes it more suitable for gradient based learning in neural networks, allowing for more efficient back propagation


</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


== Exercise 2.5 ==
== Exercise 1.21 ==
'''Level:''' * (Moderate)


'''Exercise Types:''' Novel
<b>Level:</b> * (Easy)


<b>Exercise Types:</b> Novel
=== Question ===
=== Question ===
<p>Consider a <strong>Feed-Forward Neural Network (FFN)</strong> with one or more hidden layers. Answer the following questions:</p>


<ol>
Consider a linear regression model where we aim to estimate the weight vector <math>w</math> by minimizing the Residual Sum of Squares (RSS), defined as:
    <p> (a) Describe how does the Feed-Forward Neural Network (FFN) work in general. Describe the component of the Network. </p>
 
    <p> (b) How does the forward pass work ? Provide the relevant formulas for each step.</p>
<math>
    <p> (c) How does the backward pass (backpropagation) ? Explain and provide the formulas for each step.</p>
\text{RSS}(w) = \frac{1}{2} \sum_{n=1}^{N} (y_n - w^T x_n)^2 = \frac{1}{2} \|Xw - y\|_2^2 = \frac{1}{2} (Xw - y)^T (Xw - y).
</ol>
</math>
 
# Compute the gradient: Derive the gradient of <math>\text{RSS}(w)</math> with respect to <math>w</math>.
# Find the optimal <math>w</math>: Solve for <math>w</math> by setting the gradient to zero.
# Interpretation: What is the significance of the solution you obtained in terms of ordinary least squares (OLS)?
 
Provide your answers with clear derivations and explanations.


=== Solution ===
=== Solution ===
<p><b>(a):</b> A Feed-Forward Neural Network (FFN) consists of an input layer, one or more hidden layers, and one output layer. Each layer transforms the input data, with each neuron's output being fed to the next layer as input. Each neuron in a layer is a perceptron, which is a basic computational unit that contains weights, bias and an activation function. The perceptron computes a weighted sum of its inputs, adds a bias term, and passes the result through an activation function. In this structure, each layer transforms the data as it passes through, with each neuron's output being fed to the next layer. The final output is the network’s prediction, then the loss function use the prediction and the true label of the data to calculate the loss. The backward pass computes the gradients of the loss with respect to each weight and bias in the network, and then update the weights and biases to minimize the loss. This process is repeated for each sample (or mini-batch) of data until the loss converges and the weights are optimized.


<p><b>(b):</b> The forward pass involves computing the output for each layer in the network. For each layer, the algorithm performs the following steps:</p>
To find the optimal weight vector <math>w</math>, we first compute the gradient of the Residual Sum of Squares (RSS):
<p>1. Compute the weighted sum of inputs to the layer:</p>


<div style="text-align: center;">
<math>
<math display="block">
\nabla_w \text{RSS}(w) = X^T X w - X^T y.
z^{(l)} = W^{(l)} a^{(l-1)} + b^{(l)}
</math>
</math>
</div>
 
<p>2. Use the activation function to calculate the output of the layer:</p>
Setting the gradient to zero and solving for <math>w</math> gives:
<div style="text-align: center;">
 
<math display="block">
<math>
\hat{y} = a^{(L)} = \sigma(z^{(L)})
X^T X w = X^T y.
</math>
</math>
</div>
<p>3. Repeat these steps for each layer, until getting to the output layer</p>


<p><b>(c):</b> The backward pass (backpropagation) updates the gradients of the loss function with respect to each weight and bias, and then use the gradient descents to update the weights.</p>
These are known as the normal equations, since at the optimal solution, <math>y - Xw</math> is orthogonal to the range of <math>X</math>
 
The corresponding solution <math>\hat{w}</math> is the ordinary least squares (OLS) solution, given by:


<p>1. Calculate the errors for each layer: </p>
<math>
Error at the output layer: The error term at the output layer has this formula: </p>
\hat{w} = (X^T X)^{-1} X^T y.
<div style="text-align: center;">
<math display="block">
\delta^{(L)} = \frac{\partial \mathcal{L}}{\partial a^{(L)}} \cdot \sigma'(z^{(L)})
</math>
</math>
</div>
<p>Error for the hidden layers: The error for each hidden layer is:</p>
<div style="text-align: center;">
<math display="block">
\delta^{(l)} = \left( W^{(l+1)} \right)^T \delta^{(l+1)} \cdot \sigma'(z^{(l)})
</math>
</div>
<p>3. Gradient of the loss with respect to weights and biases. Compute the gradients for the weights and biases:</p>
<p>The gradient for weights is:</p>
<div style="text-align: center;">
<math display="block">
\frac{\partial \mathcal{L}}{\partial W^{(l)}} = a^{(l-1)} \cdot (\delta^{(l)})^T
</math>
</div>
<p>The gradient is for biases is:</p>
<div style="text-align: center;">
<math display="block">
\frac{\partial \mathcal{L}}{\partial b^{(l)}} = \delta^{(l)}
</math>
</div>


<p>4. Update the weights and biases using gradient descent:</p>
The matrix <math>(X^T X)^{-1} X^T</math> is known as the (left) pseudo-inverse of <math>X</math>, which generalizes matrix inversion for non-square matrices.
<div style="text-align: center;">
 
<math display="block">
To ensure the solution is unique, we examine the Hessian matrix:
W^{(l)} \leftarrow W^{(l)} - \rho \cdot \frac{\partial \mathcal{L}}{\partial W^{(l)}}
 
<math>
H(w) = \frac{\partial^2}{\partial w^2} \text{RSS}(w) = X^T X.
</math>
</math>
</div>


<p>Where <math>\rho</math> is the learning rate.</p>
If <math>X</math> has full column rank (i.e., its columns are linearly independent), then <math>H</math> is positive definite, as shown by:


<div style="text-align: center;">
<math>
<math display="block">
v^T (X^T X) v = (X v)^T (X v) = \|X v\|^2 > 0, \quad \text{for any nonzero vector } v.
b^{(l)} \leftarrow b^{(l)} - \rho \cdot \frac{\partial \mathcal{L}}{\partial b^{(l)}}
</math>
</math>
</div>


<p>Repeat these steps for each layers from output layer to input layers to update all the weights and biases</p>
Since the Hessian is positive definite in this case, the least squares objective has a unique global minimum.


</div>
</div>  


<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


== Exercise 1.22 ==


== Exercise 2.6 ==
<b>Level:</b> * (Easy)
'''Level:''' * (Easy)


'''Exercise Types:''' Novel
<b>Exercise Types:</b> Novel  


=== Question ===
=== Question ===
A single neuron takes an input vector <math>x=[2,-3]</math>, with weights <math>w=[0.4,-0.6]</math>. The target output is <math> y_{\text{true}}=1 </math>.


1. Calculate the weighted sum <math>z = w \cdot x</math>.
Which of the following best highlights the key difference between Machine Learning and Deep Learning?
 
A. Machine Learning is only suitable for small datasets, while Deep Learning can handle datasets of any size.


2. Compute the squared error loss: <math>L = 0.5 \cdot (z - y_{\text{true}})^2</math>
B. Machine Learning is restricted to regression and classification, whereas Deep Learning is used for image and text processing.


3. Find the gradient of the loss with respect to the weights <math>w</math> and perform one step of gradient descent with a learning rate <math>\eta = 0.01</math>.
C. Deep Learning can model without any data, while Machine Learning requires large datasets.


4.Provide the updated weights and the error after the update.
D. Machine Learning relies on manually extracted features, while Deep Learning can automatically learn feature representations.


5. Compare the result of the previous step with the case of a learning rate of <math>\eta = 0.1</math>
=== Solution ===
Answer: D;


=== Solution ===
Explanation: Machine Learning algorithms often require manual feature engineering, whereas Deep Learning can automatically extract features from data through multi-layered neural networks. This is a significant distinction between the two.
1. <math>z = w \cdot x = (0.4 \cdot 2) + (-0.6 \cdot -3)
= 0.8 + 1.8 = 2.6</math>


2. <math>L = 0.5 \cdot (z - y_{\text{true}})^2 = 0.5 \cdot (2.6 - 1)^2 = 0.5 \cdot (1.6)^2 = 0.5 \cdot 2.56 = 1.28</math>
Machine Learning techniques include decision trees, svms, xgboosting, etc. These techniques typically work better on smaller datasets due to simpler structure. They often struggle to match the flexibility and scalability of deep neural networks as the data becomes more complex.  


3. The gradient of the loss with respect to <math>w_i</math> is:
Deep neural networks work well on large datasets consisting of data with a more complex structure, such as images or sentences (LLM). Often times, more data is needed for deep neural networks in order for them to learn effectively and avoid overfitting. Their complex architecture of deep neural networks allow them to learn feature representations from raw data, without the need for manual feature engineering.
<math>\frac{\partial L}{\partial w_i} = (z - y_{\text{true}}) \cdot x_i</math>


For <math>w_1</math> (associated with <math>x_1 = 2</math>):
In summary,
<math>\frac{\partial L}{\partial w_1} = (2.6 - 1) \cdot 2 = 1.6 \cdot 2 = 3.2</math>


For <math>w_2</math> (associated with <math>x_2 = -3</math>):
Machine Learning: Simpler models, better suited for structured/tabular data.
<math>\frac{\partial L}{\partial w_2} = (2.6 - 1) \cdot (-3) = 1.6 \cdot -3 = -4.8</math>
The updated weights are:
<math>w_i = w_i - \eta \cdot \frac{\partial L}{\partial w_i}</math>


For <math>w_1</math>:
Deep Learning: Automatically extracts features, and excels in unstructured data like images, audio, and text.
<math>w_1 = 0.4 - 0.01 \cdot 3.2 = 0.4 - 0.032 = 0.368</math>


For <math>w_2</math>:
</div>
<math>w_2 = -0.6 - 0.01 \cdot (-4.8) = -0.6 + 0.048 = -0.552</math>


4. Recalculate <math>z</math> with updated weights:
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
<math>z = (0.368 \cdot 2) + (-0.552 \cdot -3) = 0.736 + 1.656 = 2.392</math>


Recalculate the error:
== Exercise 1.23 ==
<math>L = 0.5 \cdot (z - y_{\text{true}})^2 = 0.5 \cdot (2.392 - 1)^2 = 0.5 \cdot (1.392)^2 = 0.5 \cdot 1.937 = 0.968</math>


5. Compare the result of the previous step with the case of a learning rate of <math>\eta = 0.1</math>:
<b>Level:</b> * (Easy)


For <math>w_1</math>:
<b>Exercise Types:</b> Novel
<math>w_1 = 0.4 - 0.1 \cdot 3.2 = 0.4 - 0.032 = 0.08</math>


For <math>w_2</math>:
=== Question ===
<math>w_2 = -0.6 - 0.1 \cdot (-4.8) = -0.6 + 0.048 = -0.12</math>
 
Recalculate <math>z</math> with the updated weights:
<math>z = (0.08 \cdot 2) + (-0.12 \cdot -3) = 0.16 + 0.36 = 0.52</math>


Recalculate the error:
Pros and Cons of supervised learning and unsupervised learning?
<math>L = 0.5 \cdot (z - y_{\text{true}})^2 = 0.5 \cdot (0.52 - 1)^2 = 0.5 \cdot (-0.48)^2 = 0.5 \cdot 0.2304 = 0.1152</math>


Comparison:
=== Solution ===
 
Supervised learning is to learn from labelled data. The benefits of supervised learning include its clear objective and direct evaluation through performance metrics such as MSE to compare model predictions with clear labels. The consequences of supervised learning encompass the time-consuming nature to obtain large labelled dataset and the risk of overfitting.
- With a learning rate of <math>\eta = 0.01</math>, the error after one update is <math>L = 0.968</math>.
Unsupervised learning needs pattern or data structure detection. The benefits of unsupervised learning include opportunities for data preprocessing. Thus, dimension reduction techniques can be used to simplify the data structure. Nevertheless, we can't directly control or interpret the results as good as the supervised learning does.
 
- With <math>\eta = 0.1</math>, the error after one update is <math>L = 0.1152</math>.
 
The error is much lower when using a larger learning rate <math>\eta = 0.1</math> compared to a smaller learning rate <math>\eta = 0.01</math>. However, large learning rates can sometimes cause overshooting of the optimal solution, so care must be taken when selecting a learning rate.


</div>
</div>
Line 1,200: Line 1,200:
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


== Exercise 2.7 ==
== Exercise 1.24 ==
'''Level:''' * (Easy)


'''Exercise Types:''' Copied
<b>Level:</b> * (Easy) 


'''References:''' https://www.uni-weimar.de/fileadmin/user/fak/medien/professuren/Webis/teaching/ws13/ml/exercises-en-neural-networks.pdf
<b>Exercise Types:</b> Novel 


This problem comes from Exercise 2 : Perceptron Learning.
=== Question ===


=== Question ===  
Consider the dataset:
<math>\{(x_1, y_1), (x_2, y_2), (x_3, y_3)\} = \{([1, 2], 1), ([2, 3], 1), ([4, 5], -1)\},</math>
and a linear decision boundary defined as:
<math>w_1x_1 + w_2x_2 + b = 0,</math>
where the classifier predicts <math>y = 1</math> if <math>f(x) > 0</math>, and <math>y = -1</math> if <math>f(x) \leq 0</math>.


Given two single perceptrons <math>a</math> and <math>b</math> each of which defined by the inequality <math>w_0 + w_1x_1 + w_2x_2 ≥ 0</math>, perceptron <math>a</math> has the weights <math>w_0 = 1</math>, <math>w_1 = 2</math>, <math>w_2 = 1</math>, perceptron <math>b</math> has the weights <math>w_0 = 0</math>, <math>w_1 = 2</math>, <math>w_2 = 1</math>. Is perceptron <math>a</math> more general than perceptron <math>b</math>?
Given the weights and bias:
<math>w_1 = 1, \, w_2 = -1, \, b = 0,</math>
determine whether all points in the dataset are correctly classified.


=== Solution ===
=== Solution ===


To determine whether perceptron <math>a</math> is more general than perceptron <math>b</math>, we need to examine their decision boundaries and the regions they classify as "positive" (where <math>w_0 + w_1x_1 + w_2x_2 \geq 0</math>).
The decision function is:
<math>f(x) = w_1x_1 + w_2x_2 + b.</math>
Substituting <math>w_1 = 1</math>, <math>w_2 = -1</math>, and <math>b = 0</math>, we evaluate <math>f(x)</math> for each point in the dataset.


The decision boundaries for both perceptrons are defined by: <math>w_0 + w_1x_1 + w_2x_2 = 0</math>.
For <math>x_1 = [1, 2]</math>:
<math>
f(x_1) = (1)(1) + (-1)(2) + 0 = -1 \quad \Rightarrow \, y = -1 \, (\text{incorrect, since } y_1 = 1).
</math>


For Perceptron <math>a</math>: <math>1 + 2x_1 + x_2 \geq 0</math>; the decision boundary is: <math>x_2 = -2x_1 - 1</math>.
For <math>x_2 = [2, 3]</math>:
<math>
f(x_2) = (1)(2) + (-1)(3) + 0 = -1 \quad \Rightarrow \, y = -1 \, (\text{incorrect, since } y_2 = 1).
</math>


For Perceptron <math>b</math>: <math>2x_1 + x_2 \geq 0</math>; the decision boundary is: <math>x_2 = -2x_1</math>.
For <math>x_3 = [4, 5]</math>:
<math>
f(x_3) = (1)(4) + (-1)(5) + 0 = -1 \quad \Rightarrow \, y = -1 \, (\text{correct, since } y_3 = -1).
</math>
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 1.25 ==
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
=== Question ===
 
Given a dataset with three samples: <math>{(x_1,y_1)=(1,2),(x_2,y_2)=(2,3),(x_3,y_3)=(3,5)}</math>.
 
Assume a hypothesis class <math>F</math> consisting of functions <math>f(x) = w\cdot x+b</math>, where <math>w</math> and <math>b</math> are parameters. Use the MSE as the loss function: <math>L(y,f(x))=(y−f(x))^2</math>.


-a). For the score critereon, compute the sample score: <math>S(f)= \frac{1}{n}\sum_{i=1}^{n}L(y_i,f(x_i))</math>.


We want to clarify what does more general mean. If perceptron <math>a</math> classifies every point classified positively by perceptron <math>b</math> as positive, then <math>a</math> is at least as general as <math>b</math>. If in addition, <math>a</math> classifies points as positive that <math>b</math> does not, then <math>a</math> is strictly more general.
-b). For the search strategy, find the optimal parameters <math>w</math> and <math>b</math> that minimizes <math>S(f)</math>.


Apparently perceptron <math>a</math>'s positive region includes all points that satisfy <math>x_2 \geq -2x_1 - 1</math>, which is strictly larger than <math>b</math>'s region because <math>-2x_1 - 1 < -2x_1</math> for all <math>x_1</math>; perceptron <math>b</math>'s positive region includes all points that satisfy <math>x_2 \geq -2x_1</math>, which is a subset of <math>a</math>'s region.
=== Solution ===
-a).
The loss for three samples:


<math>L(y_1, f(x_1))=(2-(w\cdot 1+b))^2</math>


Therefore, perceptron <math>a</math> is more general than perceptron <math>b</math> because all points classified as positive by <math>b</math> are also classified as positive by <math>a</math>, and <math>a</math> classifies additional points (where <math>-2x_1 - 1 \leq x_2 < -2x_1</math>) as positive that <math>b</math> does not.
<math>L(y_2, f(x_2))=(3-(w\cdot 2+b))^2</math>


</div>
<math>L(y_3, f(x_3))=(5-(w\cdot 3+b))^2</math>


<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
The sample score:


== Exercise 2.10 ==
<math>S(f)=\frac{1}{3}[(2-(w\cdot 1+b))^2+(3-(w\cdot 2+b))^2+(5-(w\cdot 3+b))^2]</math>


'''Level:''' * (Easy)
Simplify the sample score formula:


'''Exercise Type:''' Novel
<math>S(f)=\frac{1}{3}[(2-w-b)^2+(3-2w-b)^2+(5-3w-b)^2]</math>


=== Question ===


In a simple linear regression


a). Derive the vectorized form of the SSE (loss function) in terms of <math>Y</math>, <math>X</math> and <math>\theta</math>.
-b).  
In order to minimize <math>S(f)</math>, first differentiate <math>S(f)</math> with respect to <math>w</math> and <math>b</math>:


b). Find the equation which minimizes <math>\theta</math> (Recall that this is the weights of the linear regression).
<math>\frac{\partial S(f)}{\partial w}=-\frac{2}{3}[(2-w-b)+2(3-2w-b)+3(5-3w-b)]</math>


=== Solution ===
<math>\frac{\partial S(f)}{\partial b}=-\frac{2}{3}[(2-w-b)+(3-2w-b)+(5-3w-b)]</math>


a).
Set <math>\frac{\partial S(f)}{\partial w}</math> and <math>\frac{\partial S(f)}{\partial b}</math> equal to 0, we can get:


<math> \begin{align*}
<math>w=1</math>, <math>b=1</math>.
    SSE &= (Y - \hat{Y})^2 \
    &= (Y - \hat{Y})^T (Y - \hat{Y}) \
    &= Y^TY - Y^TX\theta - (X\theta)^T Y + (X\theta)^T(X\theta) \
    &= Y^TY - 2Y^TX\theta + (X\theta)^T(X\theta) \
\end{align*}
</math>


b).  
Therefore, <math>S(f)</math> is minimized at these parameters.


<math>
\begin{align*}
    0 &= \frac{\partial SSE}{\partial \theta} \
    0 &= \frac{\partial}{\partial \theta} \Big[ Y^TY - 2Y^TX\theta + (X\theta)^T(X\theta)\Big] \
    0 &= 0 - 2YX^T + 2X^TX\theta \
    2X^TX\theta &= 2YX^T \
    \theta &= (YX^T)(X^TX)^{-1}
\end{align*}
</math>


</div>
</div>
Line 1,277: Line 1,297:
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


== Exercise 3.1 ==
== Exercise 1.26 ==
<b>Level:</b> ** (Moderate)
<b>Exercise Type:</b> Novel


Implement the perceptron learning algorithm with momentum for the AND function. Plot the decision boundary after 10 epochs of training with a learning rate of 0.1 and a momentum of 0.9.
<b>Level:</b> * (Easy)


=== Solution ===
<b>Exercise Types:</b> Novel
<pre>
import numpy as np
import matplotlib.pyplot as plt


# Dataset
=== Question ===
data = np.array([
Given the weights and bias of a single neuron, classify several input points using a step function as the activation method.
    [0, 0, -1],
 
    [0, 1, -1],
<b>Details:</b>
    [1, 0, -1],
- Weights: \( w_1 = 0.6, w_2 = -0.8 \)
    [1, 1, 1]
- Bias: \( b = 0.1 \)
])
- Activation: Step function where output is 1 if input is non-negative, and 0 otherwise.
 
<b>Input Points:</b>
1. \( (1, 1) \)
2. \( (-1, 1) \)
3. \( (0.5, -0.5) \)
4. \( (0, 0) \)


# Initialize weights, learning rate, and momentum
=== Solution ===
weights = np.random.rand(3)
learning_rate = 0.1
momentum = 0.9
epochs = 10
previous_update = np.zeros(3)


# Add bias term to data
<b>Calculating the Outputs</b>
X = np.hstack((np.ones((data.shape[0], 1)), data[:, :2]))
For each input point \( (x_1, x_2) \), calculate the linear combination using the formula \( y = w_1 \times x_1 + w_2 \times x_2 + b \), then apply the step function.
y = data[:, 2]


# Training loop
- **Point 1 \((1, 1)\):**
for epoch in range(epochs):
\[ y = 0.6 \times 1 - 0.8 \times 1 + 0.1 = -0.1 \rightarrow \text{step}(-0.1) = 0 \] (Class 0)
    for i in range(len(X)):
        prediction = np.sign(np.dot(weights, X[i]))
        if prediction != y[i]:
            update = learning_rate * y[i] * X[i] + momentum * previous_update
            weights += update
            previous_update = update


# Plot final decision boundary
- **Point 2 \((-1, 1)\):**
x_vals = np.linspace(-0.5, 1.5, 100)
\[ y = 0.6 \times -1 - 0.8 \times 1 + 0.1 = -1.3 \rightarrow \text{step}(-1.3) = 0 \] (Class 0)
y_vals = -(weights[1] * x_vals + weights[0]) / weights[2]
plt.plot(x_vals, y_vals, label='Final Decision Boundary')


# Plot dataset
- **Point 3 \((0.5, -0.5)\):**
for point in data:
\[ y = 0.6 \times 0.5 - 0.8 \times -0.5 + 0.1 = 0.8 \rightarrow \text{step}(0.8) = 1 \] (Class 1)
    color = 'blue' if point[2] == 1 else 'red'
    plt.scatter(point[0], point[1], color=color)


plt.title('Perceptron with Momentum')
- **Point 4 \((0, 0)\):**
plt.legend()
\[ y = 0.6 \times 0 - 0.8 \times 0 + 0.1 = 0.1 \rightarrow \text{step}(0.1) = 1 \] (Class 1)
plt.show()
</pre>


[[Image:exercise_3_1.png|thumb|300px|left|Final decision boundary.]]
<b>Conclusion</b>
<br clear="all">
This exercise demonstrates how a neuron uses its weights and bias to compute outputs for given inputs and classify them using a step function based on a threshold.


</div>
</div>


<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
== Exercise 3.2 ==
'''Level:''' ** (Moderate)


'''Exercise Types:''' Novel
== Exercise 1.27 ==


=== Question ===
<b>Level:</b> * (Easy)
Write a python program showing how the back propagation algorithm work with a 2 inputs 2 hidden layer and 1 output layer neural network. Train the network on the XOR problem:
* Input[0,0] -> Output 0
* Input [0,1] -> Output 1
* Input [1,0] -> Output 1
* Input [1,1] -> Output 0
Use the sigmoid activation function. Use Mean Square Error as the loss function.


=== Solution ===
<b>Exercise Types:</b> Novel
<pre>
import numpy as np


# -------------------------
=== Question ===
# 1. Define Activation Functions
# -------------------------


def sigmoid(x):
Consider the following 2D and 3D datasets and determine whether a perceptron solution exists for each. If a solution exists, visually prove it by plotting the data points and a possible decision boundary. Use Python to accomplish this task.
    """
    Sigmoid activation function.
    """
    return 1 / (1 + np.exp(-x))


def sigmoid_derivative(x):
<b>Part 1:</b>
    """
Given the dataset:
    Derivative of the sigmoid function.
    Here, 'x' is assumed to be sigmoid(x),
    meaning x is already the output of the sigmoid.
    """
    return x * (1 - x)


\begin{array}{|c|c|c|}
\hline
x_1 & x_2 & y \
\hline
3 & 5 & -1 \
3 & 8 & +1 \
7 & 7 & +1 \
6 & 5 & +1 \
\hline
\end{array}


# -------------------------
Show visually whether there exists a perceptron solution that correctly classifies all points.
# 2. Prepare the Training Data (XOR)
# -------------------------
# Input data (4 samples, each with 2 features)
X = np.array([
    [0, 0],
    [0, 1],
    [1, 0],
    [1, 1]
])


# Target labels (4 samples, each is a single output)
<b>Part 2:</b>
y = np.array([
Given the dataset:
    [0],
    [1],
    [1],
    [0]
])


# -------------------------
\begin{array}{|c|c|c|}
# 3. Initialize Network Parameters
\hline
# -------------------------
x_1 & x_2 & y \
# Weights for input -> hidden (shape: 2x2)
\hline
W1 = np.random.randn(2, 2)
3 & 5 & -1 \
# Bias for hidden layer (shape: 1x2)
3 & 8 & +1 \
b1 = np.random.randn(1, 2)
7 & 7 & -1 \
6 & 5 & +1 \
\hline
\end{array}


# Weights for hidden -> output (shape: 2x1)
Show visually whether there exists a perceptron solution that correctly classifies all points.
W2 = np.random.randn(2, 1)
 
# Bias for output layer (shape: 1x1)
<b>Part 3:</b>
b2 = np.random.randn(1, 1)
Given the 3D dataset:
 
\begin{array}{|c|c|c|c|}
\hline
x_1 & x_2 & x_3 & y \
\hline
3 & 5 & 2 & -1 \
3 & 8 & 6 & +1 \
7 & 7 & 5 & -1 \
6 & 5 & 4 & +1 \
\hline
\end{array}


# Hyperparameters
learning_rate = 0.1
num_epochs = 10000


# -------------------------
Show visually whether there exists a perceptron solution that correctly classifies all points.
# 4. Training Loop
# -------------------------
for epoch in range(num_epochs):
    # 4.1. Forward Pass
    #  - Compute hidden layer output
    hidden_input = np.dot(X, W1) + b1  # shape: (4, 2)
    hidden_output = sigmoid(hidden_input)
   
    #  - Compute final output
    final_input = np.dot(hidden_output, W2) + b2  # shape: (4, 1)
    final_output = sigmoid(final_input)
   
    # 4.2. Compute Loss (Mean Squared Error)
    error = y - final_output  # shape: (4, 1)
    loss = np.mean(error**2)
   
    # 4.3. Backpropagation
    #  - Gradient of loss w.r.t. final_output
    d_final_output = error * sigmoid_derivative(final_output)  # shape: (4, 1)
   
    #  - Propagate error back to hidden layer
    error_hidden_layer = np.dot(d_final_output, W2.T)  # shape: (4, 2)
    d_hidden_output = error_hidden_layer * sigmoid_derivative(hidden_output)  # shape: (4, 2)
   
    # 4.4. Gradient Descent Updates
    #  - Update W2, b2
    W2 += learning_rate * np.dot(hidden_output.T, d_final_output)  # shape: (2, 1)
    b2 += learning_rate * np.sum(d_final_output, axis=0, keepdims=True)  # shape: (1, 1)
   
    #  - Update W1, b1
    W1 += learning_rate * np.dot(X.T, d_hidden_output)  # shape: (2, 2)
    b1 += learning_rate * np.sum(d_hidden_output, axis=0, keepdims=True)  # shape: (1, 2)
   
    # Print loss every 1000 epochs
    if epoch % 1000 == 0:
        print(f"Epoch {epoch}, Loss: {loss:.6f}")


# -------------------------
=== Solution ===
# 5. Testing / Final Outputs
# -------------------------
print("\nTraining complete.")
print("Final loss:", loss)


# Feedforward one last time to see predictions
Part 1:
hidden_output = sigmoid(np.dot(X, W1) + b1)
final_output = sigmoid(np.dot(hidden_output, W2) + b2)


print("\nOutput after training:")
for i, inp in enumerate(X):
    print(f"Input: {inp} -> Predicted: {final_output[i][0]:.4f} (Target: {y[i][0]})")
</pre>
Output:
<pre>
<pre>
Epoch 0, Loss: 0.257193
import numpy as np
Epoch 1000, Loss: 0.247720
import matplotlib.pyplot as plt
Epoch 2000, Loss: 0.226962
Epoch 3000, Loss: 0.191367
Epoch 4000, Loss: 0.162169
Epoch 5000, Loss: 0.034894
Epoch 6000, Loss: 0.012459
Epoch 7000, Loss: 0.007127
Epoch 8000, Loss: 0.004890
Epoch 9000, Loss: 0.003687


Training complete.
Final loss: 0.0029435579049382756


Output after training:
part1_data = np.array([
Input: [0 0] -> Predicted: 0.0598 (Target: 0)
    [3, 5, -1],
Input: [0 1] -> Predicted: 0.9461 (Target: 1)
    [3, 8, 1],
Input: [1 0] -> Predicted: 0.9506 (Target: 1)
    [7, 7, 1],
Input: [1 1] -> Predicted: 0.0534 (Target: 0)
    [6, 5, 1]
</pre>
])


</div>
part1_X = part1_data[:, :2]  # First two columns for features
part1_y = part1_data[:, 2]  # Last column for classes


<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
# Define colors based on classes, Im chooosing green and red
== Exercise 3.3 ==
colors = ['red' if label == -1 else 'green' for label in part1_y]
'''Level:''' * (Easy)


'''Exercise Types:''' Novel


=== Question ===
plt.scatter(part1_X[:, 0], part1_X[:, 1], c=colors, edgecolors='black', s=100)
Implement 4 iterations of gradient descent with and without momentum for the function <math>f(x) = x^2 + 2</math> with learning rate <math>\eta=0.1</math>, momentum <math>\gamma=0.9</math>, starting value of <math>x_0=2</math>, starting velocity of <math>v_0=0</math>. Comment on the differences.


=== Solution ===
part1_x1_vals = np.linspace(2, 7, 100)
Note that <math>f'(x) = 2x </math>
part1_x2_vals = -part1_x1_vals + 9
plt.plot(part1_x1_vals, part1_x2_vals, 'b--')


<strong>Without momentum:</strong>
plt.xlabel('x1')
plt.ylabel('x2')
plt.title('Part 1: 2D Classification Data')


Iteration 1: <math>x_1 = x_0 - \eta* f'(x_0) = 2 - 0.1*2*2 = 1.6</math>
plt.grid(True)
plt.show()
</pre>


Iteration 2: <math>x_2 = x_1 - \eta* f'(x_1) = 1.6 - 0.1*2*1.6 = 1.28</math>
There exists a perceptron solution that correctly classifies all points.


Iteration 3: <math>x_3 = x_2 - \eta* f'(x_2) = 1.28 - 0.1*2*1.28 = 1.024</math>
<math>x_1 + x_2 - 9 = 0</math>


Iteration 4: <math>x_4 = x_3 - \eta* f'(x_3) =1.024 - 0.1*2*1.024 = 0.8192</math>
where the perceptron parameters are:


<strong>With momentum:</strong>
<math>  
w_1 = 1
</math>


Iteration 1: <math> v_1 = \gamma*v_0 + \eta * f'(x_0) = 0.9*0 + 0.1*2*2 = 0.4, x_1 = x_0-v_1 = 2-0.4 = 1.6 </math>
<math>
w_2 = 1
</math>


Iteration 2: <math> v_2 = \gamma*v_1 + \eta * f'(x_1) = 0.9*0.4+0.1*2*1.6 = 0.68, x_2 = x_1-v_2 = 1.6-0.68 = 0.92 </math>
<math>
b = -9
</math>


Iteration 3: <math> v_3 = \gamma*v_2 + \eta * f'(x_2) = 0.9*0.68 + 0.1*2*0.92 = 0.796, x_3 = x_2-v_3 = 0.92-0.796 = 0.124 </math>
Part 2:


Iteration 4: <math> v_4 = \gamma*v_3 + \eta * f'(x_3) = 0.9*0.796 + 0.1*2*0.124 = 0.7412, x_4 = x_3-v_4 = 0.124 - 0.7412 = -0.6172 </math>
<pre>
part2_data = np.array([
    [3, 5, -1],
    [3, 8, 1],
    [7, 7, -1],
    [6, 5, 1]
])


By observation, we know that the minimum of <math>f(x)=x^2+2</math> occurs at <math>x=0</math>. We can see that with momentum, the algorithm moves towards the minimum much faster than without momentum as past gradients are accumulated, leading to larger steps. However, we also can see that momentum can cause the algorithm to overshoot the minimum since we are taking larger steps.
part2_X = part2_data[:, :2]  # First two columns for data points
part2_y = part2_data[:, 2]  # Last column for classes


'''Benefits for momentum:'''
# Define colors based on class classes, Im chooosing green and red
Momentum is a technique used in optimization to accelerate convergence. Inspired by physical momentum, it helps in navigating the optimization landscape.
colors = ['red' if label == -1 else 'green' for label in part2_y]


By remembering the direction of previous gradients, which are accumulated into a running average (the velocity), momentum helps guide the updates more smoothly, leading to faster progress. This running average allows the optimizer to maintain a consistent direction even if individual gradients fluctuate. Additionally, momentum can help the algorithm escape from shallow local minima by carrying the updates through flat regions. This prevents the optimizer from getting stuck in small, unimportant minima and helps it continue moving toward a better local minimum.
plt.scatter(part2_X[:, 0], part2_X[:, 1], c=colors, edgecolors='black', s=100)


</div>
plt.xlabel('x1')
plt.ylabel('x2')
plt.title('Part 2: 2D Classification Data')


<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
plt.legend()
plt.grid(True)


== Exercise 3.4 ==
plt.show()
'''Level:''' ** (Moderate)
</pre>


'''Exercise Types:''' Novel
There does not exist perceptron solution that correctly classifies all points.


=== Question ===
Part 3:
Perform one iteration of forward pass and backward propagation for the following network:


* Input layer: 2 neurons (x₁, x₂)
<pre>
* Hidden layer: 2 neurons (h₁, h₂)
from mpl_toolkits import mplot3d
* Output layer: 1 neuron (ŷ)
#library needed to plot 3d data


* Input-to-Hidden Layer:
part3_data = np.array([
  w₁₁¹ = 0.15, w₂₁¹ = 0.20, w₁₂¹ = 0.25, w₂₂¹ = 0.30
    [2, 3, 1, -1],  
   Bias: b¹ = 0.35
    [5, 6, 2, -1],    
   Activation function: sigmoid
    [8, 9, 3, +1],    
    [9, 10, 6, +1],
])


*Hidden-to-Output Layer:
part3_X = part3_data[:, :3]  # First three columns for data points
  w₁₁² = 0.40, w₂₁² = 0.45
part3_y = part3_data[:, 3]   # Last column for classes
  Bias: b² = 0.60
   Activation function: sigmoid


Input:
# Define colors based on classes, Im chooosing green and red
* x₁ = 0.05, x₂ = 0.10
colors = ['red' if label == -1 else 'green' for label in part3_y]
* Target output: y = 0.01
* Learning rate: η = 0.5


=== Solution ===
# Use projection="3d" to create 3D scatter plot
ax = plt.axes(projection='3d')


==== Step 1: Forward Pass ====
# Plot 3d data points
ax.scatter(part3_X[:, 0], part3_X[:, 1], part3_X[:, 2], c=colors, edgecolors='black', s=100)


===== 1. Hidden Layer Outputs =====
# Create a horizontal hyperplane at x2 = 7
part3_x1, part3_x3 = np.meshgrid(np.linspace(0, 10, 10), np.linspace(0, 10, 10))
part3_x2 = 7


For neuron h₁:
ax.plot_surface(part3_x1, part3_x2, part3_x3, color='blue', alpha=0.5)
* <math> z₁¹ = w₁₁¹ \cdot x₁ + w₂₁¹ \cdot x₂ + b¹ = 0.15(0.05) + 0.20(0.10) + 0.35 = 0.3775 </math>
* <math> h₁ = \sigma(z₁¹) = \frac{1}{1 + e^{-0.3775}} \approx 0.5933 </math>


For neuron h₂:
ax.set_xlabel('x1')
* <math> z₂¹ = w₁₂¹ \cdot x₁ + w₂₂¹ \cdot x₂ + b¹ = 0.25(0.05) + 0.30(0.10) + 0.35 = 0.3925 </math>
ax.set_ylabel('x2')
* <math> h₂ = \sigma(z₂¹) = \frac{1}{1 + e^{-0.3925}} \approx 0.5968 </math>
ax.set_zlabel('x3')
ax.set_title('3D Perceptron Solution Visualization')


===== 2. Output Layer =====
plt.show()
* <math> z² = w₁₁² \cdot h₁ + w₂₁² \cdot h₂ + b² = 0.40(0.5933) + 0.45(0.5968) + 0.60 = 1.1051 </math>
</pre>
* <math> \hat{y} = \sigma(z²) = \frac{1}{1 + e^{-1.1051}} \approx 0.7511 </math>
 
There exists a perceptron solution that correctly classifies all points.


==== Step 2: Compute Error ====
<math>
x_2 = 7
</math>


* <math> E = \frac{1}{2} (\hat{y} - y)^2 = \frac{1}{2} (0.7511 - 0.01)^2 \approx 0.2738 </math>
where the perceptron parameters are:


==== Step 3: Backpropagation ====
<math>
w_1 = 0
</math>


===== 3.1: Gradients for Output Layer =====
<math>
w_2 = 1
</math>


1. Gradient w.r.t. output neuron:
<math>
* <math> \delta² = (\hat{y} - y) \cdot \hat{y} \cdot (1 - \hat{y}) </math>
w_3 = 0
* <math> \delta² = (0.7511 - 0.01) \cdot 0.7511 \cdot (1 - 0.7511) = 0.1381 </math>
</math>


2. Update weights and bias for hidden-to-output layer:
<math>
* <math> w₁₁² = w₁₁² - \eta \cdot \delta² \cdot h₁ = 0.40 - 0.5 \cdot 0.1381 \cdot 0.5933 = 0.359 </math>
b = -7
* <math> w₂₁² = w₂₁² - \eta \cdot \delta² \cdot h₂ = 0.45 - 0.5 \cdot 0.1381 \cdot 0.5968 = 0.409 </math>
</math>
* <math> b² = b² - \eta \cdot \delta² = 0.60 - 0.5 \cdot 0.1381 = 0.53095 </math>


===== 3.2: Gradients for Hidden Layer =====


1. Gradients for hidden layer neurons:
</div>


For h₁:
</div>
* <math> \delta₁ = \delta² \cdot w₁₁² \cdot h₁ \cdot (1 - h₁) </math>
* <math> \delta₁ = 0.1381 \cdot 0.40 \cdot 0.5933 \cdot (1 - 0.5933) = 0.0138 </math>


For h₂:
* <math> \delta₂ = \delta² \cdot w₂₁² \cdot h₂ \cdot (1 - h₂) </math>
* <math> \delta₂ = 0.1381 \cdot 0.45 \cdot 0.5968 \cdot (1 - 0.5968) = 0.0148 </math>


2. Update weights and bias for input-to-hidden layer:
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


For w₁₁¹:
== Exercise 1.28 ==
* <math> w₁₁¹ = w₁₁¹ - \eta \cdot \delta₁ \cdot x₁ = 0.15 - 0.5 \cdot 0.0138 \cdot 0.05 = 0.14965 </math>


For w₂₁¹:
<b>Level:</b> * (Easy)
* <math> w₂₁¹ = w₂₁¹ - \eta \cdot \delta₁ \cdot x₂ = 0.20 - 0.5 \cdot 0.0138 \cdot 0.10 = 0.19931 </math>


For b¹:
<b>Exercise Types:</b> Novel
* <math> b¹ = b¹ - \eta \cdot (\delta₁ + \delta₂) = 0.35 - 0.5 \cdot (0.0138 + 0.0148) = 0.3347 </math>


<b>References:</b> A. Ghodsi, STAT 940 Deep Learning: Lecture 1, University of Waterloo, Winter 2025.


This completes one iteration of forward and backward propagation.
=== Question ===


</div>
Artificial Intelligence can be applied to a wide variety of fields. Give an example where AI has been used as a tool for scientific discovery.


<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
=== Solution ===


== Exercise 3.5 ==
Artificial intelligence has been applied in climate science, where deep learning models are used to predict climate patterns, simulate climate models, and forecast extreme weather events. These AI models have demonstrated high accuracy, enabling better disaster preparedness efforts.
'''Level:''' * (Easy)


'''Exercise Types:''' Novel
Additionally, AI has accelerated scientific research by facilitating faster and more efficient simulations of complex physical systems. It has been used to study black holes and particle physics, advancing our understanding of fundamental sciences.
 
=== Question ===
Consider the loss function <math>Q(w) = w^2 + 2w + 1</math>.
Compute the gradient of <math>Q(w)</math>.
Starting from <math>w_0 = 2</math>, perform two iterations of stochastic gradient descent using a learning rate <math>\rho = 0.1</math>.
 
=== Solution ===
Compute the gradient at <math>w_0</math>:<math>\nabla Q(w_0) = 2(2) + 2 = 4 + 2 = 6</math>
 
Update the weight using SGD:
<math>w_1 = w_0 - \rho \cdot \nabla Q(w_0) = 2 - 0.1 \cdot 6 = 2 - 0.6 = 1.4</math>
 
Compute the gradient at <math>w_1</math>:
<math>\nabla Q(w_1) = 2(1.4) + 2 = 2.8 + 2 = 4.8</math>
 
Update the weight again:
<math>w_2 = w_1 - \rho \cdot \nabla Q(w_1) = 1.4 - 0.1 \cdot 4.8 = 1.4 - 0.48 = 0.92</math>


</div>


</div>


<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


== Exercise 2.1 ==


== Exercise 3.6 ==
'''Level:''' * (Easy)
'''Level:''' * (Easy)


'''Exercise Types:''' Novel
'''Exercise Types:''' Novel


=== Question ===
'''References:''' Calin, Ovidiu. Deep learning architectures: A mathematical approach. Springer, 2020
What is the prediction of the following MLP for <math>x = [221]</math>?


[[File:mlp.png|321px|thumb|center|Diagram of the MLP]]
This problem is coincidentally similar to Exercise 5.10.1 (page 163) in this textbook, although that exercise was not used as the basis for this question.


Both layers are using sigmoid activation. The weight matrices connecting the input and hidden layer, and the hidden layer and output are respectively: 
=== Question ===
<math> V = [101110], \quad W = [01]. </math>


Choose the correct answer: <br>
This problem is about using perceptrons to implement logic functions. Assume a dataset of the form <math>x_1, x_2 \in \{0, 1\}</math>, and a perceptron defined as:
a) <math>\sigma(0)</math> <br> 
<math>
b) <math>\sigma(\sigma(0))</math> <br> 
y = H(\beta_0 + \beta_1 x_1 + \beta_2 x_2),
c) <math>\sigma(-1)</math> <br>
</math>
d) <math>\sigma(\sigma(0))</math>
where <math>H</math> is the Heaviside step function, defined as:
<math>
H(z) = \begin{cases}
1, & \text{if } z \geq 0, \\  
0, & \text{if } z < 0.
\end{cases}
</math>


=== Solution ===
(a)* Find weights <math>\beta_1, \beta_2</math> and bias <math>\beta_0</math> for a single perceptron that implements the '''AND''' function.
The correct answer is <b>b)</b>: <math>\sigma(\sigma(0))</math>.


=== Calculation ===
(b)* Find the weights <math>\beta_1, \beta_2</math> and bias <math>\beta_0</math> for a single perceptron that implements the '''OR''' function.
Step 1: Compute the hidden layer output <math>h</math>.  <br>
<math>h = \sigma(Vx) = [σ(3)σ(0)]</math>


Step 2: Compute the output layer prediction <math>y</math>.  <br>
(c)** Given the truth table for the '''XOR''' function:
<math>y = \sigma(Wh) = \sigma(\sigma(0))</math> 


Thus, the prediction of the MLP is <math>\sigma(\sigma(0))</math>.
<math>
\begin{array}{|c|c|c|}
\hline
x_1 & x_2 & x_1 \oplus x_2 \
\hline
0 & 0 & 0 \
0 & 1 & 1 \
1 & 0 & 1 \
1 & 1 & 0 \
\hline
\end{array}
</math>


</div>
Show that it cannot be learned by a single perceptron. Find a small neural network of multiple perceptrons that can implement the '''XOR''' function. (Hint: a hidden layer with 2 perceptrons).


<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
=== Solution ===


(a) A perceptron that implements the '''AND''' function:


== Exercise 3.7 ==
<math>y = H(-1.5 + x_1 + x_2).</math>
'''Level:''' * (Easy)


'''Exercise Types:''' Novel
Here:


=== Question ===
<math>\beta_0 = -1.5, \quad \beta_1 = 1, \quad \beta_2 = 1.</math>. This works because the '''AND''' function returns 1 only when both inputs are 1. For a perceptron, the condition for activation is:
<p>Feedforward Neural Networks (FNNs) are one of the commonly used model in deep learning. In the context of training such networks, there are some important parameters we can choose.  
<math>
    </p>
\beta_0 + \beta_1 x_1 + \beta_2 x_2 \geq 0.
    <ol type="A">
</math>
        <li><strong>(a):</strong> Give three commonly used activation functions, along with their formulas and when to use them.</li>
This must hold for (1, 1) but fail for all other combinations. Substituting values leads to the choice of <math>\beta_0 = -1.5</math> and <math>\beta_1 = \beta_2 = 1</math>.
        <li><strong>(b):</strong> Write down a widely used loss function for classification and why it is popular. </li>
        <li><strong>(c):</strong> Explain what is adaptive learning methods and how they help optimize and speed up network training.</li>
    </ol>


=== Solution ===
(b) A perceptron that implements the '''OR''' function:


<p>(a)</p>
<math>y = H(-0.5 + x_1 + x_2).</math>
    <ol>
        <li><strong>Sigmoid Activation Function</strong>
            <p><math>f(z) = \frac{1}{1 + e^{-z}}</math></p>
            <p>Usage: Output ranges from 0 to 1, suitable for estimating probabilities.</p>
        </li>
        <li><strong>ReLU (Rectified Linear Unit) Activation Function</strong>
            <p><math>f(z) = \max(0, z)</math></p>
            <p> Outputs zero or a positive number, enabling some weights to be set to 0, promoting sparse representation</p>
        </li>
    </ol>


<p>(b)</p>
Here:
    <p><strong>Cross-Entropy Loss</strong> 
        <br>
        <math>\mathcal{L}_{\text{CE}} = -\sum_{i=1}^{n} \bigl[\, y_i \log\bigl(y_{\text{pred},i}\bigr)\ +\ (1 - y_i)\,\log\bigl(1 - y_{\text{pred},i}\bigr) \bigr]</math>
    </p>
    <p> It provides a smooth and continuous gradient, and it penalizes the incorrect predictions more when the predictions are made with confidence. It is well suited for multi-class classification, especially when used with softmax function together.
    </p>


<p>(c)</p>
<math>\beta_0 = -0.5, \quad \beta_1 = 1, \quad \beta_2 = 1.</math> This works because the '''OR''' function returns 1 if either or both inputs are 1. Using similar logic to the '''AND''' case, the decision boundary conditions lead to these parameters.
    <p>Some variants of SGD adjust the learning rate during the training process based on the gradients' magnitudes, helping accelerate convergence and manage gradients more effectively. </p>
 
[[Image:AND OR perceptrons.png|thumb|200px|left|Perceptrons that implement the '''AND''' and '''OR''' functions respectively.]]
<br clear="all">
 
(c) '''XOR''' is not linearly separable, so it cannot be implemented by a single perceptron.


</div>
The '''XOR''' function returns 1 when the following are true:
* Either <math> x_1 </math> or <math> x_2 </math> are 1. In other words, the expression <math> x_1</math> '''OR''' <math>x_2 </math> returns 1.
* <math> x_1 </math> and <math> x_2 </math> are not both 1. In other words, the expression <math> x_1 </math> '''NAND''' <math> x_2 </math> returns 1.


To implement this, the outputs of an '''OR''' and a '''NAND''' perceptron can be taken as inputs to an '''AND''' perceptron. (The '''NAND''' perceptron was derived by multiplying the weights and bias of the '''AND''' perceptron by -1.)


<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
[[Image:XOR NN.png|thumb|200px|left|Neural network that implements the XOR function.]]
<br clear="all">


== Exercise 3.8 ==
'''Why can't the perceptron converge in the case of linear non-separability?'''
'''Level:''' * (Easy)


'''Exercise Types:''' Novel
In linearly separable data, there exists a weight vector <math>w</math> and bias <math>b</math> such that:


=== Question ===
<math> y_i(w \cdot x_i + b) > 0 \quad \forall i </math>
Consider a Feedforward Neural Network (FNN) with a single neuron, where the loss function is given by: <math>L(w)=(w-3)^2</math>. Compute the gradient of <math>L(w)</math>. Starting from <math>w_{0}=0</math> perform two iterations of Stochastic Gradient Descent (SGD) using a learning rate <math>\eta = 0.5 </math>


=== Solution ===
But in the case of linear non-separability, w and b satisfying this condition do not exist, so the perceptron cannot satisfy the convergence condition.
Gradient of <math>L(w)</math>: <br>
<math>
\frac{dL}{dw}=2(w-3)</math><br>
<math>w_{0}=0</math><br>
<math>w_{1}=w_{0}-\eta \frac{dL}{dw}=3</math><br>
<math>w_{2}=w_{1}-\eta \frac{dL}{dw}=3</math><br>
So, after 2 iterations, <math>w_{2}=3</math>.
</div>
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


== Exercise 3.9 ==
== Exercise 2.2 ==
'''Level:''' * (Easy)


<b>Level:</b> ** (Moderate) 
'''Exercise Types:''' Novel


<b>Exercise Types:</b> Modified 
=== Question ===


<b>References:</b> Source: Schonlau, M., Applied Statistical Learning. With Case Studies in Stata, Springer. ISBN 978-3-031-33389-7 (Chapter 14, page 318).
1.How do feedforward neural networks utilize backpropagation to adjust weights and improve the accuracy of predictions during training?


=== Question ===
2. How would the training process be affected if the learning rate in optimization algorithm were too high or too low?
Consider the feedforward neural network with initial weights shown in Figure 3.9 (For simplicity, there are no biases). Use sigmoid activation functions for both the hidden and the output layers. Use a learning rate of <math> \rho= 0.5</math>.


[[Image:Ex 3.9.jpg|thumb|600px|left|Figure 3.9]]
=== Solution ===
<br clear="all">


(a): Compute a forward pass through the network for the observation (y,x1,x2,x3) = (1,3,-2,5). That is, compute the predicted probability <math> p_1 </math>.
1. After a forward pass where inputs are processes to generate an output, the error between the prediction and actual values is calculated. This error is then propagated backward through the network, and the gradients of the loss function with respect to the weights are computed. Using these gradients, the weights are updated with an optimization algorithm like stochastic gradient descent, gradually minimizing the error and improving the networks' performance.


(b): Using the result from (a), make a backward pass to compute the revised w7 and w1. Use squared error loss: <math> E = 0.5 * (y-p_1)^2 </math>, where <math> y\in \{0,1\} </math> is the true value of the response and <math>p_1</math> is the predicted probability.
2. If the learning rate is too high, the weights might overshoot the optimal values, leading to oscillations or divergence. If it's too low, the training process might become very slow and stuck in local minimum.


=== Solution ===
==== Calculations ====
===== Step 1: Forward Propagation =====
Each neuron computes:


==== (a) ====
<math> z = W \cdot x + b </math>


<math> z_A = x_1w_1 + x_2w_2 + x_3w_3 = 3*0.8+(-2)*(-1)+5*0.1=4.9 </math>
<math> a = f(z) </math>


<math> z_B = x_1w_4 + x_2w_5 + x_3w_6 = 3*0.3+(-2)*0.5+5*(-0.2)=-1.1 </math>
where:
*  W = weights, b  = bias
* f(z) = activation function (e.g., sigmoid, ReLU)
* a  = neuron’s output


<math> out_A = \frac{1}{1+e^{-z_A}} = \frac{1}{1+e^{-4.9}} = 0.9926 </math>
===== Step 2: Compute Loss =====
The error between predicted <math> \hat{y} </math> and actual <math> y </math> is calculated using a loss function, such as **Mean Squared Error (MSE)**:


<math> out_B = \frac{1}{1+e^{-z_B}} = \frac{1}{1+e^{1.1}} = 0.2497 </math>
<math> L = \frac{1}{n} \sum (y - \hat{y})^2 </math>
 
For classification, **Cross-Entropy Loss** is commonly used.
 
===== Step 3: Backward Propagation =====
Using the **chain rule**, gradients are computed:


<math> z_1 = out_Aw_7+out_Bw_8=0.9926*1.3+0.2497*0.4=1.3903 </math>
<math> \frac{\partial L}{\partial W} = \frac{\partial L}{\partial a} \cdot \frac{\partial a}{\partial z} \cdot \frac{\partial z}{\partial W} </math>


<math> p_1 = \frac{1}{1+e^{-z_1}} = \frac{1}{1+e^{-1.3903}} =0.8006 </math>
These gradients guide weight updates to minimize loss.


==== (b) ====
===== Step 4: Weight Update using Gradient Descent =====
Weights are updated using:


<math>\frac{\partial{E}}{\partial{w_7}}=\frac{\partial{E}}{\partial{p_1}}\frac{\partial{p_1}}{\partial{z_1}}\frac{\partial{z_1}}{\partial{w_7}}=(p_1-y)*p_1*(1-p_1)*out_A=-0.0317</math>
<math> W = W - \alpha \frac{\partial L}{\partial W} </math>


<math>w_7^{new} = 1.3-0.5*(-0.0317)=1.3159</math>
where <math> \alpha </math> is the **learning rate**.


<math>\frac{\partial{E}}{\partial{w_1}}=\frac{\partial{E}}{\partial{p_1}}\frac{\partial{p_1}}{\partial{z_1}}\frac{\partial{z_1}}{\partial{out_A}}\frac{\partial{out_A}}{\partial{z_A}}\frac{\partial{z_A}}{\partial{w_1}}=(p_1-y)*p_1*(1-p_1)*w_7*out_A*(1-out_A)*x_1=-0.0091</math>


<math>w_1^{new} = 0.8-0.5*(-0.0091)=0.8046</math>
</div>
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


== Exercise 2.3 ==
'''Level:''' * (Easy)


'''Exercise Types:''' Modified


== Exercise 4.1 ==
'''References:''' Simon J.D. Prince. Understanding Deep learning. 2024
'''Level:''' * (Easy)


'''Exercise Types:''' Novel
This problem comes from Problem 3.5 in this textbook. In addition to the proof, I explained why this property is important to learning neural networks.


=== Question ===  
=== Question ===  
Explain why SURE is rarely used in large-scale deep learning in practice.


=== Solution ===
Prove that the following property holds for <math>\alpha \in \mathbb{R}^+ </math>:
Note that to compute the model complexity part of the SURE estimator, we have to compute the divergence term:


<math>
<math> \text{ReLU}[\alpha \cdot z] = \alpha \cdot \text{ReLU}[z] </math>
2\sigma^2 \sum_{i=1}^{n} D_i
</math>


where
Explain why this property is important in neural networks.


<math>
=== Solution ===
D_i=\frac{\partial \hat{f}_i(y)}{\partial y_i}
</math>


For modern deep learning frameworks, both the number of parameters (weights) and the number of data dimensions are huge (in million or billions). This makes the computation of the divergence term extremely expensive. Note that using stochastic gradient descent the estimation of the weights is the result of an iterative process. If we include an inner loop to compute all the divergence, the computation complexity is growing exponentially.  
This is known as the '''non-negative homogeneity property''' of the ReLU function.


Additionally, the high-dimensional nature of deep learning models means that computing the divergence requires handling large matrices or tensors, making the task even more resource-intensive. Even though parallel computation techniques like GPU acceleration can reduce the time for individual gradient calculations, the divergence computation still adds significant overhead when applied across all data points and iterations. Moreover, the computational complexity becomes even more challenging when dealing with large-scale datasets and real-time training, where the time needed to calculate divergence can slow down the training process substantially. This makes methods like SURE impractical for real-time or large-scale applications compared to simpler and more efficient alternatives like cross-validation, which does not require computing high-dimensional divergence and is easy to implement, making it a more suitable approach in practice.
Recall the definition of the ReLU function:


However, SURE gives very good insight about the behaviour of the true error, and the divergence term is considered a regularization term. For simpler models such as linear regression, the divergence term can be easy to compute, and perturbing a trained data point would not change the estimated function by much. However in more complex models such as deep learning frameworks, perturbing a trained data point can result in large changes in our estimated function, meaning that the divergence term will be larger. Often times, we add a regularization term to our loss function that mimics the behaviour of the divergence term, such that the loss function increases the more complex our model is. Techniques such as adding weight decay or penalties on gradient magnitudes are often used to improve generalization.
<MATH>
</div>


<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
\text{ReLU}(z) =
\begin{cases}
z & \text{if } z \geq 0, \
0 & \text{if } z < 0.
\end{cases}
</MATH>


== Exercise 4.2 ==
We prove the property by considering the two possible cases for <math> z </math>.


<b>Level:</b> * (Easy) 
'''Case 1: <math>z \geq 0 </math>'''


<b>Exercise Types:</b> Novel
If <math>z \geq 0 </math>, then by the definition of the ReLU function:
 
<math>\text{ReLU}(z) = z</math>


=== Question ===
Therefore:
Use SURE to analyze how the bias-variance tradeoff is reflected in the risk of an estimator. Consider two scenarios:


*A high-bias, low-variance estimator (e.g., a constant estimate <math>\hat{f}(y) = c</math> for all <math>y</math>).
<math>\text{ReLU}(\alpha \cdot z) = \alpha \cdot z</math>
*A high-variance, low-bias estimator (e.g., <math>\hat{f}(y) = y</math>).


Show how the SURE formula quantifies the risk in both cases.
and:


=== Solution ===
<math>\alpha \cdot \text{ReLU}(z) = \alpha \cdot z</math>
High-bias, low-variance estimator:
* Since <math>\hat{f}(y) = c</math>, the divergence <math>\text{D}(\hat{f}) = 0</math> (no dependence on <math>y</math>).
* The SURE risk simplifies to <math>\text{Risk} = (c - y)^2 + 2\sigma^2 \cdot 0</math>.
* The expected risk is influenced entirely by the choice of <math>c</math> relative to <math>f</math> (bias).


High-variance, low-bias estimator:
Hence, in this case:
* For <math>\hat{f}(y) = y</math>, the divergence <math>\text{D}(\hat{f}) = 1</math> (derivative of <math>y</math> w.r.t. itself is 1).
* The SURE risk becomes <math>\text{Risk} = |y - y|^2 + 2\sigma^2 \cdot 1 = 2\sigma^2</math>.
* The risk reflects only the variance, as bias is negligible.


</div>
<math>\text{ReLU}(\alpha \cdot z) = \alpha \cdot \text{ReLU}(z)</math>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


== Exercise 4.3 ==
'''Case 2: <math>z<0</math>'''


'''Level:''' ** (Moderate)
If <math>z < 0</math>, then <math>\alpha \cdot z < 0</math>.


'''Exercise Types:''' Novel
Therefore:


=== Question === 
<math>\text{ReLU}(\alpha \cdot z) = \text{ReLU}(z) = 0</math>
How does SURE explain why cross-validation and regularization are effective for estimating true error? <br>
Hint: Consider the cases when a data point is not in the training set and when it is included in the training set.


=== Solution ===
and:


Let’s first recall the SURE (Stein's Unbiased Risk Estimate) formula:
<math>\alpha \cdot \text{ReLU}(z) = \alpha \cdot 0 = 0</math>


<math>
Hence, in this case:
E[(\hat{y_0}-y_0)^2] = E[(\hat{f_0} - f_0)^2] + E[\epsilon_0^2] - 2 E[\epsilon_0 (\hat{f_0} - f_0)]
</math>


==== Case 1: Data Point Not in the Training Set ====
<math>\text{ReLU}(\alpha \cdot z) = \alpha \cdot \text{ReLU}(z)</math>


When the data point is not in the training set, the covariance term <math>E[\epsilon_0 (f_0 - f_0)]</math> becomes zero, since the model does not have access to that particular point during training. This simplifies the formula to:
Since the property holds in both cases, this completes the proof.


<math>
'''Why is this property important in neural networks?'''
E[(\hat{y_0}-y_0)^2] = E[(\hat{f_0} - f_0)^2] + E[\epsilon_0^2]
</math>


Now, when summing over all <math>m</math> points, we obtain:
In a neural network, the input to a neuron is often a linear combination of the weights and inputs.


<math>
When training neural networks, scaling the inputs or weights can affect the activations of neurons. However, because ReLU satisfies the homogeneity property, the output of the ReLU function scales proportionally with the input. This means that scaling the inputs by a positive constant (like a learning rate or normalization factor) does not change the overall pattern of activations — it only scales them. This stability in scaling is important during optimization because it makes the network's output more predictable and ensures that scaling transformations don't break the network's functionality.
\sum_{i=1}^{m} (\hat{y_i} - y_i)^2 = \sum_{i=1}^{m} (\hat{f_i} - f_i)^2 + m \sigma^2
</math>


Where <math>\sigma^2</math> is noise. The total error (<math>Err</math>) can be written as:
Additionally, because of the non-negative homogeneity property, the gradients also scale proportionally, the scale of the gradient changes proportionally with the input scale, which ensures that the optimization process remains stable. It helps prevent exploding gradients when the inputs are scaled by large positive values.


<math>
The homogeneity property of ReLU also helps the network to perform well on different types of data. By keeping the scaling of activations consistent, it helps maintain the connection between inputs and outputs during training, even when the data is adjusted or scaled. This makes ReLU useful when input values vary a lot, and it simplifies the network's response to changes in input distributions, which is especially valuable when transferring a trained model to new data or domains.
Err = err - m \sigma^2
</math>


Here, <math>m \sigma^2</math> is a constant, which means the true error differs from the empirical error by a constant value only. Therefore, the empirical error (<math>err</math>) provides a good estimate of the true error (<math>Err</math>) when the point is not in the training set.
While great in most cases, there have been some slight modifications to this property to yeild better results in specific cases. Known as the "dying ReLU" problem, in which neurons output zero for all inputs when their weights are updated to negative values, this effectively makes them inactive which can hinder learning and reduce model capacity. Similarly, ReLU can also suffer from exploding gradients for large inputs. Therefore, alternative propossed modifications include Leaky ReLU, which allows a small, non-zero gradient for negative inputs to mitigate neuron death; ELU (Exponential Linear Unit), which smooths gradients and improves convergence; and GELU (Gaussian Error Linear Unit), which combines smoothness and non-linearity for improved performance in certain cases.


This explains why cross-validation is effective. Cross-validation essentially evaluates the model on data points that were not part of the training set, and since the empirical error is only offset by a constant, it provides a reliable estimate of the true error.
</div>


==== Case 2: Data Point in the Training Set ====
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


When the data point is part of the training set, the covariance term <math>E[\epsilon_0 (f_0 - f_0)]</math> is no longer zero. We have:
== Exercise 2.4 ==
'''Level:''' * (Easy)


<math>
'''Exercise Types:''' Novel
\sum_{i=1}^{m} (\hat{y_i} - y_i)^2 = \sum_{i=1}^{n} (\hat{f_i} - f_i)^2 + n \sigma^2 - 2 \sigma^2 \sum_{i=1}^{n} D_i
</math>


Where <math>D_i</math> represents the bias introduced by the model. This equation can be further simplified to:
=== Question ===
Train a perceptron on the given dataset using the following initial settings, and ensure it classifies all data points correctly.


<math>
* Initial weights: <math>w_0 = 0, w_1 = 0, w_2 = 0</math>
Err = err - n \sigma^2 + 2 \sigma \sum_{i=1}^{n} D_i
* Learning rate: <math>\eta = 0.1</math>
</math>
* Training dataset:
  (x₁ = 1, x₂ = 2, y = 1)
  (x₁ = -1, x₂ = -1, y = -1)
  (x₁ = 2, x₂ = 1, y = 1)


In this case, the additional term <math>\sum_{i=1}^{n} D_i</math> reflects the model’s complexity. The complexity term increases with the capacity of the model and is often difficult to calculate directly. To handle this, instead of directly calculating the complexity term, we can use a function that increases with respect to model capacity, and treat it as the regularization term. The regularization term penalizes model complexity to avoid overfitting, thus helping to prevent the model from fitting noise in the training set.
<math> y = 1 </math> if the output <math> z = w_1 \cdot x_1 + w_2 \cdot x_2 + w_0 \geq 0 </math>, otherwise <math> y = -1 </math>.


This explains the need for regularization techniques. Regularization helps to control model complexity and ensures that the model generalizes better to unseen data, improving the estimation of the true error.
=== Solution ===


Thus, both cross-validation and regularization are grounded in the same principle of improving the estimation of true error by adjusting for complexity and noise.
==== Iteration 1 ====
1. First data point (x₁ = 1, x₂ = 2) with label 1:
* Weighted sum: <math>\hat{y} = w_0 + w_1 x_1 + w_2 x_2 = 0 + 0(1) + 0(2) = 0</math>
* Predicted label: <math>\hat{y} = 1</math>
* Actual label: 1 → No misclassification


(Note: the formulas are all from Lecture 4 content, STAT 940)
2. Second data point (x₁ = -1, x₂ = -1) with label -1:
* Weighted sum: <math>\hat{y} = w_0 + w_1 x_1 + w_2 x_2 = 0 + 0(-1) + 0(-1) = 0</math>
* Predicted label: <math>\hat{y} = 1</math>
* Actual label: -1 → Misclassified


</div>
3. Third data point (x₁ = 2, x₂ = 1) with label 1:
* Weighted sum: <math>\hat{y} = w_0 + w_1 x_1 + w_2 x_2 = 0 + 0(2) + 0(1) = 0</math>
* Predicted label: <math>\hat{y} = 1</math>
* Actual label: 1 → No misclassification


==== Update Weights (using the Perceptron rule with the cost as the distance of all misclassified points) ====
For the misclassified point (x₁ = -1, x₂ = -1):
* Updated weights:
* <math>w_0 = w_0 + \eta y = 0 + 0.1(-1) = -0.1</math>
* <math>w_1 = w_1 + \eta y x_1 = 0 + 0.1(-1)(-1) = 0.1</math>
* <math>w_2 = w_2 + \eta y x_2 = 0 + 0.1(-1)(-1) = 0.1</math>


Updated weights after first iteration: <math>w_0 = -0.1, w_1 = 0.1, w_2 = 0.1</math>


<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
==== Iteration 2 ====
== Exercise 4.4 ==  


'''Level:''' ** (Moderate)
1. First data point (x₁ = 1, x₂ = 2) with label 1:
* Weighted sum: <math>\hat{y} = -0.1 + 0.1(1) + 0.1(2) = -0.1 + 0.1 + 0.2 = 0.2</math>
* Predicted label: <math>\hat{y} = 1</math>
* Actual label: 1 → No misclassification


'''Exercise Types:''' Novel
2. Second data point (x₁ = -1, x₂ = -1) with label -1:
* Weighted sum: <math>\hat{y} = -0.1 + 0.1(-1) + 0.1(-1) = -0.1 - 0.1 - 0.1 = -0.3</math>
* Predicted label: <math>\hat{y} = -1</math>
* Actual label: -1 → No misclassification


=== Question === 
3. Third data point (x₁ = 2, x₂ = 1) with label 1:
Assume there is a point set <math>(x_i,y_i)</math> satisfying <math>y_i=2x_i+3sin(x_i)+n_i</math>, where <math>n_is</math> are i.i.d Gaussian with 0 mean and variance of 4.<br>
* Weighted sum: <math>\hat{y} = -0.1 + 0.1(2) + 0.1(1) = -0.1 + 0.2 + 0.1 = 0.2</math>
Now we fit the relationship between y and x, using polynomial linear models with order from 1 to 10. Show the MSE of models of different complexity.
* Predicted label: <math>\hat{y} = 1</math>
=== Solution ===
* Actual label: 1 → No misclassification


<pre>
Since there are no misclassifications in the second iteration, the perceptron has converged!
library(ggplot2)
x <- seq(0, 10, length.out = 100)
y <- 2 * x + 3 * sin(x) + rnorm(100, mean = 0, sd = 2)
data <- data.frame(x = x, y = y)


degrees <- 1:10
==== Final Result ====
mse_values <- numeric(length(degrees))
* Weights after convergence: <math>w_0 = -0.1, w_1 = 0.1, w_2 = 0.1</math>
* Total cost after convergence: <math>Cost = 0</math>, since no misclassified points.


for (i in seq_along(degrees)) {
  degree <- degrees[i]
 
  model <- lm(y ~ poly(x, degree), data = data)


  predicted <- predict(model, data)
</div>
 
  mse_values[i] <- mean((data$y - predicted)^2)
}


mse_results <- data.frame(Degree = degrees, MSE = mse_values)
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
print(mse_results)


ggplot(mse_results, aes(x = Degree, y = MSE)) +
== Exercise 2.5 ==
  geom_line(color = "blue") +
'''Level:''' * (Moderate)
  geom_point(size = 3, color = "red") +
  labs(title = "MSE vs. Model Complexity",
      x = "Polynomial Degree",
      y = "Mean Squared Error (MSE)") +
  theme_minimal()


ggplot(data, aes(x = x, y = y)) +
'''Exercise Types:''' Novel
  geom_point(color = "black", alpha = 0.6) +
  geom_smooth(method = "lm", formula = y ~ poly(x, 1), color = "red", se = FALSE) +
  geom_smooth(method = "lm", formula = y ~ poly(x, 3), color = "blue", se = FALSE) +
  geom_smooth(method = "lm", formula = y ~ poly(x, 10), color = "green", se = FALSE) +
  labs(title = "Polynomial Regression Fits",
      x = "x",
      y = "y") +
  theme_minimal()
</pre>
Output:
[[File:Exercise 4.4_1.png|thumb|600px|left|]]
[[File:Exercise 4.4_2.png|thumb|600px|right|]]
<br clear="all">


</div>
=== Question ===
<p>Consider a <strong>Feed-Forward Neural Network (FFN)</strong> with one or more hidden layers. Answer the following questions:</p>


== Regularization in Deep Learning ==
<ol>
    <p> (a) Describe how does the Feed-Forward Neural Network (FFN) work in general. Describe the component of the Network. </p>
    <p> (b) How does the forward pass work ? Provide the relevant formulas for each step.</p>
    <p> (c) How does the backward pass (backpropagation) ? Explain and provide the formulas for each step.</p>
</ol>


=== Introduction ===
=== Solution ===
<p><b>(a):</b> A Feed-Forward Neural Network (FFN) consists of an input layer, one or more hidden layers, and one output layer. Each layer transforms the input data, with each neuron's output being fed to the next layer as input. Each neuron in a layer is a perceptron, which is a basic computational unit that contains weights, bias and an activation function. The perceptron computes a weighted sum of its inputs, adds a bias term, and passes the result through an activation function. In this structure, each layer transforms the data as it passes through, with each neuron's output being fed to the next layer. The final output is the network’s prediction, then the loss function use the prediction and the true label of the data to calculate the loss. The backward pass computes the gradients of the loss with respect to each weight and bias in the network, and then update the weights and biases to minimize the loss. This process is repeated for each sample (or mini-batch) of data until the loss converges and the weights are optimized.


Regularization is a fundamental concept in machine learning, particularly in deep learning, where models with a high number of parameters are prone to overfitting. Overfitting occurs when a model learns the noise in the training data rather than the underlying distribution, leading to poor generalization on unseen data. Regularization techniques aim to constrain the model’s capacity, thus preventing overfitting and improving generalization. This chapter will explore various regularization methods in detail, complete with mathematical formulations, intuitive explanations, and practical implementations.
<p><b>(b):</b> The forward pass involves computing the output for each layer in the network. For each layer, the algorithm performs the following steps:</p>
<p>1. Compute the weighted sum of inputs to the layer:</p>


=== Classical Regularization: Parameter Norm Penalties ===
<div style="text-align: center;">
<math display="block">
z^{(l)} = W^{(l)} a^{(l-1)} + b^{(l)}
</math>
</div>
<p>2. Use the activation function to calculate the output of the layer:</p>
<div style="text-align: center;">
<math display="block">
\hat{y} = a^{(L)} = \sigma(z^{(L)})
</math>
</div>
<p>3. Repeat these steps for each layer, until getting to the output layer</p>


==== L2 Regularization (Weight Decay) ====
<p><b>(c):</b> The backward pass (backpropagation) updates the gradients of the loss function with respect to each weight and bias, and then use the gradient descents to update the weights.</p>


== L2 Parameter Regularization (Weight Decay) ==
<p>1. Calculate the errors for each layer: </p>
Error at the output layer: The error term at the output layer has this formula: </p>
<div style="text-align: center;">
<math display="block">
\delta^{(L)} = \frac{\partial \mathcal{L}}{\partial a^{(L)}} \cdot \sigma'(z^{(L)})
</math>
</div>
<p>Error for the hidden layers: The error for each hidden layer is:</p>
<div style="text-align: center;">
<math display="block">
\delta^{(l)} = \left( W^{(l+1)} \right)^T \delta^{(l+1)} \cdot \sigma'(z^{(l)})
</math>
</div>
<p>3. Gradient of the loss with respect to weights and biases. Compute the gradients for the weights and biases:</p>
<p>The gradient for weights is:</p>
<div style="text-align: center;">
<math display="block">
\frac{\partial \mathcal{L}}{\partial W^{(l)}} = a^{(l-1)} \cdot (\delta^{(l)})^T
</math>
</div>
<p>The gradient is for biases is:</p>
<div style="text-align: center;">
<math display="block">
\frac{\partial \mathcal{L}}{\partial b^{(l)}} = \delta^{(l)}
</math>
</div>


=== Overview ===
<p>4. Update the weights and biases using gradient descent:</p>
<div style="text-align: center;">
<math display="block">
W^{(l)} \leftarrow W^{(l)} - \rho \cdot \frac{\partial \mathcal{L}}{\partial W^{(l)}}
</math>
</div>


L2 parameter regularization, commonly known as weight decay, is a technique used to prevent overfitting in machine learning models by penalizing large weights. This penalty helps in constraining the model's complexity.
<p>Where <math>\rho</math> is the learning rate.</p>


The regularization term is given by:
<div style="text-align: center;">
<math display="block">
b^{(l)} \leftarrow b^{(l)} - \rho \cdot \frac{\partial \mathcal{L}}{\partial b^{(l)}}
</math>
</div>


<math> \mathcal{R}(w) = \frac{\lambda}{2} \|w\|_2^2 </math>
<p>Repeat these steps for each layers from output layer to input layers to update all the weights and biases</p>


where:
</div>
* <math> \lambda </math> is the regularization strength (a hyperparameter),
* <math> w </math> represents the model weights,
* <math> \|w\|_2 </math> denotes the L2 norm of the weight vector.


=== Gradient of the Total Objective Function ===
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


The gradient of the total objective function, which includes both the loss and the regularization term, is given by:


<math> \nabla_w \mathcal{L}_{\text{total}}(w; X, y) = \lambda w + \nabla_w \mathcal{L}(w; X, y) </math>
== Exercise 2.6 ==
'''Level:''' * (Easy)


The weight update rule with L2 regularization using gradient descent is:
'''Exercise Types:''' Novel


<math> w := w - \eta (\lambda w + \nabla_w \mathcal{L}(w; X, y)) </math>
=== Question ===
A single neuron takes an input vector <math>x=[2,-3]</math>, with weights <math>w=[0.4,-0.6]</math>. The target output is <math> y_{\text{true}}=1 </math>.


where <math> \eta </math> is the learning rate.
1. Calculate the weighted sum <math>z = w \cdot x</math>.


=== Quadratic Approximation to the Objective Function ===
2. Compute the squared error loss: <math>L = 0.5 \cdot (z - y_{\text{true}})^2</math>


Consider a quadratic approximation to the objective function:
3. Find the gradient of the loss with respect to the weights <math>w</math> and perform one step of gradient descent with a learning rate <math>\eta = 0.01</math>.


<math> \mathcal{L}(w) \approx \mathcal{L}(w^*) + \frac{1}{2} (w - w^*)^\top H (w - w^*) </math>
4.Provide the updated weights and the error after the update.


where:
5. Compare the result of the previous step with the case of a learning rate of <math>\eta = 0.1</math>
* <math> w^* </math> is the optimum weight vector,
* <math> H </math> is the Hessian matrix of second derivatives.


The modified gradient equation becomes:
=== Solution ===
1. <math>z = w \cdot x = (0.4 \cdot 2) + (-0.6 \cdot -3)
= 0.8 + 1.8 = 2.6</math>


<math> \lambda w + H (w - w^*) = 0 </math>
2. <math>L = 0.5 \cdot (z - y_{\text{true}})^2 = 0.5 \cdot (2.6 - 1)^2 = 0.5 \cdot (1.6)^2 = 0.5 \cdot 2.56 = 1.28</math>


Solving for <math> w </math>, we get:
3. The gradient of the loss with respect to <math>w_i</math> is:
<math>\frac{\partial L}{\partial w_i} = (z - y_{\text{true}}) \cdot x_i</math>


<math> w = (H + \lambda I)^{-1} H w^* </math>
For <math>w_1</math> (associated with <math>x_1 = 2</math>):
<math>\frac{\partial L}{\partial w_1} = (2.6 - 1) \cdot 2 = 1.6 \cdot 2 = 3.2</math>


where <math> I </math> is the identity matrix.
For <math>w_2</math> (associated with <math>x_2 = -3</math>):
<math>\frac{\partial L}{\partial w_2} = (2.6 - 1) \cdot (-3) = 1.6 \cdot -3 = -4.8</math>
The updated weights are:
<math>w_i = w_i - \eta \cdot \frac{\partial L}{\partial w_i}</math>


=== Eigenvalue Decomposition ===
For <math>w_1</math>:
<math>w_1 = 0.4 - 0.01 \cdot 3.2 = 0.4 - 0.032 = 0.368</math>


Assume <math> H = Q \Lambda Q^\top </math> where <math> Q </math> is the orthogonal matrix of eigenvectors and <math> \Lambda </math> is the diagonal matrix of eigenvalues.
For <math>w_2</math>:
<math>w_2 = -0.6 - 0.01 \cdot (-4.8) = -0.6 + 0.048 = -0.552</math>


Then the weight vector can be expressed as:
4. Recalculate <math>z</math> with updated weights:
<math>z = (0.368 \cdot 2) + (-0.552 \cdot -3) = 0.736 + 1.656 = 2.392</math>


<math> w = Q(\Lambda + \lambda I)^{-1} \Lambda Q^\top w^* </math>
Recalculate the error:
<math>L = 0.5 \cdot (z - y_{\text{true}})^2 = 0.5 \cdot (2.392 - 1)^2 = 0.5 \cdot (1.392)^2 = 0.5 \cdot 1.937 = 0.968</math>


The effect of weight decay is to rescale the coefficients of the eigenvectors. The <math> i </math>-th component is rescaled by a factor of <math> \frac{\lambda_i}{\lambda_i + \lambda} </math>, where <math> \lambda_i </math> is the <math> i </math>-th eigenvalue.
5. Compare the result of the previous step with the case of a learning rate of <math>\eta = 0.1</math>:


* If <math> \lambda_i > \lambda </math>, the effect of regularization is relatively small.
For <math>w_1</math>:
* Components with <math> \lambda_i < \lambda </math> will be shrunk to have nearly zero magnitude.
<math>w_1 = 0.4 - 0.1 \cdot 3.2 = 0.4 - 0.032 = 0.08</math>


=== Effective Number of Parameters ===
For <math>w_2</math>:
<math>w_2 = -0.6 - 0.1 \cdot (-4.8) = -0.6 + 0.048 = -0.12</math>


Directions along which the parameters contribute significantly to reducing the objective function are preserved. A small eigenvalue of the Hessian indicates that movement in this direction will not significantly increase the gradient.
Recalculate <math>z</math> with the updated weights:
<math>z = (0.08 \cdot 2) + (-0.12 \cdot -3) = 0.16 + 0.36 = 0.52</math>


The effective number of parameters can be defined as:
Recalculate the error:
<math>L = 0.5 \cdot (z - y_{\text{true}})^2 = 0.5 \cdot (0.52 - 1)^2 = 0.5 \cdot (-0.48)^2 = 0.5 \cdot 0.2304 = 0.1152</math>


<math> \text{Effective Number of Parameters} = \sum_i \frac{\lambda_i}{\lambda_i + \lambda} </math>
Comparison:


As <math> \lambda </math> increases, the effective number of parameters decreases, which reduces the model's complexity.
- With a learning rate of <math>\eta = 0.01</math>, the error after one update is <math>L = 0.968</math>.


''(Placeholder for Image)''
- With <math>\eta = 0.1</math>, the error after one update is <math>L = 0.1152</math>.
(Include an image illustrating the effect of weight decay on the eigenvalues and the effective number of parameters)


=== Dataset Augmentation ===
The error is much lower when using a larger learning rate <math>\eta = 0.1</math> compared to a smaller learning rate <math>\eta = 0.01</math>. However, large learning rates can sometimes cause overshooting of the optimal solution, so care must be taken when selecting a learning rate.


==== Overview ====
</div>


Dataset augmentation is a technique used to improve the generalization ability of machine learning models by artificially increasing the size of the training dataset. This is particularly useful when the amount of available data is limited. The idea is to create new, synthetic data by applying various transformations to the original dataset.
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


* '''Key Idea:''' The best way to make a machine learning model generalize better is to train it on more data. When the amount of available data is limited, creating synthetic data (e.g., by applying transformations like rotation, translation, and noise addition) and adding it to the training set can be effective.
== Exercise 2.7 ==


* '''Practical Example:''' Operations like translating training images a few pixels in each direction can greatly improve generalization. Another approach is to train neural networks with random noise applied to their inputs, which also serves as a form of dataset augmentation. This technique can be applied not only to the input layer but also to hidden layers, effectively performing dataset augmentation at multiple levels of abstraction.
'''Level:''' * (Easy)


---
'''Exercise Types:''' Copied


=== Noise Injection ===
'''References:''' https://www.uni-weimar.de/fileadmin/user/fak/medien/professuren/Webis/teaching/ws13/ml/exercises-en-neural-networks.pdf


==== Overview ====
This problem comes from Exercise 2 : Perceptron Learning.


Noise injection is a regularization strategy that can be applied in two main ways:
=== Question ===
Given two single perceptrons <math>a</math> and <math>b</math>, each defined by the inequality <math>w_0 + w_1 x_1 + w_2 x_2 \geq 0</math>:


1. '''Adding Noise to the Input:''' This method can be interpreted as a form of dataset augmentation and also has a direct connection to traditional regularization methods.
- Perceptron <math>a</math>: <math>w_0 = 1</math>, <math>w_1 = 2</math>, <math>w_2 = 1</math> 
2. '''Adding Noise to the Weights:''' This method is primarily used in the context of recurrent neural networks and can be viewed as a stochastic implementation of Bayesian inference over the weights.
- Perceptron <math>b</math>: <math>w_0 = 0</math>, <math>w_1 = 2</math>, <math>w_2 = 1</math>


==== Mathematical Proof for Injecting Noise at the Input ====
Is perceptron <math>a</math> more general than perceptron <math>b</math>?


Consider a regression setting where we have an input-output pair \( (x, y) \) and the goal is to minimize the expected loss function:
=== Solution ===
To decide if perceptron <math>a</math> is more general than perceptron <math>b</math>, we compare their respective decision boundaries and positive regions:


<math> J = \mathbb{E}_{x, y} \left[(f(x) - y)^2\right] </math>
- Perceptron <math>a</math>:
The positive region satisfies <math>1 + 2 x_1 + x_2 \ge 0</math>. 
The decision boundary is <math>x_2 = -2 x_1 - 1</math>.


Now, suppose we inject noise into the input \( x \), where the noise \( \epsilon \) is drawn from a distribution with mean zero (e.g., Gaussian noise \( \epsilon \sim \mathcal{N}(0, \sigma^2) \)). The modified objective function with noise-injected inputs becomes:
- Perceptron <math>b</math>:
The positive region satisfies <math>2 x_1 + x_2 \ge 0</math>.
The decision boundary is <math>x_2 = -2 x_1</math>.


<math> J_{\text{noise}} = \mathbb{E}_{x, y, \epsilon} \left[(f(x + \epsilon) - y)^2\right] </math>
A perceptron <math>a</math> is called “more general” than perceptron <math>b</math> if:
1. Every point that <math>b</math> classifies as positive is also classified as positive by <math>a</math>. 
2. There exist points that <math>a</math> classifies as positive which <math>b</math> does not.


To understand the effect of noise injection, we can expand the function \( f(x + \epsilon) \) around \( x \) using a Taylor series:
Observe that for any <math>x_1</math>:
<math>-2 x_1 - 1 \leq -2 x_1</math>.
Hence, the set of points <math>\{(x_1, x_2) : x_2 \ge -2 x_1\}</math> (perceptron <math>b</math>’s positive region) is contained in the set <math>\{(x_1, x_2) : x_2 \ge -2 x_1 - 1\}</math> (perceptron <math>a</math>’s positive region). Therefore:
1. If <math>b</math> classifies a point as positive, <math>a</math> also does. 
2. There are additional points (namely those where <math>-2 x_1 - 1 \le x_2 < -2 x_1</math>) that <math>a</math> classifies as positive but <math>b</math> does not.


<math> f(x + \epsilon) = f(x) + \epsilon^\top \nabla_x f(x) + \frac{1}{2} \epsilon^\top \nabla_x^2 f(x) \epsilon + \mathcal{O}(\|\epsilon\|^3) </math>
Hence, perceptron <math>a</math> is indeed more general than perceptron <math>b</math>.


Since the expectation of the noise \( \epsilon \) is zero:
=== Additional Subquestion ===
For a random sample of points, verify empirically that any point classified as positive by perceptron <math>b</math> is also classified as positive by perceptron <math>a</math>.


<math> \mathbb{E}[\epsilon] = 0 </math>
=== Additional Solution (Sample Code) ===
Below is a short Python snippet that generates random points and checks their classification according to each perceptron. (No visual output is included.)


and assuming that the noise is isotropic with covariance matrix \( \sigma^2 I \), the expectation of the second-order term becomes:
<source lang="python">
import numpy as np


<math> \mathbb{E}[\epsilon \epsilon^\top] = \sigma^2 I </math>
def perceptron_output(x1, x2, w0, w1, w2):
    return (w0 + w1*x1 + w2*x2) >= 0


Substituting the Taylor expansion into the objective function:
# Weights for a and b:
w_a = (1, 2, 1)  # w0=1, w1=2, w2=1
w_b = (0, 2, 1)  # w0=0, w1=2, w2=1


<math> J_{\text{noise}} = \mathbb{E}_{x, y} \left[(f(x) - y)^2\right] + \frac{\sigma^2}{2} \mathbb{E}_{x, y} \left[\|\nabla_x f(x)\|^2\right] + \mathcal{O}(\sigma^4) </math>
n_points = 1000
x1_vals = np.random.uniform(-10, 10, n_points)
x2_vals = np.random.uniform(-10, 10, n_points)


This shows that the objective function with noise injection is equivalent to the original objective function plus a regularization term that penalizes large gradients of the function \( f(x) \). Specifically, the added term <math> \frac{\sigma^2}{2} \mathbb{E}_{x, y} \left[\|\nabla_x f(x)\|^2\right] </math> reduces the sensitivity of the network's output to small variations in its input.
count_b_positive_also_positive_in_a = 0
count_b_positive = 0


'''Key Result:'''
for x1, x2 in zip(x1_vals, x2_vals):
    output_b = perceptron_output(x1, x2, *w_b)
    output_a = perceptron_output(x1, x2, *w_a)
    if output_b:
        count_b_positive += 1
        if output_a:
            count_b_positive_also_positive_in_a += 1


For small noise variance \( \sigma^2 \), the minimization of the loss function with noise-injected input is equivalent to minimizing the original loss function with an additional regularization term that penalizes large gradients:
print("Out of", count_b_positive, "points that B classified as positive,")
print(count_b_positive_also_positive_in_a, "were also positive for A.")
print("Hence, all (or nearly all) B-positive points lie in A's positive region.")
</source>


<math> J_{\text{noise}} \approx J + \frac{\sigma^2}{2} \mathbb{E}_{x, y} \left[\|\nabla_x f(x)\|^2\right] </math>
</div>


This regularization term effectively reduces the sensitivity of the output with respect to small changes in the input \( x \), which is beneficial in avoiding overfitting.
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


'''Connection to Weight Decay:'''
== Exercise 2.10 ==


In linear models, where \( f(x) = w^\top x \), the gradient \( \nabla_x f(x) \) is simply the weight vector \( w \). Therefore, the regularization term becomes:
'''Level:''' * (Easy)


<math> \frac{\sigma^2}{2} \|w\|^2 </math>
'''Exercise Type:''' Novel


which is equivalent to L2 regularization or weight decay.
=== Question ===


=== Manifold Tangent Classifier ===
In a simple linear regression


==== Overview ====
a). Derive the vectorized form of the SSE (loss function) in terms of <math>Y</math>, <math>X</math> and <math>\theta</math>.


The Manifold Tangent Classifier (MTC) is a classification technique that leverages the idea that data often lies on a lower-dimensional manifold within the high-dimensional input space. The key assumption is that examples on the same manifold share the same category, and the classifier should be invariant to local factors of variation that correspond to movements on the manifold.
b). Find the optimal value of <math>\theta</math> that minimizes the SSE (Recall that this is the weights of the linear regression).


* '''Key Idea:''' The classifier should be invariant to variations along the manifold while being sensitive to changes that move the data off the manifold.
=== Solution ===


==== Tangent Propagation Algorithm ====
a).


One approach to achieve invariance to manifold variations is to use the Tangent-Prop algorithm (Simard et al., 1992). The main idea is to add a penalty to the loss function that encourages the neural network's output to be locally invariant to known factors of variation. This is achieved by requiring the gradient of the output with respect to the input to be orthogonal to the known manifold tangent vectors \( v_i \) at each point \( x \).
<math> \begin{align*}
    SSE &= \|Y - \hat{Y}\|^2 \
    &= (Y - \hat{Y})^T (Y - \hat{Y}) \\
    &= Y^TY - Y^TX\theta - (X\theta)^T Y + (X\theta)^T(X\theta) \
    &= Y^TY - 2Y^TX\theta + (X\theta)^T(X\theta) \
\end{align*}
</math>


The regularization term can be expressed as:
b).


<math> \text{Regularizer} = \lambda \sum_{i} \left(\frac{\partial f(x)}{\partial x} \cdot v_i \right)^2 </math>
<math>
\begin{align*}
    0 &= \frac{\partial SSE}{\partial \theta} \\
    0 &= \frac{\partial}{\partial \theta} \Big[ Y^TY - 2Y^TX\theta + (X\theta)^T(X\theta)\Big] \
    0 &= 0 - 2YX^T + 2X^TX\theta \
    2X^TX\theta &= 2YX^T \
    \theta &= (YX^T)(X^TX)^{-1}
\end{align*}
</math>


where:
Note that <math>X^TX\geq 0</math>, so <math>\frac{\partial^2}{\partial \theta^2} SSE = 2 X^TX\geq 0.</math>
* \( \frac{\partial f(x)}{\partial x} \) is the gradient of the neural network output with respect to the input,
Hence, the stationary point derived above yields a local minimum.
* \( v_i \) are the known tangent vectors of the manifold,
* \( \lambda \) is the regularization strength.


This regularization ensures that the directional derivative of \( f(x) \) in the directions \( v_i \) is small, promoting invariance along the manifold.
</div>


==== Manifold Tangent Classifier (MTC) ====
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


A more recent approach, introduced by Rifai et al. (2011), eliminates the need to know the tangent vectors a priori. The Manifold Tangent Classifier automatically learns these tangent vectors during training, making it more flexible and applicable to a wider range of problems.
== Exercise 2.11 ==


---
<b>Level:</b> **(Moderate)


=== Early Stopping as a Form of Regularization ===
<b>Exercise Types:</b> Novel


==== Overview ====
=== Question ===


Early stopping is one of the most commonly used forms of regularization in deep learning. Instead of running the optimization algorithm until it reaches a local minimum of the training error, early stopping involves monitoring the validation error during training and halting the process when the validation error stops improving.
Deep learning models often face challenges during training due to the vanishing gradient problem, especially when using sigmoid or tanh activation functions.


* '''Key Idea:''' During training, whenever the error on the validation set improves, a copy of the model parameters is stored. The training is stopped when the validation error has not improved for a predetermined amount of time, and the best model parameters (those that resulted in the lowest validation error) are returned.
(a) Describe the vanishing gradient problem and its impact on the training of deep networks.


==== Mathematical Formulation ====
(b) Explain how the introduction of ReLU (Rectified Linear Unit) activation function mitigates this problem.


Assume that \( w \) represents the model weights (ignoring bias parameters). We take a quadratic approximation to the objective function \( J(w) \) around the empirically optimal value of the weights \( w^* \):
(c) Discuss one potential downside of using ReLU and propose an alternative activation function that addresses this limitation.


<math> J(w) \approx J(w^*) + \frac{1}{2} (w - w^*)^\top H (w - w^*) </math>
=== Solution ===


where:
(a) Vanishing Gradient Problem:
* \( H \) is the Hessian matrix of second derivatives.
The vanishing gradient problem occurs when the gradients of the loss function become extremely small as they are propagated back through the layers of a deep network. This leads to:


The gradient of the objective function is:
(i)Slow or stagnant weight updates in early layers;


<math> \nabla_w J(w) = H(w - w^*) </math>
(ii)Difficulty in effectively training deep models. This issue is particularly pronounced with activation functions like sigmoid and tanh, where gradients approach zero as inputs saturate.


During training, the parameter vector is updated according to:
(b) Role of ReLU in Mitigation:
ReLU, defined as <math>f(x) = \max(0, x)</math>, mitigates the vanishing gradient problem by:


<math> w^{(t+1)} = w^{(t)} - \eta \nabla_w J(w^{(t)}) </math>
(i)Producing non-zero gradients for positive inputs, maintaining effective weight updates;


Substituting the expression for the gradient:
(ii)Introducing sparsity, as neurons deactivate (output zero) for negative inputs, which improves model efficiency.


<math> w^{(t+1)} - w^* = (I - \eta H) (w^{(t)} - w^*) </math>
(c) Downside of ReLU and Alternatives:
One downside of ReLU is the "dying ReLU" problem, where neurons output zero for all inputs, effectively becoming inactive. This can happen when weights are poorly initialized or during training. In other words, the weighted sum of inputs falls below zero, and the gradient of the ReLU function becomes zero. High learning rate may push neurons into this inactive states.


where \( \eta \) is the learning rate. If we assume that the initial weights are zero (i.e., \( w^{(0)} = 0 \)), we can express the weight update after \( t \) iterations as:
Alternative: Leaky ReLU allows a small gradient for negative inputs, defined as <math>f(x) = x</math> for <math>x > 0</math> and <math>f(x) = \alpha x</math> for <math>x \leq 0</math>, where <math>\alpha</math> is a small positive constant. This prevents neurons from dying, ensuring all neurons contribute to learning.


<math> w^{(t)} - w^* = (I - \eta H)^t (w^{(0)} - w^*) </math>
</div>


If we perform an eigenvalue decomposition of \( H \), we get:
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


<math> H = Q \Lambda Q^\top </math>
== Exercise 2.12 ==


where \( Q \) is the orthogonal matrix of eigenvectors, and \( \Lambda \) is the diagonal matrix of eigenvalues. The weight update can then be rewritten as:
'''Level:''' * (Easy)


<math> w^{(t)} - w^* = Q (I - \eta \Lambda)^t Q^\top (w^{(0)} - w^*) </math>
'''Exercise Type:''' Novel


Assuming \( w^{(0)} = 0 \) and that \( |1 - \eta \lambda_i| < 1 \) for all eigenvalues \( \lambda_i \), after \( t \) training updates, we have:
=== Question ===
Consider the following data:


<math> Q^\top w^{(t)} \approx [I - (1 - \eta \Lambda)^t] Q^\top w^* </math>
<math>x = \begin{bmatrix} 1 \ 1 \ 2 \ 2 \ 3 \ 3 \end{bmatrix}, \quad y = \begin{bmatrix} 1 \ 2 \ 2 \ 3 \ 2 \\ 3 \end{bmatrix}</math>


Taking the logarithm and using the series expansion for \( \log(1 + x) \), it can be shown that the number of training iterations \( t \) plays a role inversely proportional to the L2 regularization parameter \( \lambda \), and the inverse of \( t \) plays the role of the weight decay coefficient.
This data is fitted by a linear regression model with no bias term. What is the loss for the first four data points? 
Use the L2 loss defined as: 


'''Key Insight:'''
<math>L = \frac{1}{2}(y - \hat{y})^2</math>. 


This result shows that early stopping can be interpreted as a form of implicit regularization, where the number of training iterations controls the effective complexity of the model.
=== Solution ===
The correct losses for the first four data points are <b>0</b>, <b>0.5</b>, <b>0</b>, and <b>0.5</b>.


=== Early Stopping as a Form of Regularization ===
=== Calculation ===
Step 1: Fit the linear regression model.  <br>
Since there is no bias term, the model is <math>\hat{y} = \beta x</math>, where <math>\beta = \frac{\sum x_i y_i}{\sum x_i^2}</math>. 


==== Overview ====
Compute <math>\beta</math>: 
<math>\beta = \frac{1 \cdot 1 + 1 \cdot 2 + 2 \cdot 2 + 2 \cdot 3 + 3 \cdot 2 + 3 \cdot 3}{1^2 + 1^2 + 2^2 + 2^2 + 3^2 + 3^2} = \frac{28}{28} = 1.</math> 


Early stopping is one of the most commonly used forms of regularization in deep learning. Instead of running the optimization algorithm until it reaches a local minimum of the training error, early stopping involves monitoring the validation error during training and halting the process when the validation error stops improving.
Step 2: Calculate <math>\hat{y}</math> for each <math>x</math>. <br>
For the first four data points:  <br>
<math>\hat{y}_1 = 1 \cdot 1 = 1</math>  <br>
<math>\hat{y}_2 = 1 \cdot 1 = 1</math>  <br>
<math>\hat{y}_3 = 1 \cdot 2 = 2</math>  <br>
<math>\hat{y}_4 = 1 \cdot 2 = 2</math> 


* '''Key Idea:''' During training, whenever the error on the validation set improves, a copy of the model parameters is stored. The training is stopped when the validation error has not improved for a predetermined amount of time, and the best model parameters (those that resulted in the lowest validation error) are returned.
Step 3: Compute the L2 loss for each point.  <br>
- For <math>(x_1, y_1)</math>: <math>L_1 = \frac{1}{2}(1 - 1)^2 = 0</math>.  <br>
- For <math>(x_2, y_2)</math>: <math>L_2 = \frac{1}{2}(2 - 1)^2 = 0.5</math>.  <br>
- For <math>(x_3, y_3)</math>: <math>L_3 = \frac{1}{2}(2 - 2)^2 = 0</math>. <br>
- For <math>(x_4, y_4)</math>: <math>L_4 = \frac{1}{2}(3 - 2)^2 = 0.5</math>.  


==== Mathematical Formulation ====
Thus, the losses are: <b>0, 0.5, 0, 0.5</b>.
</div>


Assume that \( w \) represents the model weights (ignoring bias parameters). We take a quadratic approximation to the objective function \( J(w) \) around the empirically optimal value of the weights \( w^* \):


<math> J(w) \approx J(w^*) + \frac{1}{2} (w - w^*)^\top H (w - w^*) </math>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


where:
== Exercise 2.13 ==
\( H \) is the Hessian matrix of second derivatives.
'''Level:''' ** (Moderate)


The gradient of the objective function is:
'''Exercise Types:''' Novel


<math> \nabla_w J(w) = H(w - w^*) </math>
<b>References:</b> A. Ghodsi, STAT 940 Deep Learning: Lecture 2, University of Waterloo, Winter 2025.


During training, the parameter vector is updated according to:
=== Question ===
In Lecture 2, we derived a formula for a simple perceptron to determine a hyperplane which splits a set of linearly independant data.


<math> w^{(t+1)} = w^{(t)} - \eta \nabla_w J(w^{(t)}) </math>
In class, we defined the error as


Substituting the expression for the gradient:
<math>
err = \sum_{i \in M} -y_i(\beta^Tx_i+\beta_0)
</math>


<math> w^{(t+1)} - w^* = (I - \eta H) (w^{(t)} - w^*) </math>
Where <math>M</math> is the set of points which have been misclassified


where \( \eta \) is the learning rate. If we assume that the initial weights are zero (i.e., \( w^{(0)} = 0 \)), we can express the weight update after \( t \) iterations as:
The function for the simple perceptron was defined as  


<math> w^{(t)} - w^* = (I - \eta H)^t (w^{(0)} - w^*) </math>
<math>
y_i = \beta^Tx + \beta_0
</math>


If we perform an eigenvalue decomposition of \( H \), we get:
Where a point belongs to Set 1 if it is above the line, and Set 2 if it is below the line.


<math> H = Q \Lambda Q^\top </math>
In lecture 2, we found the partial derivatives as


where \( Q \) is the orthogonal matrix of eigenvectors, and \( \Lambda \) is the diagonal matrix of eigenvalues. The weight update can then be rewritten as:
<math>
\frac{\partial err}{\partial f} = \sum_{i \in M}-y_i(\beta^Tx_i+\beta_i)
</math>


<math> w^{(t)} - w^* = Q (I - \eta \Lambda)^t Q^\top (w^{(0)} - w^*) </math>
and


Assuming \( w^{(0)} = 0 \) and that \( |1 - \eta \lambda_i| < 1 \) for all eigenvalues \( \lambda_i \), after \( t \) training updates, we have:
<math>
\frac{\partial err}{\partial \beta} = \sum_{i \in M}-y_i
</math>


<math> Q^\top w^{(t)} \approx [I - (1 - \eta \Lambda)^t] Q^\top w^* </math>
And defined the formula for gradient descent as


Taking the logarithm and using the series expansion for \( \log(1 + x) \), it can be shown that the number of training iterations \( t \) plays a role inversely proportional to the L2 regularization parameter \( \lambda \), and the inverse of \( t \) plays the role of the weight decay coefficient.
<math>
\begin{bmatrix}
\beta \
\beta_0
\end{bmatrix} =
\begin{bmatrix}
\beta \
\beta_0
\end{bmatrix} + \eta
\begin{bmatrix}
\sum_{i \in M} y_ix_i \
\sum_{i \in M} y_i
\end{bmatrix}
</math>


'''Key Insight:'''
Generate a random set of points and a line in 2D using python, and sort the set of points into 2 sets above and below the line.  Then use gradient descent and the formulas above to find a hyperplane which also sorts the set with no prior knowledge of the line used for sorting.


This result shows that early stopping can be interpreted as a form of implicit regularization, where the number of training iterations controls the effective complexity of the model.
=== Solution ===


The code below is a sample of implementing the 2D gradient descent algorithm derived in Lecture 2 to a random dataset


== Label Smoothing ==
<pre>
import numpy as np
import matplotlib.pyplot as plt
import functools


Label smoothing is a technique to prevent a model from becoming over-confident on a specific class by not forcing the model to fit the data exactly. This approach provides more flexibility and generalization abilities.
#Generate a random array of points
random_array = np.random.random((40,2))


Suppose the predicted output is <math>y = [0, 1, 0]</math>, then after applying label smoothing, it becomes <math>y = [0.033, 0.933, 0.033]</math>.
#Linearlly seperate the points by a random hyperplane (in this case, a 2D line)
#y = ax + b
a = np.random.random()
b = np.random.random()*0.25


The formula for label smoothing is:
#Create the ground truth, classify points into Set 1 or Set 2
set_1_indicies = random_array[:,1] >= (a*random_array[:,0] + b) #Boolean indicies where y is greater to or equal to the line y = ax + b
set_2_indicies = random_array[:,1] < (a*random_array[:,0] + b)


<math> y_{\text{smooth}} = (1 - a) \cdot y + \frac{a}{k} </math>
#Get the (x,y) coordinates of set 1 and set 2 by selecting the indicies of the random array which are either above or below the hyperplane
set_1= random_array[set_1_indicies]
set_2= random_array[set_2_indicies]


where:
* <math>a</math> is the smoothing factor,
* <math>y</math> is the original label,
* <math>k</math> is the number of classes.


The reason for using label smoothing:
plt.figure(1,figsize=(6,6))
* '''Prevents overfitting''': By preventing the model from becoming too confident in its predictions, label smoothing reduces the likelihood of overfitting.
plt.scatter(set_1[:,0],set_1[:,1],c='r')
* '''Improves generalization''': Label smoothing can help the model generalize better to unseen data, as it discourages overconfidence in training.
plt.scatter(set_2[:,0],set_2[:,1],c='b')
plt.xlabel('x')
plt.ylabel('y')
x = np.linspace(0,1,2)
y = x*a + b
plt.plot(x,y,'g')
plt.legend(['Set 1','Set 2','Initial Hyperplane Used to Split Sets'])
plt.title("Generated Dataset")
plt.show()


== Bagging/Ensemble ==
#Now use a simple perceptron and the algorithm developed in class during lecture 2 to have an agent with no prior knowledge of the hyperplane determine what it is, or find a hyperplane that can seperate the two sets.


Bagging (short for bootstrap aggregating) is a machine learning  ensemble technique for reducing generalization error by combining several models (Breiman, 1994)
#Randomly initialize beta and beta_0


Explanation: Aggregating is to ombine the predictions of each model, often using voting (for classification) or averaging (for regression).
beta = np.random.random()


It works by training several different models separately, and then have all of the models vote on the output for test examples. For example, random forest, which is a popular bagging algorithm that builds multiple decision trees on different bootstrap samples of the data and aggregates their predictions.  
beta_0 = np.random.random()*0.25


The reason why bagging works:
def update_weights(beta,beta_0,random_array,set_1_indicies,set_2_indicies,learning_rate):
* '''Variance reduction''': By training multiple models on different data subsets, bagging reduces the variance of the predictions. This means that it helps models generalize better to new, unseen data.
    #Find perceptron set 1 and set 2
* '''Handling overfitting''': Bagging is particularly useful for high-variance models (e.g., decision trees) as it helps reduce overfitting.
    perceptron_set_1_indicies = random_array[:,1] >= (beta*random_array[:,0] + beta_0)
    perceptron_set_2_indicies = random_array[:,1] < (beta*random_array[:,0] + beta_0)
   
    #Find set M, the misclassified points
    #A point x,y classified by the agent as class 1 is misclassified if it is actually in set 2 or if it is classified as class 2 and is actually in set 1
    M_indicies= np.logical_or(np.logical_and(perceptron_set_1_indicies,set_2_indicies),np.logical_and(perceptron_set_2_indicies,set_1_indicies))
   
    #Get an array of the x,y coordinates of the misclassified points
    M=random_array[M_indicies]
   
    #Define variables for the sums on the right side of the gradient descent linear equation
    sum_yixi = 0
    sum_yi = 0
   
    #Compute the sums needed to do gradient descent
    for i in range(0,len(M)):
        sum_yixi = sum_yixi + M[i,0]*M[i,1]
        sum_yi = sum_yi + M[i,1]
   
    #Update beta and beta_0
    beta = beta + learning_rate*sum_yixi
    beta_0 = beta_0 + learning_rate*sum_yi
   
    return beta,beta_0




While bagging is highly useful for traditional machine learning models, it is less commonly used in deep learning because modern neural networks are already highly expressive. Instead, other ensemble methods, such as model ensembling or dropout, are used.
#Run for 1000 epochs


Code Sample:
for i in range(0,1000):
    beta,beta_0 = update_weights(beta,beta_0,random_array,set_1_indicies,set_2_indicies,0.01)
   


from sklearn.ensemble import RandomForestClassifier
plt.figure(1,figsize=(6,6))
plt.scatter(set_1[:,0],set_1[:,1],c='r')
plt.scatter(set_2[:,0],set_2[:,1],c='b')
plt.xlabel('x')
plt.ylabel('y')
x = np.linspace(0,1,2)
y = beta*x + beta_0
plt.plot(x,y,c='g')
plt.legend(['Set 1','Set 2','Gradient Descent Hyperplane'])
plt.title("Gradient Descent Generated Hyperplane")
plt.show()


from sklearn.datasets import load_iris
</pre>


from sklearn.model_selection import train_test_split
The figure below shows a sample of the randomly generated linearly separated sets, and the lines used to separate the sets.


- Load a dataset (Iris dataset for example)
[[Image:213a.png|thumb|300px|center|Randomy generated sets of data linearly separated]]
data = load_iris()


X_train, X_test, y_train, y_test = train_test_split(data.data, data.target, test_size=0.3, random_state=42)
The figure below shows the predicted hyperplane found using gradient descent


- Train a random forest classifier (bagging technique)
[[Image:213b.png|thumb|300px|center|Hyperplane found through gradient descent algorithm derived in STAT 240 lecture 2]]
</div>


rf_model = RandomForestClassifier(n_estimators=100, random_state=42)
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
== Exercise 2.14 ==
<p><strong>Level:</strong> *(Easy)</p>
<p><strong>Exercise Types:</strong> Novel</p>
<h4>Question</h4>
<p>Consider a simple neural network model with a single hidden layer to classify input data into two categories based on their features. Address the following points:</p>
<ol>
<li>Describe the process of input data transformation through a single hidden layer.</li>
<li>Identify the role of activation functions in neural networks.</li>
<li>Explain the importance of the learning rate in the neural network training process.</li>
</ol>
<h4>Solution</h4>
<ol>
<li><strong>Input Processing:</strong>
<p>The network receives input features and feeds them through a hidden layer, where each input is subject to a weighted sum, addition of a bias, and application of an activation function. This series of operations transforms the input data into a representation that captures complex relationships within the data.</p>
<p>Mathematically, the output <math>h</math> of the hidden layer for an input vector <math>x</math> is given by: <math>h = f(W^{(1)}x + b^{(1)})</math>, where <math>W^{(1)}</math> represents the weights, <math>b^{(1)}</math> the biases, and <math>f</math> the activation function.</p>
</li>
<li><strong>Role of Activation Functions:</strong>
<p>Activation functions such as sigmoid, ReLU, or tanh introduce necessary non-linearities into the model, enabling it to learn more complex patterns and relationships in the data. These functions are applied to each neuron's output and help regulate the neural network's overall output, ensuring predictability and differentiation between different types of outputs.</p>
</li>
<li><strong>Importance of Learning Rate:</strong>
<p>The learning rate <math>η</math> is a critical parameter that determines the extent to which the weights in the network are updated during training. An optimal learning rate ensures efficient convergence to a minimum, whereas an excessively high rate can lead to overshooting and an excessively low rate to slow convergence or getting stuck in local minima.</p>
</li>
</ol>


rf_model.fit(X_train, y_train)
</div>


- Make predictions


y_pred = rf_model.predict(X_test)


- Evaluate the model


accuracy = rf_model.score(X_test, y_test)
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


== Dropout ==
== Exercise 2.15 ==


=== Overview ===
<b>Level:</b> ** (Moderate)
Dropout is one of the techniques for preventing overfitting in deepneural network which contains a large number of parameters.


The key idea is to randomly drop units from the neural networkduring training.
<b>Exercise Types:</b> Novel
* During training, dropout samples from number of different “thinned” network.
* At test time, we approximate the effect of averaging the predictions of all these thinned networks


=== Model ===
=== Question ===


Consider a neural network with <math>L</math> hidden layers:
    <p>
* Let <math>z^{(l)}</math> denote the vector inputs into layer <math>l</math>.
        Consider a simple feedforward neural network with one input layer, one hidden layer, and one output layer.
* Let <math>y^{(l)}</math> denote the vector of outputs from layer <math>l</math>.
        The network structure is as follows:
* Let <math>W^{(l)}</math> and <math>b^{(l)}</math> represent the weights and biases at layer <math>l</math>.
    </p>
    <ul>
        <li><strong>Input layer:</strong> 2 neurons (features <math>x_1</math> and <math>x_2</math>).</li>
        <li><strong>Hidden layer:</strong> 3 neurons with ReLU activation (<math>(a = \max(0, z))</math>).</li>
        <li><strong>Output layer:</strong> 1 neuron with no activation (linear output).</li>
    </ul>


With dropout, the feed-forward operation becomes:
    <p>The weights (<math>W</math>) and biases (<math>b</math>) for the layers are:</p>


<math> r^{(l)} \sim \text{Bernoulli}(p) </math>
    <p><strong>Hidden layer:</strong></p>


<math> y^{(l)} = r^{(l)} \odot y^{(l)} </math>
<math>
W_{\text{hidden}} =  
        \begin{bmatrix}  
        0.5 & -0.2 \
        0.8 & 0.3 \
        -0.5 & 0.7
        \end{bmatrix}, \quad
        b_{\text{hidden}} =
        \begin{bmatrix}
        0.1 \
        -0.4 \
        0.2
        \end{bmatrix}
</math>


where <math>\odot</math> denotes element-wise multiplication.
    <p><strong>Output layer:</strong></p>
<math>
W_{\text{hidden}} =
       
        W_{\text{output}} =
        \begin{bmatrix}
        0.6 & -0.1 & 0.3
        \end{bmatrix}, \quad
        b_{\text{output}} = 0.5
       
</math>


The feed-forward equation for layer <math>l+1</math> becomes:


<math> z^{(l+1)} = W^{(l+1)} y^{(l)} + b^{(l+1)} </math>


<math> y^{(l+1)} = f(z^{(l+1)}) </math>
    <p>For input values <math>x_1 = 1.5</math> and <math>x_2 = -0.5</math>:</p>
    <ol>
        <li>Calculate the output of the hidden layer (<math>a_{\text{hidden}}</math>).</li>
        <li>Calculate the final output of the network (<math>y_{\text{output}}</math>).</li>
    </ol>


where <math>f</math> is the activation function.
=== Solution ===


For any layer <math>l</math>, <math>r^{(l)}</math> is a vector of independent Bernoulli random variables, each of which has a probability <math>p</math> of being 1. The vector <math>y^{(l)}</math> is the input after some hidden units are dropped. The rest of the model remains the same as a regular feed-forward neural network.
<p>Step 1: Calculate
<math>


=== Training ===
z_{\text{hidden}} = W_{\text{hidden}} \cdot \mathbf{x} + b_{\text{hidden}}
Dropout neural network can be trained using stochastic gradient descent.
       
The only difference here is that we only back propagate on eachthinned network.
</math></p>
The gradient for each parameter are averaged over the training cases in each mini-batch.


=== Test Time ===
The input vector is:
Use a single neural net without dropout
<math>
If a unit is retained with probability p during training, the outgoing weights of that unit are multiplied by p at test time. <math>p \cdot w</math>


== Additional Regularization ==
\mathbf{x} = [x1x2] = [1.50.5]


=== L1 norm ===
       
L1 norm regularization, also known as Lasso, is a technique that adds a penalty equal to the absolute value of the magnitude of coefficients to the loss function. This encourages sparsity in the learned weights, meaning it forces some of the weights to become exactly zero, effectively selecting important features and reducing model complexity.
</math>


=== Mixup ===
<math>
Mixup is a data augmentation technique that creates new training examples by taking convex combinations of pairs of input data and their labels. By blending images and labels together, the model learns smoother decision boundaries and becomes more robust to adversarial examples and noise.


=== Cutout ===
z_{\text{hidden}} = [0.50.20.80.30.50.7] \cdot [1.50.5] + \begin{bmatrix} 0.1 \ -0.4 \ 0.2 \end{bmatrix}
Cutout is a form of data augmentation where random square regions are masked out (set to zero) in input images during training. This forces the model to focus on a broader range of features across the image rather than relying on any single part, leading to better generalization and robustness.


=== Gradient Clipping ===
</math>
Gradient clipping is a technique used to prevent the gradients from becoming too large during training, which can cause the model to diverge. This is done by capping the gradients at a predefined threshold, ensuring that updates remain stable, especially in models like recurrent neural networks (RNNs) where exploding gradients are a common issue.


=== DropConnect ===
DropConnect is a variation of Dropout, but instead of dropping neurons, it randomly drops connections (weights) between neurons during training. This prevents the co-adaptation of neurons while allowing individual neurons to contribute to learning.


=== Data Augmentation (beyond Mixup and Cutout) ===
<math>
* '''Random Flips and Rotations''': Randomly flipping (either vertical or horizontal) or rotating images during training to make the model invariant to certain transformations.
* '''Color Jittering''': Modifying the brightness, contrast, saturation, and hue of images to make the model more robust to variations in color.
* '''Random Cropping and Scaling''': Randomly cropping and scaling images to force the model to learn from different perspectives and contexts within the data.


For PyTorch augmentation, one can refer https://pytorch.org/vision/stable/transforms.html


== Generalization Paradox ==
z_{\text{hidden}} = \begin{bmatrix} (0.5 \cdot 1.5) + (-0.2 \cdot -0.5) \ (0.8 \cdot 1.5) + (0.3 \cdot -0.5) \ (-0.5 \cdot 1.5) + (0.7 \cdot -0.5) \end{bmatrix} + [0.10.40.2]
* Models with many parameters tend to overfit
</math>
* However, deep neural network, despite using many parameters, works well with unseen data (look up the Double Descent Curve), the reason remains unknown


This phenomenon is illustrated by the '''Double Descent Curve''', where after reaching a peak in test error (due to overfitting), the error decreases again with further model complexity. The precise reasons remain uncertain, but hypotheses include implicit regularization from optimization methods like SGD, hierarchical feature learning, and the redundancy offered by overparameterization.
<math>
z_{\text{hidden}} = \begin{bmatrix} 0.75 + 0.1 \ 1.2 - 0.15 \ -0.75 - 0.35 \end{bmatrix} + [0.10.40.2] = [0.850.650.9]


== Batch Normalization ==
</math>


=== Overview ===
<p>Step 2: Apply ReLU activation</p>
Batch normalization is a technique used to improve the training process of deep neural networks by normalizing the inputs of each layer. Despite the initial intuition for the method being somewhat incorrect, it has proven to be highly effective in practice. Batch normalization speeds up convergence, allows for larger learning rates, and makes the model less sensitive to initialization, resulting in more stable and efficient training.


Batch normalization motivated by internal covariate shift (2015 lofee & Szegedy)
The ReLU activation is defined as:


=== Internal Covariance Shift ===
<math>
Batch normalization was originally proposed as a solution to the internal covariance shift problem, where the distribution of inputs to each layer changes during training. This shift complicates training because the model must constantly adapt to new input distributions.
a_{\text{hidden}} = \max(0, z_{\text{hidden}})
</math>


The transformation of layers can be described as:


<math> l = F_2(F_1(u, \theta_1), \theta_2) </math>
<math>
a_{\text{hidden}} = \begin{bmatrix} \max(0, 0.85) \ \max(0, 0.65) \ \max(0, -0.9) \end{bmatrix} = [0.850.650]
</math>


For a mini-batch of activations <math>X = \{x_1, x_2, \dots, x_m\}</math> from a specific layer, batch normalization proceeds as follows:


1. '''Compute the mean''': <math> \mu_B = \frac{1}{m} \sum_{i=1}^{m} x_i </math>
<p>Step 3: Calculate <math>z_{\text{output}} = W_{\text{output}} \cdot a_{\text{hidden}} + b_{\text{output}}</math></p>


2. '''Compute the variance''': <math> \sigma_B^2 = \frac{1}{m} \sum_{i=1}^{m} (x_i - \mu_B)^2 </math>
<math>
z_{\text{output}} = \begin{bmatrix} 0.6 & -0.1 & 0.3 \end{bmatrix} \cdot \begin{bmatrix} 0.85 \ 0.65 \ 0 \end{bmatrix} + 0.5
</math>


3. '''Normalize the activations''': <math> \hat{x}_i = \frac{x_i - \mu_B}{\sqrt{\sigma_B^2 + \epsilon}} </math>
<math>
z_{\text{output}} = (0.6 \cdot 0.85) + (-0.1 \cdot 0.65) + (0.3 \cdot 0) + 0.5
</math>


4. '''Scale and shift''' the normalized activations using learned parameters <math>\gamma</math> (scale) and <math>\beta</math> (shift): <math> y_i = \gamma \hat{x}_i + \beta </math>
<math>
z_{\text{output}} = 0.51 - 0.065 + 0 + 0.5 = 0.945
</math>


where:
<p>Step 4: Final Output</p>
* <math>x_i</math> represents the activations in the mini-batch,
* <math>\mu_B</math> is the mean of the mini-batch,
* <math>\sigma_B^2</math> is the variance of the mini-batch,
* <math>\epsilon</math> is a small constant added for numerical stability,
* <math>\hat{x}_i</math> is the normalized activation,
* <math>\gamma</math> and <math>\beta</math> are learned parameters for scaling and shifting.


The batch normalization improves validation accuracy by removing the dropout and enables higher learning rate
The final output of the network is:
<math>
y_{\text{output}} = z_{\text{output}} = 0.945
</math>


=== Batch Normalization ===


As mentioned earlier, the original intuition behind batch normalization was found to be incorrect after further research. A paper by Santurkar, S., Tsipras, D., Ilyas, A., & Madry, A. (NeurIPS 2019) contradicted the original 2015 paper on BatchNorm by highlighting the following points:


* Batch normalization does not fix covariate shift.
</div> <div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
* If we fix covariate shift, it doesn't help.
* lf we intentionally increase lCS, it doesn't harm.
* Batch Norm is not the only possible normalization. There are alternatives.


Instead, they argue that Batch normalization works better due to other factors, particularly related to its effect on the optimization process:
== Exercise 2.16 ==
'''Level:''' * (Easy)


1. '''Reparameterization of the loss function:'''
'''Exercise Types:''' Novel
* Improved Lipschitzness: Batch normalization improves the Lipschitz continuity of the loss function, meaning that the loss changes at a smaller rate, and the magnitudes of the gradients are smaller. This makes the gradients of the loss more "Lipschitz."
* Better β-smoothness: The loss exhibits significantly better smoothness, which aids in optimization by preventing large, erratic changes in the gradient.


2. '''Variation of the loss function''': BatchNorm reduces the variability of the value of the loss. Consider the variation of the loss function:  
=== Question ===
<math> \mathcal{L}(x + \eta \nabla \mathcal{L}(x)) </math> where <math> \eta \in [0.05, 0.4] </math>.
Consider the following binary classification task, where the goal is to classify points into two categories: +1 or -1.
A smaller variability of the loss indicates that the steps taken during training are less likely to cause the loss to increase uncontrollably.


3. '''Gradient predictiveness''': BatchNorm enhances the predictiveness of the gradients, meaning the changes in the loss gradient are more stable and predictable. This can be expressed as:  
Training Data:  
<math> || \nabla \mathcal{L}(x) - \nabla \mathcal{L}(x + \eta \nabla \mathcal{L}(x)) || </math>, where <math> \eta \in [0.05, 0.4] </math>.
\begin{array}{|c|c|c|}
A good gradient predictiveness implies that the gradient evaluated at a given point remains relevant over longer distances, which allows for larger step sizes during training.
\hline
x_1 & x_2 & y \
\hline
2  & 3  & 1 \
1  & 2  & 1 \
3  & 1  & -1 \\
4  & 5  & -1 \
\hline
\end{array}
Where <math>x_1</math> and <math>x_2</math> are the input features, <math>y</math> is the target label (+1 or -1).
 
Task: Train a perceptron model using gradient descent, and update the weights using the perceptron update rule using the first data point(2,3,1). Initialize the weights as <math>\beta_0 = 0</math>, <math>\beta_1 = 0</math>, and <math>\beta_2 = 0</math>. Choose a learning rate of <math>\eta = 0.1</math>.


=== Alternatives to Batch Norm ===
=== Solution ===


'''Weight Normalization''': Weight normalization is a technique where the weights, instead of the activations, are normalized. This method reparameterizes the weight vectors to accelerate the training of deep neural networks.
==== Step 1: Compute the Prediction ====


Tim Salimans and Diederik P. Kingma, "Weight Normalization: A Simple Reparameterization to Accelerate Training of Deep Neural Networks," 2016.
The perceptron model predicts the label using the following equation:


'''ELU (Exponential Linear Unit) and SELU (Scaled Exponential Linear Unit)''': ELU and SELU are two proposed activation functions that have a decaying slope instead of a sharp saturation. They can be used as alternatives to BatchNorm by providing smoother, non-linear activation without requiring explicit normalization.
<math> \hat{y} = \text{sign}(\beta_0 + \beta_1 x_1 + \beta_2 x_2) </math>


Djork-Arné Clevert, Thomas Unterthiner, and Sepp Hochreiter, "Fast and Accurate Deep Network Learning by Exponential Linear Units (ELUs)," In International Conference on Learning Representations (ICLR), 2016.
Substituting the initial weights and the input values:
Günter Klambauer, Thomas Unterthiner, Andreas Mayr, and Sepp Hochreiter, "Self-Normalizing Neural Networks," ICLR, 2017.


== Convolutional Neural Network (CNN) ==
<math> \hat{y} = \text{sign}(0 + 0 \cdot 2 + 0 \cdot 3) = \text{sign}(0) = 0 </math>
=== Introduction ===
Convolutional networks are simply neural networks that use convolution instead of general matrix multiplication in at least one of their layers. CNN is mainly used for image processing.


=== Convolution ===
Since the predicted label <math>\hat{y} = 0</math> is not equal to the true label <math>y = 1</math>, we need to update the weights.
In ML, convolution means dot product


<math> h = \sigma(\langle x, w\rangle+b)</math>
==== Step 2: Update the Weights ====
* Same x, different w -- multi-layer perception (MLP)
* Different x, same w --  CNN (weight sharing)


From class, the following operation is called convolution
<math> \beta_0 = \beta_0 + \eta \cdot y = 0 + 0.1 \cdot 1 = 0.1 </math>


<math> s(t) = \int x(a)w(t-a)ds </math>
<math>\beta_1 = \beta_1 + \eta \cdot y \cdot x_1 = 0 + 0.1 \cdot 1 \cdot 2 = 0.2 </math>


The convolution operation is typically denoted with an asterisk:
<math>\beta_2 = \beta_2 + \eta \cdot y \cdot x_2 = 0 + 0.1 \cdot 1 \cdot 3 = 0.3 </math>


<math> s(t) = (x \ast w)(t) </math>
</div>


=== Discrete Convolution ===
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
If we now assume that x and w are defined only on integer t, we can define the discrete convolution:


<math>
== Exercise 2.17 ==
s[t] = (x \ast w)(t) = \sum_{a=-\infty}^{\infty} x[a] \, w[t-a]
'''Level:''' * (Easy)
</math>


<math>w[t-a]</math> represents the sequence <math>w[t]</math> shifted by <math>a</math> units.
'''Exercise Types:''' Novel


=== In practice ===
=== Question ===  
We often use convolutions over more than one axis at a time.
Consider a binary classification problem where a perceptron is used to separate two linearly separable classes in <math>\mathbb{R}^2</math>. The perceptron updates its weight vector w using the following update rule: 


<math>
<math>
s[i,j] = (I * K)[i,j] = \sum_m \sum_n I[m,n] K[i-m, j-n]
w^{(t+1)} = w^{(t)} + \eta y^{(t)} x^{(t)}
</math>
</math> 
 
where: 
* <math>w^{(t)}</math> is the weight vector at iteration <math>t</math>,
* <math>x^{(t)} \in \mathbb{R}^2</math> is the feature vector of the misclassified sample at iteration <math>t</math>, 
* <math>y^{(t)} \in \{+1, -1\}</math> is the corresponding label,
* <math>\eta > 0</math> is the learning rate. 


* '''Input''': usually a multidimensional array of data.
Prove that if the data is **linearly separable**, the perceptron algorithm **converges in a finite number of steps


* '''Kernel''': usually a multidimensional array of parameters that should be learned.
=== Solution === 
Define the angle between <math>w</math> and the optimal weight vector <math>w^*</math>, which perfectly separates the data. The perceptron algorithm updates the weight vector in the direction of each misclassified sample, gradually aligning it with <math>w^*</math>.


We assume that these functions are zero everywhere but the finite set of points for which we store the values.
By repeatedly applying the update rule and using the Cauchy-Schwarz inequality, we can show that: 


We can implement the infinite summation as a summation over a finite number of array elements.
<math>
w^{(t)} \cdot w^* \geq t \gamma R
</math> 


=== Convolution and Cross-Correlation ===
which grows linearly with <math>t</math>. Meanwhile, the norm of <math>w^{(t)}</math> is bounded as:
Convolution is commutative:


<math>
<math>
s[i,j] = (I * K)[i,j] = \sum_m \sum_n I[i-m, j-n] K[m, n]
\|w^{(t)}\|^2 \leq t R^2
</math>
</math>


Cross-correlation:
Combining these inequalities leads to the bound on the number of updates:


<math>
<math>
s[i,j] = (I * K)[i,j] = \sum_m \sum_n I[i+m, j+n] K[m, n]
T \leq \frac{R^2}{\gamma^2}
</math>
</math
</div>


Many machine learning libraries implement cross-correlation but call it convolution. In the context of backpropagation in neural networks, cross-correlation simplifies the computation of gradients with respect to the input and kernel.
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


Visualization of Cross-Correlation and Convolution with Matlab (https://www.youtube.com/v/Ma0YONjMZLI)
== Exercise 2.18 ==


=== Image to Convolved Feature ===
<b>Level:</b> * (Easy)
* '''Kernel\filter size''': weight <math>\times</math> height, e.g. 3 <math>\times</math> 3 in below example
* '''Stride''': how many pixels to move the filter each time
* '''Padding''': add zeros (or any other value) around the boundary of the input


=== Example ===
<b>Exercise Types:</b> Novel 
The following image illustrates a 2D convolution operation between an input image and a filter to produce a convolved feature map.


'''Image (Input)''':
=== Question ===
The grid on the left represents a 5<math>\times</math>5 matrix of pixel values. The orange-highlighted 3<math>\times</math>3 region is part of the image currently being convolved with the filter.


'''Convolution Operation''':
In a binary classification problem, assume the input data is a 2-dimensional vector '''x''' = [x1,x2].The Perceptron model is defined with the following parameters:
The filter values are applied to the selected region in an element-wise multiplication followed by a summation. The operation is as follows:


<math> (1 \times 1) + (1 \times 0) + (1 \times 1) + (0 \times 0) + (1 \times 1) + (1 \times 0) + (0 \times 1) + (0 \times 0) + (1 \times 1) = 4 </math>
Weights: '''w''' = [2,-1]
Bias: b = -0.5


'''Convolved Feature Map''':
The Perceptron output is given by: y = sign('''wx''' + b), where sign(z) is the sign function that outputs +1 if z > 0, and -1 otherwise.
The result value <math>4</math>, is placed in the corresponding position (top-left) of the convolved feature map on the right.


[[Image:conv_example.png|thumb|400px|center|One Convolution Example]]
1. Compute the Perceptron output y for the input sample '''x''' = [1,2];


This process is repeated as the filter slides across the entire image. The final feature map is shown below.
2. Assume the target label is t = +1. Determine if the Perceptron classifies the sample correctly. If it misclassifies, provide the update rule for the weights '''w''' and biases b, and compute their updated values after one step.


[[Image:conv_example_final.png|thumb|400px|center|Final Feature Map]]
=== Solution ===


=== Sparse Interactions===
1. Compute the predicted output y and determine if classification is correct:
In feed forward neural network '''every''' output unit interacts with every input unit.
* When we have <math>m</math> inputs and <math>n</math> outputs, then matrix multiplication requires <math> (m \times n) </math> parameters. and the algorithms used in practice have <math> O(m \times n) </math> runtime (per example)


Convolutional networks, typically have sparse connectivity (sparse weights). This is accomplished by making the kernel smaller than the input.
<math>z = \textbf{w*x} + b = (2*1) + (-1*2) + (-0.5) = 2 - 2 - 0.5 = -0.5 < 0 </math>
* Limit the number of connections each output may have to <math>k</math>, then requires only <math> (k \times n) </math> parameters and <math> O(k \times n) </math> runtime


=== Parameter Sharing ===
since <math>z<0</math>, the Perceptron output is
* In a traditional neural net, each element of the weight matrix is multiplied by one element of the input. i.e. It is used once when computing the output of a layer.
* In CNNs, each member of the kernel is used at every position of the input
* Instead of learning a separate set of parameters for every location, we learn only one set


=== Equivariance ===
<math> y = \text{sign}(-0.5) = -1 </math>
A function <math>f(x)</math> is '''equivaraint''' to a function <math>g</math> is the following holds:


<math>f(g(x)) = g(f(x))</math>
2. The target label t = +1, but the Perceptron output y = -1. Hence, the classification is incorrect.


'''In simple terms''': Applying the function <math>f</math> after <math>g</math> is equivalent to applying <math>g</math> after <math>f</math>
Update rule for weights and bias:


[[Image:equivariance.png|thumb|300px|center|Equivariance]]
Gradient:


==== Equivariance in CNNs ====
<math>
* CNNs are naturally equivariant to translation (Covlution = Shift)
\nabla w = \rho (t-y)*x = 0.1*(1-(-1))*[1,2]=[0.2,0.4]  \newline
* If an input image is shifted, the output feature map shifts correspondingly, preserving spatial structure
</math>
* Importance: This property ensures that CNNs can detect features like edges or corners, no matter where they appear in the image


A convolutional layer has equivariance to translation. For example,
<math>
\nabla b = \rho (t-y) = 0.1*(1-(-1))=0.2
</math>


<math>g(x)[i] = x[i-1]</math>
Update:


Assume the learning rate here is 0.1,


If we apply this transformation to x, then apply convolution, the result will be the same as if we applied convolution to x, then applied the transformation to the output.
<math>
w^{new} = w^{old} + \nabla w = [2, -1] + [0.2, 0.4] = [2.2, -0.6]
</math>


For images, convolution creates a 2-D map of where certain features appear in the input. Note that convolution is not equivariant to some other transformations, such as changes in the scale (rescaling) or rotation of an image.
<math>
b^{new} = b^{old} + \nabla b = -0.5 +0.2 = -0.3
</math>


==== Importance of Data Augmentation ====
</div>
Data augmentation is commonly used to make CNNs robust against variations in scale, rotation, or other transformations. This involves artificially modifying the training data by applying transformations like flipping, scaling, and rotating to expose the network to different variations of the same object.


=== Convolutional Networks ===
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
'''The first stage (Convolution):''' The layer performs several convolutions in parallel to produce a set of preactivations. The convolution stage is designed to detect local features in the input image, such as edges and patterns. It does this by applying filters/kernels across the input image.


'''The second stage (Detector): ''' Each preactivation is run through a nonlinear activation function (e.g. rectified linear). This stage introduces nonlinearity into the model, enabling it to learn complex patterns. Without this nonlinearity, the model would be limited to learning only linear relationships.
== Exercise 2.19 ==


'''The third stage (Pooling)''' Pooling reduces the spatial dimensions of the feature maps (height and width), helping to make the model more invariant to small translations and distortions in the input image. It also reduces computational load and helps prevent overfitting.
<b>Level:</b> ** (Moderate)


[[Image:cnn.png|thumb|400px|center|CNN Structure]]
<b>Exercise Types:</b> Novel 


=== Pooling===
=== Question ===
Down-sample input size to reduce computation and memory
<p>
        Given a simple feedforward neural network with one hidden layer and a softmax output, the network has the following structure:
        <ul>
            <li>Input layer: <math>x \in \mathbb{R}^n</math>,</li>
            <li>Hidden layer: Linear transformation <math xmlns="http://www.w3.org/1998/Math/MathML">h = W₁ x + b₁</math>, followed by a ReLU activation, i.e., <math xmlns="http://www.w3.org/1998/Math/MathML">h₊ = max(0, h)</math>,</li>
            <li>Output layer: Softmax output <math xmlns="http://www.w3.org/1998/Math/MathML">y_{output} = Softmax(W₂ h₊ + b₂)</math>.</li>
        </ul>
    </p>
    <p>
        Let the true label be <math xmlns="http://www.w3.org/1998/Math/MathML">y \in \mathbb{R}^k</math>, where <math xmlns="http://www.w3.org/1998/Math/MathML">k</math> is the number of output classes and <math xmlns="http://www.w3.org/1998/Math/MathML">y</math> is a one-hot vector.
    </p>
<p>


==== Popular Pooling functions ====
1.Derive the gradient of the loss function (cross-entropy loss) with respect to the output logit <math xmlns="http://www.w3.org/1998/Math/MathML">W_2 h_+ + b_2</math> in terms of the softmax output and the true label <math>y</math>. Write the expression for <math>\frac{\partial L}{\partial y_{output}}</math>.
* The maximum of a rectangular neighborhood (Max pooling operation)
* The average of a rectangular neighborhood
* The L2 norm of a rectangular neighborhood
* A weighted average based on the distance from the central pixel


==== Pooling with Downsampling ====
Here we assume the loss function is the entropy loss, i.e. <math>L = - \sum_{i} y_i \log(y_{output,i})</math> where <math xmlns="http://www.w3.org/1998/Math/MathML">y_i</math> is the true label and <math xmlns="http://www.w3.org/1998/Math/MathML">y_{output,i}</math>
Max-pooling with a pool width of 3 and a stride between pools of 2. This reduces the representation size by a factor of 2, which reduces the the computational and statistical burden on the next layer.


==== Pooling and Translations ====
</p>
Pooling helps to make the representation become invariant to small translations of the input. Invariance to local translation can be a very useful property if we care more about whether some feature is present than exactly where it is. For example: In a face, we need not know the exact location of the eyes.
<p>
==== Input of Varying Size ====
2. Using the chain rule, derive the gradient of the loss function with respect to the hidden layer <math>h_+</math>. How does the ReLU activation affect the gradient computation?
Example: we want to classify images of variable size.
</p>


The input to the classification layer must have a fixed size. In the final pooling output (for example) four sets of summary statistics, one for each quadrant of an image, regardless of the image size. Feature after pooling is <math>2 \times 2</math>.
=== Solution ===


It is also possible to dynamically pool features together, for example, by running a clustering algorithm on the locations of interesting features (Boureau et al., 2011).


i.e. a different set of pooling regions for each image.


Learn a single pooling structure that is then applied to all images (Jia et al., 2012)
    <p>
        1.
        Let the output logits be represented as:
        <math xmlns="http://www.w3.org/1998/Math/MathML">z = W₂ h₊ + b₂</math>
        where <math xmlns="http://www.w3.org/1998/Math/MathML">h₊ = max(0, W₁ x + b₁)</math> is the output of the hidden layer after the ReLU activation.
    </p>
    <p>
        The softmax output <math xmlns="http://www.w3.org/1998/Math/MathML">y_{output} = Softmax(z)</math> is given by:
        <math xmlns="http://www.w3.org/1998/Math/MathML">y_{output, i} = \frac{e^{z_i}}{\sum_j e^{z_j}}</math>
    </p>
    <p>
        The cross-entropy loss <math xmlns="http://www.w3.org/1998/Math/MathML">L = - \sum_{i} y_i \log(y_{output,i})</math> where <math xmlns="http://www.w3.org/1998/Math/MathML">y_i</math> is the true label and <math xmlns="http://www.w3.org/1998/Math/MathML">y_{output,i}</math> is the predicted probability from the softmax.
    </p>
    <p>
        The gradient of the loss with respect to the output logits <math xmlns="http://www.w3.org/1998/Math/MathML">z_i</math> is:
        <math xmlns="http://www.w3.org/1998/Math/MathML">\frac{\partial L}{\partial z_i} = y_{output,i} - y_i</math>
    </p>
    <p>
        The gradient with respect to the output <math xmlns="http://www.w3.org/1998/Math/MathML">y_{output}</math> is:
        <math xmlns="http://www.w3.org/1998/Math/MathML"> \frac{\partial L}{\partial y_{output}} = y_{output} - y</math>
    </p>


=== Convolution and Pooling as an Infinitely Strong Prior ===
<p>2.
* '''Weak Prior''':  a prior distribution that has high entropy, which means there is a high level of uncertainty or spread in the distribution. An example of this would be a Gaussian distribution with high variance
        Now, we compute the gradient of the loss with respect to the hidden layer <math xmlns="http://www.w3.org/1998/Math/MathML">h_+</math>.
* '''Strong Prior''': has very low entropy, which implies a high level of certainty or concentration in the distribution. An example of this would be a Gaussian distribution with low variance
    </p>
* '''Infinitely Strong Prior''': places zero probability on some parameters and says a convolutional net is similar to a fully connected net with an infinitely strong prior over its weights
    <p>
        Using the chain rule, we have:
        <math xmlns="http://www.w3.org/1998/Math/MathML"> \frac{\partial L}{\partial h_+} = \frac{\partial L}{\partial z} \cdot \frac{\partial z}{\partial h_+}</math>
    </p>
    <p>
        From part 1, we already computed the derivative of the loss with respect to the output logits:
        <math xmlns="http://www.w3.org/1998/Math/MathML"> \frac{\partial L}{\partial z} = y_{output} - y</math>
    </p>
    <p>
        The derivative of the logits with respect to the hidden layer is:
        <math xmlns="http://www.w3.org/1998/Math/MathML"> \frac{\partial z}{\partial h_+} = W₂</math>
    </p>
    <p>
        Therefore, the gradient with respect to the hidden layer is:
        <math xmlns="http://www.w3.org/1998/Math/MathML"> \frac{\partial L}{\partial h_+} = W₂^T (y_{output} - y)</math>
    </p>
    <p>
        The ReLU activation introduces a nonlinearity in the gradient computation. Specifically, ReLU is defined as:
        <math xmlns="http://www.w3.org/1998/Math/MathML"> ReLU(x) = max(0, x)</math>
    </p>
    <p>
        The gradient of the ReLU function is:
        <math xmlns="http://www.w3.org/1998/Math/MathML"> ReLU'(x) = 1 \text{ if } x > 0 \text{ else } 0</math>
    </p>
    <p>
        Therefore, the gradient with respect to the hidden layer becomes:
        <math xmlns="http://www.w3.org/1998/Math/MathML"> \frac{\partial L}{\partial h_+} = (W₂^T (y_{output} - y)) \cdot ReLU'(h_+)</math>
    </p>
    <p>
        This means that if an element of <math xmlns="http://www.w3.org/1998/Math/MathML">h_+</math> is zero (due to the ReLU activation), the corresponding gradient is also zero, which effectively prevents updates to that particular element during backpropagation.
    </p>


</div>


The weights for one hidden unit must be identical to the weights of its neighbor, but shifted in space. The weights must be zero, except for in the small, spatially contiguous receptive field assigned to that hidden unit.
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 2.20 ==
<b>Level:</b> * (Easy) 
<b>Exercise Types:</b> Novel  


Use of convolution as infinitely strong prior probability distribution over the parameters of a layer. This prior says that the function the layer should learn contains only local interactions and is equivariantto translation.
=== Question ===


The use of pooling is infinitely strong prior that each unit should be invariant to small translations. Convolution and pooling can cause underfitting.
Compute the distance of the following misclassified points to the hyperplane <math>L</math>:
<math>x_1 = [2, 3]</math>, <math>y_1 = 1</math>,
<math>x_2 = [4, -1]</math>, <math>y_2 = -1</math>.


=== Practical Issues ===
The hyperplane parameters are:
The input is usually not just a grid of real values. It is a grid of vector-valued observations. For example, a color image has a red, green, and blue intensity at each pixel.
<math>\beta = [1, -2]^T, \quad \beta_0 = 3.</math>


When working with images, we usually think of the input and output of the convolution as 3-D tensors. One index into the different channels and two indices into the coordinates of each channel.
=== Solution ===


Software implementations usually work in batch mode, so they will actually use 4-D tensors, with the fourth axis indexing different examples in the batch.
The hyperplane equation is:
<math>\beta^T x + \beta_0 = x_1 - 2x_2 + 3.</math>


=== Training ===
Suppose we want to train a convolutional network that incorporates convolution of kernel stack <math>K</math> applied to multi-channel image <math>V</math> with stride <math>s</math>:<math>c(K; V; s)</math>


Suppose we want to minimize some loss function <math>J(V; K)</math>. During forward propagation, we will need to use <math>c</math> itself to output <math>Z</math>.
For <math>x_1 = [2, 3]</math>, <math>y_1 = 1</math>:
<math>
\beta^T x_1 + \beta_0 = (1)(2) + (-2)(3) + 3 = 2 - 6 + 3 = -1.
</math>
The distance is:
<math>
d_1 = -y_1 (\beta^T x_1 + \beta_0) = -(1)(-1) = 1.
</math>


<math>Z</math> is propagated through the rest of the network and used to compute <math>J</math>.
For <math>x_2 = [4, -1]</math>, <math>y_2 = -1</math>:
<math>
\beta^T x_2 + \beta_0 = (1)(4) + (-2)(-1) + 3 = 4 + 2 + 3 = 9.
</math>
The distance is:
<math>
d_2 = -y_2 (\beta^T x_2 + \beta_0) = -(-1)(9) = 9.
</math>


* During backpropagation, we receive a tensor <math>\mathbf{G}</math> such that:
</div>
<math> G_{i,j,k} = \frac{\partial}{\partial Z_{i,j,k}} J(V, K) </math>


*To train the network, we compute the derivatives with respect to the weights in the kernel:
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
<math> g(\mathbf{G}, \mathbf{V}, s)_{i,j,k,l} = \frac{\partial}{\partial Z_{i,j,k}} J(V, K) = \sum_{m,n} G_{i,m,n} V_{j,ms+k,ns+l} </math>


*If this layer is not the bottom layer of the network, we compute the gradient with respect to <math>\mathbf{V}</math> to backpropagate the error further:
== Exercise 2.21 ==
<math> h(\mathbf{K}, \mathbf{G}, s)_{i,j,k} = \frac{\partial}{\partial V_{i,j,k}} J(V, K) = \sum_{l,m \lvert s l + m = j} \sum_{n,p \lvert s n + p = k} \sum_{q} K_{q,i,m,p} G_{i,l,n} </math>
<b>Level:</b> * (Easy)


<b>Exercise Types:</b> Novel 


=== Random or Unsupervised Features ===
=== Question ===
The most computationally expensive part of training a convolutional network is learning the features.


* Supervised training with gradient descent requires full forward and backward propagation through the entire network for every gradient update.
Train a perceptron using gradient descent for the following settings:
* One approach to reduce this cost is to use features that are not learned in a supervised manner, such as random or unsupervised features.
<ul>
    <li>Input Data: <math>\mathbf{x}_i = [x_{i1}, x_{i2}]^T</math>.</li>
    <li>Labels: <math>y_i \in \{-1, +1\}</math>.</li>
    <li>Initial Weights: <math>\mathbf{w} = [w_1, w_2]^T = [0, 0]^T</math>, <math>b = 0</math>.</li>
    <li>Learning Rate: <math>\eta = 0.1</math>.</li>
</ul>


==== Random Initilizations ====
The perceptron update rules are:<br>
Simply initialize the convolution kernels randomly. In high-dimension space, random vectors are almost orthogonal to each other (correlated). Features captured by different kernels are independent.
<math>\mathbf{w} \leftarrow \mathbf{w} + \eta \cdot y_i \cdot \mathbf{x}_i</math><br>
<math>b \leftarrow b + \eta \cdot y_i</math>


==== Unsupervised Learning ====
Dataset:<br>
Learn the convolution kernels using an unsupervised criterion.
<math>\mathbf{x}_1 = [2, 1]^T</math>, <math>y_1 = 1</math><br>
<math>\mathbf{x}_2 = [1, -1]^T</math>, <math>y_2 = -1</math><br>
<b>Tasks:</b>
<ol>
  <li>Perform one iteration of gradient descent (update weights and bias).</li>
  <li>Determine whether both points are correctly classified after the update.</li>
</ol>


==== Key insight ====
=== Solution ===
Random filters can perform surprisingly well in convolutional networks.
<b>Initialization:</b> <math>\mathbf{w} = [0, 0]^T</math>, <math>b = 0</math>, <math>\eta = 0.1</math>.<br>
* Layers composed of convolution followed by pooling naturally become frequency-selective and translation-invariant, even with random weights.


Inexpensive architecture selection
<b>Step 1:</b> Update for Point <math>\mathbf{x}_1 = [2, 1]^T</math>, <math>y_1 = 1</math><br>
* Evaluate multiple convolutional architectures by training only the last layer.
Compute perceptron output: <math>\text{Output} = \mathbf{w}^T \mathbf{x}_1 + b = 0</math>.<br>
* Choose the best-performing architecture and then fully train it using a more intensive method.
Misclassification occurs (<math>\text{Output} \cdot y_1 \leq 0</math>).<br>
Update weights and bias:<br>
<math>\mathbf{w} \leftarrow [0, 0]^T + 0.1 \cdot 1 \cdot [2, 1]^T = [0.2, 0.1]^T</math><br>
<math>b \leftarrow 0 + 0.1 \cdot 1 = 0.1</math><br>


<b>Step 2:</b> Update for Point <math>\mathbf{x}_2 = [1, -1]^T</math>, <math>y_2 = -1</math><br>
Compute perceptron output: <math>\text{Output} = \mathbf{w}^T \mathbf{x}_2 + b = 0.2</math>.<br>
Misclassification occurs (<math>\text{Output} \cdot y_2 > 0</math>).<br>
Update weights and bias:<br>
<math>\mathbf{w} \leftarrow [0.2, 0.1]^T + 0.1 \cdot (-1) \cdot [1, -1]^T = [0.1, 0.2]^T</math><br>
<math>b \leftarrow 0.1 + 0.1 \cdot (-1) = 0</math><br>


== Residual Networks (ResNet) ==
<b>Results:</b><br>
=== Overview ===
Final weights: <math>\mathbf{w} = [0.1, 0.2]^T</math><br>
Deeper models are harder to train due to vanishing/exploding gradients and can be worse than shallower networks if not properly trained. There are advanced networks to deal with the degradation problem.
Final bias: <math>b = 0</math><br>


ResNet, short for Residual Networks, was introduced by Kaiming He et al. from Microsoft Research in 2015. It brought a significant breakthrough in deep learning by enabling the training of much deeper networks, addressing the vanishing gradient problem.
<b>Classification Check:</b><br>
For <math>\mathbf{x}_1</math>: <math>\mathbf{w}^T \mathbf{x}_1 + b = 0.4</math> (correctly classified).<br>
For <math>\mathbf{x}_2</math>: <math>\mathbf{w}^T \mathbf{x}_2 + b = -0.1</math> (correctly classified).<br>


[[Image:resnet.png|thumb|400px|center|ResNet Structure]]
<b>Conclusion:</b><br>
After one iteration of gradient descent, both points are correctly classified.


* ResNet introduces the concept of skip connections (or residual connections) that allow the gradient to be directly backpropagated to earlier layers
</div>
* Skip connections help in overcoming the degradation problem, where the accuracy saturates and then degrades rapidly as the network depth increases


===  Variants ===
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
Several variants of ResNet have been developed, including ResNet-50, ResNet-101, and ResNet-152, differing in the number of layers.


=== Application ===
== Exercise 2.22 ==
ResNet has been widely adopted for various computer vision tasks, including image classification, object detection, and facial recognition.


== DenseNet ==
<b>Level:</b> * (Moderate) 
=== Overview ===
* DenseNet, short for Densely Connected Networks, was introduced by Gao Huang et al. in 2017.
* It is known for its efficient connectivity between layers, which enhances feature propagation and reduces the number of parameters


[[Image:densenet.png|thumb|500px|center|DenseNet Structure]]
<b>Exercise Types:</b> Novel


=== Key Feature ===
=== Question ===
The key feature is '''Dense Connectivity'''.
* In DenseNet, each layer receives feature maps from all preceding layers and passes its own feature maps to all subsequent layers
* This dense connectivity improves the flow of information and gradients throughout the network, mitigating the vanishing gradient problem


== Echo State Network ==
For the following neural network, do one forward pass through the network using the point (x1, x2, x3) = (1, 2, -1). The hidden layer uses the ReLu activation function and the output layer uses the sigmoid activation function. Calculate pfinal.


In RNNs, the ability to capture long-term dependencies is crucial. Set the recurrent and input weights such that the recurrent hidden units do a good job of capturing the history of past inputs, and only learn the output weights. The goal is to access the information from the past implicitly.
[[File:Neural_Network.png|321px|thumb|center|Diagram of the neural network]]


The hidden state at time <math>t</math> can be expressed as:
=== Solution ===
1) Hidden layer calculations:
The equations for the hidden layer are <math> z1 = x1*w1 + x2*w2 + x3*w3 + w4 </math> and <math> z2 = x1*w5 + x2*w6 + x3*w7 + w8 </math>.
Plugging in the values x and the weights we obtain <math> z1 = (1)*(0.5) + (2)*(0.3) + (-1)*(0.4) - 1 = -0.3 </math> and <math> z2 = (1)*(-0.2) + (2)*(1) + (-1)*(0.7) + 0.9 = 2 </math>. The equations to activate the hidden layers are <math> za = max(0, z1) </math> and <math> zb = max(0, z2) </math>. Plugging in z1 and z2 we obtain <math> za = max(0, -0.3) = 0 </math> and <math> zb = max(0, 2) = 2 </math>.


<math>s_t = \sigma(W s_{t-1} + U x_t)</math>
2) Output layers calculations:
The equations for the output layer is <math> zfinal = za*w9 + zb*w10 + w11 </math>. Plugging in za, zb and the weights we obtain <math> zfinal = 0*0.6 + 2*0.5 - 0.4 = 0.6 </math>. To calculate pfinal we need to use the sigmoid activation function so the equation is <math> pfinal = \frac{1}{1 + e^{-zfinal}} </math>. Plugging in the value for zfinal we obtain <math> pfinal = \frac{1}{1 + e^{-0.6}} = 0.646 </math>.


where:
</div>
* <math>W</math> represents the recurrent weight matrix, which connects previous hidden states to the current state,
* <math>U</math> is the input weight matrix, responsible for incorporating the current input <math>x_t</math>,
* <math>\sigma</math> is an activation function, like a non-linear function such as a sigmoid or tanh.


It is important to control how small changes in the hidden state propagate through time to ensure the network does not become unstable.
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


If a change <math>\Delta s</math> in the state at time <math>t</math> is aligned with an eigenvector <math>v</math> of the Jacobian <math>J</math> with eigenvalue <math>\lambda > 1</math>, then the small change <math>\Delta s</math> becomes <math>\lambda \Delta s</math> after one-time step, and <math>\lambda^t \Delta s</math> after <math>t</math> time steps.
== Exercise 2.23 ==


If the largest eigenvalue <math>\lambda < 1</math>, the map from <math>t</math> to <math>t+1</math> is contractive.
<b>Level:</b> * (Easy) 


The network forgets information about the long-term past.
<b>Exercise Types:</b> Novel


Set the weights to make the Jacobians slightly contractive. This allows the network to gradually forget irrelevant information while still remembering key long-term dependencies.
=== Question ===
You are given a perceptron with weights <math> w = [2, -3] </math> and bias <math> b = 5 </math>. The perceptron uses the activation function: <math> f(x) = sign(w⋅x+b) </math>  where <math> x =[x_1​,x_2] </math> is the input and <math> sign(z) </math> outputs 1  if <math> z>0 </math> and −1 otherwise.
1) Write the equation of the hyperplane that separates the two classes defined by this perceptron.
2) Determine whether the following points are classified as 1 or -1 by the perceptron.  
<math> x_1​ =[1,1] </math> <math> x_2=[2,−1] </math> <math> x_3=[0,2] </math>


[[Image:echo_state_net.png|thumb|500px|center|Echo State Network]]
=== Solution ===
1) The hyperplane is defined by the equation where <math> w \cdot x + b = 0 </math>.  Substituting the given weights and bias gives <math> 2x_1 - 3x_2 + 5 = 0. </math>
This is the equation of the hyperplane that separates the two classes.
2) For <math> x_1​ =[1,1] </math>, <math> w \cdot x_1 + b = 2(1) - 3(1) + 5 = 4 </math>. Thus, <math> x_1 = 1 </math> by the perceptron.
For <math> x_2​ =[2,-1] </math>, <math> w \cdot x_2 + b = 2(2) - 3(-1) + 5 = 12 </math>. Thus, <math> x_2 = 1 </math> by the perceptron.
For <math> x_3​ =[0,2] </math>, <math> w \cdot x_3 + b = 2(0) - 3(2) + 5 = -1 </math>. Thus, <math> x_3 = -1 </math> by the perceptron.


== Long Delays ==
</div> 


RNNs often fail to capture these dependencies due to the vanishing gradient problem. Long delays use recurrent connections. It knows something from the past, help vanishing gradient - even if gradient get vanished during the path, it still has the direct information from the past.
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


[[Image:long delay.png|thumb|500px|center|Long Delays]]
== Exercise 2.24 ==
'''Level:''' * (Easy)


== Leaky Units ==
'''Exercise Types:''' Novel
=== Question ===
Given a dataset
<math>
D = \left\{ (x_1,y_1)=([1,2],1), (x_2,y_2)=([2,-1],-1), (x_3,y_3)=([3,1],1), (x_4,y_4)=([1,-2],1)\right\}


In some cases, we do need to forget the path while in some we do not since we do not want to remember redundant information.
</math>
 
<b>a).</b> Show that the dataset <math>D</math> is linearly separable by finding the weight vector <math>\beta=[w_1,w_2]</math> and bias <math>b</math> such that:
<math>
y_i\cdot (\beta^Tx_i+b)\gt 0 , \forall (x_i,y_i)\in D
</math>


Recall that:
<b>b).</b> Train the perceptron starting with <math>w_1=0, w_2 = 0, b = 0</math>. Use the update rule for misclassification points:  
<math>
\beta\gets \beta+y_i\cdot x_i,b\gets b+y_i
</math>
Show the full process and update <math>\beta</math> and <math>b</math>.


<math>s_t = \sigma(W s_{t-1} + U x_t)</math>
<b>c).</b> Write the final values of <math>\beta</math> and <math>b</math>.


Then consider the following refined form of the equation (convex combination of the current state and previous through a new parameter):
=== Solution ===


<math>s_{t,i} = \left(1 - \frac{1}{\tau_i}\right) s_{t-1} + \frac{1}{\tau_i} \sigma(W s_{t-1} + U x_t)</math>
<b>a). </b> When <math>y=1</math>, <math>[1,2]</math> and <math>[3,1]</math>.


where
When <math>y=-1</math>, <math>[2,-1]</math> and <math>[1,-2]</math>.
* <math>1 \leq \tau_i \leq \infty</math>
* <math>\tau_i = 1</math> corresponds to an ordinary RNN
* <math>\tau_i > 1</math> allows gradients to propagate more easily
* <math>\tau_i \gg 1</math> means the state changes very slowly, integrating past values associated with the input sequence over a long duration


Infinity means the current state is the previous state while one means completely forgetting the previous steps and only depends on the current observations.
Assume a line <math>w_!x_1+w_2x_2+b=0</math>, where <math>\beta=[1,1],b=-2</math>.


== Gated RNNs ==
For <math>[1,2]:1\cdot 1+1\cdot 2-2=1\gt 0</math> (correctly separated).
=== Defnition ===


It might be useful for the neural network to forget the old state in some cases like if we only care about if the current letter is a or b.
For <math>[3,1]:1\cdot 3+1\cdot 1-2=2\gt 0</math> (correctly separated).


Example: <math>a\ a\ b\ b\ b\ b\ a\ a\ a\ a\ b\ a\ b</math>
For <math>[2,-1]:1\cdot 2+1\cdot (-1)-2=-1\lt 0</math> (correctly separated).


It might be useful to keep the memory of the past.
For <math>[1,-2]:1\cdot 1+1\cdot (-2)-2=-3\lt 0</math> (correctly separated).


Example:
<b>b). </b>
As <math>w_1=0,w_2=0,b=0</math>,


Instead of manually deciding when to clear the state, we want the neural network to learn to decide when to do it.
For <math>(x_1,y_1)=([1,2],1)</math>,
<math>
f(x_1)=sign(0\cdot1+0\cdot2+0)=0
</math>


=== Long-Short-Term-Memory (LSTM) ===
This is incorrect, thus update into:
<math>
w_1\gets 0+1\cdot 1=1, w_2\gets 0+1\cdot 2=2, b\gets 0+1=1
</math>


The Long-Short-Term-Memory (LSTM) algorithm was proposed in 1997 (Hochreiter and Schmidhuber, 1997). It is a type of recurrent neural network designed for approaching the vanishing gradient problem.
For <math>(x_2,y_2)=([2,-1],-1)</math>,
<math>
f(x_2)=sign(1\cdot2+2\cdot(-1)+1)=1
</math>


Several variants of the LSTM are found in the literature:
This is incorrect, thus update into:
<math>
w_1\gets 1+(-1)\cdot 2=-1, w_2\gets 2+(-1)\cdot (-1)=3, b\gets 1+(-1)=0
</math>


*Hochreiter and Schmidhuber, 1997
For <math>(x_3,y_3)=([3,1],1)</math>,
*Graves, 2012
<math>
*Graves et al., 2013
f(x_3)=sign(-1\cdot3+3\cdot1+0)=0
*Sutskever et al., 2014
</math>


The principle is always to have a linear self-loop through which gradients can flow for a long duration.
This is incorrect, thus update into:
<math>
w_1\gets -1+1\cdot 3=2, w_2\gets 3+1\cdot 1=4, b\gets 0+1=1
</math>


== Gated Recurrent Units (GRU) ==
For <math>(x_4,y_4)=([1,-2],-1)</math>,
<math>
f(x_4)=sign(2\cdot1+4\cdot(-2)+1)=-1
</math>


Here is the plain text version of the new image content:
This is correct, thus no update.


Recent work on gated RNNs, Gated Recurrent Units (GRU), was proposed in 2014.
<b>c). </b>
Therefore, final weight is <math>w_1=2,w_2=4,b=1</math>


* Cho et al., 2014
</div>
* Chung et al., 2014, 2015
* Jozefowicz et al., 2015
* Chrupala et al., 2015


Standard RNN computes the hidden layer at the next time step directly:
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


<math>s_t = \sigma(W s_{t-1} + U x_t)</math>
== Exercise 2.25 ==


There are two gates: the update gate and the reset gate. Update gate for the case that we want to keep the information around while reset gate is the case when forgetting. A temporary state locks down some of the values of the current state.
<b>Level:</b> * (Easy) 


GRU first computes an update gate (another layer) based on the current input vector and hidden state:
<b>Exercise Types:</b> Novel 


<math>z_t = \sigma(U^{(z)} x_t + W^{(z)} s_{t-1})</math>
=== Question ===
Explain the mechanism of self-attention used in transformers, focusing on the computation of attention scores. Use a small example with the input vectors corresponding to three words of your choice to demonstrate how self-attention weights are calculated and used to produce the output vectors.


It also computes the reset gate similarly but with different weights:
=== Solution ===


<math>r_t = \sigma(U^{(r)} x_t + W^{(r)} s_{t-1})</math>
<b>Self-Attention Mechanism:</b>
Self-attention allows a model to dynamically weigh the importance of each word in a sequence relative to others, which is crucial for understanding the context and relationships in sentences.


New memory content is calculated as:
<b>Example Setup:</b>
- Assume we have three words in our input: "Star Wars," "Star Trek," and "Star Gate".
- Each word is initially represented by a simple 2-dimensional embedding for simplicity.


<math>\tilde{s_t} = \tanh(U x_t + r_t \odot W s_{t-1})</math>
<b>Step 1: Compute Q, K, V vectors</b>
For each word, compute the Query (Q), Key (K), and Value (V) vectors using learned weight matrices (assume identity matrices for simplicity):
- Q, K, V for "Star Wars" = [1, 0]
- Q, K, V for "Star Trek" = [0, 1]
- Q, K, V for "Star Gate" = [1, 1]


which has current observations and forgetting something from the past
<b>Step 2: Compute Attention Scores</b>
Calculate the dot product of the query vector of each word with the key vector of every other word:
- Score for "Star Wars" with "Star Trek": [1, 0] • [0, 1] = 0
- Score for "Star Wars" with "Star Gate": [1, 0] • [1, 1] = 1
- Score for "Star Trek" with "Star Wars": [0, 1] • [1, 0] = 0
- Score for "Star Trek" with "Star Gate": [0, 1] • [1, 1] = 1
- Score for "Star Gate" with "Star Wars": [1, 1] • [1, 0] = 1
- Score for "Star Gate" with "Star Trek": [1, 1] • [0, 1] = 1


If the reset gate is close to 0, this causes the network to ignore the previous hidden state, effectively allowing the model to drop irrelevant information.
<b>Step 3: Normalize Scores using Softmax</b>
Apply the softmax function to ensure scores sum to one and represent probabilities:
- Normalized scores between "Star Wars," "Star Trek," and "Star Gate": [0.333, 0.333, 0.333] (this type of simplicity would be like using a naive bayes model to predict)


The final memory at time step <math>t</math> is a combination of the current and previous time steps:
<b>Step 4: Compute Output Vectors</b>
Multiply each value vector by the corresponding normalized score and sum them to produce the output vector for each word:
- Output for "Star Wars": 0.333*[1, 0] + 0.333*[0, 1] + 0.333*[1, 1] = [0.666, 0.666]
- Output for "Star Trek": Similar calculation
- Output for "Star Gate": Similar calculation


<math>s_t = z_t \odot s_{t-1} + (1 - z_t) \odot \tilde{s_t}</math>


If the reset gate is close to 0, it will ignore the previous hidden state, allowing the model to discard irrelevant information.
</div>


The update gate <math>z_t</math> controls how much of the past state should matter in the current time step. If <math>z_t</math> is close to 1, then we can effectively copy information from the past state across multiple time steps.
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


Units that need to capture short-term dependencies often have highly active reset gates.
== Exercise 3.1 ==
<b>Level:</b> ** (Moderate)
<b>Exercise Type:</b> Novel


== Cliping Gradients ==
Implement the perceptron learning algorithm with momentum for the AND function. Plot the decision boundary after 10 epochs of training with a learning rate of 0.1 and a momentum of 0.9.


A simple solution for clipping the gradient. (Mikolov, 2012; Pascanu et al., 2013):
=== Solution ===
<syntaxhighlight lang="python">
import numpy as np
import matplotlib.pyplot as plt


* Clip the parameter gradient from a mini-batch element-wise (Mikolov, 2012) just before the parameter update.
# Dataset
* Clip the norm <math>g</math> of the gradient <math>g</math> (Pascanu et al., 2013a) just before the parameter update.
data = np.array([
    [0, 0, -1],
    [0, 1, -1],
    [1, 0, -1],
    [1, 1, 1]
])


The formula for clipping the gradient is:
# Initialize weights, learning rate, and momentum
weights = np.random.rand(3)
learning_rate = 0.1
momentum = 0.9
epochs = 10
previous_update = np.zeros(3)


<math>g' = \min\left(1, \frac{c}{|g|}\right) g</math>
# Add bias term to data
X = np.hstack((np.ones((data.shape[0], 1)), data[:, :2]))
y = data[:, 2]


where c is a constant.
# Training loop
for epoch in range(epochs):
    for i in range(len(X)):
        prediction = np.sign(np.dot(weights, X[i]))
        if prediction != y[i]:
            update = learning_rate * y[i] * X[i] + momentum * previous_update
            weights += update
            previous_update = update


== Attention ==
# Plot final decision boundary
x_vals = np.linspace(-0.5, 1.5, 100)
y_vals = -(weights[1] * x_vals + weights[0]) / weights[2]
plt.plot(x_vals, y_vals, label='Final Decision Boundary')


The attention mechanism was introduced to improve the performance of the encoder-decoder model for machine translation.
# Plot dataset
for point in data:
    color = 'blue' if point[2] == 1 else 'red'
    plt.scatter(point[0], point[1], color=color)


=== Common Representation ===
plt.title('Perceptron with Momentum')
plt.legend()
plt.show()
</syntaxhighlight>


A single 'concept' is universally represented, transcending specific languages or forms.


* '''Encoder''': Processes the word 'elephant' from its original source.
[[Image:exercise_3_1.png|thumb|300px|left|Final decision boundary.]]
* '''Output''': A universal representation vector (the abstract 'concept' of an elephant).
<br clear="all">
* '''Decoders''': Translate this concept into various domains or applications.


The 'concept' is an abstract entity that exists independently of any particular language or representation.
</div>


For example, if we want to translate from English to Spanish
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


* '''Encoder (English Input)''': The system processes the word "elephant."
== Exercise 3.2 ==
* '''Output (Universal Representation)''': The system generates an abstract concept or vector representing an "elephant," independent of any specific language.
'''Level:''' ** (Moderate)
* '''Decoder (Spanish Output)''': The system decodes this concept and outputs the equivalent Spanish word: "elefante."


[[Image:attn_exmaple.png|thumb|500px|center|Common Representation]]
'''Exercise Types:''' Novel


=== Question ===
Write a python program showing how the back propagation algorithm work with a 2 inputs 2 hidden layer and 1 output layer neural network. Train the network on the XOR problem:
* Input[0,0] -> Output 0
* Input [0,1] -> Output 1
* Input [1,0] -> Output 1
* Input [1,1] -> Output 0
Use the sigmoid activation function. Use Mean Square Error as the loss function.


=== Sequence-to-Sequence Model ===
=== Solution ===
<syntaxhighlight lang="python">
import numpy as np


In the sequence-to-sequence model, every word <math>x_i</math> produces a hidden vector <math>h_i</math> in the encoder part of the autoencoder. The hidden vector of every word, <math>h_i</math>, is fed to the next hidden vector, <math>h_{i+1}</math>, by a projection matrix <math>W</math>.
# -------------------------
# 1. Define Activation Functions
# -------------------------


In this model, for the whole sequence, there is only one context vector <math>c</math>, which is equal to the last hidden vector of the encoder, i.e., <math>c = h_n</math>.
def sigmoid(x):
    """
    Sigmoid activation function.


[[Image:sqe2seq.png|thumb|800px|center|Sequence-to-Sequence Model]]
    :param x: A decimal value
    :return: The sigmoid activation of given value
    """
    return 1 / (1 + np.exp(-x))


Challenges:
def sigmoid_derivative(x):
    """
    Derivative of the sigmoid function.
    Here, 'x' is assumed to be sigmoid(x),
    meaning x is already the output of the sigmoid.


1. '''Long-range dependencies''': As the model processes long sequences, it can struggle to remember and utilize information from earlier steps, especially in cases where long-term context is crucial.
    :param x: A decimal value
    :return: The derivative of sigmoid activation of given value
    """
    return x * (1 - x)


2. '''Sequential processing''': Since these models process data step by step in sequence, they can't take full advantage of parallel processing, which limits the speed and efficiency of training.


These are the core challenges that newer architectures, such as transformers, aim to address.
# -------------------------
# 2. Prepare the Training Data (XOR)
# -------------------------
# Input data (4 samples, each with 2 features)
X = np.array([
    [0, 0],
    [0, 1],
    [1, 0],
    [1, 1]
])


=== Attention Definition ===
# Target labels (4 samples, each is a single output)
y = np.array([
    [0],
    [1],
    [1],
    [0]
])


The basic idea behind the attention mechanism is directing the focus on important factors when processing data. Attention is a fancy name for '''weighted average'''.
# -------------------------
# 3. Initialize Network Parameters
# -------------------------
# Weights for input -> hidden (shape: 2x2)
W1 = np.random.randn(2, 2)
# Bias for hidden layer (shape: 1x2)
b1 = np.random.randn(1, 2)


=== Sequence-to-Sequence Model with Attention ===
# Weights for hidden -> output (shape: 2x1)
W2 = np.random.randn(2, 1)
# Bias for output layer (shape: 1x1)
b2 = np.random.randn(1, 1)


* Sequence-to-sequence models:
# Hyperparameters
Multiple RNN units serve as the encoder. They encode information into the context vectors. Multiple RNN units decode the concept in the context vector to different domain information. The limitations of this approach are long-range dependencies and prevention of parallelization.  
learning_rate = 0.1
num_epochs = 10000


<math>p(y_i | y_1, \ldots, y_{i-1}) = g(y_{i-1}, l_i, c)</math>
# -------------------------
# 4. Training Loop
# -------------------------
for epoch in range(num_epochs):
    # 4.1. Forward Pass
    #  - Compute hidden layer output
    hidden_input = np.dot(X, W1) + b1  # shape: (4, 2)
    hidden_output = sigmoid(hidden_input)
   
    #  - Compute final output
    final_input = np.dot(hidden_output, W2) + b2  # shape: (4, 1)
    final_output = sigmoid(final_input)
   
    # 4.2. Compute Loss (Mean Squared Error)
    error = y - final_output  # shape: (4, 1)
    loss = np.mean(error**2)
   
    # 4.3. Backpropagation
    #  - Gradient of loss w.r.t. final_output
    d_final_output = error * sigmoid_derivative(final_output)  # shape: (4, 1)
   
    #  - Propagate error back to hidden layer
    error_hidden_layer = np.dot(d_final_output, W2.T)  # shape: (4, 2)
    d_hidden_output = error_hidden_layer * sigmoid_derivative(hidden_output)  # shape: (4, 2)
   
    # 4.4. Gradient Descent Updates
    #  - Update W2, b2
    W2 += learning_rate * np.dot(hidden_output.T, d_final_output)  # shape: (2, 1)
    b2 += learning_rate * np.sum(d_final_output, axis=0, keepdims=True)  # shape: (1, 1)
   
    #  - Update W1, b1
    W1 += learning_rate * np.dot(X.T, d_hidden_output)  # shape: (2, 2)
    b1 += learning_rate * np.sum(d_hidden_output, axis=0, keepdims=True)  # shape: (1, 2)
   
    # Print loss every 1000 epochs
    if epoch % 1000 == 0:
        print(f"Epoch {epoch}, Loss: {loss:.6f}")


* Sequence-to-sequence with attention:
# -------------------------
Pass multiple context vectors to the decoder.  
# 5. Testing / Final Outputs
 
# -------------------------
<math>p(y_i | y_1, \ldots, y_{i-1}) = g(y_{i-1}, l_i, c_i)</math>
print("\nTraining complete.")
print("Final loss:", loss)


# Feedforward one last time to see predictions
hidden_output = sigmoid(np.dot(X, W1) + b1)
final_output = sigmoid(np.dot(hidden_output, W2) + b2)


[[Image:sqe2seq attn.png|thumb|800px|center|Sequence-to-Sequence Model with Attention]]
print("\nOutput after training:")
for i, inp in enumerate(X):
    print(f"Input: {inp} -> Predicted: {final_output[i][0]:.4f} (Target: {y[i][0]})")


There are some calculations:
</syntaxhighlight>


1. Similarity score:
Output:
<math>s_{ij} = similarity(l_{i-1}, h_j)</math>
<pre>
Epoch 0, Loss: 0.257193
Epoch 1000, Loss: 0.247720
Epoch 2000, Loss: 0.226962
Epoch 3000, Loss: 0.191367
Epoch 4000, Loss: 0.162169
Epoch 5000, Loss: 0.034894
Epoch 6000, Loss: 0.012459
Epoch 7000, Loss: 0.007127
Epoch 8000, Loss: 0.004890
Epoch 9000, Loss: 0.003687


2. Attention weight:
Training complete.
<math>a_{ij} = \frac{e^{s_{ij}}}{\sum_{k=1}^{T} e^{s_{ik}}}</math>
Final loss: 0.0029435579049382756


The attention weight <math>a_{ij}</math> is obtained by applying a softmax function to the similarity scores. This normalizes the scores across all encoder hidden states, turning them into a probability distribution.
Output after training:
Input: [0 0] -> Predicted: 0.0598 (Target: 0)
Input: [0 1] -> Predicted: 0.9461 (Target: 1)
Input: [1 0] -> Predicted: 0.9506 (Target: 1)
Input: [1 1] -> Predicted: 0.0534 (Target: 0)
</pre>


3. Context vector:
</div>
<math>c_i = \sum_{j=1}^{T} a_{ij} h_j</math>


The effectiveness of the correlation between inputs around position <math>j</math> and the output at position <math>i</math> is crucial.
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">


This score is determined based on:
== Exercise 3.3 ==
'''Level:''' * (Easy)
* The RNN hidden state <math>l_{i-1}</math> just before emitting <math>y_i</math>.
* The <math>j^{th}</math> hidden state <math>h_j</math> of the input sentence.


== Transformer Architecture ==
'''Exercise Types:''' Novel
The basic concept behind transformers is attention as summarized in the paper by Vaswani et. al [https://arxiv.org/abs/1706.03762 'Attention is all you need']. This paper claims that all you need is attention and with the structure of attentions, basically you can handle the sequential data. It was based on GPT and many other models that we use in LLM and imaging processing. Transformer is an example of an encoder-decoder architecture.  Unlike RNNs, Transformers can process sequences in parallel, making them faster to train on large datasets. Transformers have applications beyond NLP, such as Vision Transformers (ViT) in computer vision and protein structure prediction in biology (AlphaFold). Transformers' ability to capture long-range dependencies efficiently has made them the standard for many modern AI models.


=== Encoder ===
=== Question ===  
The encoder consists of two main components: Self Attention and Feed Forward Neural Network. The architecture of the Encoder is given below:
Implement 4 iterations of gradient descent with and without momentum for the function <math>f(x) = x^2 + 2</math> with learning rate <math>\eta=0.1</math>, momentum <math>\gamma=0.9</math>, starting value of <math>x_0=2</math>, starting velocity of <math>v_0=0</math>. Comment on the differences.
[[File:Encoder.png|center|thumb|Encoder architecture of the Transformer]]


==== Self Attention ====
=== Solution ===
Understanding the individual words in a sentence is not enough to understand the whole sentence and one needs to understand how the words relate to each other. The attention mechanism forms composite representations. We aim to have embeddings of words and embeddings of compositions at the same time in different levels. Unlike word2vec introduced in 2013 by Mikolov et al., which captures the vector representations of words in an embedding space such that words that are similar are represented closer to each other, self-attention aims to capture the similarity between words based on context and in relation to each other. Multiple layers help form complex concept representations. For example, the context of the word "bank" differs based on if the surrounding words involve "money" or "river".
Note that <math>f'(x) = 2x </math>


[[File:word2vec.jpg|center|thumb|Illustration of word2vec where "King" - "Man" + "Woman" produces a vector close to the word "Queen"]]
<strong>Without momentum:</strong>


Self-attention is analogous to the fundamental retrieval strategy in databases where given a query, and key-value pairs, we use the query to identify the key and retrieve the corresponding value. The generalized definition for calculating the attention of a target word with respect to the input word: use the '''Query''' of the target and the '''Key''' of the input and then calculate a matching score. These matching scores act as the weights of the '''Value''' vectors.
Iteration 1: <math>x_1 = x_0 - \eta* f'(x_0) = 2 - 0.1*2*2 = 1.6</math>


Iteration 2: <math>x_2 = x_1 - \eta* f'(x_1) = 1.6 - 0.1*2*1.6 = 1.28</math>


Then we look at the definition if matrix form. Given an input vector <math>\mathbf{x} \in \mathbb{R}^d</math>, the weights for the query, key, and value transformations are defined as:
Iteration 3: <math>x_3 = x_2 - \eta* f'(x_2) = 1.28 - 0.1*2*1.28 = 1.024</math>


* <b>Query weight matrix</b>: <math>\mathbf{W}_q \in \mathbb{R}^{d \times p}</math>
Iteration 4: <math>x_4 = x_3 - \eta* f'(x_3) =1.024 - 0.1*2*1.024 = 0.8192</math>


* <b>Key weight matrix</b>: <math>\mathbf{W}_k \in \mathbb{R}^{d \times p}</math>
<strong>With momentum:</strong>


* <b>Value weight matrix</b>: <math>\mathbf{W}_v \in \mathbb{R}^{d \times r}</math>
Iteration 1: <math> v_1 = \gamma*v_0 + \eta * f'(x_0) = 0.9*0 + 0.1*2*2 = 0.4, x_1 = x_0-v_1 = 2-0.4 = 1.6 </math>


The transformations for the query (<math>\mathbf{q}</math>), key (<math>\mathbf{k}</math>), and value (<math>\mathbf{v}</math>) vectors are given by:
Iteration 2: <math> v_2 = \gamma*v_1 + \eta * f'(x_1) = 0.9*0.4+0.1*2*1.6 = 0.68, x_2 = x_1-v_2 = 1.6-0.68 = 0.92 </math>


* <b>Query vector</b>: <math>\mathbf{q} = \mathbf{W}_q^T \mathbf{x}</math> where <math>\mathbf{q} \in \mathbb{R}^{p \times 1}</math>, since <math>\mathbf{W}_q^T \in \mathbb{R}^{p \times d}</math>, and <math>\mathbf{x} \in \mathbb{R}^{d \times 1}</math>
Iteration 3: <math> v_3 = \gamma*v_2 + \eta * f'(x_2) = 0.9*0.68 + 0.1*2*0.92 = 0.796, x_3 = x_2-v_3 = 0.92-0.796 = 0.124 </math>


* <b>Key vector</b>: <math>\mathbf{k} = \mathbf{W}_k^T \mathbf{x}</math> where <math>\mathbf{k} \in \mathbb{R}^{p \times 1}</math>, since <math>\mathbf{W}_k^T \in \mathbb{R}^{p \times d}</math>, and <math>\mathbf{x} \in \mathbb{R}^{d \times 1}</math>
Iteration 4: <math> v_4 = \gamma*v_3 + \eta * f'(x_3) = 0.9*0.796 + 0.1*2*0.124 = 0.7412, x_4 = x_3-v_4 = 0.124 - 0.7412 = -0.6172 </math>


* <b>Value vector</b>:  <math>\mathbf{v} = \mathbf{W}_v^T \mathbf{x}</math> where <math>\mathbf{v} \in \mathbb{R}^{r \times 1}</math>, since <math>\mathbf{W}_v^T \in \mathbb{R}^{r \times d}</math>, and <math>\mathbf{x} \in \mathbb{R}^{d \times 1}</math>
By observation, we know that the minimum of <math>f(x)=x^2+2</math> occurs at <math>x=0</math>. We can see that with momentum, the algorithm moves towards the minimum much faster than without momentum as past gradients are accumulated, leading to larger steps. However, we also can see that momentum can cause the algorithm to overshoot the minimum since we are taking larger steps.


The transformations allow the attention mechanism to compute similarity scores between the query and key vectors and to use the value vectors to produce the final weighted output as <math>\mathbf{z_1} = \alpha_1 \mathbf{v}_1 + \alpha_2 \mathbf{v}_2 + \ldots + \alpha_n \mathbf{v}_n</math>, where <math>\mathbf{v}_i</math> are similar to the input in CNNs, and <math>\alpha_i</math> are similar to the kernels in CNNs.  
'''Benefits for momentum:'''
Momentum is a technique used in optimization to accelerate convergence. Inspired by physical momentum, it helps in navigating the optimization landscape.


However, unlike the kernels in CNNs, the <math>\alpha_i</math>'s are data-dependent and given by: 
By remembering the direction of previous gradients, which are accumulated into a running average (the velocity), momentum helps guide the updates more smoothly, leading to faster progress. This running average allows the optimizer to maintain a consistent direction even if individual gradients fluctuate. Additionally, momentum can help the algorithm escape from shallow local minima by carrying the updates through flat regions. This prevents the optimizer from getting stuck in small, unimportant minima and helps it continue moving toward a better local minimum.
<math>\alpha_i = \text{softmax}\left(\frac{\mathbf{q}^T \mathbf{k}_i}{\sqrt{p}}\right)</math>.


Extending this to the entire dataset, the equations are:
<strong>Additional Comment:</strong>
It is important to note that the use of running average is only there to help with intuition. At time t, while the velocity is a linear sum of previous gradients, the weight of the gradient decreases as time get further away. That is, the <math>\nabla Q(w_0)</math> term will have a coefficient of <math>(1-\gamma)^{t}</math>.
</div>


<math>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
\mathbf{X} = [\mathbf{x}_1, \mathbf{x}_2, \ldots, \mathbf{x}_n] \in \mathbb{R}^{d \times n}
</math>


<math>
== Exercise 3.4 ==
\mathbf{Q} = [\mathbf{q}_1, \mathbf{q}_2, \ldots, \mathbf{q}_n] \in \mathbb{R}^{p \times n}
'''Level:''' ** (Moderate)
</math>


<math>
'''Exercise Types:''' Novel
\mathbf{K} = [\mathbf{k}_1, \mathbf{k}_2, \ldots, \mathbf{k}_n] \in \mathbb{R}^{p \times n}
</math>


<math>
=== Question ===
\mathbf{V} = [\mathbf{v}_1, \mathbf{v}_2, \ldots, \mathbf{v}_n] \in \mathbb{R}^{r \times n}
Perform one iteration of forward pass and backward propagation for the following network:
</math>


The transformations are defined as:
* Input layer: 2 neurons (x₁, x₂)
* Hidden layer: 2 neurons (h₁, h₂)
* Output layer: 1 neuron (ŷ)


<math>
* Input-to-Hidden Layer:
\mathbf{Q}_{p \times n} = \mathbf{W}_{q}^{T_{p \times d}} \mathbf{X}_{d \times n}
  w₁₁¹ = 0.15, w₂₁¹ = 0.20, w₁₂¹ = 0.25, w₂₂¹ = 0.30
</math>
  Bias: b¹ = 0.35
  Activation function: sigmoid


<math>
*Hidden-to-Output Layer:
\mathbf{K}_{p \times n} = \mathbf{W}_{k}^{T_{p \times d}} \mathbf{X}_{d \times n}
  w₁₁² = 0.40, w₂₁² = 0.45
</math>
  Bias: b² = 0.60
  Activation function: sigmoid


<math>
Input:
\mathbf{V}_{r \times n} = \mathbf{W}_{v}^{T_{r \times d}} \mathbf{X}_{d \times n}
* x₁ = 0.05, x₂ = 0.10
</math>
* Target output: y = 0.01
* Learning rate: η = 0.5


Therefore the output,
=== Solution ===
<math>
\mathbf{Z}_{r \times n} = \mathbf{V}_{r \times n} \cdot \text{softmax}\left(\frac{\mathbf{Q}^{T} \mathbf{K}}{\sqrt{p}}\right)_{n \times n}
</math>


Additionally, we have:
==== Step 1: Forward Pass ====


<math>
===== 1. Hidden Layer Outputs =====
\mathbf{Q}^{T} \mathbf{K} = \mathbf{X}^{T} \mathbf{W}_{q} \mathbf{W}_{k}^{T} \mathbf{X} \quad \text{(an asymmetric kernel extracting the global similarity between words)}
</math>


Let us take a closer look at how one word is processed in the encoder.
For neuron h₁:
[[File:Encoder-Deeper-View.jpg|center|thumb|Deeper view of the Encoder]]
* <math> z₁¹ = w₁₁¹ \cdot x₁ + w₂₁¹ \cdot x₂ + b¹ = 0.15(0.05) + 0.20(0.10) + 0.35 = 0.3775 </math>
The input vector x is passed through a linear transformation layer which transforms the input into query q, key k, and value v vectors, given by the equations above. This is passed through a stacked multi-head self-attention layer which extracts global information across pairwise sequence of words to produce the output vector Z also given by the equation above. The equation for Z can be compared to how similarity is computed between the key and value pairs in databases. This output is added to the residual input x to preserve the meaning of individual words in addition to the pairwise representations. This is normalized to produce the output <math>\mathbf{(Z+x)} \in \mathbb{R}^{h \times r}</math>. This serves as the input to the feed forward neural network.
* <math> h₁ = \sigma(z₁¹) = \frac{1}{1 + e^{-0.3775}} \approx 0.5933 </math>


==== Feed Forward Neural Network ====
For neuron h₂:
The structure of the feed forward network (FFN) is Linear Layer 1, followed by ReLU activation and then another linear layer 2. While the attention mechanism captures global information between words and hence aggregates across columns, the feed forward neural network aggregates across rows and takes a more broader look at each word independently. Depsite the individual processing, all positions share the same set of weights and biases in the FFN. In a classroom environment, the attention mechanism is similar to the teacher observing the interactions among students in a group, whereas the feed forward neural network resembles the teacher evaluating each student independently for their understanding of the assignment. The output of the feed forward layer r also has a residual connection from the previous layer which is normalized and passed as the input of the decoder as <math>\mathbf{(r+(z+x))}</math>. The encoder also has a positional encoding component which captures information about the position of words in a sequence.
* <math> z₂¹ = w₁₂¹ \cdot x₁ + w₂₂¹ \cdot x₂ + b¹ = 0.25(0.05) + 0.30(0.10) + 0.35 = 0.3925 </math>
* <math> h₂ = \sigma(z₂¹) = \frac{1}{1 + e^{-0.3925}} \approx 0.5968 </math>


While the above figure zooms in at how a word vector x is processed by the encoder, the major advantage of the transformer architecture is its ability to handle multiple words in a sequence in parallel and so in practice, the above zoomed in version of the encoder is usually stacked to handle a group of words in parallel.
===== 2. Output Layer =====
* <math> z² = w₁₁² \cdot h₁ + w₂₁² \cdot h₂ + b² = 0.40(0.5933) + 0.45(0.5968) + 0.60 = 1.1051 </math>
* <math> \hat{y} = \sigma(z²) = \frac{1}{1 + e^{-1.1051}} \approx 0.7511 </math>


==== Global v.s. Local Information
==== Step 2: Compute Error ====


For Attention Mechanism:
* <math> E = \frac{1}{2} (\hat{y} - y)^2 = \frac{1}{2} (0.7511 - 0.01)^2 \approx 0.2738 </math>


* '''Global Understanding''': Captures relationships among different positions in the sequence.
==== Step 3: Backpropagation ====
* '''Context Aggregation''': Spreads relevant information across the sequence, enabling each position to see a broader context.


For Feed-Forward Networks (FFN):
===== 3.1: Gradients for Output Layer =====


* '''Local Processing''': While attention looks across the entire sequence, FFN zooms back in to process each position independently.
1. Gradient w.r.t. output neuron:
* '''Individual Refinement''': Enhances the representation of each position based on its own value, refining the local information gathered so far.
* <math> \delta² = (\hat{y} - y) \cdot \hat{y} \cdot (1 - \hat{y}) </math>
* <math> \delta² = (0.7511 - 0.01) \cdot 0.7511 \cdot (1 - 0.7511) = 0.1381 </math>


=== Decoder ===
2. Update weights and bias for hidden-to-output layer:
The decoder consist of three main components: Masked Self Attention, Cross Attention and Linear Layer. The architecture of the Decoder is given below:
* <math> w₁₁² = w₁₁² - \eta \cdot \delta² \cdot h₁ = 0.40 - 0.5 \cdot 0.1381 \cdot 0.5933 = 0.359 </math>
[[File:Transformer-Decoder.png|center|thumb|Decoder architecture of the Transformer]]
* <math> w₂₁² = w₂₁² - \eta \cdot \delta² \cdot h₂ = 0.45 - 0.5 \cdot 0.1381 \cdot 0.5968 = 0.409 </math>
* <math> b² = b² - \eta \cdot \delta² = 0.60 - 0.5 \cdot 0.1381 = 0.53095 </math>


==== Masked Self Attention ====
===== 3.2: Gradients for Hidden Layer =====
In masked self attention, we add a mask matrix <math>\mathbf{M} \in \mathbb{R}^{n \times n}</math> to the normalized argument within the softmax of <math>\mathbf{Z}</math> given by
<math>
\mathbf{Z}_{r \times n} = \mathbf{V}_{r \times n} \cdot \text{softmax}\left(\frac{\mathbf{Q}^{T} \mathbf{K} + \mathbf{M}}{\sqrt{p}}\right)_{n \times n}
</math>
The reason for adding a mask matrix M is to ensure that the output is informed only by the past words and not by the words further along in the sequence. The mask matrix therefore is given by:


<math>M(i,j) = \begin{cases}
1. Gradients for hidden layer neurons:
0 & \text{if } j \leq i \
-\infty & \text{if } j > i
\end{cases}</math>


This is because <math>\mathbf{Z}</math> is an upper triangular matrix with values for previous words since <math>softmax(x + 0)</math> is the same as <math>softmax(x)</math>, but <math>softmax(x - \infty)</math> will be equal to 0.
For h₁:
* <math> \delta₁ = \delta² \cdot w₁₁² \cdot h₁ \cdot (1 - h₁) </math>
* <math> \delta₁ = 0.1381 \cdot 0.40 \cdot 0.5933 \cdot (1 - 0.5933) = 0.0138 </math>


==== Cross Attention ====
For h₂:
The intuition behind cross attention is similar to sequence-to-sequence models where the context vector is passed from the encoder to the decoder capturing relevant information from the input sequence. The residual connection plus the output of the masked self attention is passed as the query to the cross attention block, whereas the key and value pairs are the same as the output of the encoder. The relationship and relevance between words in different sentences are captured.
* <math> \delta₂ = \delta² \cdot w₂₁² \cdot h₂ \cdot (1 - h₂) </math>
* <math> \delta₂ = 0.1381 \cdot 0.45 \cdot 0.5968 \cdot (1 - 0.5968) = 0.0148 </math>


==== Linear Layer ====
2. Update weights and bias for input-to-hidden layer:
The linear layer is applied to the output of the feed forward neural network of the decoder and its primary role is to adjust the dimensionality of the network to match the size of the vocabulary. It involves learning a set of parameters - a matrix of dimension equal to <math> p \times len(vocab)</math>. This results in a <math> p \times 1</math> vector which is then passed through a probabilistic softmax layer to predict the next word in the sequence.


====  Softmax Activation ====
For w₁₁¹:
The function transforms the linear layer's output into probabilities as mentioned above. The output represents the likelihood of a respective word being the next word in the sequence.
* <math> w₁₁¹ = w₁₁¹ - \eta \cdot \delta₁ \cdot x₁ = 0.15 - 0.5 \cdot 0.0138 \cdot 0.05 = 0.14965 </math>


=== Positional Encoding ===
For w₂₁¹:
So far, the encoder and decoder has no sense of the order of the words in the sequence. The sentences "I am a teacher", "Teacher I am", "Am I a teacher?" are processed the same way, even though the meaning may not be the same. To circumvent this issue, and due to the lack of the convolution or recurrence operations, a positional encoding scheme is embedded within the encoder and decoder. In this encoding, the position of the words in a sequence is encoded by a vector. The even positions are represented by a sinusoidal wave with 1 representing the peaks and 0 representing the troughs. Similarly, the odd positions are represented by a cosine wave. Thus, each position is encoded by a unique binary vector and each unique binary vector represents a specific position.
* <math> w₂₁¹ = w₂₁¹ - \eta \cdot \delta₁ \cdot x₂ = 0.20 - 0.5 \cdot 0.0138 \cdot 0.10 = 0.19931 </math>
 
For b¹:
* <math> b¹ = b¹ - \eta \cdot (\delta₁ + \delta₂) = 0.35 - 0.5 \cdot (0.0138 + 0.0148) = 0.3347 </math>
 
 
This completes one iteration of forward and backward propagation.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.5 ==
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===  
Consider the loss function <math>Q(w) = w^2 + 2w + 1</math>.
Compute the gradient of <math>Q(w)</math>.
Starting from <math>w_0 = 2</math>, perform two iterations of stochastic gradient descent using a learning rate <math>\rho = 0.1</math>.
 
=== Solution ===
Compute the gradient at <math>w_0</math>:<math>\nabla Q(w_0) = \frac{d}{dw_0}(w_0^2 + 2w_0 + 1) = 2w_0 + 2 = 2(2) + 2 = 4 + 2 = 6</math>
 
Update the weight using SGD:
<math>w_1 = w_0 - \rho \cdot \nabla Q(w_0) = 2 - 0.1 \cdot 6 = 2 - 0.6 = 1.4</math>
 
Compute the gradient at <math>w_1</math>:
<math>\nabla Q(w_1) = \frac{d}{dw_1}(w_1^2 + 2w_1 + 1) = 2w_1 + 2 = 2(1.4) + 2 = 2.8 + 2 = 4.8</math>
 
Update the weight again:
<math>w_2 = w_1 - \rho \cdot \nabla Q(w_1) = 1.4 - 0.1 \cdot 4.8 = 1.4 - 0.48 = 0.92</math>
 
 
Gradient Path Figure:
 
[[File:gradient.png|thumb|center|600px|Gradient Descent Path on Loss Function]]
 
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.6 ==
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
What is the prediction of the following MLP for <math>x = [221]</math>?
 
[[File:mlp.png|321px|thumb|center|Diagram of the MLP]]
 
Both layers are using sigmoid activation. The weight matrices connecting the input and hidden layer, and the hidden layer and output are respectively: 
<math> V = [101110], \quad W = [01]. </math>
 
Choose the correct answer: <br>
a) <math>\sigma(0)</math> <br> 
b) <math>\sigma(\sigma(0))</math> <br> 
c) <math>\sigma(-1)</math> <br> 
d) <math>\sigma(\sigma(0))</math> 
 
=== Solution ===
The correct answer is <b>b)</b>: <math>\sigma(\sigma(0))</math>.
 
=== Calculation ===
Step 1: Compute the hidden layer output <math>h</math>.  <br>
<math>h = \sigma(Vx) = [σ(3)σ(0)]</math> 
 
Step 2: Compute the output layer prediction <math>y</math>. <br>
<math>y = \sigma(Wh) = \sigma(\sigma(0))</math> 
 
Thus, the prediction of the MLP is <math>\sigma(\sigma(0))</math>.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
 
== Exercise 3.7 ==
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
<p>Feedforward Neural Networks (FNNs) are one of the commonly used model in deep learning. In the context of training such networks, there are several important design components and techniques to consider. </p>
 
(a) Give three commonly used activation functions. For each function, provide the formula and comment on its usage.
 
(b) Write down a widely used loss function for classification and explain why it is popular. Provide an example.
 
(c) Explain what adaptive learning methods are and how they help optimize and speed up neural network training.
 
=== Solution ===
 
<p>(a)</p>
    <ol>
        <li><strong>Sigmoid Activation Function</strong>
            <p><math>f(z) = \frac{1}{1 + e^{-z}}</math></p>
            <p>The output of the sigmoid function ranges from 0 to 1, making it suitable for estimating probabilities. For example, it can be used in the final layer of a binary classification task.</p>
        </li>
<li><strong>ReLU (Rectified Linear Unit) Activation Function</strong>
    <p>
        <math> f(z) = \max(0, z) = \begin{cases}
            z, & \text{if } z > 0, \
            0, & \text{if } z \leq 0.
        \end{cases} </math>
    </p>
<p> ReLU outputs zero or a positive number, enabling some weights to be set to 0, promoting sparse representation. Since it only requires a comparison, and possibly setting a number to zero, it is more computationally efficient than other activation functions. An activation function similar to ReLU is the Gaussian error linear unit (GELU), which has a very similar shape except it is smooth at <math>z=0</math>.</p>
        <li><strong>Tanh (Hyperbolic Tangent) </strong>
            <p><math>f(z) = \frac{e^{z}-e^{-z}}{e^{z}+e^{-z}}</math>
            <p> Advantages: It can have zero-centered output, which helps during optimization by leading to balanced gradient updates; It's also a smooth gradient that works well in many cases. It also squashes extreme values into the range [-1,1], reducing the bias introduced from outlying datapoints. </p>
            <p> Disadvantages: It outputs close to -1 or 1 can have near-zero gradients, leading to slower learning (vanishing gradient issue).</p>
        </li>
    </ol>
 
<p>(b)</p>
    <p><strong>Cross-Entropy Loss</strong> 
        <br>
        <math>\mathcal{L}_{\text{CE}} = -\sum_{i=1}^{n} \bigl[\, y_i \log\bigl(y_{\text{pred},i}\bigr)\ +\ (1 - y_i)\,\log\bigl(1 - y_{\text{pred},i}\bigr) \bigr]</math>
    </p>
    <p> It provides a smooth and continuous gradient, and it penalizes the incorrect predictions more when the predictions are made with confidence. It is well suited for multi-class classification, especially when used with softmax function together.
    </p>
   
    <p> Consider a binary classification problem where <math>y_i=[1,0,1],y_{\text{pred},i}=[0.9,0.2,0.7]</math>. Using the <math>\mathcal{L}_{\text{CE}}</math>, we could calculate:
        <br>
        <math>\mathcal{L}_{\text{CE}} = -\frac{1}{3}\bigl[1\cdot \log\bigl(0.9\bigr)\ +0\cdot \log\bigl(0.1\bigr)+0\cdot \log\bigl(0.2\bigr)+1\cdot \log\bigl(0.7\bigr) ]\approx 0.154</math>
    </p>
    <p> The gradient of the loss with respect to <math>y_{\text{pred},i}</math> is:
        <br>
        <math>\frac{\partial \mathcal{L}_{\text{CE}}}{\partial y_{\text{pred},i}}=-\frac{1}{n}[\frac{y_i}{y_{\text{pred},i}}-\frac{1-y_i}{1-y_{\text{pred},i}}]
</math>
    </p>
    <p> Calculate the gradients, <math>\frac{\partial \mathcal{L}_{\text{CE}}}{\partial y_{\text{pred},1}}\approx -0.370,\frac{\partial \mathcal{L}_{\text{CE}}}{\partial y_{\text{pred},2}}\approx 0.417,\frac{\partial \mathcal{L}_{\text{CE}}}{\partial y_{\text{pred},3}}\approx -0.476</math>, which is a relatively smooth gradient.</p>
    <p> The loss should be between 0 and 1 for a binary classification. A value of 0.154 shows that the model performs well.
    </p>
    <p> When <math>y_{\text{pred},i}</math> is close to 1 but the true label <math>y_i=0</math>, the term <math>\ (1 - y_i)\,\log\bigl(1 - y_{\text{pred},i}\bigr)</math> would approach infinity. This is because <math>\log\bigl(1 - y_{\text{pred},i}\bigr)\to -\infty </math> when <math>y_{\text{pred},i}\to 1</math>. This large gradient would force the model to correct overconfidence.
    </p>
 
<p>(c)</p>
    <p>Some variants of SGD adjust the learning rate during the training process based on the gradients' magnitudes, helping accelerate convergence and manage gradients more effectively. </p>
 
</div>
 
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.8 ==
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
Consider a Feedforward Neural Network (FNN) with a single neuron, where the loss function is given by: <math>L(w)=(w-3)^2</math>. Compute the gradient of <math>L(w)</math>. Starting from <math>w_{0}=0</math> perform two iterations of Stochastic Gradient Descent (SGD) using a learning rate <math>\eta = 0.5 </math>
 
=== Solution ===
Gradient of <math>L(w)</math>: <br>
<math>
\frac{dL}{dw}=2(w-3)</math><br>
<math>w_{0}=0</math><br>
<math>w_{1}=w_{0}-\eta \frac{dL}{dw}=3</math><br>
<math>w_{2}=w_{1}-\eta \frac{dL}{dw}=3</math><br>
So, after 2 iterations, <math>w_{2}=3</math>.
 
 
=== Additional Expanded Question ===
What if the loss function were <math>L(w) = (w - 3)^4</math>? Compute its gradient and perform two iterations of SGD starting from <math>w_{0} = 0</math> using the same learning rate <math>\eta = 0.5</math>. Do we still reach <math>w = 3</math> in two steps?
 
=== Additional Solution ===
For <math>L(w) = (w - 3)^4</math>, the gradient is:
<math>\frac{dL}{dw} = 4(w - 3)^3</math>.
 
1. **Iteration 1** (<math>k=0</math>):
<math>\frac{dL}{dw}\big\rvert_{w=0} = 4(0 - 3)^3 = 4 \times (-27) = -108</math>. 
<math>w_{1} = 0 \;-\; 0.5 \times (-108) = 54</math>.
 
2. **Iteration 2** (<math>k=1</math>):
<math>\frac{dL}{dw}\big\rvert_{w=54} = 4(54 - 3)^3 = 4 \times 51^3 = 4 \times 132651 = 530604</math>. 
<math>w_{2} = 54 \;-\; 0.5 \times 530604 = 54 - 265302 = -265248</math>.
 
Clearly, <math>w</math> does not converge to <math>3</math> in just two steps. Because <math>w</math> is far from <math>3</math> initially, the gradient is extremely large and causes a massive overshoot. In practice, you would reduce <math>\eta</math> or use more sophisticated optimization methods to handle the higher-order curvature of this loss function.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.9 ==
 
<b>Level:</b> ** (Moderate) 
 
<b>Exercise Types:</b> Modified 
 
<b>References:</b> Source: Schonlau, M., Applied Statistical Learning. With Case Studies in Stata, Springer. ISBN 978-3-031-33389-7 (Chapter 14, page 318).
 
=== Question ===
Consider the feedforward neural network with initial weights shown in Figure 3.9 (For simplicity, there are no biases). Use sigmoid activation functions (<math> \sigma(x) = \frac{1}{1+e^{-x}} </math>) for both the hidden and the output layers. Use a learning rate of <math> \rho= 0.5</math>.
 
[[Image:Ex 3.9.jpg|thumb|600px|left|Figure 3.9]]
<br clear="all">
 
(a): Compute a forward pass through the network for the observation (y,x1,x2,x3) = (1,3,-2,5). That is, compute the predicted probability <math> p_1 </math>.
 
(b): Using the result from (a), make a backward pass to compute the revised w7 and w1. Use squared error loss: <math> E = 0.5 * (y-p_1)^2 </math>, where <math> y\in \{0,1\} </math> is the true value of the response and <math>p_1</math> is the predicted probability.
 
=== Solution ===
 
==== (a) ====
 
<math> z_A = x_1w_1 + x_2w_2 + x_3w_3 = 3*0.8+(-2)*(-1)+5*0.1=4.9 </math>
 
<math> z_B = x_1w_4 + x_2w_5 + x_3w_6 = 3*0.3+(-2)*0.5+5*(-0.2)=-1.1 </math>
 
<math> out_A = \frac{1}{1+e^{-z_A}} = \frac{1}{1+e^{-4.9}} = 0.9926 </math>
 
<math> out_B = \frac{1}{1+e^{-z_B}} = \frac{1}{1+e^{1.1}} = 0.2497 </math>
 
<math> z_1 = out_Aw_7+out_Bw_8=0.9926*1.3+0.2497*0.4=1.3903 </math>
 
<math> p_1 = \frac{1}{1+e^{-z_1}} = \frac{1}{1+e^{-1.3903}} =0.8006 </math>
 
==== (b) ====
Using <math>w_i^{new}=w_i^{old} - \rho \frac{\partial{E}}{\partial{w_i}} </math>
 
<math>\frac{\partial{E}}{\partial{w_7}}=\frac{\partial{E}}{\partial{p_1}}\frac{\partial{p_1}}{\partial{z_1}}\frac{\partial{z_1}}{\partial{w_7}}=(p_1-y)*p_1*(1-p_1)*out_A=-0.0317</math>
 
<math>w_7^{new} = 1.3-0.5*(-0.0317)=1.3159</math>
 
<math>\frac{\partial{E}}{\partial{w_1}}=\frac{\partial{E}}{\partial{p_1}}\frac{\partial{p_1}}{\partial{z_1}}\frac{\partial{z_1}}{\partial{out_A}}\frac{\partial{out_A}}{\partial{z_A}}\frac{\partial{z_A}}{\partial{w_1}}=(p_1-y)*p_1*(1-p_1)*w_7*out_A*(1-out_A)*x_1=-0.0091</math>
 
<math>w_1^{new} = 0.8-0.5*(-0.0091)=0.8046</math>
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.10 ==
 
<b>Level:</b> * (Easy) 
 
<b>Exercise Types:</b> Novel
 
=== Question ===
 
What is vanishing gradient and how is it caused? What is the solution that fixes vanishing gradient?
 
=== Answer ===
The vanishing gradient problem occurs when the gradients used to update weights in a neural network become extremely small as they propagate backward through the layers. This happens because activation functions compress their inputs into a narrow output range. Consequently, their derivatives are very small, particularly for inputs far from zero, causing gradients to shrink exponentially in deeper layers.
As a result, in modern computing, the gradient will be the result of multiplying multiple epsilon sized gradients where the resulting update is 0. To fix this, we use the relu activation function where the gradient is either 0 or 1. This ensures that the update value will not vanish due to small gradients.
This is because ReLU does not squash its outputs into a narrow range. For positive inputs, the gradient of ReLU is constant and equal to 1, ensuring that gradients remain significant during backpropagation. Unlike other functions that lead to exponentially small gradients, ReLU’s piecewise linear nature avoids the compounding effect of small derivatives across layers. By maintaining larger gradient values, ReLU ensures that weight updates are not hindered, making it an effective solution to the vanishing gradient problem, especially in deep networks.
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.11 ==
 
<b>Level:</b> ** (Moderate) 
 
<b>Exercise Types:</b> Novel 
 
=== Question ===
Given a two-layer neural network with the following specifications: 
 
Inputs: Represented as <math>\mathbf{x} = [x_1, x_2]^T</math>, a <math>2\times1</math> column vector. 
 
Weights: First layer weight matrix: <math>W_1</math>, a <math>2\times2</math> matrix; Second layer weight vector: <math>W_2</math>, a <math>1\times2</math> row vector. 
 
Activations: The activation function for all layers is the sigmoid function, defined as: <math>\sigma(z) = \frac{1}{1 + e^{-z}}</math>.
 
Loss Function: The cross-entropy loss, given by <math> L = -y \log(\hat{y}) - (1 - y) \log(1 - \hat{y})</math> where <math>y</math> is the true label (0 or 1) and <math>\hat{y}</math> is the predicted output.
 
(a). Write out the forward propagation steps.
(b). Calculate the derivative of the loss with respect to weights in <math>W_1</math> and <math>W_2</math> using the chain rule. 
 
=== Solution ===
 
(a). Forward Propagation Steps:
 
For the first layer pre-activation: <math>\mathbf{z}_1 = W_1 \cdot \mathbf{x}</math> where <math>\mathbf{z}_1</math> is a <math>2\times1</math> column vector. 
 
For the first layer activation: <math>\mathbf{a}_1 = \sigma(\mathbf{z}_1)</math> where the sigmoid function is applied element-wise, resulting in <math>\mathbf{a}_1</math>, a <math>2\times1</math> column vector.
 
For the second layer pre-activation: <math>z_2 = W_2 \cdot \mathbf{a}_1</math> where <math>z_2</math> is a scalar value.
 
For the second layer activation (output): <math>\hat{y} = \sigma(z_2)</math> where <math>\hat{y}</math> represents the predicted probability.
 
For the loss calculation: <math>L = -y \log(\hat{y}) - (1 - y) \log(1 - \hat{y})</math>.
 
 
(b). Derivative of the Loss
 
Gradients for the Second Layer <math>W_2</math>: using the chain rule: <math>
\frac{\partial L}{\partial W_2} = \frac{\partial L}{\partial \hat{y}} \cdot \frac{\partial \hat{y}}{\partial z_2} \cdot \frac{\partial z_2}{\partial W_2}.</math>
 
For the loss gradient w.r.t. output:<math>
  \frac{\partial L}{\partial \hat{y}} = -\frac{y}{\hat{y}} + \frac{1 - y}{1 - \hat{y}}.
  </math>
 
For the gradient of sigmoid output w.r.t. pre-activation:<math>
  \frac{\partial \hat{y}}{\partial z_2} = \hat{y} (1 - \hat{y}).
  </math>
 
For the gradient of pre-activation w.r.t. weights:<math>
  \frac{\partial z_2}{\partial W_2} = \mathbf{a}_1.
  </math>
 
For the combine terms:<math>
  \frac{\partial L}{\partial W_2} = (\hat{y} - y) \cdot \mathbf{a}_1.
  </math>
 
Gradients for the First Layer <math>W_1</math>: using the chain rule:<math>
\frac{\partial L}{\partial W_1} = \frac{\partial L}{\partial \mathbf{a}_1} \cdot \frac{\partial \mathbf{a}_1}{\partial \mathbf{z}_1} \cdot \frac{\partial \mathbf{z}_1}{\partial W_1}.
</math>
 
For the gradient of loss w.r.t. first layer activation:<math>
  \frac{\partial L}{\partial \mathbf{a}_1} = \frac{\partial L}{\partial z_2} \cdot \frac{\partial z_2}{\partial \mathbf{a}_1}</math>;
from the second layer:<math>
  \frac{\partial L}{\partial z_2} = (\hat{y} - y), \quad \frac{\partial z_2}{\partial \mathbf{a}_1} = W_2^T.</math>
So:<math>
  \frac{\partial L}{\partial \mathbf{a}_1} = (\hat{y} - y) \cdot W_2^T.
  </math>
 
For the gradient of activation w.r.t. pre-activation: <math>
  \frac{\partial \mathbf{a}_1}{\partial \mathbf{z}_1} = \mathbf{a}_1 \odot (1 - \mathbf{a}_1),
  </math> where <math>\odot</math> denotes element-wise multiplication.
 
For the gradient of pre-activation w.r.t. first layer weights: <math>
  \frac{\partial \mathbf{z}_1}{\partial W_1} = \mathbf{x}^T.
  </math>
 
For the combine terms: <math>\frac{\partial L}{\partial W_1} = \left[ (\hat{y} - y) \cdot W_2^T \right] \odot \left[ \mathbf{a}_1 \odot (1 - \mathbf{a}_1) \right] \cdot \mathbf{x}^T.</math>
 
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.12 ==
 
<b>Level:</b> ** (Moderate) 
 
<b>Exercise Types:</b> Novel 
 
=== Question ===
Consider the **Bent Identity loss function**, a smooth approximation of the absolute loss, defined as:
 
<math xmlns="http://www.w3.org/1998/Math/MathML">
  l(y, \hat{y}) = \sqrt{1 + (\hat{y} - y)^2} - 1
</math>
 
The following identities may be useful:
 
<math>
\frac{d}{dx} \sqrt{1 + x^2} = \frac{x}{\sqrt{1 + x^2}}, \quad \frac{\partial y}{\partial x} = \frac{\partial y}{\partial u} \frac{\partial u}{\partial x}.
</math>
 
where <math>y</math> is the true response, and <math>\hat{y} = w^T x + b</math> is the predicted response for a feature vector <math>x</math> given model parameters <math>w</math> and <math>b</math>.
 
<b> Part (a): Compute the Gradient </b>
Find the gradient of the loss function with respect to <math>w</math> and <math>b</math>.
 
<b> Part (b): Implement Gradient Descent </b>
Using your result from Part (a), write the update rules for **gradient descent** and implement the iterative optimization process.
 
=== Solution ===
 
<b> Step 1: Computing the Gradient </b>
We differentiate the loss function:
 
<math>
  l(y, \hat{y}) = \sqrt{1 + (\hat{y} - y)^2} - 1.
</math>
 
Differentiating with respect to <math>w</math> and <math>b</math>, we obtain:
 
<math>
    \nabla_w l = \frac{(\hat{y} - y) x}{\sqrt{1 + (\hat{y} - y)^2}}
</math>
 
<math>
    \nabla_b l = \frac{\hat{y} - y}{\sqrt{1 + (\hat{y} - y)^2}}
</math>
 
<b> Step 2: Gradient Descent Update Rules </b>
We update the parameters using gradient descent:
 
<math>
    w_{t+1} = w_t - \eta \nabla_w l
</math>
 
<math>
    b_{t+1} = b_t - \eta \nabla_b l
</math>
 
where <math>\eta</math> is the learning rate.
 
<b> Step 3: Algorithm Implementation </b>
 
<pre>
Initialize w, b randomly
Set learning_rate η
For t = 1 to max_iterations:
    Compute predicted value: y_hat = w^T * x + b
    Compute gradients:
        grad_w = ((y_hat - y) / sqrt(1 + (y_hat - y)^2)) * x
        grad_b = (y_hat - y) / sqrt(1 + (y_hat - y)^2)
    Update parameters:
        w = w - η * grad_w
        b = b - η * grad_b
    Check for convergence
</pre>
 
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.13 ==
 
'''Level:''' ** (Difficult)
 
'''Exercise Types:''' Novel
 
=== Question ===
Consider training a deep neural network with momentum-based SGD on a quadratic approximation of the loss near a local minimum, <math>L(\theta) = \tfrac{1}{2}\theta^\top H ,\theta</math>, where <math>H</math> is the Hessian. Explain how the momentum term modifies the effective condition number of <math>H</math>, and why this can speed convergence in directions with small curvature while controlling overshoot in directions with large curvature. Provide a brief analysis of the discrete iteration dynamics that illustrates this effect.
 
=== Solution ===
Let <math>\theta_t</math> be the parameters at iteration <math>t</math>, and <math>v_t</math> be the velocity term. The momentum-based SGD updates for a quadratic loss can be written as:
 
<math> v_{t+1} = \beta\,v_t + \eta\,H\,\theta_t, \quad \theta_{t+1} = \theta_t - v_{t+1}, </math>
 
where <math>\beta</math> is the momentum coefficient and <math>\eta</math> is the learning rate.
 
In the eigenbasis of <math>H</math>, let <math>\lambda_i</math> be an eigenvalue and <math>u_i</math> the corresponding eigenvector.
 
Projecting the iteration onto the direction <math>u_i</math> yields a scalar recurrence of the form:
 
<math> \theta_{t+1}^{(i)} \;=\; \theta_t^{(i)} \;-\; \bigl[\beta\,v_t^{(i)} \;+\;\eta\,\lambda_i\,\theta_t^{(i)}\bigr]. </math>
 
Because <math>v_t^{(i)}</math> itself depends on past gradients, the combined effect of <math>\beta</math> and <math>\eta,\lambda_i</math> modifies the “effective” eigenvalue seen in that direction. Specifically:
 
Small <math>\lambda_i</math> (Flat Directions)
 
When <math>\lambda_i</math> is small, repeated gradient directions are reinforced by <math>\beta</math>, accelerating convergence compared to vanilla SGD. Effectively, momentum increases the update step in directions that change slowly.
 
Large <math>\lambda_i</math> (Steep Directions)
 
If <math>\lambda_i</math> is large, the term <math>\beta,v_t^{(i)}</math> moderates the sudden jumps, helping to avoid overshooting. The velocity “remembers” past updates, dampening abrupt swings caused by steep curvature.
 
Overall, momentum alters the eigenvalues of <math>H</math> into a more favorable spectrum, reducing the effective condition number. In practice, this translates into faster convergence along flat directions and controlled progress in steep directions, both of which are crucial in the highly non-convex landscapes typical of deep neural networks.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.14 ==
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
Perform one step of backpropagation for the following network:
 
* Input layer: 2 neurons
* Hidden layer: 2 neurons
* Output layer: 1 neuron
* Activation function: sigmoid
* Weight matrix between the input and hidden layer: <math>W_1=[0.40.20.60.3] </math>
*Weight matrix between the hidden layer and output layer: <math>W_2=[0.50.3] </math>
 
* Input:<math>X=[0.50.1] </math>
* Target output: y = 0.8
* Learning rate: η = 0.1
 
=== Solution ===
 
==== Step 1: Forward Pass ====
 
===== Hidden Layer Outputs =====
 
<math> a_1= 0.4*0.5 +(-0.20)*0.10 = 0.18 </math>
 
<math> z_1 = \sigma(a_1) = \frac{1}{1 + e^{-0.18}} \approx 0.545 </math>
 
<math> a_2 =0.5*0.6 + 0.3*0.1 = 0.33 </math>
 
<math> z_2 = \sigma(a_2) = \frac{1}{1 + e^{-0.33}} \approx 0.582 </math>
 
===== Output Layer =====
<math> a_3 = 0.5*(0.545) +(-0.3)*0.582=0.0979 </math>
 
<math> \hat{y} = \sigma(a_3) = \frac{1}{1 + e^{-0.0979}} \approx 0.5245 </math>
 
==== Step 2: Compute Error ====
 
<math> L = (\hat{y} - y)^2 = (0.5245 – 0.8)^2 \approx 0.0759 </math>
 
==== Step 3: Backpropagation ====
 
===== Gradients for Output Layer =====
 
<math> \delta_3 = 2*(\hat{y} - y) =-0.2755 </math>
 
Update weights for hidden-to-output layer:
 
<math> W’_{2[1]} = W_{2[1]}- \eta \cdot \delta_3 \cdot z_1 = 0.5 - 0.1 \cdot (-0.2755) \cdot 0.545 = 0.515 </math>
<math> W’_{2[2]} = W_{2[2]} - \eta \cdot \delta_3 \cdot z_2 = -0.3 - 0.1 \cdot (-0.2755) \cdot 0.582 = -0.284 </math>
 
===== Gradients for Hidden Layer =====
 
<math> \delta_1 = \sigma’(a_1) \cdot \delta_3 \cdot W_{2[1]} = 0.545 \cdot (1 - 0.545) \cdot (-0.2755) \cdot 0.5 = -0.0342 </math>
 
<math> \delta_2 = \sigma’(a_2) \cdot \delta_3 \cdot W_{2[2]} = 0.582 \cdot (1 - 0.582) \cdot (-0.2755) \cdot (-0.3) = 0.0201 </math>
 
Update weights and bias for input-to-hidden layer:
 
<math> W’_{1[11]} = W_{1[11]} - \eta \cdot \delta_1 \cdot X_[1] = 0.4 - 0.1 \cdot (-0.0342) \cdot 0.5 = 0.4017 </math>
 
<math> W’_{1[12]} = W_{1[12]} - \eta \cdot \delta_1 \cdot X_[2] = -0.2 - 0.1 \cdot (-0.0342) \cdot 0.1 = -0.1997 </math>
 
<math> W’_{1[21]} = W_{1[21]} - \eta \cdot \delta_2 \cdot X_[1] = 0.6 - 0.1 \cdot 0.0201 \cdot 0.5 = 0.5990 </math>
 
<math> W’_{1[22]} = W_{1[22]} - \eta \cdot \delta_2 \cdot X_[2] = 0.3 - 0.1 \cdot 0.0201 \cdot 0.1 = 0.2998 </math>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
 
== Exercise 3.15 ==
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Modified (Based on ME 780 Assignment 2, University of Waterloo, Fall 2024 - in the assignment, backpropogation was programmed for a 2D vector field with a deeper network using MATLAB not Python.  This was modified to use Python with a simpler network as an easier exercise to understand backpropogation.  A sigmoid activation function is used rather than tanh)
 
<b>References:</b>
 
A. Ghodsi, STAT 940 Deep Learning: Lecture 3, University of Waterloo, Winter 2025.
 
W. Melek, ME 780 Computational Intelligence Chapter 6 Neural Network Parameter Learning Algorithms Course Notes, University of Waterloo, Fall 2024
 
=== Question ===
 
Define a function <math> f(x) = x^2 </math> on the domain (0,1).
 
Develop a 3 layer feedforward neural network with 10 neurons in the second layer to predict the output of this function.  Use a sigmoid activation function for the hidden layer, and a linear activation function for the output layer. 
 
Manually code backpropogation to learn the weights for this network using Python.
 
Use stochastic gradient descent, as discussed in Lecture 3 of STAT 940.
 
=== Solution ===
<pre>
import numpy as np
import matplotlib.pyplot as plt
 
x = np.linspace(0,1,50).reshape(50,1)
y = x**2
 
#number of neurons in hidden layer
 
#Define a matrix with the weights and biases for the hidden layer
w_1 = np.random.rand(10,1) #10 is the number of neurons in the hidden layer, 1 is the number of neurons in the input layer
b_1 = np.random.rand(10,1)
 
#define a matrix with weights for the output layer
w_2 = np.random.rand(1,10) #1 is the number of neurons in the output layer, 10 is the number of neurons in the hidden layer
b_2 = np.random.rand(1,1)
 
#Sigmoid function in Python credit https://stackoverflow.com/questions/60746851/sigmoid-function-in-numpy
def sigmoid(z):
    return 1/(1 + np.exp(-z))
 
def nn_output(w_1,b_1,w_2,b_2,x):
   
    hidden_layer_output = sigmoid(np.matmul(w_1,np.transpose(x)) + b_1)
   
    return (np.matmul(w_2,hidden_layer_output) + b_2), hidden_layer_output
 
#Plot the desired function and initial neural network output before training
plt.figure(1,figsize=(7,6))
plt.plot(x,y)
plt.plot(x,nn_output(w_1,b_1,w_2,b_2,x)[0].flatten())
plt.title('Neural Network Output Before Training')
plt.legend(['Desired Function','Neural Network Output'])
plt.show()
 
learning_rate = 0.1
 
x2 = np.linspace(0,1,50)
 
#Do 1000 epochs
for i in range(1000):
   
    #shuffle x2 for each epoch
    np.random.shuffle(x2)   
   
    #For each epoch, do stochastic gradient descent, looping through each element in x
    for j in range(x2.shape[0]):
 
        #Evaluate the neural network output at x to get the error of the output
        y_nn = nn_output(w_1,b_1,w_2,b_2,x2[j].reshape(1,1))
       
        #Update the weights and bias in the output layer
       
        #Note - these equations for the output layer only work for a linear activation function, otherwise you'd have to use the chain rule
        #delta is the error in the output
        delta_output = (x2[j]**2 - y_nn[0])
        #Bias update is previous bias + learning rate * delta
        b_2 = b_2 + learning_rate*delta_output
        #Weight update is previous weight + learning rate * delta * input (input is the hidden layer neuron output)
        w_2 = w_2 + np.matmul(learning_rate*delta_output,np.transpose(y_nn[1]))
       
        #Update the weights and bias in the hidden layer
        #Note that the derivative of the sigmoid function is f'(x) = y(1-y)
        delta_hidden = (y_nn[1])*np.matmul(np.transpose(w_2),delta_output)
        #Bias update is same like above
        b_1 = b_1 + learning_rate*delta_hidden
        #Weight update is same like above
        w_1 = w_1 + learning_rate*np.matmul(delta_hidden,x2[j].reshape(1,1))
       
#Plot the desired function and initial neural network output after training
plt.figure(1,figsize=(7,6))
plt.plot(x,y)
plt.plot(x,nn_output(w_1,b_1,w_2,b_2,x)[0].flatten())
plt.title('Neural Network Output After Training')
plt.legend(['Desired Function','Neural Network Output'])
plt.show()
</pre>
   
 
[[Image:315a.png|thumb|300px|center|Neural Network Output Before Training]]
 
 
[[Image:315b.png|thumb|300px|center|Neural Network Output after Using Backpropogation for Training]]
</div>
 
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.16 ==
'''Level:''' * (Moderate)
 
'''Exercise Types:''' Copied
 
'''Reference:''' Calin, Ovidiu. Deep learning architectures: A mathematical approach. Springer, 2020
 
This question is from exercise 6.6.9 on page 198.
 
=== Question ===
Consider a one-hidden layer neural network with sigmoid neurons in the hidden layer. Given that the input is normally distributed, <math>X \sim N(0,1)</math>, and the output is <math>Y=\sum_{i=1}^N\alpha_i\sigma(w_i X+b_i)</math>. Show that <math>Var(Y)</math> is approximately <math>\sum_i \sigma '(b_i)^2\alpha_i^2w_i^2</math>.
 
=== Solution ===
The variance of Y is given by <math>Var(Y) = Var\left(\sum_{i=1}^N\alpha_i\sigma(w_i X+b_i)\right) </math>
 
Since the <math>\sigma(w_i X+b_i)</math> terms are not independent, it can be hard to decompose. However, we can use a linear approximation as follows for small values <math>w_i X</math> around <math>b_i</math>:
 
<math>\sigma(w_i X+b_i) \approx \sigma(b_i) + \sigma '(b_i) w_iX</math>
 
Therefore, we have <math>Var(Y) \approx Var\left(\sum_{i=1}^N\alpha_i(\sigma(b_i) + \sigma '(b_i) w_iX)\right) = Var\left(\sum_{i=1}^N\alpha_i\sigma '(b_i) w_iX\right) = \left(\sum_{i=1}^N\alpha_i\sigma '(b_i) w_i\right)^2</math> since <math>X \sim N(0,1)</math>
 
This is approximately equal to <math>\sum_i \sigma '(b_i)^2\alpha_i^2w_i^2</math> if we ignore the cross terms. Note that the squared terms dominate the cross terms since the squared terms are always positive, and we assume weights are small.
 
 
</div>
 
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.17 ==
'''Level:''' * (Moderate)
 
'''Exercise Types:''' Modified
 
=== Question ===
 
Consider the loss function <math>Q(w) = w^2 + 3w + 5</math>.
 
Compute the gradient of <math>Q(w)</math>.
Starting from <math>w_0 = -2</math>, perform three iterations of stochastic gradient descent using a learning rate <math>\rho = 0.15</math>.
Explain how the choice of <math>\rho</math> influences the stability and speed of convergence for this loss function.
=== Solution ===
 
Compute the gradient of <math>Q(w)</math>:
<math>\nabla Q(w) = \frac{d}{dw}(w^2 + 3w + 5) = 2w + 3</math>
 
At <math>w_0 = -2</math>:
<math>\nabla Q(w_0) = 2(-2) + 3 = -4 + 3 = -1</math>
Update <math>w</math>:
<math>w_1 = w_0 - \rho \cdot \nabla Q(w_0) = -2 - 0.15 \cdot (-1) = -2 + 0.15 = -1.85</math>
 
At <math>w_1 = -1.85</math>:
<math>\nabla Q(w_1) = 2(-1.85) + 3 = -3.7 + 3 = -0.7</math>
Update <math>w</math>:
<math>w_2 = w_1 - \rho \cdot \nabla Q(w_1) = -1.85 - 0.15 \cdot (-0.7) = -1.85 + 0.105 = -1.745</math>
 
At <math>w_2 = -1.745</math>:
<math>\nabla Q(w_2) = 2(-1.745) + 3 = -3.49 + 3 = -0.49</math>
Update <math>w</math>:
<math>w_3 = w_2 - \rho \cdot \nabla Q(w_2) = -1.745 - 0.15 \cdot (-0.49) = -1.745 + 0.0735 = -1.6715</math>
 
Effect of <math>\rho</math>:
With <math>\rho = 0.15</math>, the convergence is stable, but it might require more iterations for steeper gradients.
A smaller <math>\rho</math> (e.g., <math>\rho = 0.05</math>) would slow down the updates, increasing the number of iterations required to reach the minimum.
A larger <math>\rho</math> (e.g., <math>\rho = 0.5</math>) could lead to overshooting or divergence, especially near sharp curvatures in the loss function.
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.18 ==
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
In a feedforward neural network, explain why introducing more hidden layers can potentially improve the network's capacity to model complex functions. However, why might adding too many hidden layers degrade the model's performance or make training difficult?
 
=== Solution ===
 
<p>
        Adding more hidden layers increases the <strong>expressive power</strong> of the network, enabling it to approximate more complex functions. This stems from the Universal Approximation Theorem, which states that a sufficiently large feedforward neural network with non-linear activation functions can approximate any continuous function on a compact subset of <em>ℝ<sup>n</sup></em>. Each additional layer allows the network to learn and represent features at different levels of abstraction, with earlier layers capturing simpler patterns and deeper layers identifying more complex relationships.
    </p>
    <p>However, adding too many hidden layers introduces several challenges:</p>
    <ul>
        <li><strong>Vanishing/Exploding Gradients:</strong> During backpropagation, the gradients of the loss function with respect to weights in earlier layers can diminish (vanishing) or grow uncontrollably (exploding). This makes it difficult to update weights effectively and slows down or destabilizes training.</li>
        <li><strong>Overfitting:</strong> Excessively deep networks with many parameters are prone to overfitting, especially if the training data is insufficient or noisy. The network may memorize the training data instead of generalizing well to unseen data.</li>
        <li><strong>Computational Cost:</strong> Deeper networks require more computation, leading to longer training times and higher resource demands, which might be inefficient for certain applications.</li>
        <li><strong>Optimization Challenges:</strong> Deep networks create highly non-convex loss landscapes, increasing the risk of getting stuck in poor local minima or saddle points, making convergence to a good solution more challenging.</li>
        <li><strong>Diminishing Returns:</strong> Beyond a certain depth, additional layers may no longer contribute significantly to the network's ability to learn, resulting in wasted computational resources.</li>
    </ul>
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
 
== Exercise 3.19 ==
 
<b>Level:</b> * (Easy) 
 
<b>Exercise Types:</b> Modified 
 
<b>References:</b> Calin, Ovidiu. Deep learning architectures: A mathematical approach. Springer, 2020, Exercise 4.17.2, Page 130.
 
=== Question ===
Consider the quadratic function <math> Q(x)=\frac{1}{2}\mathbf{x}^T A \mathbf{x}-b \mathbf{x} </math>, with <math>A</math> nonsingular square matrix of order <math>n</math>.
 
(1) Find the gradient.
 
(2) Write down the update equation using standard gradient descent and momentum
 
=== Solution ===
(1) <math> \nabla Q(x)= A \mathbf{x}-b </math>
 
(2) Update equation given by gradent descent
 
<math>\mathbf{x}_{t+1}=\mathbf{x}_{t}-\rho\nabla Q(x_t)=\mathbf{x}_{t}-\rho (A\mathbf{x}_t-b)=(I-\rho A)\mathbf{x}_t+\rho b</math>
 
Update equation given by momentum
<math>\mathbf{v}_{t+1}=\beta\mathbf{v}_{t}+(1-\beta)\nabla Q(x) = \beta \mathbf{v}_{t}+(1-\beta)(A\mathbf{x}_t-b)</math>
 
<math>\mathbf{x}_{t+1}=\mathbf{x}_{t}-\rho\mathbf{v}_{t+1}=(I-\rho(1-\beta)A)\mathbf{x}_t-\rho\beta\mathbf{v}_t+\rho(1-\beta)b</math>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.20 ==
 
<b>Level:</b> * (Easy) 
 
<b>Exercise Types:</b> Novel
 
=== Question ===
Consider a simple feedforward neural network with one hidden layer. The network takes an input vector <math>x = [x_1, x_2, ..., x_n]</math>, passes it through a hidden layer with activation function <math>\sigma</math>, and produces an output <math>y_{\text{pred}}</math> via a linear output layer.
 
The architecture of the network is as follows:
* Input Layer: <math>x = [x_1, x_2, ..., x_n]</math>
* Hidden Layer: <math>h = \sigma(W_1 x + b_1)</math>, where <math>W_1 \in \mathbb{R}^{m \times n}</math> and <math>b_1 \in \mathbb{R}^m</math> are the weights and bias of the hidden layer,
* Output Layer: <math>y_{\text{pred}} = W_2 h + b_2</math>, where <math>W_2 \in \mathbb{R}^{1 \times m}</math> and <math>b_2 \in \mathbb{R}</math> are the weights and bias of the output layer.
 
Given the mean squared error (MSE) loss function:
<math>
L = \frac{1}{2} (y_{\text{true}} - y_{\text{pred}})^2
</math>
where <math>y_{\text{true}}</math> is the true target value.
 
Derive the backpropagation equations for updating the weights <math>W_1, W_2</math> and biases <math>b_1, b_2</math> using gradient descent.
 
=== Solution ===
=== Step 1: Gradients with respect to <math>W_2</math> and <math>b_2</math> ===
 
The predicted output <math>y_{\text{pred}}</math> is given by:
<math>
y_{\text{pred}} = W_2 h + b_2
</math>
 
The derivative of the loss function with respect to <math>y_{\text{pred}}</math> is:
<math>
\frac{\partial L}{\partial y_{\text{pred}}} = -(y_{\text{true}} - y_{\text{pred}})
</math>
 
Now, compute the gradient of the loss with respect to <math>W_2</math> and <math>b_2</math>:
 
For <math>W_2</math>:
<math>
\frac{\partial L}{\partial W_2} = \frac{\partial L}{\partial y_{\text{pred}}} \cdot \frac{\partial y_{\text{pred}}}{\partial W_2} = -(y_{\text{true}} - y_{\text{pred}}) \cdot h
</math>
 
For <math>b_2</math>:
<math>
\frac{\partial L}{\partial b_2} = \frac{\partial L}{\partial y_{\text{pred}}} \cdot \frac{\partial y_{\text{pred}}}{\partial b_2} = -(y_{\text{true}} - y_{\text{pred}})
</math>
 
=== Step 2: Gradients with respect to <math>W_1</math> and <math>b_1</math> ===
 
Next, we compute the gradients with respect to the hidden layer parameters.
 
The hidden layer activation is:
<math>
h = \sigma(W_1 x + b_1)
</math>
 
Using the chain rule, we first compute <math>\frac{\partial L}{\partial h}</math>:
<math>
\frac{\partial L}{\partial h} = \frac{\partial L}{\partial y_{\text{pred}}} \cdot \frac{\partial y_{\text{pred}}}{\partial h} = -(y_{\text{true}} - y_{\text{pred}}) \cdot W_2
</math>
 
Then, we compute the gradient with respect to <math>W_1</math> and <math>b_1</math>:
 
For <math>W_1</math>:
<math>
\frac{\partial L}{\partial W_1} = \frac{\partial L}{\partial h} \cdot \frac{\partial h}{\partial W_1} = -(y_{\text{true}} - y_{\text{pred}}) \cdot W_2 \cdot \sigma'(W_1 x + b_1) \cdot x^T
</math>
 
For <math>b_1</math>:
<math>
\frac{\partial L}{\partial b_1} = \frac{\partial L}{\partial h} \cdot \frac{\partial h}{\partial b_1} = -(y_{\text{true}} - y_{\text{pred}}) \cdot W_2 \cdot \sigma'(W_1 x + b_1)
</math>
 
=== Step 3: Update Equations ===
 
Using the gradients derived above, the updates for the weights and biases using gradient descent are:
 
For <math>W_2</math>:
<math>
W_2^{(t+1)} = W_2^{(t)} - \eta \frac{\partial L}{\partial W_2}
</math>
 
For <math>b_2</math>:
<math>
b_2^{(t+1)} = b_2^{(t)} - \eta \frac{\partial L}{\partial b_2}
</math>
 
For <math>W_1</math>:
<math>
W_1^{(t+1)} = W_1^{(t)} - \eta \frac{\partial L}{\partial W_1}
</math>
 
For <math>b_1</math>:
<math>
b_1^{(t+1)} = b_1^{(t)} - \eta \frac{\partial L}{\partial b_1}
</math>
 
Where <math>\eta</math> is the learning rate.
 
</div>
 
 
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.21 ==
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
=== Question ===
There are many choices of activation functions in Feedforward Neural Networks, such as the sigmoid functions and hyperbolic tangent. This question considers other possibilities.
 
(a) Suppose a and b are constants. Is <math>a \tanh(b x)</math> a good candidate?
(b) Is <math>sin(x)</math> a good activation function?
 
=== Solution ===
(a) It could be a good candidate, but the main effect would be similar to <math>\tanh(x)</math>. The addition of constants can scale the intermediate values within the networks and therefore can affect the convergence rate, akin to the effect of batch normalization.
 
(b) It may not be a good choice of activation function. Although it introduces nonlinearities in the training, the periodicity also introduces many local minimum, exacerbating the issue of escaping local minima.
 
Smaller mini-batch size outperforms larger mini-batch size when we need to deal with highly non-convex optimization problems where escaping local minima is prioritized. Nevertheless, it may cause the model not to converge effectively as one of the drawbacks.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.22 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
 
Assume you are training a nerual network model with gradient decent. There is a dataset with 1000 samples.
 
1. If you choose a mini-batch size of 100, how many times will the weights be updated during training?
 
2. If the mini-batch size is 50, how will the number of updates change? Why?
 
=== Solution ===
 
1. The dataset has 1000 samples, and each mini-batch has 100 samples. Thus, the number of weight updates will be:
 
<math>\frac{1000}{100} = 10</math> updates.
 
2. If the mini-batch size is 50, the number of weight updates will be:
 
<math>\frac{1000}{50} = 20</math> updates.
 
Therefore, the number of updates increases, and asmaller mini-batch results in more frequent updates, but each update involves fewer sample.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.23 ==
 
<b>Level:</b> ** (Moderate) 
 
<b>Exercise Types:</b> Novel 
 
=== Question ===
 
Given a simple linear regression model y = w x + b and a single training example (x=2,y=4), show how to perform one Stochastic Gradient Descent update step for w and b. Suppose:
\begin{aligned}
& w=1, \quad b=0, \
& L = \frac{1}{2}\bigl(y_{\mathrm{pred}} - y\bigr)^{2}, \quad \eta = 0.1.
\end{aligned}
=== Solution ===
\begin{aligned}
y_{\text{pred}} & = w \cdot x + b = 1 \cdot 2 + 0 = 2, \
\text{error} & = y_{\text{pred}} - y = 2 - 4 = -2, \
\frac{\partial L}{\partial w} & = (y_{\text{pred}} - y) \cdot x = (-2) \cdot 2 = -4, \
\frac{\partial L}{\partial b} & = (y_{\text{pred}} - y) = -2, \
w_{\text{new}} & = w - \eta \cdot \frac{\partial L}{\partial w} = 1 - 0.1 \cdot (-4) = 1.4, \
b_{\text{new}} & = b - \eta \cdot \frac{\partial L}{\partial b} = 0 - 0.1 \cdot (-2) = 0.2.
\end{aligned}
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.24 ==
 
<b>Level:</b> ** (Moderate)
 
<b>Exercise Types:</b> Modified 
 
<b>References:</b> Deep Learning - Foundations and Concepts, by Christopher M. Bishop and Hugh Bishop, Exercise 7.1, Page 212.
 
=== Question ===
 
Prove that the Stochastic Gradient Descent (SGD) algorithm reduces the value of the objective function Q(w), where Q(w) is differentiable, and its gradient satisfies <math>\nabla Q(w)</math>. The goal of the proof is to show that for a sufficiently small learning rate <math> \eta</math>, the weight update rule: <math> w_{t+1} = w_{t} - \eta \nabla Q(w_{t}) </math> ensures that the objective function Q(w) decreases monotonically.
 
=== Solution ===
 
<b> 1. Change in the Objective Function:</b>
 
The change in the objective function value can be expressed as:
 
<math>
Q(w_{t+1}) - Q(w_{t})
</math>
 
Using the first-order Taylor expansion of Q(w), we can approximate it as:
 
<math>
Q(w_{t+1}) \approx Q(w_{t}) + \nabla Q(w_{t})^T(w_{t+1}-w_{t})
</math>
 
<b> 2. Substitude the update rule:</b> Substituting the weight update rule <math> w_{t+1} = w_{t} - \eta \nabla Q(w_{t}) </math>, we get:
 
<math>
Q(w_{t+1}) \approx Q(w_{t}) - \eta \nabla Q(w_{t})^T \nabla Q(w_{t})
</math>
 
<b> 3. Gradient Property:</b>
 
The quadratic term involving the gradient can be written as:
 
<math>
\nabla Q(w_{t})^T \nabla Q(w_{t}) = \| \nabla Q(w_{t}) \|^2
</math>
 
Therefore,
<math>
Q(w_{t+1}) - Q(w_{t}) \approx - \eta \| \nabla Q(w_{t}) \|^2
</math>
 
<b> 4. Conclusion:</b>
 
Since the learning rate <math> \eta > 0 and \| \nabla Q(w_{t}) \|^2 \geq 0 </math>,
 
we have: <math> Q(w_{t+1}) - Q(w_{t}) \leq 0 </math>.
 
As long as the learning rate <math> \eta </math> is sufficiently small, the objective function Q(w) will decrease monotonically, and SGD will converge to a local minimum of Q(w).
 
This proof shows that with an appropriately chosen learning rate, SGD guarantees a reduction in the objective function at each step, making it a reliable optimization method for machine learning tasks.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.25 ==
 
 
<b>Level:</b> ** (Moderate)
 
<b>Exercise Types:</b> Modified (Reference: Probabilistic Machine Learning: An Introduction, 13.2.3 Activation Functions) 
 
=== Question ===
Consider a single-layer neural network with the ReLU activation function defined as:
<math>\text{ReLU}(x) = \max(0, x).</math>
 
Given a weight matrix <math>W</math>, an input vector <math>x</math>, and a bias <math>b</math>, the output of the layer is:
<math>h = \text{ReLU}(Wx + b).</math>
 
Let:
<math>W = [1230],</math>
<math>x = [21],</math>
<math>b = [13].</math>
 
1. Compute the output <math>h</math> of the layer. </br>
2. Derive the gradient of the ReLU activation for the given <math>x</math> and explain how it behaves for positive and negative values of the input.
 
=== Solution ===
 
1. The output is computed as:
<math>
h = \text{ReLU}(Wx + b),
</math>
where:
<math>
Wx = [1230] [21] = [1(2)+(2)(1)3(2)+0(1)] = [2+26+0] = [46].
</math>
 
Adding the bias:
<math>
Wx + b = [46] + [13] = [53].
</math>
 
Applying ReLU:
<math>
h = \text{ReLU}\left([53]\right) = [max(0,5)max(0,3)] = [53].
</math>
 
2. Gradient of ReLU:
 
The derivative of ReLU is defined as:
<math>
\text{ReLU}'(x) =
\begin{cases}
1 & \text{if } x > 0, \
0 & \text{if } x \leq 0.
\end{cases}
</math>
 
For example take <math>x = [21]</math>:
Then <math>2 > 0</math>, the gradient is <math>1</math>.
<math>-1 \leq 0</math>, the gradient is <math>0</math>.
 
Hence, the gradient of ReLU activation behaves as a binary switch, passing gradients only for positive values of the input and blocking gradients for non-positive values.
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.26 == 
<b>Level:</b> ** (Moderate) 
 
<b>Exercise Types:</b> Novel 
 
=== Question === 
Given a single-layer neural network with a sigmoid activation function used for binary classification, the network is trained using stochastic gradient descent (SGD) with the cross-entropy loss function:
 
<math>
L = -[y \cdot \log(\hat{y}) + (1 - y) \cdot \log(1 - \hat{y})],
</math>
 
where <math>y</math> is the binary label (0 or 1) and <math>\hat{y}</math> is the predicted probability.
 
Assuming the input vector <math>x = [0.5, 1.2, -0.3]</math>, label <math>y = 1</math>, and learning rate <math>\eta = 0.01</math>, derive and apply the SGD update rules for a single training instance. Include calculations for the weights and bias from initial random values.
 
=== Solution === 
1. **Forward Pass Calculation:**
Calculate the output before activation, <math>z</math>, by <math>z = w \cdot x + b</math> where initial weights <math>w = [0.2, -0.1, 0.1]</math> and bias <math>b = 0.01</math>. Then apply the sigmoid function to obtain the predicted probability <math>\hat{y} = \frac{1}{1 + e^{-z}}</math>. 
 
2. **Loss and Gradient Calculation:**
Calculate the loss using the cross-entropy formula. Derive the gradients with respect to <math>\hat{y}</math> as <math>\frac{\partial L}{\partial \hat{y}} = -[y \cdot \frac{1}{\hat{y}} - (1 - y) \cdot \frac{1}{1 - \hat{y}}]</math> and chain it to get <math>\frac{\partial L}{\partial z} = \hat{y} - y</math>.
 
3. **Update Weights and Bias:**
Use the gradient and learning rate to update each weight <math>w_i</math> and the bias <math>b</math>:
<math>w_i = w_i - \eta \cdot \frac{\partial L}{\partial z} \cdot x_i</math>, 
<math>b = b - \eta \cdot \frac{\partial L}{\partial z}</math>.
 
For example, the weight update for <math>w_1</math> would be:
<math>w_1 = 0.2 - 0.01 \cdot (\hat{y} - 1) \cdot 0.5</math>,
and similarly for other weights and bias.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.27 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
 
Consider the following two optimization update rules:
 
Standard Gradient Descent (GD):
<math> w_{t+1} = w_t - \rho\nabla Q(w_t) </math>
 
Momentum-Based Update:
<math> v_{t+1} = \beta v_t + (1 - \beta)\nabla Q(w_t) </math>,
<math> w_{t+1} = w_t - \rho v_{t + 1} </math>
Explain the key differences between standard gradient descent and the momentum-based update in terms of:
 
1) How the gradient information is used.
 
2) The behaviour of the optimization process, particularly in flat regions and regions with high curvature.
 
3) The convergence speed to the minimum.
 
=== Solution ===
 
<b> Gradient Information Usage: </b>
 
Standard Gradient Descent: Each update is based solely on the current gradient <math> \nabla Q(w_t) </math>. It does not account for the gradients from previous steps.
 
Momentum: Uses a running average of past gradients, <math> v_t </math>, to smooth out updates. This accumulates past gradient information, making the optimization less sensitive to short-term noise in the gradient.
 
<b> Behaviour in Flat and High-Curvature Regions: </b>
 
Standard Gradient Descent: Progress in flat regions (e.g., plateaus or saddle points) is slow since updates rely only on the small gradients at each step. In high-curvature regions, it may oscillate across the curvature due to abrupt changes in gradient direction.
 
Momentum: Momentum accelerates progress in flat regions by building up velocity from consistent gradients, preventing you from getting stuck in a flat region. It also reduces oscillations in high-curvature regions by smoothing out the updates, leading to more stable convergence.
 
<b> Convergence Speed: </b>
 
Standard Gradient Descent: Typically slower, especially in scenarios where gradients are small or noisy, as it lacks the mechanism to "remember" past gradients.
 
Momentum: Often converges faster, especially when <math> \beta </math> is tuned appropriately. The accumulated velocity helps overcome small local minima and speeds up optimization in flat regions.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.28 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
'''References:''' Adapted from Hastie, T., Tibshirani, R., & Friedman, J. (2021). ''The Elements of Statistical Learning'', pages 174-180.
 
=== Question ===
 
(a) Starting with the given smoothing matrix formulation for the Reinsch form:
\[ S_\lambda = N(N^T N + \lambda \Omega_N)^{-1}N^T, \]
derive the simplified Reinsch form under the assumption that \( N \) is invertible. Show step-by-step how this leads to:
\[ S_\lambda = (N^{-T}(N^T N + \lambda \Omega_N)N^{-1})^{-1} = (I + \lambda N^{-T} \Omega_N N^{-1})^{-1}. \]
 
(b) Discuss how wavelet smoothing can be applied to feedforward neural networks to help manage overfitting, especially in scenarios where the data is highly noisy. How does introducing the smoothing parameter \( \lambda \) and the penalty matrix \( \Omega_N \) affect the generalization ability of the neural network model?
 
=== Solution ===
 
==== Part (a) Derivation ====
Given the matrix \( S_\lambda \) as defined above, start with the inner product and factor in the invertibility of \( N \):
\[ S_\lambda = N(N^T N + \lambda \Omega_N)^{-1}N^T. \]
Assuming \( N \) is invertible, we have:
\[ S_\lambda = N^{-T}(N^T N + \lambda \Omega_N)N^{-1}. \]
This can be further simplified to:
\[ S_\lambda = (I + \lambda N^{-T} \Omega_N N^{-1})^{-1}, \]
where \( I \) denotes the identity matrix.
 
==== Part (b) Application to Neural Networks ====
In feedforward neural networks, overfitting is a significant challenge when dealing with complex models and noisy data. Wavelet smoothing, applied through the Reinsch form, offers a method to control model complexity by smoothing the learned functions.
 
The matrix \( N \) typically represents the network's weight matrix, and \( \Omega_N \) acts as a regularization term that penalizes the weight configurations based on their complexity. The smoothing parameter \( \lambda \) adjusts the trade-off between the training data's fidelity and the solution's smoothness.
 
By incorporating the Reinsch form into the network's training process, the effective degrees of freedom are reduced, leading to smoother function estimates. This reduction helps prevent the network from capturing noise as signal, enhancing its ability to generalize from the training data to unseen data.
 
The mathematical formulation provided in the exercise guides the understanding of how different components of the regularization term and smoothing parameter interact to influence the network’s learning process, potentially improving prediction accuracy on new, unseen data.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 3.29 ==
 
<b>Level:</b> * (Easy) 
 
<b>Exercise Types:</b> Modified - Problem 3.16, Prince, Simon JD. Understanding Deep Learning. MIT Press, 2023 
 
=== Question ===
 
Draw a fully-connected neural network with 2 inputs, 3 hidden units in the first hidden layer, 2 hidden units in the second hidden layer, and 2 outputs. Then, write out the general equations for each layer (i.e. <math>h^{(1)}, h^{(2)},</math> and <math>y</math>), where <math>\sigma</math> is the activation function used for each layer.
 
=== Solution ===
 
Below is the drawing of the neural network:
 
[[Image:3.29Drawing.png|thumb|300px|center|Fully-Connected Neural Network Drawing for Exercise 3.29]]
 
Equations:
 
<math>
h^{(1)} = \sigma (W^{(1)}x + b^{(1)})
</math>
 
<math>
h^{(2)} = \sigma (W^{(2)}h^{(1)} + b^{(2)})
</math>
 
<math>
y = \sigma (W^{(3)}h^{(2)} + b^{(3)})
</math>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
== Exercise 3.30 ==
 
<b>Level:</b> ** (Moderate) 
 
<b>Exercise Types:</b> Novel 
 
 
===Question===
 
Suppose <math>f: \mathbb{R}^n \to \mathbb{R}</math> is differentiable, convex, and <math>L</math>-smooth. Suppose we are given a starting point <math>x^0</math>. Assume that there exists an <math>r</math> such that <math>\{x \in \mathbb{R}^n: f(x) \leq f(x^0)\} \subseteq B(0,r)</math>.
 
<b>(a)</b> Show that <math>f</math> has a minimizer <math>x^*</math>.
 
<b>Proof.</b> Let <math> f: \mathbb{R}^n \to \mathbb{R} </math> be differentiable, convex, and <math> L</math>-smooth. Differentiability implies <math>f</math>  is continuous and convexity of <math>f</math> implies that any local minima is a global minima for <math>f</math>. Thus it is enough to show that there exist local minima. By hypothesis, there exists <math>r</math> such that <math>S = \{x \in \mathbb{R}^n: x \leq f(x^0)\} \subseteq B(0,r)</math>.
 
<math>S</math> is bounded: By definition of a bounded set, a set <math>A \subseteq X</math> is bounded if there exist <math>a \in X</math> and <math>r > 0</math> such that <math>A \subseteq B(a,r)</math>. Thus, by hypothesis <math>S</math> is bounded.
 
<math>S</math> is closed:} A function <math>g: X \to Y</math> is said to be continuous if for every closed set <math>V \subseteq Y</math>, the inverse image <math>g^{-1}(V) = \{x \in X : g(x) \in V\}</math> is also a closed subset of <math>X</math>. Since <math>f</math> is continuous, the pre-image of a closed set is closed. We set <math>c = f(x^0)</math>, then <math>S = S_{f(x^0)}</math> is closed in <math>\mathbb{R}^n</math>.
 
Now that we have <math>S</math> is bounded and closed, it follows from the \textit{Heine-Borel Theorem} that <math>S</math> is compact, and then by the \textit{Extreme-value Theorem} there exists <math>x^* \in S</math> such that <math>f(x^*) \leq f(x)</math> for all <math>x \in S</math>. By convexity of <math>f</math>, we have that <math>f(x^*) \leq f(x)</math> for all <math>x \in \mathbb{R}^n</math>, as needed.
 
<b>(b)</b> Show the following inequality:
For any <math>x</math> such that <math>f(x) \leq f(x^0)</math>,
<math>
f(x) - f(x^*) \leq 2r\|\nabla f(x)\|.
</math>
 
<b>Proof.</b> Suppose <math>f</math> has a minimizer <math>x^*</math> and let <math>f(x) \leq f(x^0)</math>. Since <math>x^* \in S</math> by definition, we use the sub-gradient inequality for convex functions:
<math>
f(x^*) \geq f(x) + \nabla f(x)^T (x^* - x)
</math>
which implies:
<math>
f(x^*) - f(x) \geq \nabla f(x)^T (x^* - x).
</math>
Multiplying both sides by <math>-1</math> gives:
<math>
f(x) - f(x^*) \leq \nabla f(x)^T (x - x^*).
</math>
Since <math>f(x^*) \leq f(x)</math>, we obtain:
<math>
|\nabla f(x)^T (x - x^*)| \geq 0.
</math>
Using the Cauchy-Schwarz inequality:
<math>
f(x) - f(x^0) \leq \nabla f(x)^T (x - x^*) \leq \|\nabla f(x)\| \cdot \|x - x^*\|.
</math>
Applying the triangle inequality:
<math>
\|x - x^*\| \leq \|x\| + \|x^*\|.
</math>
 
Since <math>x, x^* \in S \subseteq B(0,r)</math>, we have <math>\|x\| \leq r</math> and <math>\|x^*\| \leq r</math>. Thus,
 
<math>
f(x) - f(x^*) \leq \|\nabla f(x)\| \cdot (r + r) = 2r\|\nabla f(x)\|.
</math>
This completes the proof.
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 4.1 ==
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
Explain why SURE is rarely used in large-scale deep learning in practice.
 
=== Solution ===
Note that to compute the model complexity part of the SURE estimator, we have to compute the divergence term:
 
<math>
2\sigma^2 \sum_{i=1}^{n} D_i
</math>
 
where
 
<math>
D_i=\frac{\partial \hat{f}_i(y)}{\partial y_i}
</math>
 
For modern deep learning frameworks, both the number of parameters (weights) and the number of data dimensions are huge (in million or billions). This makes the computation of the divergence term extremely expensive. Note that using stochastic gradient descent the estimation of the weights is the result of an iterative process. If we include an inner loop to compute all the divergence, the computation complexity is growing exponentially.
 
Additionally, the high-dimensional nature of deep learning models means that computing the divergence requires handling large matrices or tensors, making the task even more resource-intensive. Even though parallel computation techniques like GPU acceleration can reduce the time for individual gradient calculations, the divergence computation still adds significant overhead when applied across all data points and iterations. Moreover, the computational complexity becomes even more challenging when dealing with large-scale datasets and real-time training, where the time needed to calculate divergence can slow down the training process substantially. This makes methods like SURE impractical for real-time or large-scale applications compared to simpler and more efficient alternatives like cross-validation, which does not require computing high-dimensional divergence and is easy to implement, making it a more suitable approach in practice.
 
However, SURE gives very good insight about the behaviour of the true error, and the divergence term is considered a regularization term. For simpler models such as linear regression, the divergence term can be easy to compute, and perturbing a trained data point would not change the estimated function by much. However in more complex models such as deep learning frameworks, perturbing a trained data point can result in large changes in our estimated function, meaning that the divergence term will be larger. Often times, we add a regularization term to our loss function that mimics the behaviour of the divergence term, such that the loss function increases the more complex our model is. Techniques such as adding weight decay or penalties on gradient magnitudes are often used to improve generalization.
 
=== Additional Subquestion ===
Could we use SURE in a simplified or approximate way for deep learning models, perhaps by estimating only a subset of partial derivatives or using a smaller batch of data? What would be the potential trade-offs?
 
=== Solution for Additional Question ===
One possible approach to making SURE more tractable is to approximate the divergence term using a small subset of data points or partial derivatives. For instance:
- **Subsampled Divergence**: Compute <math>D_i</math> for only a small mini-batch of the dataset and use this to extrapolate the full divergence. 
- **Block-Diagonal or Low-Rank Approximation**: Instead of computing the full Jacobian, approximate it by a block-diagonal or low-rank structure, significantly reducing the computational cost.
 
However, these approximations introduce additional variance or bias into the divergence estimate. If the mini-batch is not representative, the divergence (and thus the SURE estimate) might be inaccurate. Although such tricks can offer partial relief, they still tend to be more computationally demanding than alternatives like cross-validation. As a result, most large-scale deep learning pipelines avoid SURE in favor of simpler, widely supported methods.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 4.2 ==
 
<b>Level:</b> * (Easy) 
 
<b>Exercise Types:</b> Novel
 
=== Question ===
Use SURE to analyze how the bias-variance tradeoff is reflected in the risk of an estimator. Consider two scenarios:
 
*A high-bias, low-variance estimator (e.g., a constant estimate <math>\hat{f}(y) = c</math> for all <math>y</math>).
*A high-variance, low-bias estimator (e.g., <math>\hat{f}(y) = y</math>).
*For the estimator defined by the equation:
 
<math>\hat{f}(y) = cy + d</math>,
 
where c and d are constants:
 
a. Derive the divergence <math> \text{D}(\hat{f}).</math>,
 
b. Use the derived divergence to compute the SURE formula for the risk.
 
Show how the SURE formula quantifies the risk in both cases.
 
=== Solution ===
High-bias, low-variance estimator:
* Since <math>\hat{f}(y) = c</math>, the divergence <math>\text{D}(\hat{f}) = 0</math> (no dependence on <math>y</math>).
* The SURE risk simplifies to <math>\text{Risk} = (c - y)^2 + 2\sigma^2 \cdot 0 = (c - y)^2</math>
* The expected risk is influenced entirely by the choice of <math>c</math> relative to <math>f</math> (bias).
 
High-variance, low-bias estimator:
* For <math>\hat{f}(y) = y</math>, the divergence <math>\text{D}(\hat{f}) = 1</math> (derivative of <math>y</math> w.r.t. itself is 1).
* The SURE risk becomes <math>\text{Risk} = |y - y|^2 + 2\sigma^2 \cdot 1 = 2\sigma^2</math>.
* The risk reflects only the variance, as bias is negligible.
 
Divergence and SURE formula:
a. The divergence is <math> \text{D}(\hat{f}) = c</math> because the derivative of <math>cy + d</math> with respect to <math>y</math> is <math>c</math>.
 
b. The SURE formula for the risk becomes:
 
<math>\text{Risk} = \mathbb{E}\left[(cy + d - y)^2\right] + 2\sigma^2 \cdot c = \mathbb{E}\left[(c - 1)^2 y^2 + 2(c - 1)d y + d^2\right] + 2\sigma^2 \cdot c</math>.
 
 
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 4.3 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
=== Question === 
How does SURE explain why cross-validation and regularization are effective for estimating true error? <br>
Hint: Consider the cases when a data point is not in the training set and when it is included in the training set.
 
=== Solution ===
 
Let’s first recall the SURE (Stein's Unbiased Risk Estimate) formula:
 
<math>
E[(\hat{y_0}-y_0)^2] = E[(\hat{f_0} - f_0)^2] + E[\epsilon_0^2] - 2 E[\epsilon_0 (\hat{f_0} - f_0)]
</math>
 
<b> Case 1: Data Point Not in the Training Set </b>
 
When the data point is not in the training set, the covariance term <math>E[\epsilon_0 (f_0 - f_0)]</math> becomes zero, since the model does not have access to that particular point during training. This simplifies the formula to:
 
<math>
E[(\hat{y_0}-y_0)^2] = E[(\hat{f_0} - f_0)^2] + E[\epsilon_0^2]
</math>
 
Now, when summing over all <math>m</math> points, we obtain:
 
<math>
\sum_{i=1}^{m} (\hat{y_i} - y_i)^2 = \sum_{i=1}^{m} (\hat{f_i} - f_i)^2 + m \sigma^2
</math>
 
Where <math>\sigma^2</math> is noise. The total error (<math>Err</math>) can be written as:
 
<math>
Err = err - m \sigma^2
</math>
 
Here, <math>m \sigma^2</math> is a constant, which means the true error differs from the empirical error by a constant value only. Therefore, the empirical error (<math>err</math>) provides a good estimate of the true error (<math>Err</math>) when the point is not in the training set.
 
This explains why cross-validation is effective. Cross-validation essentially evaluates the model on data points that were not part of the training set, and since the empirical error is only offset by a constant, it provides a reliable estimate of the true error.
 
<b> Case 2: Data Point in the Training Set </b>
 
When the data point is part of the training set, the covariance term <math>E[\epsilon_0 (f_0 - f_0)]</math> is no longer zero. We have:
 
<math>
\sum_{i=1}^{m} (\hat{y_i} - y_i)^2 = \sum_{i=1}^{n} (\hat{f_i} - f_i)^2 + n \sigma^2 - 2 \sigma^2 \sum_{i=1}^{n} D_i
</math>
 
Where <math>D_i</math> represents the bias introduced by the model. This equation can be further simplified to:
 
<math>
Err = err - n \sigma^2 + 2 \sigma \sum_{i=1}^{n} D_i
</math>
 
In this case, the additional term <math>\sum_{i=1}^{n} D_i</math> reflects the model’s complexity. The complexity term increases with the capacity of the model and is often difficult to calculate directly. To handle this, instead of directly calculating the complexity term, we can use a function that increases with respect to model capacity, and treat it as the regularization term. The regularization term penalizes model complexity to avoid overfitting, thus helping to prevent the model from fitting noise in the training set.
 
This explains the need for regularization techniques. Regularization helps to control model complexity and ensures that the model generalizes better to unseen data, improving the estimation of the true error.
 
Thus, both cross-validation and regularization are grounded in the same principle of improving the estimation of true error by adjusting for complexity and noise.
 
(Note: the formulas are all from Lecture 4 content, STAT 940)
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 4.4 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
=== Question === 
Assume there is a point set <math>(x_i,y_i)</math> satisfying <math>y_i=2x_i+3sin(x_i)+n_i</math>, where <math>n_i \sim \mathcal{N}(0, 4)</math>, for i = 1, 2, ...
 
Now we fit the relationship between y and x, using polynomial linear models with order from 1 to 10. Show the MSE of models of different complexity.
 
=== Solution ===
 
<pre>
library(ggplot2)
x <- seq(0, 10, length.out = 100)
y <- 2 * x + 3 * sin(x) + rnorm(100, mean = 0, sd = 2)
data <- data.frame(x = x, y = y)
 
degrees <- 1:10
mse_values <- numeric(length(degrees))
 
for (i in seq_along(degrees)) {
  degree <- degrees[i]
 
  model <- lm(y ~ poly(x, degree), data = data)
 
  predicted <- predict(model, data)
 
  mse_values[i] <- mean((data$y - predicted)^2)
}
 
mse_results <- data.frame(Degree = degrees, MSE = mse_values)
print(mse_results)
 
ggplot(mse_results, aes(x = Degree, y = MSE)) +
  geom_line(color = "blue") +
  geom_point(size = 3, color = "red") +
  labs(title = "MSE vs. Model Complexity",
      x = "Polynomial Degree",
      y = "Mean Squared Error (MSE)") +
  theme_minimal()
 
ggplot(data, aes(x = x, y = y)) +
  geom_point(color = "black", alpha = 0.6) +
  geom_smooth(method = "lm", formula = y ~ poly(x, 1), color = "red", se = FALSE) +
  geom_smooth(method = "lm", formula = y ~ poly(x, 3), color = "blue", se = FALSE) +
  geom_smooth(method = "lm", formula = y ~ poly(x, 10), color = "green", se = FALSE) +
  labs(title = "Polynomial Regression Fits",
      x = "x",
      y = "y") +
  theme_minimal()
</pre>
Output:
[[File:Exercise 4.4_1.png|thumb|600px|left|]]
[[File:Exercise 4.4_2.png|thumb|600px|right|]]
<br clear="all">
 
Additional Comment:
This graph clearly shows the importance in choosing a good space for your model candidates. When allowing your model to have too much complexity, we see that there is not a lot of reduction in the MSE after 4 polynomial degrees. But there is a big difference from 3 to 4, so based on the graph, it would be best to pick the polynomial of degree 4 as the model as it performed good on the testing dataset while being more robust than models of higher polynomial order.
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 4.5 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
Use the SURE equation to explain the difference of using data in the training dataset vs outside of the training dataset in estimating the true error using emperical error (of same size of dataset).
 
=== Answer ===
The Key is in the term <math>2 \sigma^2 \sum_{i=1}^{n} D_i</math>. There are overall 2 main terms that contributes to this value ---the model complexity and the variance of the error. If the variance is sufficiently small and the model complexity is not too large (i.e p<3), the difference between using training datapoints and using testing datapoints would not be as significant. Thus, if the complexity of the model is not very high (low <math>D_i</math>) with low sample size, using the training dataset to estimate true error will not be extremely different from using a separate dataset. 
<p>
When the model complexity increases (p become larger), the model becomes more sensitive to small changes in the training data. The sensitivity could be written as <math>\frac{\partial \hat{y}_i}{\partial y_i}</math>. This derivative would be larger as it follows the training data, exaggerating the penalty term <math>2\sigma^2\sum_{i=1}^{n}D_i</math> in SURE.
 
</p>
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 4.6 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
For a momentum factor <math>\beta</math>, explain the impact of increasing or decreasing <math>\beta</math> (e.g., <math>\beta = 0.9</math> vs. <math>\beta = 0.5</math>) on the learning process.
 
=== Solution ===
The momentum factor <math>\beta</math> determines how much of the velocity contributes to the current step during gradient descent.
 
When <math>\beta</math> is high (e.g., <math>\beta = 0.9</math>), momentum retains most of the previous velocity, resulting in smoother and more consistent updates. In situations where gradients do not change direction significantly, high <math>\beta</math> accelerates convergence as momentum accumulates in the correct direction. However, on highly non-convex surfaces or steep gradients, high <math>\beta</math> may cause oscillations or overshooting as the momentum term dominates gradient changes.
 
When <math>\beta</math> is low (e.g., <math>\beta = 0.5</math>), the updates rely more heavily on the current gradient rather than accumulated momentum, which can introduce more noise into the updates. In flat regions or long valleys, low <math>\beta</math> leads to slower progress as previous updates fade quickly. However, a lower <math>\beta</math> adapts better to situations where the loss landscape changes direction frequently, reducing the risk of overshooting.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 4.7 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
=== Question ===
Suppose we have a linear regression model <math>y = X \beta + \varepsilon</math> with <math>\varepsilon \sim \mathcal{N}\bigl(0, \sigma^2 I\bigr)</math>. We use a ridge estimator with penalty <math>\lambda</math>:
 
<math> \hat{\beta}_\lambda = \bigl(X^\top X + \lambda I\bigr)^{-1} X^\top y, \quad \hat{y}_\lambda = X\,\hat{\beta}_\lambda. </math>
Write down the form of Stein’s Unbiased Risk Estimator (SURE) for this ridge estimator in terms of <math>\hat{y}_\lambda</math> and the hat matrix.
Briefly explain why the term involving the trace of the hat matrix <math>H_\lambda</math> adjusts for overfitting, and how that adjustment depends on <math>\lambda</math>.
Describe how you would use SURE to select an optimal value of <math>\lambda</math>.
=== Solution ===
1. SURE for the Ridge Estimator
Define the hat matrix for ridge regression as:
 
<math> H_\lambda = X \bigl(X^\top X + \lambda I\bigr)^{-1} X^\top, \quad \hat{y}_\lambda = H_\lambda\,y. </math>
Stein’s Unbiased Risk Estimator (SURE) for this setting is:
 
<math> \mathrm{SURE}(\lambda) = \|y - \hat{y}_\lambda\|^2 + 2\,\sigma^2 \,\mathrm{trace}\bigl(H_\lambda\bigr). </math>
Here, <math>|y - \hat{y}\lambda|^2</math> represents the (in-sample) residual sum of squares, and <math>\mathrm{trace}(H\lambda)</math> measures the effective degrees of freedom used by the ridge estimator.
 
2. Role of the Hat Matrix Trace
 
The matrix <math>H_\lambda</math> maps the observed data <math>y</math> to the fitted values <math>\hat{y}\lambda</math>. Its trace, <math>\mathrm{trace}(H\lambda)</math>, indicates how sensitive the fitted values are to the observed data.
Larger <math>\mathrm{trace}(H_\lambda)</math> means the model is using more degrees of freedom and risks overfitting, causing the naive residual sum of squares <math>|y - \hat{y}_\lambda|^2</math> to underestimate true prediction error.
As <math>\lambda</math> increases, the estimator shrinks coefficients more aggressively and <math>\mathrm{trace}(H_\lambda)</math> typically decreases, reflecting a simpler (less flexible) model.
3. Using SURE to Select <math>\lambda</math>
To choose an optimal <math>\lambda</math> from the perspective of unbiased risk estimation, one can:
 
Compute <math>\mathrm{SURE}(\lambda)</math> over a grid of possible <math>\lambda</math> values.
Select the <math>\lambda</math> that minimizes <math>\mathrm{SURE}(\lambda)</math>.
Because SURE includes the penalty <math>2,\sigma^2,\mathrm{trace}(H_\lambda)</math>, it corrects for the bias introduced by fitting the same data used in the residual calculation. This makes SURE a more reliable guide to out-of-sample error than just looking at <math>|y - \hat{y}_\lambda|^2</math>.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 4.8 ==
 
'''Level:''' * (Easy)
 
'''Exercise Type:''' Novel
 
=== Question ===
You are tasked with understanding the Mean Squared Error (MSE) and its components: bias and variance, using the provided diagram as a reference. 
 
[[File:model_selection.png|321px|thumb|center|Diagram for MSE calculation]]
 
<b>Setup:</b>  <br>
1. You have a true underlying function: 
<math>f(x) = 2x + 3</math> <br> 
 
2. A model is used to estimate <math>f(x)</math>, given as: <math>\hat{f}(x) = ax + b</math>, where <math>a</math> and <math>b</math> are estimated from data.  <br>
 
3. Your model has the following properties:  <br>
- Expected estimate: <math>\mathbb{E}[\hat{f}(x)] = 1.8x + 2.5</math>  <br>
- Variance: <math>\text{Var}[\hat{f}(x)] = 0.1</math> (constant for all <math>x</math>).  <br>
 
(a) Calculate the <b>bias</b> at <math>x = 2</math>. 
 
(b) Given that <math>\text{Var}[\hat{f}(x)] = 0.1</math>, compute the <b>Mean Squared Error (MSE)</b> at <math>x = 2</math>.
 
=== Solution ===
 
<b>1. Bias Calculation:</b> <br>
The bias is defined as: 
<math>\text{Bias} = \mathbb{E}[\hat{f}(x)] - f(x).</math> 
 
Substitute the values for <math>f(x)</math> and <math>\mathbb{E}[\hat{f}(x)]</math> at <math>x = 2</math>:  <br>
 
- <math>f(2) = 2(2) + 3 = 7</math>  <br>
- <math>\mathbb{E}[\hat{f}(2)] = 1.8(2) + 2.5 = 3.6 + 2.5 = 6.1.</math> 
 
Thus, <math>\text{Bias} = \mathbb{E}[\hat{f}(2)] - f(2) = 6.1 - 7 = -0.9.</math> 
 
<b>2. Variance Contribution:</b>  <br>
The variance is directly given as: <math>\text{Var}[\hat{f}(x)] = 0.1.</math> 
 
<b>3. MSE Decomposition:</b>  <br>
The Mean Squared Error (MSE) is defined as: <math>\text{MSE} = \text{Bias}^2 + \text{Var}.</math> 
 
Substitute the values:  <br>
- <math>\text{Bias}^2 = (-0.9)^2 = 0.81,</math>  <br>
- <math>\text{MSE} = 0.81 + 0.1 = 0.91.</math> 
 
<b>Final Answer:</b>  <br>
- Bias: <math>-0.9</math>.  <br>
- Variance: <math>0.1</math>.  <br>
- MSE: <math>0.91</math>. 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 4.9 ==
 
<b>Level:</b> * (Easy) 
 
<b>Exercise Types:</b> Novel
 
=== Question ===
 
Suppose you are developing a predictive model for house prices using a dataset with features like square footage, number of bedrooms, and location. You decide to compare three models with increasing complexity:
 
1. A simple linear regression model.
 
2. A polynomial regression model with degree 3.
 
3. A neural network with multiple layers.
 
Using Stein's Unbiased Risk Estimator (SURE), explain how you would determine which model is expected to generalize best to unseen data. Any practical challenges you might encounter?
 
=== Solution ===
<b> Approach </b>
 
1. For each model, compute the empirical error on the training data. For instance, compute the Mean Squared Error: <math> err = \frac{1}{n} \sum_{i=1}^{n} (y_i - \hat y_i)^2.</math>
 
2. Estimate <math> \sigma^2 </math>, analyze the variance of residuals from a simple baseline model like linear regression, which provides a good approximation of the noise in the data.
 
3. For each model, calculate the complexity term <math> 2 \sigma^2 \sum_{i=1}^n D_i </math>, where <math> D_i = \frac{\partial{\hat{f_i}}}{\partial{y_i}}</math>
 
4. Compute the Stein's Unbiased Risk Estimator for each model by <math> Err = err - n \sigma^2 + 2 \sigma^2 \sum_{i=1}^n D_i </math>
 
5. Compare the SURE values for the three models. The model with the lowest SURE is expected to generalize best to unseen data.
 
<b> Practical Challenges </b>
 
1. Using a simple model like linear regression might provide a biased estimate if the data is highly nonlinear. This will suggest an inaccurate variance <math> \sigma^2 </math>.
 
2. While SURE penalizes complexity, it may favor simpler models if the noise variance is high. However, overly simplistic models might underfit.
 
3. If the best model is neural networks, then it will be less interpretable in this case and calculating <math> D_i </math> becomes computationally expensive.
 
4. For neural networks, estimating <math> D_i </math> is challenging due to the model's intricate structure, lack of interpretability and prone to numerical instability.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 4.10 ==
 
<b>Level:</b> ** (Moderate) 
 
<b>Exercise Types:</b> Novel
 
=== Question ===
Derive Stein’s Unbiased Risk Estimator (SURE) for the training set and the testing set.
 
=== Solution ===
 
  <!--  -->
  <p><strong>Notation</strong></p>
  <p>
    We have observations
    <math> y_i = f(x_i) + \varepsilon_i </math>
    where
    <math> \varepsilon_i \sim \mathcal{N}(0, \sigma^2) </math>
    and
    <math> \hat{f}(x_i) </math>
    is the model’s prediction at <math> x_i </math>.
    We write
    <math> \hat{y}_i = \hat{f}(x_i). </math>
  </p>
 
  <!-- -->
  <p><strong>Test Data</strong></p>
  <p>
    For a test point
    <math> (x_0, y_0) </math>
    not used in fitting
    <math> \hat{f} </math>:
  </p>
  <p>
    <math> \hat{y}_0 - y_0 \;=\; \hat{f}(x_0) - \bigl(f(x_0) + \varepsilon_0\bigr). </math>
  </p>
  <p>
    <math> (\hat{y}_0 - y_0)^2
      \;=\; (\hat{f}(x_0) - f(x_0))^2 + \varepsilon_0^2
            - 2\,\varepsilon_0\,(\hat{f}(x_0) - f(x_0)). </math>
  </p>
  <p>
    <math> \hat{f}(x_0) </math>
    is independent of
    <math> \varepsilon_0 </math>,
    <math> E\bigl[\varepsilon_0\,(\hat{f}(x_0) - f(x_0))\bigr]  = 0 </math>
  </p>
  <p>
    <math> E\bigl[(\hat{y}_0 - y_0)^2\bigr]
      \;=\; E\bigl[(\hat{f}(x_0) - f(x_0))^2\bigr]
        + \sigma^2. </math>
  </p>
  <p>
    Summing over
    <math> M </math>
    test points:
  </p>
  <p>
    <math> \sum_{i=1}^M (\hat{y}_i - y_i)^2
      \;=\; \sum_{i=1}^M (\hat{f}(x_i) - f(x_i))^2
        \;+\; M\,\sigma^2. </math>
  </p>
 
  <!--  -->
  <p><strong>Training Data</strong></p>
  <p>
    For a point <math> (x_0, y_0) </math> used in training, <math> \hat{f}(x_0) </math> depends on <math> y_0. </math>
    We have:
  </p>
  <p>
    <math> (\hat{y}_0 - y_0)^2
      \;=\; \bigl(\hat{f}(x_0) - (f(x_0) + \varepsilon_0)\bigr)^2. </math>
  </p>
  <p>
    Define
    <math> D_0 := \frac{\partial\,\hat{f}(x_0)}{\partial\,y_0}. </math>  </p>
  <p>
    By Stein’s lemma,
  </p>
  <p>
    <math>
    E\bigl[\varepsilon_0\,(\hat{f}(x_0) - f(x_0))\bigr]
    \;=\; \sigma^2 \, E\bigl[\tfrac{\partial\,\hat{f}(x_0)}{\partial\,\varepsilon_0}\bigr].
    </math>
  </p>
  <p>
    But
    <math> \tfrac{\partial\,\hat{f}(x_0)}{\partial\,\varepsilon_0}
    = \tfrac{\partial\,\hat{f}(x_0)}{\partial\,y_0}, </math>
    so
    <math> E\bigl[\varepsilon_0(\hat{f}(x_0) - f(x_0))\bigr] = \sigma^2 E[D_0]. </math>
  </p>
  <p>
    <math> E\bigl[(\hat{y}_0 - y_0)^2\bigr]
      \;=\; E\bigl[(\hat{f}(x_0) - f(x_0))^2\bigr]
          + \sigma^2
          - 2\,\sigma^2 \, E[D_0]. </math>
  </p>
 
  <p> Summing over <math> n </math> training points: </p>
  <p>
    <math>
      \sum_{i=1}^n (\hat{y}_i - y_i)^2
      \;=\; \sum_{i=1}^n (\hat{f}_i - f_i)^2
          + n\,\sigma^2
          - 2\,\sigma^2 \sum_{i=1}^n D_i.
    </math>
  </p>
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 4.11 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
How does the choice of momentum factor <math>\beta</math> influence the ability of gradient descent to escape saddle points or local minima during optimization?
 
=== Solution ===
The momentum factor <math>\beta</math> plays a significant role in determining how gradient descent navigates complex loss landscapes.
 
For reference, the formula for momentum-based SGD is as follows:
 
<math> v_{t+1} = \beta\,v_t + \eta\,\Delta W_t, </math>
 
where <math>\beta</math> is the momentum coefficient and <math>\eta</math> is the learning rate.
 
When <math>\beta</math> is high (e.g., <math>\beta</math> = 0.9), the optimizer builds up velocity over time, which helps push it through flat regions like saddle points more effectively. This accumulated momentum can prevent the algorithm from getting stuck in shallow local minima by carrying the updates forward despite weak gradients. However, in very sharp local minima, high <math>\beta</math> may cause overshooting, making it harder to settle at the true minima. When <math>\beta</math> is low (e.g., <math>\beta</math> = 0.5), the optimizer relies more on the current gradient, which reduces the accumulated velocity. While this makes the updates more adaptive to the local landscape, it also increases the likelihood of getting trapped in saddle points or small local minima, as the velocity is insufficient to escape flat or weak gradient regions.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 4.12 ==
 
'''Level:''' * (Moderate)
 
'''Exercise Types:''' Novel
 
=== Question ===
Explain the key idea behind Stein's Unbiased Risk Estimator (SURE) and how it can be applied to choose an optimal parameter or model in high-dimensional estimation problems. Why is it preferred over traditional risk estimation methods in some scenarios?
 
=== Solution ===
Stein's Unbiased Risk Estimator (SURE) provides an unbiased estimate of the risk (expected squared error) of an estimator using only the observed data, without requiring knowledge of the true parameter. It is particularly useful in high-dimensional problems, where it balances bias and variance effectively, aiding in tasks like model selection and hyperparameter tuning for methods such as LASSO or ridge regression. SURE is computationally efficient, often providing closed-form expressions, and is preferred over traditional methods like cross-validation in scenarios with Gaussian noise and differentiable estimators. However, its applicability depends on specific assumptions (e.g., noise distribution and estimator smoothness), and it may not always perform well in small sample sizes or under non-standard conditions. In practice, SURE is widely used in signal processing, image denoising, and compressive sensing, where risk estimation plays a crucial role in optimizing model performance.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 4.13 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
In order for Stein's unbiased risk estimator to be useful, we need to figure out how to compute <math>D_i</math>, which can be challenging. Then what is the advantage of SURE despite the challenge?
 
=== Solution ===
1. SURE is useful because it provides an unbiased estimate of the risk of an estimator without needing the true parameter. Typically, to evaluate the MSE of an estimator, you would need to know the true parameter value but SURE allows you to assess the performance of an estimator without this information.
 
2. Even if computing the sum of the partial derivatives directly is complex, SURE can be applied to compare different estimators. The goal is often to choose an estimator that minimizes the risk, so SURE helps identify more efficient estimators, especially in high-dimensional settings.
 
3. In many practical applications, it's not necessary to compute the exact sum of partial derivatives. Instead, we can approximate or use simplified models for the estimator and the data.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 4.14 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
 
Prove that MSE = Bias<math>^2</math>+Var
=== Solution ===
Let <math>f</math> denote the true function, <math>\hat{f}</math> denote the estimated function , <math>x</math> denote the data
 
<math>
\begin{align*}
\text{MSE}  &= \mathbb{E}[(f(x)-\hat{f}(x))^2] \
&= \mathbb{E}\Big[(f(x)-\mathbb{E}[\hat{f}(x)] + \mathbb{E}[\hat{f}(x)]-\hat{f}(x))^2\Big] \
&= (f(x)-\mathbb{E}[\hat{f}(x)])^2 + (\mathbb{E}[\hat{f}(x)]-\hat{f}(x))^2 \
&= \text{Bias}^2+\text{Var}
\end{align*}
</math>
 
where the second last equality comes from
<math>\mathbb{E}[(f(x)-E[\hat{f}(x)])(\mathbb{E}[\hat{f}(X)]-\hat{f}(x))] = \mathbb{E}[f(x)E[\hat{f}(x)]-f(x)\hat{f}(x)-\mathbb{E}[\hat{f}(X)]^2+\hat{f}(x)\mathbb{E}[\hat{f}(X)])] = f(x)\mathbb{E}[\hat{f}(X)]-f(x)\mathbb{E}[\hat{f}(X)]-\mathbb{E}[\hat{f}(X)]^2+\mathbb{E}[\hat{f}(X)]^2 = 0</math>
 
Alternatively,
 
<math>
\begin{align*}
\mathbb{E}\Big[(f(x)-\mathbb{E}[\hat{f}(x)])(\mathbb{E}[\hat{f}(x)]-\hat{f}(x))\Big]
&= (f(x)-\mathbb{E}[\hat{f}(x)])\mathbb{E}\Big[\mathbb{E}[\hat{f}(x)]-\hat{f}(x)\Big] \
&= (f(x)-\mathbb{E}[\hat{f}(x)])\Big(\mathbb{E}[\mathbb{E}[\hat{f}(x)]]-\mathbb{E}[\hat{f}(x)]\Big) \
&= (f(x)-\mathbb{E}[\hat{f}(x)])\Big(\mathbb{E}[\hat{f}(x)]-\mathbb{E}[\hat{f}(x)]\Big) \
&= 0,
\end{align*}</math>
 
since the bias <math>(f(x)-\mathbb{E}[\hat{f}(x)])</math> is a constant.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 4.15 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
=== Question ===
When applying numerical methods, it is essential to constantly remind ourselves of the assumptions behind the model. What are the assumptions of SURE required for SURE to provide an unbiased estimate of the true risk? How does it compare to cross-validation as a model selection technique?
 
=== Solution ===
<b>Assumptions:</b>
 
1. The noise follows a normal distribution with constant variance.
 
2. The response must be linearly related to the predictors.
 
3. The effective degrees of freedom must be correctly computed.
 
<b>Comparisons with Cross-validation:</b>
 
1. While the assumptions of SURE could be unrealistic to hold, cross validation may suffer from higher variance due to the random splitting.
 
2. SURE is computationally cheaper than cross validation.
 
3. Cross validation does not impose normality on the noise, giving a more general account.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 4.16 ==
'''Level:''' * (Easy)
 
'''Exercise Types:''' Modified (Reference: Lecture 04)
 
=== Question ===
Suppose <math>y \sim N(\theta, \sigma^2I)</math>, where <math>\theta \in \mathbb{R}^n</math> is the true parameter, <math>y</math> is the observed data, and <math>\sigma^2</math> is the variance of the noise. Consider the following estimator for <math>\theta</math>:
<math>\hat{\theta} = a y,</math>
where <math>a \in \mathbb{R}</math> is a scalar constant.
 
Derive the Stein's Unbiased Risk Estimator (SURE) for the estimator <math>\hat{\theta}</math>.
 
=== Solution ===
The true risk is given by:
<math>
R = \mathbb{E}[\|\hat{\theta} - \theta\|^2].
</math>
Substituting <math>\hat{\theta} = a y</math> and <math>y \sim N(\theta, \sigma^2I)</math>, we expand the risk:
<math>
R = \mathbb{E}[\|a y - \theta\|^2] = \mathbb{E}[\|a(y - \theta) + (a - 1)\theta\|^2].
</math>
 
Using <math>\mathbb{E}[y - \theta] = 0</math> and <math>\mathbb{E}[\|y - \theta\|^2] = n\sigma^2</math>, we get:
<math>
R = a^2 \mathbb{E}[\|y - \theta\|^2] + (a - 1)^2 \|\theta\|^2 = a^2 n\sigma^2 + (a - 1)^2 \|\theta\|^2.
</math>
 
To derive SURE, we estimate the true risk using:
<math>
\text{SURE} = \|\hat{\theta} - y\|^2 + 2\sigma^2 \text{div}(f),
</math>
where <math>f(y) = a y</math> and <math>\text{div}(f) = a n</math> because:
<math>
\frac{\partial f_i(y)}{\partial y_i} = a \quad \text{for all } i.
</math>
 
First term:
<math>
\|\hat{\theta} - y\|^2 = \|a y - y\|^2 = (a - 1)^2 \|y\|^2.
</math>
 
Therefore:
<math>
\text{SURE} = (a - 1)^2 \|y\|^2 + 2\sigma^2 n a.
</math>
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 4.17 ==
 
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
Stein's Unbiased Risk Estimator (SURE) is often discussed in the context of its effectiveness in model selection. Explain how SURE can be used to select the best model from a set of candidates, specifically focusing on its capacity to balance model complexity against prediction error.
=== Solution ===
SURE is particularly valuable in model selection because it provides an unbiased estimate of the risk (expected prediction error) for different models, even without knowing the true underlying function. It does this by combining the empirical error (residuals) with a penalty proportional to the model's complexity.
 
For instance, if we have multiple regression models of varying complexity, SURE helps identify the model that optimally balances low empirical errors with manageable complexity. This is crucial because overly complex models might fit the training data very well (low empirical error) but perform poorly on new data due to overfitting. Conversely, overly simple models might not capture the necessary patterns in the data, leading to high empirical errors.
 
The SURE formula includes a term that adjusts the observed empirical error by adding a complexity penalty. This penalty is usually proportional to the trace of the hat matrix (a measure of leverage or influence of each observation in linear models), which scales with the flexibility or number of parameters in the model. By evaluating SURE for each model, we can choose the model that minimizes this unbiased estimate of the risk, thereby selecting the model with the best generalization performance expected on new, unseen data.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 4.18 ==
 
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
Why Stein's Unbiased Risk Estimator (SURE) serves as a good regularization method?
 
=== Solution ===
SURE directly estimates the risk (mean squared error) of an estimator <math> \hat{\theta} </math>. Thus, we can compare different estimators or penalization strategies by explicitly minimizing the estimated risk. By selecting the model or parameters that minimize the SURE criterion, we can effectively regularize the problem to achieve better generalization result. Moreover, it can handle high-dimensional problems because it takes <math> D_i </math> into consideration.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 4.19 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
'''References:''' Adapted from [Unsupervised Learning with Stein’s Unbiased Risk Estimator](https://arxiv.org/pdf/1805.10531).
 
=== Question ===
Critically evaluate the application of Stein's Unbiased Risk Estimator (SURE) for image denoising in scenarios where ground truth data is unavailable. Discuss the implementation of SURE within convolutional neural networks (CNNs) for image recovery, focusing on the use of the divergence term:
\[ \text{div} \, \mathbf{J} = \operatorname{trace}(\nabla \mathbf{f}(\mathbf{x})) \]
from the trace of the Jacobian matrix of the estimator with respect to observed data. Explain how this approach, as explored in the referenced paper, assists in parameter optimization and mitigates the challenges posed by the absence of clean reference images.
 
=== Solution ===
The paper implements Stein's Unbiased Risk Estimator (SURE) for unsupervised image denoising, demonstrating its practical use in settings devoid of ground truth data. SURE estimates the risk associated with a denoising estimator by leveraging the formula:
\[ \text{SURE} = \sigma^2 \left( n - 2\operatorname{trace}(\nabla \mathbf{f}(\mathbf{x})) \right) + \| \mathbf{y} - \mathbf{f}(\mathbf{x}) \|^2 \]
where \( \mathbf{y} \) is the observed noisy image, \( \mathbf{f}(\mathbf{x}) \) is the denoised output, and \( \sigma^2 \) is the noise variance. This approach allows for the optimization of CNN parameters so that the model self-evaluates its performance based on the observed data alone, enhancing its ability to generalize better from noisy observations to cleaner reconstructions.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 4.20 ==
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
<b>References:</b>
 
A. Ghodsi, STAT 940 Deep Learning: Lecture 4, University of Waterloo, Winter 2025.
 
=== Question ===
 
In STAT 940 Lecture 4, it was shown that the expectation <math>\mathbb{E}[(\mathcal{N}(0,\sigma^2))^2]=\sigma^2 </math>
 
Using Python and NumPy, randomly sample a large number of randomly generated gaussian samples with a mean of 0 and a randomly generated variance to numerically demonstrate that this expectation is indeed true
 
=== Solution ===
<pre>
import numpy as np
import matplotlib.pyplot as plt
 
#Generate a random variance
std = np.random.rand()
 
#Generate 1000 random number with a mean of 0 and a standard deviation of std
sampled_gaussian_numbers = np.random.normal(0, std, 1000)
 
#Plot a histogram of the sampled numbers
plt.figure(1, figsize=(8, 6))
plt.hist(sampled_gaussian_numbers, bins=30)
plt.title("Histogram of gaussian samples, mean = 0, std = " + str(np.round(std, 3)))
plt.show()
 
#Calculate the expectation value of the sampled numbers squared
expectation = np.mean(sampled_gaussian_numbers**2)
 
print("The randomly generated variance is: ", std**2)
print("The expectation of the randomly generated gaussian samples squared is: ", expectation)
</pre>
   
 
[[Image:420a.png|thumb|300px|center|Sample Histogram of Randomly Sampled Gaussians in Python]]
 
 
[[Image:420b.png|thumb|300px|center|Sample output of gaussian variance and computed expectation of randomly generated gaussian samples squared]]
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 4.21 ==
 
<b>Level:</b> * (Easy) 
 
<b>Exercise Types:</b> Novel 
 
Definition: Given a matrix <math> M </math> and vector <math> v </math> we often define a feature map <math> F : \mathbb{R}^n \to \mathbb{R}^m </math> as one of the following:
  <ul>
    <li><math> F(x) = M x + v </math> </li>
    <li> <math> F(x) = M \ast x </math> (Here <math> * </math> is convolution) </li>
    <li> <math>  F(x) = \langle M , v \rangle </math> (<math> M </math> can be replaced by a vector.) </li>
  </ul>
 
Definition: Let <math>f</math> be a real valued function defined on <math> E </math>, then <math> f </math> is is Lipschitz if exists <math> L \geq 0  </math> such that <math> \| f(x) - f(y) \| \leq L \cdot \| x - y \| </math> for all <math> x,y \in E </math>.
 
===Question===
 
Show that each feature map is Lipschitz.
 
===Proof=== 
 
There are three cases:
 
Case 1: Using linearity of multiplication and the Cauchy-Schwartz Inequality, we obtain: <math> \| F(x) - F(y) \| = \| M x + v - (My + v) \| = \| M ( x - y) \| \leq \| M \| \| x - y \|  </math>
 
Case 2: Using linearity of convolution operator (proof is trivial we leave it as an exercise for the reader)  then we obtain: <math> \| F(x) - F(y) \| = \| M \ast x - M \ast y \| = \| M \ast (x-y) \| \leq \| M \| \| x -y \|  </math>
 
Case 3: Using linearity of the inner product and the Cauchy-Schwartz Inequality for norms,
we obtain: <math> \| F(x) - F(y) \| = \| \langle M , x \rangle - \langle M , y \rangle \| = \| \langle M , x-y \rangle \| \leq \| M \| \| x - y \| </math>
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 5.1 ==
 
'''Level:''' * (Easy)
 
'''Exercise Type:''' Novel
 
=== Question ===
<b>1) Which of the following options can be used to regularize an MLP (choose all that apply)?</b> <br>
 
a) Add noise to data <br> 
b) Use full batch gradient descent <br> 
c) Add dropout <br> 
d) Use early stopping <br> 
 
<b>2) Using Stochastic Gradient Descent with a small minibatch when training an MLP helps with generalization:</b> <br>
 
a) True <br> 
b) False 
 
<b>3) Explain why adding noise to the input data helps improve generalization in a neural network.</b>
 
=== Solution ===
1) The correct answers are <b>a)</b>, <b>c)</b>, and <b>d)</b>.  <br>
- <b>a)</b> Adding noise to data is a regularization technique that can improve generalization by forcing the model to learn robust patterns. Types of noise used in MLPs include: input noise, weight noise, activation noise and dropouts. <br>
- <b>c)</b> Dropout randomly deactivates neurons during training, reducing overfitting. <br>
- <b>d)</b> Early stopping prevents overfitting by halting training once the validation error stops improving. <br>
 
<b>b)</b> is incorrect because using full batch gradient descent does not help regularize the model. <br>
 
2) The correct answer is <b>a) True</b>.  <br>
Using Stochastic Gradient Descent with a small minibatch size introduces noise into the optimization process, which can act as a form of regularization and improve generalization.
 
3) Explanation:
Adding noise to the input data acts as a form of data augmentation. It forces the model to learn features that are robust to variations in the input, reducing reliance on specific details of the training data. This helps the network generalize better to unseen data, as it becomes more adaptable to small changes and less prone to overfitting.
 
Additional Note:
One form of adding noise is through data smoothing. This ensures that the function is not overconfident on the objects that it was trained on.
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 5.2 ==
 
'''Level:''' * (Easy)
 
'''Exercise Type:''' Novel
 
=== Question === 
Derive the gradient of the loss function with respect to the weights <math>\mathbf{w}</math> for the following regularized quadratic loss: 
 
<math>
L(\mathbf{w}) = \frac{1}{2n} \sum_{i=1}^n \left( y_i - \mathbf{w}^T \mathbf{x}_i \right)^2 + \frac{\lambda}{2} \|\mathbf{w}\|^2
</math> 
 
where <math>\lambda > 0</math> is the regularization parameter.
 
=== Solution === 
The gradient of the loss function <math>L(\mathbf{w})</math> with respect to <math>\mathbf{w}</math> can be computed as follows: 
 
<math>
\nabla_{\mathbf{w}} L(\mathbf{w}) = \nabla_{\mathbf{w}} \left( \frac{1}{2n} \sum_{i=1}^n \left( y_i - \mathbf{w}^T \mathbf{x}_i \right)^2 \right) + \nabla_{\mathbf{w}} \left( \frac{\lambda}{2} \|\mathbf{w}\|^2 \right)
</math>
 
For the first term:
<math>
\nabla_{\mathbf{w}} \left( \frac{1}{2n} \sum_{i=1}^n \left( y_i - \mathbf{w}^T \mathbf{x}_i \right)^2 \right) = -\frac{1}{n} \sum_{i=1}^n \left( y_i - \mathbf{w}^T \mathbf{x}_i \right) \mathbf{x}_i
</math>
 
For the second term:
<math>
\nabla_{\mathbf{w}} \left( \frac{\lambda}{2} \|\mathbf{w}\|^2 \right) = \lambda \mathbf{w}
</math>
 
Combining both terms:
<math>
\nabla_{\mathbf{w}} L(\mathbf{w}) = -\frac{1}{n} \sum_{i=1}^n \left( y_i - \mathbf{w}^T \mathbf{x}_i \right) \mathbf{x}_i + \lambda \mathbf{w}
</math>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
== Exercise 5.3 ==
<b>Level:</b> ** (Moderate) 
 
<b>Exercise Types:</b> Novel
 
=== Question ===
What are the mathematical formulas for Ridge Regression and Lasso Regression, including their respective penalty terms?
Additionally, write a Python script that visualizes the effect of these regularization techniques on a selected loss function (e.g., Mean Squared Error) for a simple linear regression model.
Once you have the graph, interpret the graph by explaining how the shapes show the differences between Lasso and ridge regression.
 
=== Solution ===
Ridge Regression and Lasso Regression are both forms of linear regression with regularization to prevent overfitting.
 
Ridge regression minimizes the following objective function:
 
<math>
\hat{\beta} = \arg\min_{\beta} \sum_{i=1}^{n} (y_i - X_i \beta)^2 + \lambda \sum_{j=1}^{p} \beta_j^2
</math>
 
 
where:
* <math> y_i </math> are the target values,
* <math> X_i </math> represents the input features,
* <math> \beta </math>  are the regression coefficients,
* <math> \lambda </math> is the regularization parameter controlling the strength of the penalty.
 
 
 
The penalty term <math>\lambda \sum_{j=1}^{p} \beta_j^2</math> ensures that coefficients are shrunk towards zero, reducing overfitting but not setting any coefficients exactly to zero. For small <math>\lambda</math>, model behaves closer to an unregularized model (like ordinary least squares); for larger <math>\lambda</math>, strong regularization can push model coefficients towards zero. Lasso may set some to exactly zero, while Ridge reduces the size but does not zero-out coefficients.
 
 
Lasso regression introduces an L1 penalty term:
 
<math>
\hat{\beta} = \arg\min_{\beta} \sum_{i=1}^{n} (y_i - X_i \beta)^2 + \lambda \sum_{j=1}^{p} |\beta_j|
</math>
 
where the L1 penalty term <math>\lambda \sum_{j=1}^{p} |\beta_j|</math> encourages sparsity in the coefficients. Some coefficients will be set exactly to zero, making Lasso useful for feature selection.
 
<b> Visualization </b> </br>
The following Python script visualizes the impact of Ridge and Lasso regularization by plotting the contours of the Mean Squared Error (MSE) loss function along with the constraint regions imposed by Ridge (L2 ball) and Lasso (L1 diamond):
 
<source lang="python">
import numpy as np
import matplotlib.pyplot as plt
 
# Define the loss function
def mse_loss(beta1, beta2):
    return beta1**2 + beta2**2  # Simplified MSE (for visualization)
 
# Generate grid for visualization
beta1_vals = np.linspace(-2, 2, 100)
beta2_vals = np.linspace(-2, 2, 100)
B1, B2 = np.meshgrid(beta1_vals, beta2_vals)
Loss = mse_loss(B1, B2)
 
# Plot contours of the loss function
plt.figure(figsize=(10, 6))
contour = plt.contour(B1, B2, Loss, levels=20, cmap='viridis')
plt.colorbar(contour)
 
# Plot Ridge constraint (L2 ball)
ridge_circle = plt.Circle((0, 0), radius=1.2, color='red', fill=False, linestyle='dashed', label="Ridge Constraint (L2)")
 
# Plot Lasso constraint (L1 diamond)
lasso_diamond = np.array([[1, 0], [0, 1], [-1, 0], [0, -1], [1, 0]]) * 1.2
plt.plot(lasso_diamond[:, 0], lasso_diamond[:, 1], 'b--', label="Lasso Constraint (L1)")
 
# Add constraints to the plot
ax = plt.gca()
ax.add_patch(ridge_circle)
plt.xlim(-2, 2)
plt.ylim(-2, 2)
plt.axhline(0, color='black', linewidth=0.5)
plt.axvline(0, color='black', linewidth=0.5)
 
# Labels and legend
plt.xlabel(r'$\beta_1$')
plt.ylabel(r'$\beta_2$')
plt.title("Effect of Ridge and Lasso Regularization on Loss Function")
plt.legend()
plt.grid(True)
plt.show()
 
 
</source>
Output:
[[File: contr5.3.png|thumb|600px|left|]]
1. Ridge Regression (L2) – Red Circle
 
    Ridge regression enforces a circular constraint on the coefficients (β1,β2β1​,β2​).
    The solution is found where the contours of the loss function (MSE) first touch this L2 constraint region.
    Since the constraint is smooth (no sharp corners), the coefficients are shrunk gradually towards zero but rarely exactly zero.
    This means Ridge keeps all features in the model but reduces their impact by shrinking their values.
 
2. Lasso Regression (L1) – Blue Diamond
 
    Lasso regression imposes a diamond-shaped constraint on the coefficients.
    The sharp corners of the L1 constraint (at the axes) make it more likely that the optimal solution lies exactly on one of these axes.
    This means Lasso sets some coefficients to exactly zero, effectively performing feature selection by eliminating less important variables.
    The reason for this behavior is that the contours of the loss function often first touch the constraint at the corners, leading to sparsity in the solution. </br>
 
<b> Conclusion </b>
Ridge Regression (L2) shrinks coefficients continuously but keeps all variables.
Lasso Regression (L1) forces some coefficients to exactly zero, performing automatic feature selection.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 5.4 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
=== Question ===
Label smoothing modifies the standard one-hot ground truth labels in multi-class classification by assigning a small amount of probability mass to incorrect classes. Suppose we replace each one-hot label <math>y</math> with a “smoothed” label <math>\tilde{y}</math> that assigns <math>1 - \alpha</math> to the true class and <math>\alpha / (C-1)</math> to each of the other <math>C - 1</math> classes, where <math>C</math> is the total number of classes and <math>\alpha</math> is a small constant.
 
Write the modified cross-entropy loss using <math>\tilde{y}</math> and a predicted probability vector <math>p</math>.
Explain how this modification helps reduce model overconfidence and potentially improves calibration.
Give an example scenario (e.g., large-scale image classification) where label smoothing has been shown to be particularly beneficial.
=== Solution ===
 
Modified Cross-Entropy Loss
Standard cross-entropy for one-hot labels <math>y</math> and predicted probabilities <math>p</math> is <math>-\sum_{c=1}^C y_c \log p_c.</math>
With label smoothing, each target label becomes <math>\tilde{y}_c</math>. Hence, the loss is:
 
<math> \ell_{\mathrm{smooth}} = - \sum_{c=1}^C \tilde{y}_c \,\log p_c, \quad \text{where} \quad \tilde{y}_c = {1α,for the correct class,αC1,for other classes. </math>
Reduction of Overconfidence and Improved Calibration
 
In a one-hot scheme, the model is strongly penalized if it does not put near-total probability mass on the correct class.
Label smoothing distributes a fraction <math>\alpha</math> of the probability across incorrect classes, preventing the model from becoming overly confident.
By avoiding extreme outputs (probabilities close to 0 or 1), the model tends to produce more calibrated predictions, often generalizing better to unseen data.
Example Scenario
In large-scale image classification (e.g., ImageNet), label smoothing has demonstrated notable gains:
 
Models converge more smoothly, especially when data is abundant but still noisy in certain classes.
Overconfidence is reduced, leading to improved validation accuracy and calibration metrics.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 5.5 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Modified
 
<b>References:</b> https://www.cs.toronto.edu/~lczhang/321/files/midterm_b.pdf
 
=== Question ===
Which of the following about weight decay is true?
 
<br>
(A) Including weight decay generally reduces the training cost.</br>
<br>(B) Weight decay directly penalizes large activations.</br>
<br>(C) Weight decay can help revive a “dead” or “saturated” neuron.</br>
<br>(D) Weight decay helps get out of saddle points.</br>
 
=== Solution ===
C) Weight decay increases the training cost because there is an extra (positive) term in the training cost.Weight decay penalizes large weights and not activations. The choice of adding weight decay is independent
of the choice of the optimizer. Weight decay can revive a “dead” neuron, but it does not help us get out of saddle points. Weight decay primarily regularizes weights and does not directly address saddle points. Techniques like momentum or adaptive gradients are more relevant for escaping saddle points.
 
Additional note: Dead/saturated neurons have activations that are always in the plateau area of the activation function (e.g. ReLU or sigmoid or tanh), caused by large (positive or negative) weights/biases. Weight
decay reduces those parameters, so that the activations will not be consistently large. It might be useful to note that weight decay can be used in combination with various optimizers like SGD (Stochastic Gradient Descent), Adam, and RMSprop. While SGD can benefit from weight decay, optimizers like Adam and RMSprop with adaptive learning rates might help mitigate issues like saddle points and local minima, where weight decay alone might be insufficient.
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 5.6 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
=== Question ===
 
Train a neural network with both L2 regularization and early stopping on UCI dataset. Vary the regularization strength and patience, and observe how they interact to affect model generalization.
 
=== Solution ===
<source lang="python">
import torch
import torch.nn as nn
import torch.optim as optim
from sklearn.model_selection import train_test_split
from sklearn.datasets import load_diabetes
from sklearn.preprocessing import StandardScaler
from torch.utils.data import DataLoader, TensorDataset
import matplotlib.pyplot as plt
 
# Set device
device = torch.device("cuda" if torch.cuda.is_available() else "cpu")
 
# Load UCI dataset (using the diabetes dataset as an example)
data = load_diabetes()
X, y = data.data, data.target
 
# Standardize features
scaler = StandardScaler()
X = scaler.fit_transform(X)
 
# Split into training, validation, and test sets
X_train, X_temp, y_train, y_temp = train_test_split(X, y, test_size=0.3, random_state=42)
X_val, X_test, y_val, y_test = train_test_split(X_temp, y_temp, test_size=0.5, random_state=42)
 
# Convert data to PyTorch tensors
X_train_tensor = torch.tensor(X_train, dtype=torch.float32).to(device)
y_train_tensor = torch.tensor(y_train, dtype=torch.float32).view(-1, 1).to(device)
X_val_tensor = torch.tensor(X_val, dtype=torch.float32).to(device)
y_val_tensor = torch.tensor(y_val, dtype=torch.float32).view(-1, 1).to(device)
X_test_tensor = torch.tensor(X_test, dtype=torch.float32).to(device)
y_test_tensor = torch.tensor(y_test, dtype=torch.float32).view(-1, 1).to(device)
 
# Prepare DataLoader
train_loader = DataLoader(TensorDataset(X_train_tensor, y_train_tensor), batch_size=32, shuffle=True)
val_loader = DataLoader(TensorDataset(X_val_tensor, y_val_tensor), batch_size=32)
test_loader = DataLoader(TensorDataset(X_test_tensor, y_test_tensor), batch_size=32)
 
# Define neural network model
class SimpleNN(nn.Module):
    def __init__(self, input_dim):
        super(SimpleNN, self).__init__()
        self.fc1 = nn.Linear(input_dim, 64)
        self.fc2 = nn.Linear(64, 32)
        self.fc3 = nn.Linear(32, 1)
        self.relu = nn.ReLU()
   
    def forward(self, x):
        x = self.relu(self.fc1(x))
        x = self.relu(self.fc2(x))
        x = self.fc3(x)
        return x
 
# Training function with early stopping
def train_model(model, train_loader, val_loader, criterion, optimizer, num_epochs, patience):
    train_loss_history = []
    val_loss_history = []
 
    best_val_loss = float('inf')
    best_model_state = None
    patience_counter = 0
 
    for epoch in range(num_epochs):
        # Training phase
        model.train()
        train_loss = 0.0
        for X_batch, y_batch in train_loader:
            optimizer.zero_grad()
            y_pred = model(X_batch)
            loss = criterion(y_pred, y_batch)
            loss.backward()
            optimizer.step()
            train_loss += loss.item()
        train_loss /= len(train_loader)
        train_loss_history.append(train_loss)
 
        # Validation phase
        model.eval()
        val_loss = 0.0
        with torch.no_grad():
            for X_batch, y_batch in val_loader:
                y_pred = model(X_batch)
                loss = criterion(y_pred, y_batch)
                val_loss += loss.item()
        val_loss /= len(val_loader)
        val_loss_history.append(val_loss)
 
        # Early stopping
        if val_loss < best_val_loss:
            best_val_loss = val_loss
            best_model_state = model.state_dict()
            patience_counter = 0
        else:
            patience_counter += 1
            if patience_counter >= patience:
                print(f"Early stopping triggered at epoch {epoch+1}.")
                break
 
        print(f"Epoch {epoch+1}/{num_epochs}, Train Loss: {train_loss:.4f}, Val Loss: {val_loss:.4f}")
 
    # Load the best model state
    model.load_state_dict(best_model_state)
    return train_loss_history, val_loss_history
 
# Define L2 regularization strengths and patience values
l2_strengths = [0.0, 0.01, 0.1]
patience_values = [3, 5]
results = {}
 
# Train models with different regularization and early stopping settings
for l2_strength in l2_strengths:
    for patience in patience_values:
        print(f"\nTraining with L2 regularization = {l2_strength}, Patience = {patience}")
        model = SimpleNN(input_dim=X.shape[1]).to(device)
        optimizer = optim.Adam(model.parameters(), lr=0.001, weight_decay=l2_strength)
        criterion = nn.MSELoss()
 
        train_loss, val_loss = train_model(
            model, train_loader, val_loader, criterion, optimizer, num_epochs=100, patience=patience
        )
 
        # Evaluate the model on the test set
        model.eval()
        test_loss = 0.0
        with torch.no_grad():
            for X_batch, y_batch in test_loader:
                y_pred = model(X_batch)
                loss = criterion(y_pred, y_batch)
                test_loss += loss.item()
        test_loss /= len(test_loader)
 
        results[(l2_strength, patience)] = {
            "train_loss": train_loss,
            "val_loss": val_loss,
            "test_loss": test_loss
        }
 
# Plot results
plt.figure(figsize=(12, 8))
for (l2_strength, patience), result in results.items():
    plt.plot(result["val_loss"], label=f"L2={l2_strength}, Patience={patience}")
 
plt.title("Validation Loss with Different L2 Regularization and Patience")
plt.xlabel("Epochs")
plt.ylabel("Validation Loss")
plt.legend()
plt.grid(True)
plt.savefig('validation_loss.jpg')
 
# Display summary results
print("\nSummary of Results:")
for (l2_strength, patience), result in results.items():
    print(f"L2 Regularization: {l2_strength}, Patience: {patience}")
    print(f"Final Train Loss: {result['train_loss'][-1]:.4f}")
    print(f"Final Validation Loss: {result['val_loss'][-1]:.4f}")
    print(f"Test Loss: {result['test_loss']:.4f}\n")
</source>
 
Output:
 
[[File:validation loss.jpg|thumb|500px|left|]]
<br clear="all">
 
1. Effect of L2 Regularization:
 
With regularization, the validation loss decreases more smoothly. A stronger penalty (L2=0.1) slows down the training initially, as it regularizes the weights more strictly. This can prevent overfitting but may lead to underfitting if the regularization is too strong.
 
2. Effect of Patience (Early Stopping):
 
Compared with patience=3, the model with patience=5 may lead to slight improvements if the loss decreases further after plateauing. Longer patience typically benefits models with regularization (L2=0.1) because it gives the model more time to converge despite slower initial progress.
 
3. Interaction Between L2 and Patience:
 
L2=0.1 with Patience=3 stops relatively early and might underfit slightly compared to Patience=5; Moderate L2 (L2=0.01) and higher patience (5) provide a better trade-off, as the validation loss decreases smoothly without abrupt stops.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 5.7 ==
 
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
 
Describe the main idea of the Manifold Tangent Classifier and its application in regularization. Provide an example.
 
=== Solution ===
 
The Manifold Tangent Classifier (MTC) is a method that improves generalization by leveraging the low-dimensional structure of data. Many datasets lie on a lower-dimensional manifold embedded in high-dimensional space, meaning small changes along certain directions should not affect classification.
 
MTC ensures that the classifier <math> f(x) </math> is invariant to these small changes by enforcing that its gradient is orthogonal to the tangent vectors of the manifold at <math> x </math>. These tangent vectors represent directions where the data naturally varies, and the classifier should be insensitive to changes in these directions.
 
Mathematically, this is achieved through regularization:
 
<math> \lambda \sum_i \left( \frac{\partial{f(x)}}{\partial{x}} \cdot v_i \right)^2 </math>
where:
 
<math> \lambda </math> controls the strength of regularization.
<math> v_i </math> are the tangent vectors of the manifold.
The expression penalizes large directional derivatives of <math> f(x) </math> along these vectors.
By adding this regularization term to the loss function, the model becomes more invariant to small perturbations along the data manifold, leading to:
# Reduced overfitting, as the model does not capture irrelevant noise.
# Better generalization, since the decision boundary aligns with meaningful variations in the data.
# Robustness to adversarial noise, as the classifier focuses on actual structure rather than high-dimensional artifacts.
This approach is particularly useful in semi-supervised learning and unsupervised feature learning, where understanding data geometry helps in learning meaningful representations.
 
 
Consider a dataset of handwritten digits, such as the MNIST dataset, where each digit is represented as a high-dimensional image with 28×28 pixels, resulting in a 784-dimensional space. Despite this high-dimensional representation, the variations in handwritten digits do not span the entire space. Instead, they form a much lower-dimensional manifold within it. These variations include differences in slant, stroke thickness, and minor rotations, which do not alter the identity of the digit itself. However, traditional classifiers may be sensitive to these variations, potentially leading to misclassification.
 
The Manifold Tangent Classifier (MTC) helps mitigate this issue by enforcing invariance to small perturbations along the data manifold. It does this by identifying tangent vectors, which represent natural variations in the data. The classifier is then trained to ensure that its gradient is orthogonal to these tangent directions. This means that small changes in writing style—such as a slightly tilted or stretched digit—will not affect the classification outcome. By incorporating this regularization, the model aligns its decision boundary with meaningful variations rather than being influenced by irrelevant fluctuations in high-dimensional space.
 
For example, in a typical classification scenario, a standard neural network might misclassify a digit "3" as an "8" due to a slight distortion. However, with MTC, the classifier understands that such a variation is natural and maintains the correct classification. This regularization approach ensures that the model learns representations that are not just accurate but also more robust and interpretable.
 
 
 
 
 
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 5.8 ==
 
'''Level:''' *** (Hard)
 
'''Exercise Types:''' Novel
 
=== Question ===
 
You are provided with a noisy dataset sampled from a simple harmonic oscillator, with mass <math>m=1 kg</math> and spring constant <math>k=100N/m</math>. The task in this problem is to write a regression neural network that predicts the oscillator's position <math>y</math> as a function of time <math>t</math>.
 
The dataset can be generated using the following script:
 
<source lang="python">
import numpy as np
import torch
 
np.random.seed(1234)
 
t = np.random.uniform(0, 1, 30)
noise = np.random.normal(0, 0.2, t.shape)
y = np.sin(10*t) + noise
 
t = torch.tensor(t, dtype=torch.float32).view(-1, 1)
y = torch.tensor(y, dtype=torch.float32).view(-1, 1)
</source>
 
'''(a) Neural network'''
 
In PyTorch, write a fully connected neural network with 4 hidden layers, each with 200 neurons. Use a tanh activation function after each hidden layer. Use a learning rate of 0.001. Generate a test dataset of times between <math>t=0</math> and <math>t=1</math> second(s). Create a plot and comment on the result.
 
'''(b) L2 regularization'''
 
Repeat the process above, but implement L2 regularization (the weight_decay parameter) in the optimizer. Comment on the result.
 
'''(c) Physics-informed neural network'''
 
If a dataset follows a known physical law (i.e., a differential equation), this differential equation can be added as a term to the loss function. This penalizes the neural network for solutions that do not obey this law and acts as a form of regularization. The equation of motion for the simple harmonic oscillator is:
 
<math> \frac{d^2y}{dt^2} + \frac{k}{m}y = 0 </math>
 
Using PyTorch's automatic differentiation function(s), compute the first and second derivatives of <math>y</math> with respect to <math>t</math>, and create a new loss function that is the sum of the mean squared error (MSE) and a new "physics loss" term. Introduce a hyperparameter that controls what fraction of the physics loss gets added to the total loss. Note that getting a good solution requires a careful selection of this parameter as well as the weight decay factor.
 
=== Solution ===
 
<source lang="python">
 
import torch
import torch.nn as nn
import torch.optim as optim
import numpy as np
import matplotlib.pyplot as plt
 
torch.manual_seed(1234)
 
class SimpleNN(nn.Module):
    def __init__(self):
        super(SimpleNN, self).__init__()
        self.fc1 = nn.Linear(1, 200)
        self.fc2 = nn.Linear(200, 200)
        self.fc3 = nn.Linear(200, 200)
        self.fc4 = nn.Linear(200, 200)
        self.fc5 = nn.Linear(200, 1)
 
    def forward(self, t):
        t = torch.tanh(self.fc1(t))
        t = torch.tanh(self.fc2(t))
        t = torch.tanh(self.fc3(t))
        t = torch.tanh(self.fc4(t))
        t = self.fc5(t)
        return t
 
def train(t, y, WEIGHT_DECAY=0, PHYSICS=0):
    model = SimpleNN()
    criterion = nn.MSELoss()
    optimizer = optim.Adam(model.parameters(), lr=0.001, weight_decay=WEIGHT_DECAY)
 
    epochs = 2000
    for epoch in range(epochs):
        perm = torch.randperm(len(t))
        t = t[perm]
        y = y[perm]
 
        t.requires_grad = True
        y_pred = model(t) # forward pass
 
        ### derivatives for the physics loss ###
        dy_dt = torch.autograd.grad(outputs=y_pred, inputs=t, grad_outputs=torch.ones_like(y_pred), create_graph=True)[0]
        d2y_dt2 = torch.autograd.grad(outputs=dy_dt, inputs=t, grad_outputs=torch.ones_like(dy_dt), create_graph=True)[0]
        physics_loss = torch.mean((d2y_dt2 + 100 * y_pred) ** 2)
 
        loss = criterion(y_pred, y)
        total_loss = loss + PHYSICS * physics_loss
 
        optimizer.zero_grad()
        total_loss.backward() # backwards pass
        optimizer.step()  # update weights
 
        t.requires_grad = False
 
        if (epoch + 1) % 100 == 0:
            print(f"Epoch [{epoch + 1}/{epochs}], Loss: {loss.item():.4f}, "
                  f"Physics Loss: {physics_loss.item():.4f}, Total Loss: {total_loss.item():.4f}")
 
    t_test = torch.linspace(0, 1, 100).view(-1, 1)
    with torch.no_grad():
        predictions = model(t_test)
 
    return t_test.numpy(), predictions.numpy()
 
t_test, pred = train(t, y)
_, pred_L2 = train(t, y, WEIGHT_DECAY=1e-3)
_, pred_phys = train(t, y, WEIGHT_DECAY=1e-3, PHYSICS=1e-5)
 
plt.figure(figsize=(8, 4))
plt.plot(t_test, pred, label="No regularization")
plt.plot(t_test, pred_L2, label="L2 regularization")
plt.plot(t_test, pred_phys, label="L2 + physics")
plt.scatter(t.numpy(), y.numpy(), color="k", label="Training data")
plt.xlabel("$t$")
plt.ylabel("$y$")
plt.legend()
plt.show()
 
</source>
 
[[Image:PINN L2.png|thumb|400px|left|A plot of the training data, along with the test predictions for a neural network with (a) no regularization, (b) L2 regularization, and (c) L2 regularization + physics informed loss.]]
<br clear="all">
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 5.9 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
=== Question ===
 
You will train a linear regression model to predict y values. Assume you have a high-dimensional dataset with noise, where the input features are <math>\mathbf{x} \in \mathbb{R}^{100 \times 50}</math> (100 samples and 50 features), and the target outputs are <math>\mathbf{y} \in\mathbb{R}^{100}</math>.
 
1. Write a Python function to implement a linear regression model with L2 regularization using gradient descent.
 
2. Train the model in:
 
    a. Without regularization lambda = 0
 
    b. With regularization lambda = 0.1
 
=== Solution ===
 
<source lang="python">
import numpy as np
 
np.random.seed(42)
x = np.random.randn(100, 50)
true_w = np.random.randn(50) * 0.5
y = x @ true_w + np.random.randn(100) * 0.1
 
# linear regression with L2 regularization
def linear_reg(x, y, lr = 0.01, lambda = 0.0, epochs = 1000):
    n, d = x.shape
    w = np.zeros(d)
    for _ in range(epochs):
        gradient = -2/n * x.T @ (y - x @ w) + lambda_ * w
        w = w - lr * gradient
 
no_reg = linear_reg(x, y, lambda = 0.0)
with_reg = linear_reg(x, y, lambda = 0.1)
</source>
 
</div>
 
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 5.10 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
=== Question ===
Consider a deep learning model that suffers from high variance, indicating it might be overfitting to the training data. Explore regularization techniques that could potentially reduce overfitting. Describe the following methods and explain how they contribute to reducing overfitting:
 
1. Weight Decay
 
2. Noise Injection
 
3. Early Stopping
 
4. Bagging
 
Provide a simple example or formula (where applicable) to demonstrate each method's effect.
 
=== Solution ===
'''1. Weight Decay:'''
This regularization technique involves adding a penalty term to the loss function based on the sum of the squared values of the parameters (L2 regularization). This discourages large weights and helps to prevent the model from fitting the noise in the training data.
 
Example Formula: <math>L_{new} = L_{original} + \lambda \sum_{i} w_i^2</math>, where <math>\lambda</math> is the regularization strength and <math>w_i</math> are the model weights.
 
Example: This form of regularization is often used with gradient descent based optimization methods, such as when training a neural network.
 
A very similar form of regularization is an L1 penalty, which uses <math> |w_i| </math> instead of <math> w_i^2 </math>. One notable difference is that L1 can cause some weights to be set exactly to 0, while this is highly unlikely with L2.
 
'''2. Noise Injection:'''
By adding noise to the inputs or outputs during training, the model learns to ignore small variations, enhancing its generalization capabilities. Noise injection can be applied in different forms, such as adding noise to the weights (weight noise), outputs (output noise), or inputs (input noise).
 
Example: Injecting Gaussian noise <math>\epsilon \sim \mathcal{N}(0, \sigma^2)</math> to inputs during training to make the model robust to slight variations in input data.
 
'''3. Early Stopping:'''
This involves stopping the training process before the model has fully converged to the minimum of the loss function on the training set. By monitoring the performance on a validation set and stopping when performance degrades (implying the start of overfitting), this method effectively limits the capacity of the model.
 
Example: Stop training when validation loss begins to increase, even if training loss continues to decrease.
 
'''4. Bagging:'''
Bagging, or bootstrap aggregating, involves training multiple models on different random subsets of the training data (that were sampled with replacement) and then averaging their predictions. This technique reduces variance and avoids overfitting by smoothing out predictions.
 
Example: Train multiple neural networks independently on different subsets of data and average their outputs to make final predictions.
 
Example: Use bagging for models that inherently have a high variance, such as decision tree models (e.g., random forest).
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 5.11 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
Suppose the loss of a machine learning problem follows the function <math> f(x) = \cos(x) </math>. Find the tangent of <math> f(x) </math> at <math>x = 0</math>.
 
=== Solution ===
<math>f'(0) = -\sin(0) = 0</math>
 
<math>\cos(0)=1</math>
 
Therefore, the tangent function is <math> g(x) = 1 </math>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 5.12 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
=== Question ===
Consider the manifold to be the unit sphere in <math>\mathbb{R}^{3}</math>
 
(1) What is the dimension of the sphere?
 
(2) Find the tangent plane to any point on the sphere
 
=== Solution ===
 
(1) A sphere in <math>\mathbb{R}^{3}</math> can be expressed as <math>S^{2}:=\{(x_1, x_2, x_3)\in \mathbb{R}^{3}: x_1^2+x_2^2+x_3^2=1\}</math>, so it's dimension is 2
 
(2) Note that <math>S^{2}</math> can also be expressed as the zero set of the function <math>F: \mathbb{R}^{3} \rightarrow \mathbb{R}, (x_1, x_2, x_3)\mapsto x_1^2 + x_2^2 + x_3^2 - 1 </math>, and it's Jacobian <math>DF:=  (2x_1, 2x_2, 2x_3) </math> is maximal rank 1 on <math>S^{2}</math>. Therefore, for any point <math>p=(x_1, x_2, x_3)\in S^{2} </math> the tangent plane is given by ker<math>DF(p) = \{v\in \mathbb{R}^{3}: (2x_1, 2x_2, 2x_3) \cdot v = 0\} </math>
 
</div>
 
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 5.13 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Modified
 
'''Reference:''' Prince, Simon J.D. ''Understanding Deep Learning''. The MIT Press, 2023, p. 160, udlbook.com. Accessed 25 Jan. 2025.
 
=== Question ===
Show that the weight decay parameter update with decay rate <math>2\alpha\lambda</math>:
<math>w = (1-2\alpha \lambda)w - \alpha  \nabla L(w)</math> on the original loss function <math>\nabla L(w))</math> is equivalent to a standard gradient update using L2 regularization so that the modified loss function is <math>\tilde{L}(w) = L(w) + \lambda ||w||^2</math>.
 
=== Solution ===
Given <math>\tilde{L}(w) = L(w) + \lambda ||w||^2</math>,
<math>\nabla \tilde{L}(w) = \nabla L(w) + 2 \lambda w</math>.
 
Given <math>w = (1-2\alpha \lambda)w - \alpha  \nabla L(w)</math>,
<math>w = w - \alpha (2 \lambda w + \nabla L(w))</math>, which is the standard gradient update on <math>\tilde{L}(w)</math>.
 
</div>
 
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 5.14 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
Except for the examples listed in class, provide another example of noise injection as part of the regularization strategy.
 
=== Solution ===
Here we look at the dropout noise which randomly sets some features to 0 during training, this strategy prevents co-adaption of neurons.
 
The dropout function is defined as:
 
<math>
x' = x \cdot M, \quad M \sim \text{Bernoulli}(p)
</math>
 
where <math>M</math> is a binary mask with probability <math>p</math> of keeping each unit.
 
A Python Example (PyTorch):
 
<syntaxhighlight lang="python">
import torch
 
dropout = torch.nn.Dropout(p=0.5)  # 50% dropout
x = torch.tensor([0.5, 0.3, 0.8])
x_noisy = dropout(x)
print(x_noisy)
</syntaxhighlight>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 5.15 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Modified
 
'''Reference:''' Calin, Ovidiu. Deep learning architectures: A mathematical approach. Springer, 2020, page 463
 
=== Question ===
A one-hidden layer feedforward neural net, with dimensions 784-N-10, is used to classify the MNIST data. Find the range of the number of hidden
neurons, N, for which the network overfits the training data. Note the MNIST dataset consists of 28x28 images, each identified with 10 classes. Assume the dataset contains 10,000 images.
=== Solution ===
We assume the MNIST dataset has 10,000 training points <math>{(x_i, z_i)}</math> where <math>x_i</math> is a 784 dimensional vector (28x28 flattened image) and <math>z_i</math> is a 10 dimensional one hot vector (indicating which class the image belongs to). Since there are 10,000 images, this yields a space with dimension 10,000*10 =100,000.
 
The dimension of the output manifold for the one-hidden layer feedforward NN is <math>r = 784*N + N*10 + N</math> since we have <math>784*N</math> weights, from the input to hidden layer, <math>N</math> biases, and <math>N*10</math> weights from the hidden layer to the output layer.
 
Therefore for the network to overfit, we require <math>r > 100,000 \Rightarrow 784*N + N*10 + N > 100,000 \Rightarrow N > 100,000/795 =125.786</math>. That is, we require the dimension of the output manifold of the neural network to be greater than 100,000. Therefore, we require over 126 hidden neurons for which the network overfits the training data, assuming the training set consists of 10,000 images.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 5.16 ==
 
<b>Level:</b> ** (Moderate) 
 
<b>Exercise Types:</b> Novel 
 
=== Question ===
a). Given the loss function of a ridge regression, isolate the weights, <math> \theta </math> and compare the ridge regression weights against that of an OLS regression.
 
<math>  f(\theta) = \sum_i (y_i - \hat{y}_i )^2 + \lambda ||\theta||^2_2  </math>
 
b). Show how the weights of the ridge regression are updated using the Newton-Raphson method.
 
c). Discuss one benefits of ridge regression.
 
=== Solution ===
 
a).
 
<p>
<math>
\begin{align*}
    f(\theta) &= \sum_i (y_i - \hat{y}_i)^2 + \lambda \sum_j \theta_j^2 \
    &= (\textbf{y} - \mathbf{x}\theta)^T (\textbf{y} - \textbf{x}\theta) + \lambda \theta ^T \theta \
    \nabla_\theta f(\theta) &= -2 \textbf{x}^T(\textbf{y} - \textbf{x}\theta) + 2 \lambda \theta \
\end{align*}</math>
</p>
<p>
By letting <math>\nabla_\theta f(\theta) = 0,</math>
</p>
<math>
\begin{align*}
    0 &= -2 \textbf{x}^T(\textbf{y} - \textbf{x}\theta) + 2 \lambda \theta \
    &= - \textbf{x}^T\textbf{y} + \textbf{x}^T\textbf{x}\theta + \lambda \theta \
    \textbf{x}^T\textbf{y} & = \textbf{x}^T\textbf{x}\theta + \lambda \theta \
    \textbf{x}^T\textbf{y} & = (\textbf{x}^T\textbf{x} + \lambda I)\theta  \
    \theta & = (\textbf{x}^T\textbf{x} + \lambda I)^{-1}\textbf{x}^T\textbf{y}
\end{align*}
</math>
 
Comparing both weighting schemes:
 
 
<math>
\begin{align*}
    \theta_{ridge} &= (\textbf{x}^T\textbf{x} + \lambda I)^{-1}\textbf{x}^T\textbf{y} \
    \theta_{OLS} &= (\textbf{x}^T\textbf{x})^{-1}\textbf{x}^T\textbf{y}
\end{align*}
</math>
 
 
b).
 
Using the Newton-Raphson method:
 
 
<math>
\begin{align*}
    \theta^{New} &= \theta^{old} + \rho \frac{f(\theta^{Old})}{\nabla f(\theta^{Old})} \
    &= \theta + \rho\big( - \textbf{x}^T(\textbf{y} - \textbf{x}\theta) + \lambda \theta \big)^{-1}  \big((\textbf{y} - \mathbf{x}\theta)^T (\textbf{y} - \textbf{x}\theta^{}) + \lambda \theta ^T \theta \big) \
\end{align*}
</math>
 
c).
 
One advantage of Ridge Regression, apart from the general penalization effect on the coefficients, is that it allows highly correlated <math> \textbf{x} </math> data to be included in the model. When the <math> \textbf{x} </math> data is highly correlated, the <math> \textbf{x}^T \textbf{x} </math> term in the denominator of an OLS regression tends to 0, leaving us with an undefined weight. The added <math> + \lambda I</math> in the denominator of the Ridge Regression reconciles this and therefore allows for highly correlated <math> \textbf{x} </math> features to be included. This can be particularly useful in certain situations, where keeping highly correlated variables increases model accuracy while maintaining stability.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 5.17 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
=== Question ===
 
How Bagging's regularization effect differs from Dropout or L2 regularization?
 
=== Solution ===
 
Bagging reduces variance by training multiple models to integrate. It is best used when computing resources are sufficient because multiple models need to be trained for integration.
 
L2 regularization reduces the overfitting of a model to a particular sample by constraining the weight of a single model. To train individual models when the computational cost is low.
 
Dropout randomly drops neurons during training of individual models, thereby reducing overdependence between neurons, thereby enhancing the robustness of the neural network to reduce overfitting.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 5.18 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
 
Data augmentation is commonly used to improve the generalization ability of deep learning models. Consider a scenario where a convolutional neural network (CNN) is trained on a dataset of handwritten digits.
 
1) Explain how applying random rotations and Gaussian noise injection as data augmentation techniques could impact the model's performance.
 
2) What potential drawbacks can arise from excessive data augmentation, and how can these be mitigated?
 
3) Mathematically, how does injecting noise at the input act as a form of regularization? Explain using the concept of the Manifold Tangent Classifier.
 
=== Solution ===
 
1) Impact of random rotations and Gaussian Noise Injection:
 
• Random rotations: Rotating the images randomly within a small range helps the model learn rotational invariance, making it more robust to variations in real-world data. However, excessive rotation may distort digits, making classification harder.
 
• Gaussian Noise Injection: Adding Gaussian noise to the input images forces the network to learn robust features rather than memorizing the dataset. It acts similarly to dropout by introducing randomness, which helps prevent overfitting.
 
2) Drawbacks of Excessive Data Augmentation:
 
• If the augmentation introduces unrealistic transformations, such as excessive rotations that make digits unrecognizable, it may degrade model performance.
 
• Augmenting too much can increase training time significantly without proportional improvement.
 
• Mitigation: Using hyperparameter tuning, validation monitoring and adversarial training can help balance augmentation intensity.
 
3) Mathematical Explanation of Noise Injection as Regularization:
 
• Injecting noise at the input level can be interpreted as adding a regularization term to the loss function.
 
• If <math> x </math> is the input and noise <math> \epsilon </math> is added, the perturbed input becomes <math> x' = x + \epsilon </math>.
 
• Expanding the loss function using a Taylor series, we see that the noise injection penalizes large weight changes, enforcing smooth decision boundaries.
 
• The Manifold Tangent Classifier (MTC) leverages this by learning the local manifold structure of the data, ensuring that small perturbations (such as injected noise) do not drastically change the classification outcome.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 5.19 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
=== Question===
  <p>L2 regularization (also known as weight decay) is widely used to prevent overfitting in neural networks. The regularized loss function for a neural network is given by:</p>
 
  <p>
    <em>L<sub>reg</sub>(θ) = L<sub>train</sub>(θ) + λ ||θ||<sub>2</sub><sup>2</sup></em>
  </p>
  <p>where <em>L<sub>train</sub>(θ)</em> is the training loss (e.g., cross-entropy loss), <em>||θ||<sub>2</sub><sup>2</sup> = ∑<sub>i=1</sub><sup>N</sup> θ<sub>i</sub><sup>2</sup></em> is the squared L2 norm of the weights, and <em>λ</em> is the regularization hyperparameter.</p>
 
  <ol>
    <li><strong>Derive the gradient of the regularized loss function</strong> with respect to the weights <em>θ<sub>j</sub></em>. Show the update rule for the weight <em>θ<sub>j</sub></em> during gradient descent.</li>
    <li><strong>Prove that the L2 regularization term leads to a shrinkage effect on the weights.</strong> Specifically, show that for each weight <em>θ<sub>j</sub></em>, the regularization term effectively penalizes large values of <em>θ<sub>j</sub></em>, making them smaller over time.</li>
    <li><strong>Explain how L2 regularization helps control overfitting in terms of the bias-variance decomposition.</strong> Use the bias-variance decomposition of the generalization error to argue how L2 regularization reduces model variance.</li>
  </ol>
 
===Solution===
 
  <h5>1. Gradient of the Regularized Loss Function</h5>
  <p>The regularized loss function is:</p>
  <p><em>L<sub>reg</sub>(θ) = L<sub>train</sub>(θ) + λ ||θ||<sub>2</sub><sup>2</sup></em></p>
  <p>To compute the gradient of <em>L<sub>reg</sub>(θ)</em> with respect to the weight <em>θ<sub>j</sub></em>, we first compute the gradient of each term:</p>
  <ul>
    <li><strong>Gradient of the training loss term L<sub>train</sub>(θ):</strong> <em>∇<sub>θ<sub>j</sub></em> L<sub>train</sub>(θ)</em></li>
    <li><strong>Gradient of the regularization term λ ||θ||<sub>2</sub><sup>2</sup>:</strong> The gradient of the L2 penalty term is:
      <em>∇<sub>θ<sub>j</sub></em> (λ ∑<sub>i=1</sub><sup>N</sup> θ<sub>i</sub><sup>2</sup>) = 2λθ<sub>j</sub></em>
    </li>
  </ul>
  <p>The total gradient with respect to <em>θ<sub>j</sub></em> is:</p>
  <p><em>∇<sub>θ<sub>j</sub></em> L<sub>reg</sub>(θ) = ∇<sub>θ<sub>j</sub></em> L<sub>train</sub>(θ) + 2λθ<sub>j</sub></em></p>
 
  <h5>Update Rule for the Weight <em>θ<sub>j</sub></em></h5>
  <p>Using gradient descent, the update rule for <em>θ<sub>j</sub></em> is:</p>
  <p><em>θ<sub>j</sub> ← θ<sub>j</sub> - η (∇<sub>θ<sub>j</sub></em> L<sub>train</sub>(θ) + 2λθ<sub>j</sub>)</em></p>
  <p>Thus, the weight update rule with L2 regularization is:</p>
  <p><em>θ<sub>j</sub> ← θ<sub>j</sub> - η∇<sub>θ<sub>j</sub></em> L<sub>train</sub>(θ) - 2ηλθ<sub>j</sub></em></p>
 
  <h5>2. Shrinkage Effect of L2 Regularization</h5>
  <p>To understand how L2 regularization shrinks the weights, we look at the weight update rule:</p>
  <p><em>θ<sub>j</sub> ← θ<sub>j</sub> - η (∇<sub>θ<sub>j</sub></em> L<sub>train</sub>(θ) + 2λθ<sub>j</sub>)</em></p>
  <p>The second term <em>- 2ηλθ<sub>j</sub></em> represents the shrinkage of the weight <em>θ<sub>j</sub></em>. This term reduces the magnitude of <em>θ<sub>j</sub></em> over time, which is the shrinkage effect. Specifically, the term:</p>
  <p><em>- 2ηλθ<sub>j</sub></em></p>
  <p>forces the weight to decrease in magnitude during each update, thus reducing the complexity of the model and helping prevent overfitting by avoiding large values for the weights. The strength of the shrinkage effect is directly controlled by the regularization parameter <em>λ</em>, the learning rate <em>η</em>, and the magnitude of the weight <em>θ<sub>j</sub></em>.</p>
 
  <h5>3. L2 Regularization and Bias-Variance Decomposition</h5>
  <p>The generalization error <em>ℰ</em> can be decomposed into three components: bias, variance, and irreducible error:</p>
  <p><em>ℰ = Bias² + Variance + Irreducible Error</em></p>
  <p>L2 regularization helps to control overfitting by influencing the variance component. Here’s how:</p>
  <ul>
    <li><strong>Bias:</strong> L2 regularization slightly increases bias by forcing the model to simplify (via shrinking the weights). A more complex model with no regularization can fit the training data perfectly, but at the cost of increased variance.</li>
    <li><strong>Variance:</strong> L2 regularization reduces variance by preventing the weights from becoming too large, which would lead to an overfitting model with high variance. By penalizing large weights, the model generalizes better and has reduced sensitivity to fluctuations in the training data.</li>
  </ul>
  <p>Thus, L2 regularization reduces the overall generalization error by decreasing variance (the model is less sensitive to noise) while introducing a slight increase in bias (the model is less complex). This tradeoff helps the model generalize better to unseen data.</p>
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 5.20 ==
 
'''Level:''' * (Easy) 
 
'''Exercise Types:''' Novel
 
=== Question ===
 
True/False:
 
1.Regularization is a technique that reduces model complexity by adding an extra penalty term (such as L1 or L2 regularization) to the loss function, helping to prevent overfitting.
 
2.Regularization can improve a model's performance on training data by increasing its complexity, allowing it to capture more intricate patterns in the data.
 
=== Solution ===
 
1. True.
 
Regularization works by adding a penalty term to the loss function that discourages the model from becoming too complex. This helps prevent overfitting, where the model performs well on training data but poorly on new, unseen data. Common regularization methods include L1 regularization (Lasso), which penalizes the absolute values of the model weights and can lead to sparse models, and L2 regularization (Ridge), which penalizes the squared values of the weights, encouraging smaller weight magnitudes. By using regularization, the model generalizes better and avoids fitting noise or irrelevant details in the training data.
 
2. False.
 
Regularization actually works by reducing a model's complexity, not increasing it. It adds a penalty to the loss function for large weights, which encourages the model to focus on the most important features and prevents it from fitting to noise or irrelevant patterns in the training data. By controlling complexity, regularization helps the model generalize better to unseen data, rather than overfitting to the training set.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 6.1 == 
 
'''Level:''' ** (Moderate) 
 
'''Exercise Types:''' Modified 
 
'''Reference:''' Source: Schonlau, M., Applied Statistical Learning. With Case Studies in Stata, Springer. ISBN 978-3-031-33389-7 (Chapter 14, page 319).
 
=== Question === 
In binary logistic regression, we model the log odds of one class as a linear function of predictor variables. In multinomial logistic regression, where there are <math>K</math> possible classes, we model the log odds of <math>K-1</math> classes relative to a reference class <math>K</math>: 
 
<math>
\log \left( \frac{p_k}{p_K} \right) = \alpha_k + x_1 \beta_{k1} + \dots + x_p \beta_{kp},
</math>
 
for <math>k = 1, 2, \dots, K-1</math>. 
 
Suppose we use a neural network model to implement multinomial logistic regression. Design a neural network architecture for a case with four input variables (<math>p = 4</math>) and five possible outcome classes ( <math> K = 5 </math> ). 
 
(a) Explain how the output layer should be structured and which activation function should be used. 
 
(b) Introduce a **dropout** mechanism in the model. Explain where dropout can be applied and how it affects training and generalization. 
 
=== Solution === 
To design a neural network that performs multinomial logistic regression with <math>p = 4</math> input variables and <math>K = 5</math> classes, we follow these steps: 
 
1. Neural Network Architecture
 
- Input Layer:** 4 neurons (one for each predictor variable). 
 
- Hidden Layer (Optional):** To introduce non-linearity, we can add a hidden layer with dropout. 
 
- Output Layer:** 5 neurons (one for each class). 
 
Each output neuron represents the log-odds of class <math>k</math> relative to the reference class <math>K</math>, following the equation:
 
<math>
\log \left( \frac{p_k}{p_K} \right) = \alpha_k + x_1 \beta_{k1} + \dots + x_p \beta_{kp}, \quad \text{for } k = 1,2,\dots,4.
</math>
 
The probability of class <math>K</math> is obtained as:
 
<math>
p_K = 1 - \sum_{k=1}^{K-1} p_k.
</math>
 
2. Activation Function
Since this is a **classification problem**, the **softmax activation function** is used in the output layer:
 
<math>
p_k = \frac{e^{z_k}}{\sum_{j=1}^{K} e^{z_j}}, \quad \text{where } z_k = \alpha_k + x_1 \beta_{k1} + \dots + x_p \beta_{kp}.
</math>
 
This ensures that: 
- Each <math>p_k</math> is between 0 and 1. 
- The sum of all <math>p_k</math> values is 1. 
 
3. Incorporating Dropout
Dropout is a regularization technique that randomly deactivates neurons during training to prevent overfitting. It is commonly applied to hidden layers. 
 
- Where to Apply Dropout:
  - If a hidden layer is included, apply dropout (e.g., with probability <math> p = 0.5 </math>) to prevent co-adaptation of neurons. 
  - Dropout **should not** be applied to the input or output layers. 
 
- Impact on Training and Generalization: 
  - During training, dropout randomly removes a fraction of neurons in each iteration, forcing the network to learn more robust features. 
  - During inference (testing), dropout is disabled, and all neurons contribute, with weights scaled accordingly. 
  - This reduces overfitting and improves generalization to unseen data. 
 
4. Loss Function 
To train the network, the **categorical cross-entropy loss** is used:
 
<math>
L = - \sum_{i=1}^{N} \sum_{k=1}^{K} y_{ik} \log p_{ik}
</math>
 
where: 
- <math>N</math> is the number of samples.
 
- <math>y_{ik}</math> is 1 if sample <math>i</math> belongs to class <math>k</math>, otherwise 0. 
 
- <math>p_{ik}</math> is the predicted probability for class <math>k</math>.
 
 
5. Summary of Neural Network Design with Dropout
 
- Input layer: 4 neurons (one per input feature). 
 
- Hidden layer (optional): Can include 8 neurons with ReLU activation and dropout (<math>p = 0.5</math>).
- Output layer: 5 neurons (one per class) with softmax activation. 
 
- Activation function: Softmax in the output layer. 
 
- Loss function: Categorical cross-entropy. 
 
- Regularization: Dropout applied to hidden layer to reduce overfitting. 
 
By including dropout, the model becomes more robust to noise and prevents reliance on specific neurons, leading to better generalization performance.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 6.2 == 
 
'''Level:''' * (Easy) 
 
'''Exercise Types:''' Novel
 
=== Question === 
Consider a neural network with a single hidden layer. The hidden layer has 4 neurons, and the ReLU activation function is applied. During training, dropout is applied with a probability of 0.5. If the input to the hidden layer is <math>\mathbf{x} = [1, 2, 3, 4]</math> and the weights are <math>\mathbf{W} = [0.50.20.30.80.10.50.70.20.40.60.10.30.30.40.20.1]</math>, compute the output of the hidden layer after applying dropout. 
 
Assume the following dropout mask is sampled: <math>\mathbf{m} = [1, 0, 1, 0]</math>.
 
=== Solution === 
1. Compute the pre-activation values: 
<math>\mathbf{z} = \mathbf{W} \cdot \mathbf{x} = [0.50.20.30.80.10.50.70.20.40.60.10.30.30.40.20.1] \cdot [1234] = [3.50.31.40.9]
</math>
 
2. Apply the ReLU activation function: 
<math>\text{ReLU}(\mathbf{z}) = \max(0, \mathbf{z}) = [3.50.31.40.9]
</math>
 
3. Apply the dropout mask and scale by <math>\frac{1}{1 - 0.5} = 2</math>: 
<math>\mathbf{h} = \mathbf{m} \odot \text{ReLU}(\mathbf{z}) \cdot 2 = [1010] \odot [3.50.31.40.9] \cdot 2 = [7.002.80]
</math>
 
The final output of the hidden layer after applying dropout is: 
<math>\mathbf{h} = [7.0, 0, 2.8, 0]</math>.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 6.3 ==
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
=== Question ===
Train a simple deep neural network with and without dropout regularization on the MNIST dataset. Experiment with different dropout rates (0.1, 0.3, 0.5). Analyze the model's performance in terms of accuracy and generalization.
 
=== Solution ===
 
<source lang="python">
import torch
import torch.nn as nn
import torch.optim as optim
from torchvision import datasets, transforms
from torch.utils.data import DataLoader
import matplotlib.pyplot as plt
 
# Set device
device = torch.device("cuda" if torch.cuda.is_available() else "cpu")
 
# Define data preprocessing and load the MNIST dataset
transform = transforms.Compose([
    transforms.ToTensor(),
    transforms.Normalize((0.5,), (0.5,))  # Normalize to [-1, 1]
])
 
train_dataset = datasets.MNIST(root='./data', train=True, transform=transform, download=True)
test_dataset = datasets.MNIST(root='./data', train=False, transform=transform, download=True)
 
train_loader = DataLoader(train_dataset, batch_size=64, shuffle=True)
test_loader = DataLoader(test_dataset, batch_size=64, shuffle=False)
 
# Define a simple neural network
class SimpleNN(nn.Module):
    def __init__(self, dropout_rate=0.0):
        super(SimpleNN, self).__init__()
        self.fc1 = nn.Linear(28 * 28, 256)
        self.dropout = nn.Dropout(dropout_rate)
        self.fc2 = nn.Linear(256, 128)
        self.fc3 = nn.Linear(128, 10)
        self.relu = nn.ReLU()
   
    def forward(self, x):
        x = x.view(x.size(0), -1)  # Flatten the input
        x = self.relu(self.fc1(x))
        x = self.dropout(x)  # Apply dropout
        x = self.relu(self.fc2(x))
        x = self.fc3(x)  # Output layer
        return x
 
# Define training and evaluation functions
def train_model(model, train_loader, optimizer, criterion, num_epochs=10):
    model.train()
    train_loss = []
    for epoch in range(num_epochs):
        epoch_loss = 0.0
        for images, labels in train_loader:
            images, labels = images.to(device), labels.to(device)
           
            optimizer.zero_grad()
            outputs = model(images)
            loss = criterion(outputs, labels)
            loss.backward()
            optimizer.step()
           
            epoch_loss += loss.item()
        train_loss.append(epoch_loss / len(train_loader))
    return train_loss
 
def evaluate_model(model, test_loader, criterion):
    model.eval()
    correct = 0
    total = 0
    test_loss = 0.0
    with torch.no_grad():
        for images, labels in test_loader:
            images, labels = images.to(device), labels.to(device)
            outputs = model(images)
            loss = criterion(outputs, labels)
            test_loss += loss.item()
           
            _, predicted = torch.max(outputs.data, 1)
            total += labels.size(0)
            correct += (predicted == labels).sum().item()
    accuracy = 100 * correct / total
    return test_loss / len(test_loader), accuracy
 
# Experiment with different dropout rates
dropout_rates = [0.0, 0.1, 0.3, 0.5]
results = {}
 
for rate in dropout_rates:
    model = SimpleNN(dropout_rate=rate).to(device)
    criterion = nn.CrossEntropyLoss()
    optimizer = optim.Adam(model.parameters(), lr=0.001)
   
    # Train the model
    print(f"Training with dropout rate: {rate}")
    train_loss = train_model(model, train_loader, optimizer, criterion, num_epochs=10)
   
    # Evaluate the model
    test_loss, test_accuracy = evaluate_model(model, test_loader, criterion)
    results[rate] = (train_loss, test_loss, test_accuracy)
 
# Plot the training loss for different dropout rates
plt.figure(figsize=(10, 6))
for rate, (train_loss, _, _) in results.items():
    plt.plot(train_loss, label=f"Dropout {rate}")
 
plt.title("Training Loss for Different Dropout Rates")
plt.xlabel("Epochs")
plt.ylabel("Loss")
plt.legend()
plt.grid(True)
plt.savefig('training_loss.jpg')
 
 
# Display test accuracy for different dropout rates
print("\nResults Summary:")
for rate, (_, test_loss, test_accuracy) in results.items():
    print(f"Dropout Rate {rate}: Test Loss = {test_loss:.4f}, Test Accuracy = {test_accuracy:.2f}%")
 
</source>
 
 
Output:
 
[[File:training loss.jpg|thumb|600px|left|]]
<br clear="all">
 
Results Summary:
 
Dropout Rate 0.0: Test Loss = 0.0778, Test Accuracy = 97.80%
 
Dropout Rate 0.1: Test Loss = 0.0826, Test Accuracy = 97.48%
 
Dropout Rate 0.3: Test Loss = 0.0873, Test Accuracy = 97.49%
 
Dropout Rate 0.5: Test Loss = 0.0930, Test Accuracy = 97.11%
 
From the summary results and the plot above, it is clear that the model tends to overfit without dropout. With a moderate dropout rate, the model achieves a good balance between generalization and regularization, leading to improved test accuracy. However, with a high dropout rate, excessive regularization can hinder the model's ability to learn effectively, resulting in reduced test accuracy. Hence, we always select moderate dropout rate in the practical problem.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 6.4 ==
 
'''Level:''' * (Easy)
 
'''Exercise Type:''' Novel
 
=== Question ===
True/False Questions on Dropout
 
<b>1.</b> Dropout helps prevent overfitting by randomly deactivating a subset of neurons during training.<br>
 
<b>2.</b> Dropout is used both during training and during testing to ensure consistent performance.<br>
 
<b>3.</b> Using a high dropout rate (e.g., 90%) can lead to underfitting the model.<br>
 
<b>4.</b> Dropout introduces noise in the network, which makes it more robust and forces the network to learn redundant representations.<br>
 
<b>5.</b> Dropout is not compatible with batch normalization because they both normalize activations.<br>
 
<b>6.</b> Dropout improves model performance by reducing training time significantly.<br>
 
=== Solution ===
<b>1.</b> Dropout helps prevent overfitting by randomly deactivating a subset of neurons during training.<br>
<b>Answer</b>: True<br>
<b>Explanation</b>: Dropout prevents overfitting by deactivating a random subset of neurons during each forward pass in training. This forces the network to learn more generalizable features rather than relying on specific neurons or overfitting to the training data. Dropout acts as a regularizer by preventing the model from overfitting. Regularization techniques like dropout introduce some form of 'noise' or uncertainty in training, which prevents the model from memorizing the training data and forces it to focus on the most important patterns in the data <br>
 
<b>2.</b> Dropout is used both during training and during testing to ensure consistent performance.<br>
<b>Answer</b>: False<br>
<b>Explanation</b>: Dropout is only applied during training. During inference, dropout is turned off, and all neurons are active. The weights are scaled to account for the absence of dropout, ensuring consistent output without randomly deactivating neurons.<br>
 
<b>3.</b> Using a high dropout rate (e.g., 90%) can lead to underfitting the model.<br>
<b>Answer</b>: True<br>
<b>Explanation</b>: Underfitting occurs when the model is too simple to capture the underlying patterns in the data. A very high dropout rate deactivates most of the neurons, which reduces the network’s capacity to learn complex patterns. This can result in underfitting, where the model performs poorly on both the training and validation sets. Studies typically recommend a dropout rate between 20% and 50% for most problems. Extremely high rates, such as 90%, often make the network underfit and perform worse than simpler models.<br>
 
<b>4.</b> Dropout introduces noise in the network, which makes it more robust and forces the network to learn redundant representations.<br>
<b>Answer</b>: True<br>
<b>Explanation</b>: By deactivating random neurons during training, dropout adds noise, making the model more robust to variations in the data. This encourages the network to learn redundant and distributed representations, as no single neuron can dominate the decision-making process.<br>
 
<b>5.</b> Dropout is not compatible with batch normalization because they both normalize activations.<br>
<b>Answer</b>: False<br>
<b>Explanation</b>: Dropout and batch normalization are compatible, although they operate differently. Batch normalization normalizes activations, while dropout randomly deactivates neurons. The goal of Batch Normalization is to stabilize and speed up training. The goal of dropout is to prevent overfitting. Batch normalization is typically applied earlier in the network, often before nonlinearities like ReLU, while dropout is typically used later in the network, after the activation layers. Combining both allows you to stabilize training (via batch normalization) while reducing overfitting (via dropout)<br>
 
Additional notes:
Dropout prevents overfitting by giving other nodes to be trained on a chance. It avoids the pitfall of having 1 node dominating other nodes for training, and allow the option for other weights to be explored. A commonly used starting point is a dropout rate of 0.5, which means 50% of neurons are dropped during training. This can be fine-tuned depending on the model's performance on the validation set. Larger dropout rates might be used for smaller networks, while lower rates are preferred for larger models.
 
<b>6.</b> Dropout improves model performance by reducing training time significantly.<br>
<b>Answer</b>: False<br>
<b>Explanation</b>: Dropout helps in preventing overfitting by randomly deactivating a subset of neurons during training, forcing the model to learn more robust features. However, dropout does not necessarily reduce training time. In fact, it can increase training time since fewer active neurons participate in each forward and backward pass, which can slow down convergence. Additionally, since dropout is only applied during training (not inference), the computational savings do not extend to the final model when making predictions.<br>
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 6.5 == 
 
'''Level:''' ** (Moderate) 
 
'''Exercise Types:''' Novel
 
'''References:''' Adapted from concepts introduced by Srivastava et al., 2014.
 
=== Question === 
Consider the application of dropout to a linear regression model with a response variable <math>y</math> and a single predictor <math>x</math>. The linear model can be expressed as:
 
<math>
y = \beta_0 + \beta_1 x + \epsilon
</math>,
where <math>\epsilon</math> represents normally distributed error.
 
(a) If dropout is applied at a rate of 0.2 during the training phase, how does this affect the estimation of <math>\beta_0</math> and <math>\beta_1</math>? Discuss the potential benefits and drawbacks.
 
(b) Extend this to a multiple regression scenario where there are three predictors <math>x_1, x_2, x_3</math>. Explain how dropout could be implemented during training and its expected impact on model variance and bias.
 
=== Solution === 
1.Dropout Implementation and Effects in Simple Linear Regression:
 
- Applying dropout to the predictor <math>x</math> during training involves temporarily removing it from the model with a probability of 0.2. This effectively introduces missingness in the predictor data, which can make the model more robust by preventing it from relying too heavily on <math>x</math> for predicting <math>y</math>.
 
- Potential Benefits:
- Reduces the risk of overfitting by making the model less sensitive to noise in the predictor <math>x</math>.
- Forces the model to not rely on any single input feature, thus potentially discovering more general patterns in the data.
 
- Potential Drawbacks:
- Can increase model bias if important predictor information is consistently dropped.
- Might lead to higher variance in the estimated parameters due to reduced effective sample size during each training iteration.
 
2. Extension to Multiple Regression
 
- In a model with multiple predictors, dropout can be applied to each predictor independently. Each predictor <math>x_i</math> is dropped with a probability of 0.2 during each training epoch.
 
- Impact on Model Variance and Bias:
- Model Variance: Dropout generally increases model variance during training but can lead to a reduction in variance of predictions by averaging over multiple "thinned" models. It can be seen as an ensemble method: As if we have many different tiny networks, and we take the weighted average of all of them.
- Model Bias: Similar to the simple linear regression case, the bias might increase due to the systematic exclusion of potentially important predictors during training epochs.
- The application of dropout in this setting acts as a form of regularization, helping to mitigate overfitting especially when the number of predictors is large relative to the sample size.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 6.6 == 
 
'''Level:''' * (Easy) 
 
'''Exercise Types:''' Novel
 
=== Question ===
Let <math>f(x) = 4\sin(x)</math>. Apply gradient clipping with a limit of 3. What is the resulting gradient?
 
=== Solution ===
The gradient is <math> f'(x) = 4\cos(x)</math>.
 
After clipping, any gradient that exceeds 3 gets limited to 3, and any gradient that goes below -3 gets limited to -3. This is visualized in the plot below.
 
[[Image:gradient clipping.png|thumb|200px|left|]]
<br clear="all">
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 6.7 == 
 
'''Level:''' * (Easy) 
 
'''Exercise Types:''' Modified
 
'''Sources''' Calin, Ovidiu. Deep learning architectures: A mathematical approach. Springer, 2020, Exercise 12.13.9
 
=== Question ===
How does the capacity of a network change when:
 
(a) An extra fully-connected layer is added to the network
 
(b) Some perceptrons are dropped out of the network
 
(c) The weights are constrained to be kept small
 
=== Solution ===
(a) Increases. Adding an extra fully-connected layer increases the number of parameters and allows the network to learn more complex functions. The added depth enables the network to capture higher-order interactions in the data, potentially increasing its representational power. However, deeper networks may also be harder to train due to issues like vanishing gradients.
 
(b) Can decrease effective capacity (but not parameter count). Dropout randomly deactivates neurons during training, which prevents co-adaptation and encourages robustness. While the total number of parameters remains unchanged, the effective capacity of the network is reduced because fewer units participate in each forward pass. However, at test time, all neurons are active with scaled weights, meaning the full network is used.
 
(c) Decreases. Constraining weights (e.g., via L2 regularization) limits how much each neuron can contribute to the output. This reduces the flexibility of the model, making it less prone to overfitting but also potentially limiting its ability to learn complex patterns.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 6.8 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Type:''' Novel
 
=== Question ===
Dropout in Linear Regression
 
1. How does applying dropout during training differ from its use during testing in linear regression models?
 
2. Consider a linear regression model:
<math> y = w_1x_1 + w_2x_2 + w_3x_3 + b </math>
If dropout is applied to the inputs <math> x_1, x_2, x_3 </math> with a dropout rate of <math>p = 0.2</math>, describe the expected effect on the effective input during training.
 
3. Explain how dropout can affect the model’s capacity and generalization in regression tasks.
 
4. How would applying dropout to the weights of a linear regression model (instead of the inputs) impact the learned parameters and model performance?
 
=== Solution ===
 
1. Dropout during training vs. testing:
During training, dropout randomly deactivates a fraction of the neurons (or inputs, in the case of linear regression) at each forward pass. This simulates training on different "thinned" versions of the network, helping to prevent co-adaptation of features. During testing, dropout is not applied; instead, all neurons are active, and the weights are scaled down by the dropout probability to approximate the effect of averaging over the thinned networks.
 
2. Effect on inputs with <math>p = 0.2</math>:
If a dropout rate of 0.2 is applied, 20% of the inputs <math>x_1, x_2, x_3</math> will be set to zero randomly during training. On average, each input contributes only 80% of its value to the output during training. Therefore, the effective input becomes scaled by a factor of <math>1 - p = 0.8</math>. The modified equation during training becomes: 
<math>
\hat{y} = 0.8w_1x_1 + 0.8w_2x_2 + 0.8w_3x_3 + b
</math>
This ensures the model does not overly rely on any single input feature.
 
3. Effect on capacity and generalization:
Dropout reduces the effective capacity of the model during training by deactivating some inputs or neurons, forcing the model to distribute learning across all features. This prevents overfitting to the training data and improves generalization to unseen data. However, in some cases, dropout can slightly increase training time as the model requires more epochs to converge due to the reduced capacity during training.
 
4. Regularization: By preventing any single weight from dominating the learning process, it encourages a more balanced contribution of all features.
 
Weight Averaging: At test time, the model would use the full weight set, but with scaled values, approximating an ensemble of multiple different sub-models.
 
Training Stability: Unlike input dropout, weight dropout directly impacts how much each feature contributes to the prediction at every step, potentially leading to a noisier optimization process.
 
Reduced Overfitting: By forcing the model to rely on different subsets of weights at each training step, it reduces dependency on specific features and helps improve generalization.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 6.9 ==
 
'''Level:''' * (Easy)
 
'''Exercise Type:''' Novel
 
=== Question ===
 
This is a quick exercise for demonstrating the effect of '''batch normalization.''' Suppose you are given the following mini-batch of inputs:
 
<math>X=[-10, -8, 2, 10] </math>
 
(a) Apply the sigmoid activation function directly to <math> X </math>.
 
(b) Now, normalize the inputs <math> X </math> using batch normalization, assuming that the layer has learned parameters <math> \gamma = 2 </math> and <math> \beta = 0.5 </math>. Then, apply the sigmoid activation to the normalized inputs.
 
(c) Why can batch normalization be helpful in models that use activations such as the sigmoid function?
 
=== Solution ===
 
Note that all of the numerical answers here are rounded to 2 decimal places for conciseness.
 
(a) The sigmoid function is given by
 
<math>
\sigma(x) = \frac{1}{1 + e^{-x}}
</math>
 
Applying this to all of the elements of <math> X </math> results in the following.
 
<math>
\sigma(X) = [4.54 \times 10^{-5}, \quad 3.35 \times 10^{-4}, \quad 8.81 \times 10^{-1}, \quad 1.00 \times 10^{-1}]
</math>
 
(b) The mean and variance of <math> X </math> are given below.
 
<math> \mu_B = -2 </math>
<math> \sigma_B^2 = 54 </math>
 
These are used to calculate the normalized form of <math> X </math>.
 
<math>
\hat{X} = \frac{X - \mu_B}{\sqrt{\sigma_B^2 + \epsilon}} = [0.25, 0.31, 0.63, 0.80]
</math>
 
Then, the learned parameters are used for scaling and shifting.
 
<math>
Y = \gamma \hat{X} + \beta = [0.16, 0.24, 0.83, 0.96]
</math>
 
(c) The batch given in the problem statement had values that were either very large or very small, and therefore were in the saturation regions of the sigmoid function. Without batch normalization, the output contained values that were either extremely close to zero or extremely close to 1. In those regions, the gradient of the sigmoid function is very small, which makes it harder for the model to learn. Batch normalization can be used to keep the inputs in the centre, close to zero, where the gradient is non-negligible. In other words, the distribution of the inputs to a layer may change during training (i.e., internal covariate shift); batch normalization is meant to mitigate this.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 6.10 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Type:''' Novel
 
=== Question ===
1. Answer the following True or False questions, and explain why: 
 
(a). Batch normalization reduces internal covariance shift, improving model performance. 
 
(b). Beta-smoothness describes how much the output difference <math>|f(x_1) - f(x_2)|</math> changes when the input difference <math>|x_1 - x_2|</math> is perturbed. 
 
(c). A smaller L in L-Lipschitz continuity generally leads to better optimization. 
 
(d). If the gradient changes significantly between nearby points, using a large learning rate is a good choice. 
 
(e). Weight normalization is a viable alternative to batch normalization. 
 
2. A neural network layer has 5 neurons, each receiving the same input x. The activations before dropout are: 
 
<math>a = [2.0, 1.5, 3.0, 0.5, 2.5]</math>
 
Apply dropout with a dropout rate of 0.4 (i.e., 40% of neurons are randomly set to 0 during training). The remaining activations are scaled to maintain expected values. What are the output activations after applying dropout and scaling?
 
=== Solution ===
1.
 
(a). False. Initially, batch normalization was believed to mitigate internal covariance shift. However, later research (2019) found that adding noise to data performed just as well as using BatchNorm. Since noise increases the variance of each iteration, it actually amplifies internal covariance shift rather than reducing it. This suggests that batch normalization does not work by fixing covariance shift but instead improves training through other mechanisms, such as smoothing the optimization landscape.
 
(b). False. Beta-smoothness refers to a bound on how much the gradient of a function can change, meaning it limits how fast the slope of the function varies. The concept described in the statement actually corresponds to L-Lipschitz continuity, which bounds the maximum rate at which the function values can change with respect to input perturbations.
 
(c). True. A smaller L means the function has a lower maximum gradient, making it smoother. Smooth functions are easier to optimize because they reduce the risk of abrupt gradient changes (sharp cliffs) that can destabilize training. This leads to more stable updates and better convergence behavior.
 
(d). False. Large variations in the gradient indicate a highly non-smooth loss landscape. In such cases, a large learning rate can cause the optimizer to overshoot the minimum or oscillate chaotically, much like a ball bouncing between steep slopes. Instead, a more stable learning rate should be used in these situations to ensure smooth convergence.
 
(e). True. While batch normalization is widely used, it is not the only normalization technique. Weight normalization, which normalizes weight vectors instead of activations, can serve as an effective alternative, especially in cases where batch statistics are unreliable (e.g., small batch sizes or online learning).
 
2. 
With a dropout rate of 0.4, 40% of neurons (2 out of 5) are dropped (set to 0). 
Suppose the second (1.5) and fourth (0.5) neurons are dropped. The remaining activations are:
 
<math>a' = [2.0, 0, 3.0, 0, 2.5]</math>
 
During training, we scale the remaining neurons by <math>(\frac{1}{1 - 0.4} = \frac{1}{0.6} = 1.67)</math> to maintain the expected activation. 
Applying this scaling to the nonzero activations:
 
<math>a'' = [2.0 \times 1.67, 0, 3.0 \times 1.67, 0, 2.5 \times 1.67]</math>
 
After applying dropout and scaling, the output activations are:
 
<math>[3.33, 0, 5.00, 0, 4.17]</math>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 6.11 ==
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
=== Question ===
 
This Exercise has the goal of getting a better understanding of what is a Lipschitz function, an L-Smooth function and its implications.
 
We say that a function is Lipschitz if <math> \forall x \in \mathbb{R}, \exists \ L </math> such that:
 
<math> |f(x) - f(y)| \le L|x - y| </math>
 
We say that a function is L-Smooth if <math> \forall x \in \mathbb{R}, \exists \ L </math> such that:
 
<math> |\nabla f(x) - \nabla f(y)| \le L|x - y| </math>
 
Give an example of a function that is not Lipschitz and not L-Smooth. Explain the ramifications of these conditions.
 
=== Solution ===
 
Let us begin by finding a function that is not Lipschitz. Suppose we have <math> f(x) = \sqrt{x} </math>. By Lipschitz property:
 
<math>
\begin{align*}
    | f(x_1) - f(x_2) | & \le L |x_1 - x_2 | \
    \frac{| \sqrt{x_1} - \sqrt{x_2} |}{|x_1 - x_2 |} & \le L \
\end{align*}
</math>
 
Now, suppose that <math> |x_1 - x_2| \to 0^+ </math>. Now as the gap between both <math> x_1 </math> and <math> x_1 </math> narrows, while still remaining greater than 0, the function gets increasingly steeper. Take for instance <math> \sqrt{0.0001} - \sqrt{0.00001} \approx 0.0068 </math>. Now divide this by <math> 9*10^{-5} </math>, we see that this is roughly equal to 75.9746926.
 
As the gap narrows, this number increases until we are left with:
 
<math>
 
\infty \le L
 
 
</math>
 
which is absurd. Therefore, <math> f(x) = \sqrt{x} </math> is not Lipschitz.
 
When taking the gradient, we see that <math> \nabla f(x) = \frac{1}{2\sqrt{x}} </math>. Once again, as <math> x \to 0 </math>, the gradient approaches infinity.
Therefore, we can also conclude that the function is not L-Smooth.
 
When considering a loss function, and the necessity of a local minimum, having a function who's gradient increases dramatically and quickly can lead to poor convergence and inability to attain the local minimum, or in this case, the infimum. Therefore, this would not be an ideal loss function.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 6.12 ==
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
=== Question ===
Batch Normalization and Internal Covariate Shift
 
What is internal covariate shift, and why is it considered a problem in deep learning?
 
Given a mini-batch of input activations <math> x = {x_1, x_2, ..., x_m} </math>, batch normalization normalizes each activation using the batch mean and variance. Write the mathematical formulation of batch normalization for a single activation <math> x_i </math>.
 
How does batch normalization help in improving optimization and generalization in deep learning models?
 
=== Solution ===
 
Internal Covariate Shift:
Internal covariate shift refers to the change in the distribution of network activations during training as the parameters of previous layers update. This shift forces each layer to continuously adapt to new distributions, slowing down convergence and making optimization more difficult.
 
Mathematical Formulation:
Given a mini-batch <math> x = {x_1, x_2, ..., x_m} </math>, batch normalization is computed as follows:
 
Compute the batch mean:
<math> \mu = \frac{1}{m} \sum_{i=1}^{m} x_i </math>
Compute the batch variance:
<math> \sigma^2 = \frac{1}{m} \sum_{i=1}^{m} (x_i - \mu)^2 </math>
Normalize each activation:
<math> \hat{x}_i = \frac{x_i - \mu}{\sqrt{\sigma^2 + \epsilon}} </math>
Scale and shift using learnable parameters <math> \gamma </math> and <math> \beta </math>:
<math> y_i = \gamma \hat{x}_i + \beta </math>
Effect on Optimization and Generalization:
 
Optimization: Batch normalization smooths the loss landscape by normalizing activations, making gradients more predictable and allowing for larger learning rates. This speeds up convergence and stabilizes training.
Generalization: By reducing the sensitivity of the model to small variations in input distributions, batch normalization acts as a form of regularization, reducing the risk of overfitting.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 6.13 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
 
<ol>
    <li>
        <p>Which of the following is <strong>not</strong> a commonly used from of regularization in deep neural networks??</p>
        <ul>
            <li>A) Weight Decay</li>
            <li>B) Dropout</li>
            <li>C) Label smoothing</li>
            <li>D) Training the net until it hits 100% accuracy on the training data</li>
        </ul>
    </li>
 
    <li>
        <p>Label smoothing is mostly directted at preventing which of these??</p>
        <ul>
            <li>A) Large model bias</li>
            <li>B) Overconfidence in the predictions</li>
            <li>C) Too many data augmentations</li>
            <li>D) Slower training speed</li>
        </ul>
    </li>
</ol>
 
=== Solution ===
 
<ol>
    <li>
        <p><strong>Correct Answer:</strong> D</p>
        <p><strong>Short Reason:</strong> Weight Decay, Dropout, and Label Smoothing are all frequent used ways to reduce overfitting. Training a network until it absolutely nails 100% of the training data is usually <em>not</em> considered a good method and can cause severe overfitting.</p>
        <p><strong>Detailed Explanation:</strong> Weight decay, dropout, and label smoothing are regularization techniques that help deep neural networks generalize better and avoid overfitting. Weight decay prevents the model from relying too much on large weights by encouraging smaller but more evenly distributed values, making the network more stable. Dropout randomly disables a fraction of neurons during training, forcing the network to learn redundant and distributed representations, which improves robustness and reduces reliance on specific features. Label smoothing prevents the model from becoming overconfident in its predictions by slightly softening the target labels, which helps in handling noisy data and improves generalization, especially in classification tasks. These techniques are widely used because they enhance model performance on unseen data while reducing the risk of memorization. </p>
    </li>
 
    <li>
        <p><strong>Correct Answer:</strong> B</p>
        <p><strong>Short Reason:</strong> Label smoothing basically lowers the chance of being fully certain about any class. This helps reduce the model's overconfidence in it’s own predictions, so it generalizes better.</p>
    </li>
</ol>
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 6.14 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
 
<ol>
    <li>
        <p>What is the role of using Dropout when training neural networks?</p>
        <ul>
            <li>A) Speed up computation (reduce the number of neurons)</li>
            <li>B) Improve the generalization ability of the model (introduce noise to reduce the coadaptability of neurons)</li>
            <li>C) Reduce the number of parameters (force neurons to share weights)</li>
            <li>D) Increasing the complexity of the model (randomly adjusting the activation function of neurons)</li>
        </ul>
    </li>
 
    <li>
        <p>What mechanism does Batch Normalization use to accelerate the training of neural networks?</p>
        <ul>
            <li>A) Reduce the problem of gradient disappearance and gradient explosion</li>
            <li>B) Randomly discard neurons</li>
            <li>C) Add the number of network layers</li>
            <li>D) Reduce the number of weights</li>
        </ul>
    </li>
</ol>
 
=== Solution ===
 
<ol>
    <li>
        <p><strong>Correct Answer:</strong> B</p>
        <p><strong>Short Reason:</strong> Dropout reduces coadaptation by randomly dropping neurons, thereby enhancing the model's generalization ability and reducing overfitting.</p>
    </li>
 
    <li>
        <p><strong>Correct Answer:</strong> A</p>
        <p><strong>Short Reason:</strong> Batch Normalization alleviates the problem of gradient explosion by reducing internal covariate shifts to increase gradient stability and accelerate convergence.</p>
    </li>
</ol>
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 6.15 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
=== Question ===
 
1. What is the working principle of dropout?
 
2. How does dropout affect the training process of a neural network?
 
3. What is the role of dropout and why does the model performance decrease if not using dropout?
 
=== Solution ===
 
1. Dropout is a common regularization method which aims at preventing overfitting in deep learning. The principle is to randomly drop a portion of the neurons in the network during training, such as setting their outputs to zero. This "drop" operation is done proportionally, typically using a hyperparameter called the dropout rate. The dropout rate indicates the probability of a neuron being dropped in each iteration. For example, if the dropout rate is 0.5, each neuron has a 50% chance of being dropped during each forward pass.
 
2. Dropping neurons randomly can prevent the neural network model relying on the output of individual neurons during learning. This can enhances the model's ability to generalize. Dropout can also prevent overfitting, especially when the training data is small or the model is complex.
 
3. The reasons are:
 
- Dropout prevents overfitting by randomly dropping neurons during training. When Dropout is not used during model training, all neurons participate in the computation. This will lack the randomness and lead to biased unbalanced model weight compared to the training phase.
 
- If the output is not properly scaled, such as multiplying specific rate like 1-p, the model may become sensitive to the inputs, and result in inaccurate predictions.
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 6.16 ==
 
'''Level:''' * (Easy)
 
'''Exercise Type:''' Novel
 
=== Question ===
 
Dropout and Batch Normalization are two widely used techniques in deep learning for improving generalization and optimization.
 
1) Dropout: Explain how dropout prevents overfitting in deep neural networks. How does it relate to training multiple "thinned" networks?
 
2) Batch Normalization: What is the primary motivation behind Batch Normalization, and how does it address internal covariate shift?
 
Consider a scenario where you train a deep neural network with both Dropout and Batch Normalization.
 
• How do these techniques interact during training, and why can their combined use sometimes lead to suboptimal performance?
 
• What adjustments can be made to effectively combine these techniques?
 
=== Solution ===
 
1) Dropout and Overfitting Prevention:
 
• Dropout randomly deactivates neurons during training, preventing co-adaptation among neurons.
 
• It forces the network to learn redundant, independent features, acting as an ensemble of multiple "thinned" networks.
 
• At test time, dropout is turned off, and the weights are scaled accordingly to approximate the effect of averaging multiple models.
 
2) Batch Normalization and Internal Covariate Shift:
 
• Internal covariate shift refers to the change in distribution of activations across layers during training, slowing down convergence.
 
• Batch Normalization normalizes activations within each mini-batch, ensuring a stable distribution of inputs for each layer.
 
• It introduces learnable parameters (scale and shift) to preserve model expressiveness.
 
3) Interaction of Dropout and Batch Normalization:
 
• Issue: Dropout introduces noise by randomly deactivating neurons, while Batch Normalization relies on stable statistics of mini-batches.
 
• Conflict: The randomness of Dropout disrupts the mean and variance estimates of Batch Normalization, leading to unstable training.
 
Adjustments for Compatibility:
 
• Using Dropout after Batch Normalization (rather than before) to avoid interference in mean/variance computation.
 
• Reducing Dropout rate when using Batch Normalization, as BatchNorm itself provides regularization.
 
• Alternatively, using Spatial Dropout in convolutional networks, which drops entire feature maps rather than individual neurons.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 6.17 ==
 
  <p><strong>Level:</strong> ** (Moderate)</p>
  <p><strong>Exercise Types:</strong> Novel</p>
 
=== Question ===
 
This Exercise aims to explore the relationship between L-Smoothness and Lipschitz continuity of a function.
We say that a function is Lipschitz if <math> \forall x \in \mathbb{R}, \exists \ L </math> such that:
 
<math> |f(x) - f(y)| \le L|x - y| </math>
 
We say that a function is L-Smooth if <math> \forall x \in \mathbb{R}, \exists \ L </math> such that:
 
<math> |\nabla f(x) - \nabla f(y)| \le L|x - y| </math>
 
Consider the following question: 
**Can an L-Smooth function be non-Lipschitz?** Provide an example and explain the reasoning behind your answer. Discuss the implications of this scenario and the effects it could have when considering optimization or convergence in machine learning.
 
===Solution===
 
Yes, an L-Smooth function can be non-Lipschitz.
 
Consider the function <math> f(x) = x^{3/2} </math> for <math> x \geq 0 </math>.
 
First, let’s check if it is L-Smooth:
 
The gradient of <math> f(x) </math> is:
<math> \nabla f(x) = \frac{3}{2} x^{1/2} </math>.
 
For any <math> x_1, x_2 \geq 0 </math>, we compute the difference in the gradients:
<math> |\nabla f(x_1) - \nabla f(x_2)| = \left| \frac{3}{2} (x_1^{1/2} - x_2^{1/2}) \right| \leq \frac{3}{2} |x_1 - x_2|^{1/2} </math>.
 
Thus, the function is L-Smooth with a constant <math> L = \frac{3}{2} </math>.
 
Now, let’s check if it is Lipschitz:
 
For Lipschitz continuity, we want to show that there exists a constant <math> L </math> such that:
<math> |f(x_1) - f(x_2)| \leq L|x_1 - x_2| </math>.
 
However, we compute the difference between <math> f(x_1) </math> and <math> f(x_2) </math>:
<math> |f(x_1) - f(x_2)| = |x_1^{3/2} - x_2^{3/2}| \approx \frac{3}{2} |x_1 - x_2|^{1/2} \text{ for small } |x_1 - x_2| </math>.
 
As <math>( |x_1 - x_2| \to 0 </math>, we see that the ratio <math> \frac{|f(x_1) - f(x_2)|}{|x_1 - x_2|} \to \infty </math>. Therefore, the function is not Lipschitz.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 6.18 ==
 
'''Level:''' * (Easy) 
 
'''Exercise Types:''' Novel
 
=== Question ===
 
True or False: Dropout helps improve a model's ability to generalize by making it more likely to memorize the training data.
 
=== Solution ===
 
False. Dropout actually helps reduce memorization of the training data by preventing the model from becoming overly reliant on specific neurons. By randomly turning off neurons during training, it forces the model to learn more robust and generalized features instead of memorizing specific patterns in the data. This helps the model perform better on unseen data.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 7.1 == 
 
'''Level:''' ** (Moderate) 
 
'''Exercise Types:''' Novel
 
'''References:''' Hesaraki, S. (2023). Feature Map. ''Medium.'' www.medium.com/@saba99/feature-map-35ba7e6c689e
 
This article describes more details about convolutional layers and feature maps.
 
=== Question ===
 
In this problem, we are interested in how convolutional neural networks learn information during training. For this, we will be plotting the '''"feature maps"''' of a CNN, which show the output of a convolutional layer after the learned filters have been applied to a sample image.
 
For this example, you can use the '''MNIST''' (handwritten digits) or the '''FashionMNIST''' (clothes) dataset. Each dataset has 60 000 greyscale (1 channel) training images that are each 28x28 pixels in size. The following script can be used to download the MNIST dataset, and a very similar one can be used for FashionMNIST:
 
<pre>
transform = transforms.Compose([transforms.ToTensor(), transforms.Normalize((0.5,), (0.5,))])
train_dataset = torchvision.datasets.MNIST(root="./data", train=True, download=True, transform=transform)
train_loader = torch.utils.data.DataLoader(train_dataset, batch_size=64, shuffle=True)
</pre>
 
Write a CNN that consists of '''3 convolutional layers''' each with a kernel size of 3 and a padding of 1 pixel in thickness. Each one will learn '''6 filters'''. After each convolutional layer, apply a ReLU activation and a pooling layer with a kernel size of 2 and a stride of 2. After that, use a fully connected hidden layer followed by the output layer (the 2 datasets mentioned above each have 10 classes).
 
Train the neural network for ~3 epochs. Don't worry too much about the accuracy.
 
After training, select a random image from the training dataset and run it through the trained model. After each of the 3 convolutional layers, make a plot of the result for each of the 6 filters. Comment on your observations.
 
=== Solution ===
 
'''The convolutional neural network:'''
 
Note: to save space, the Python imports are not shown here.
 
<pre>
 
class SimpleCNN(nn.Module):
    def __init__(self):
        super(SimpleCNN, self).__init__()
        self.conv1 = nn.Conv2d(1, 6, kernel_size=3, padding=1)
        self.conv2 = nn.Conv2d(6, 6, kernel_size=3, padding=1)
        self.conv3 = nn.Conv2d(6, 6, kernel_size=3, padding=1)
        self.pool = nn.MaxPool2d(kernel_size=2, stride=2)
        self.fc1 = nn.Linear(6 * 3 * 3, 64)
        self.fc2 = nn.Linear(64, 10)
 
    def forward(self, x):
        x = self.pool(F.relu(self.conv1(x)))
        x = self.pool(F.relu(self.conv2(x)))
        x = self.pool(F.relu(self.conv3(x)))
        x = x.view(-1, 6 * 3 * 3)
        x = F.relu(self.fc1(x))
        x = self.fc2(x)
        return x
   
model = SimpleCNN()
optimizer = optim.Adam(model.parameters(), lr=0.005)
criterion = nn.CrossEntropyLoss()
 
for epoch in range(3): # 3 epochs
    model.train()
    for images, labels in train_loader:
        optimizer.zero_grad()
        outputs = model(images)
        loss = criterion(outputs, labels)
        loss.backward()
        optimizer.step()
 
</pre>
 
'''The feature maps:'''
 
<pre>
 
random_idx = np.random.randint(len(train_dataset))
image, label = train_dataset[random_idx] # getting a sample image
image = image.unsqueeze(0)
 
with torch.no_grad(): ### getting the feature maps
    conv1_output = F.relu(model.conv1(image)) ### feature map 1
    conv1_output_pooled = model.pool(conv1_output)
    conv2_output = F.relu(model.conv2(conv1_output_pooled)) ### feature map 2
    conv2_output_pooled = model.pool(conv2_output)
    conv3_output = F.relu(model.conv3(conv2_output_pooled)) ### feature map 3
    conv3_output_pooled = model.pool(conv3_output)
 
fig, axes = plt.subplots(4, 6, figsize=(6, 5))
 
axes[0, 0].imshow(image.reshape(28, 28), cmap="gray") # plotting the sample image
axes[0, 0].set_title("Sample Image", fontsize=10)
axes[0, 0].axis("off")
 
for j in range(1, 6):
    axes[0, j].axis("off")
 
outputs = [conv1_output, conv2_output, conv3_output]
layer_names = ["conv1", "conv2", "conv3"]
 
for row, (layer_output, name) in enumerate(zip(outputs, layer_names), start=1):
    for col in range(6):
        axes[row, col].imshow(layer_output[0, col].cpu().numpy(), cmap="viridis")
        axes[row, col].axis("off")
    axes[row, 0].set_title(name.title(), fontsize=10)
 
plt.tight_layout()
plt.show()
 
</pre>
 
According to these images, the first layer detects edges (i.e., after the first layer, the image looks like a high-pass filter was applied to it, outlining the edges), while the second layer detects the rough overall shape. After the third convolutional layer, the image is very abstracted.
 
[[Image:MNIST feature map.png|thumb|300px|left|The feature maps for a CNN trained on the MNIST dataset, for a sample image of the digit 8.]]
[[Image:FashionMNIST feature map.png|thumb|300px|left|The feature maps for a CNN trained on the FashionMNIST dataset, for a sample image of a shirt/sweater.]]
 
<br clear="all">
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 7.2 ==
 
'''Level:''' * (Easy)
 
'''Exercise Type:''' Novel
 
=== Question ===
 
Compare max pooling, average pooling, and global pooling on CIFAR-10 dataset.
 
=== Solution ===
 
<pre>
import tensorflow as tf
from tensorflow.keras.models import Sequential
from tensorflow.keras.layers import Conv2D, MaxPooling2D, AveragePooling2D, GlobalMaxPooling2D, GlobalAveragePooling2D, Flatten, Dense
from tensorflow.keras.datasets import cifar10
from tensorflow.keras.utils import to_categorical
import matplotlib.pyplot as plt
 
# Load CIFAR-10 dataset
(x_train, y_train), (x_test, y_test) = cifar10.load_data()
 
# Normalize the dataset
x_train = x_train.astype("float32") / 255.0
x_test = x_test.astype("float32") / 255.0
 
# One-hot encode the labels
y_train = to_categorical(y_train, 10)
y_test = to_categorical(y_test, 10)
 
# Function to create a model with different pooling strategies
def create_model(pooling_layer):
    model = Sequential([
        Conv2D(32, (3, 3), activation='relu', input_shape=(32, 32, 3)),
        pooling_layer,
        Flatten(),
        Dense(64, activation='relu'),
        Dense(10, activation='softmax')
    ])
    model.compile(optimizer='adam', loss='categorical_crossentropy', metrics=['accuracy'])
    return model
 
# Pooling layers to compare
pooling_strategies = {
    'MaxPooling': MaxPooling2D((2, 2)),
    'AveragePooling': AveragePooling2D((2, 2)),
    'GlobalMaxPooling': GlobalMaxPooling2D(),
    'GlobalAveragePooling': GlobalAveragePooling2D()
}
 
# Train and evaluate models
results = {}
for name, pooling_layer in pooling_strategies.items():
    print(f"Training with {name}")
    model = create_model(pooling_layer)
    history = model.fit(x_train, y_train, epochs=10, batch_size=64, validation_split=0.2, verbose=0)
    test_loss, test_acc = model.evaluate(x_test, y_test, verbose=0)
    results[name] = (history, test_loss, test_acc)
 
# Plot training and validation accuracy
plt.figure(figsize=(12, 8))
for name, (history, _, _) in results.items():
    plt.plot(history.history['val_accuracy'], label=f"{name} (val_acc)")
plt.title('Validation Accuracy for Different Pooling Strategies')
plt.xlabel('Epochs')
plt.ylabel('Accuracy')
plt.legend()
plt.grid(True)
plt.show()
 
# Print test accuracies
for name, (_, _, test_acc) in results.items():
    print(f"{name}: Test Accuracy = {test_acc:.4f}")
 
</pre>
 
[[File:different pooling strategies.png|thumb|500px|left|Validation accuracy for different pooling strategies on CIFAR-10 dataset.]]
<br clear="all">
We can conclude the following information from the plot:
 
1. MaxPooling achieves the highest validation accuracy overall. It implies that MaxPooling is the most effective pooling strategy for this dataset and architecture, likely because it preserves dominant features while reducing dimensionality.
 
2. AveragePooling performs slightly worse than MaxPooling but follows a similar trend. It provides a smoother feature extraction method but may lose some fine details.
 
3. GlobalMaxPooling and GlobalAveragePooling perform significantly worse, showing that they discard too much spatial information, leading to weaker model performance on CIFAR-10.
 
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 7.3 ==
 
Level: * (Easy)
 
Exercise Type: Novel
 
=== Question ===
Consider training a deep neural network where the gradients of the loss with respect to parameters sometimes explode to very large values. To mitigate this, gradient clipping is applied with a threshold <math>\tau = 5</math>.
 
Let <math>g = (g_1, g_2)</math> be a gradient vector with norm <math>| g | = \sqrt{g_1^2 + g_2^2}</math>. The clipped gradient is defined as:
 
<math> g_{\text{clipped}} = g \cdot \min \left(1, \frac{\tau}{\| g \|} \right). </math>
Suppose at an iteration, we have <math>g_1 = 6</math> and <math>g_2 = 8</math>.
 
(a) Compute the clipped gradient <math>g_{\text{clipped}}</math>.
 
(b) Explain why gradient clipping is necessary in deep networks and its effect on training dynamics.
 
(c) Assume we are training an LSTM with gradient clipping and a learning rate of 0.01. The norm of the unmodified gradient at time step t is <math>| g_t | = 20</math>, and the updated gradient after clipping is <math>| g_{\text{clipped},t} | = 5</math>.
 
Compute the weight update for a parameter w given that the gradient component in that direction is <math> g_t^w = 10</math>.
If gradient clipping was not applied, how would the update change, and what potential issue could occur?
 
(d) Consider the same scenario, but now the threshold for gradient clipping is increased from <math>\tau = 5</math> to <math>\tau = 10</math>.
 
Recompute the clipped gradient <math>g_{\text{clipped}}</math> using this new threshold and compare it to the previously computed result. How does increasing the threshold affect the gradient update?
 
=== Solution ===
 
(a) Computing the clipped gradient:
The gradient norm is:
 
<math> \| g \| = \sqrt{6^2 + 8^2} = 10. </math>
Since <math>| g | > \tau</math>, we apply clipping:
 
<math> g_{\text{clipped}} = g \cdot \frac{5}{10} = (6,8) \cdot 0.5 = (3,4). </math>
Thus, the clipped gradient is (3,4).
 
(b) Effect of Gradient Clipping:
Gradient clipping prevents exploding gradients by rescaling large updates, stabilizing training in deep networks and recurrent models (e.g., LSTMs). It helps avoid divergence and allows for larger learning rates while preventing numerical instability.
 
(c) Computing the Weight Update in an LSTM with Clipping:
 
The clipped gradient norm is 5, meaning that the updated gradient is scaled by (5 / 20) = 0.25 of its original value.
The clipped gradient for the weight w is:
<math> g_{\text{clipped},t}^w = g_t^w \cdot 0.25 = 10 \times 0.25 = 2.5. </math>
The weight update using learning rate <math> \eta = 0.01 </math>:
<math> \Delta w = -\eta g_{\text{clipped},t}^w = -0.01 \times 2.5 = -0.025. </math>
If gradient clipping was not applied:
 
The original update would be:
<math> \Delta w = -0.01 \times 10 = -0.1. </math>
This significantly larger update could lead to instability or divergence in training, especially in deep networks like LSTMs, where gradient magnitudes can vary significantly over time.
 
(d) Computing the clipped gradient with <math>\tau = 10</math>:
 
The gradient norm remains:
<math>\| g \| = \sqrt{6^2 + 8^2} = 10.</math>
 
Since <math>| g | = \tau</math>, the clipping factor is:
<math>\min \left(1, \frac{10}{10} \right) = 1.</math>
 
Thus, the clipped gradient remains the same:
<math>g_{\text{clipped}} = g \cdot 1 = (6,8).</math>
 
Since the threshold now matches the gradient norm, no clipping is applied. The update is larger compared to the previous case (<math>\tau = 5</math>), where the gradient was scaled down. A higher threshold allows for larger updates, which can speed up convergence but also increases the risk of instability if gradients are too large. A lower threshold enforces stronger clipping, stabilizing training but possibly slowing down learning.
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 7.4 ==
 
Level: * (Easy)
 
Exercise Type: Novel
 
=== Question ===
In convolutional neural networks (CNNs), parameter sharing is a key property that is different from fully-connected neural networks (FCNNs).
 
1. Explain the concept of parameter sharing in CNNs. How does it differ from fully connected layers?
 
2. Consider a convolutional layer with an input of size <math> 32 \times 32 \times 3 </math> (height, width, channels) and a filter of size <math> 5 \times 5 \times 3 </math>. How many parameters does this filter have, including bias(es)?
 
3. Discuss one advantage and one limitation of parameter sharing in CNNs.
 
=== Solution ===
 
1. '''Concept of Parameter Sharing:'''
 
In a fully connected layer, each neuron has its own set of unique weights for every input feature, leading to a large number of parameters. In CNNs, the same set of filter weights is applied across different spatial locations, meaning the parameters are shared across the input. This greatly reduces the total number of parameters and improves generalization.
 
Furthermore, the concept of parameter sharing (or lack thereof) makes CNNs and FCNNs suited for different tasks. Because the same filter in a CNN is applied everywhere, a feature (like an edge or corner) will be detected regardless of where it appears in the image. For example, if a filter learns to detect cats in the top-left corner, it will also detect cats in the bottom-right. This makes CNNs well-suited for spatially structured data, such as images and videos, and work well in tasks such as object detection, segmentation, motion analysis, etc. In contrast, FCNNs are better suited for tasks where each feature is independent of its position relative to other features, such as tabular datasets. Examples of this include customer data in a marketing problem (e.g., demographics, spending habits, etc.), healthcare records, business analytics, etc.
 
2. '''Computing Parameters:'''
 
''Weight parameter(s):'' <math> 5 \times 5 \times 3 = 75 </math>. The size of a filter includes all 3 of its dimensions.
 
''Bias parameter(s):'' 1. Each filter has one bias, regardless of dimensions.
 
Total parameters per filter: <math> 75 + 1 = 76 </math>
 
Therefore, a single convolutional filter of size <math> 5 \times 5 \times 3 </math> has 76 parameters in total.
 
3. '''Advantages and limitations:'''
 
''Advantage:'' Parameter sharing reduces the number of parameters; this is more computationally efficient than having many parameters and also makes CNNs less prone to overfitting.
 
Additional note: Parameter sharing is particularly useful for lower-layer filters, like edge detectors, which are applied across the entire image.Since CNNs are naturally equivalent to translation, meaning that when the image shifts, the feature map shifts similarly, this allows CNNs to detect features like edges and corners anywhere in the image, which improves generalization and helps to capture spatial hierarchies. By sharing filters/parameters, CNNs use fewer parameters, making them more efficient and less likely to overfit.
 
 
''Limitation:'' Parameter sharing assumes that the learned features are equally useful across the entire input, which may not be ideal for tasks where spatial location is important (e.g., detecting objects in fixed positions).
 
Additional note: Since parameter sharing assumes that the same features (like edges, textures, etc.) are equally important throughout the entire image, this works well for detecting general patterns that can appear anywhere. However, for tasks where the specific location of features matters, a feature might be crucial in one part of the image (like the top-left corner) but irrelevant in another part (like the bottom-right corner), applying the same filter everywhere cannot capture location-specific features effectively.  Solutions include including deformable convolutions to allow adaptive receptive fields and self-attention mechanisms to capture long-range dependencies.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 7.5 ==
 
Level: * (Easy) 
 
Exercise Type: Novel 
 
=== Question === 
 
Given an image matrix and a filter matrix, compute both the cross-correlation and convolution outputs without padding and using a stride of 1.
 
Image Matrix:
<math>
I =
\begin{bmatrix} 
1 & 2 & 3 \ 
4 & 5 & 6 \ 
7 & 8 & 9 
\end{bmatrix}
</math>
 
Filter Matrix:
<math>
K =
\begin{bmatrix} 
0 & 1 \ 
-1 & 0 
\end{bmatrix}
</math>
 
1. Compute the cross-correlation output.
 
2. Compute the convolution output.
 
3. Explain why cross-correlation is used in deep learning instead of convolution.
 
4. Give intuitive examples of cross-correlation and convolution.
 
=== Solution === 
 
1. Cross-correlation: 
 
Cross-correlation applies the filter as is, without flipping it.
 
<math>
O(i, j) = \sum_{m} \sum_{n} I(i+m, j+n) K(m, n)
</math>
 
For each position:
 
(1,1): 
<math>(1 \times 0) + (2 \times 1) + (4 \times -1) + (5 \times 0) = -2</math>
 
(1,2): 
<math>(2 \times 0) + (3 \times 1) + (5 \times -1) + (6 \times 0) = -2</math>
 
(2,1): 
<math>(4 \times 0) + (5 \times 1) + (7 \times -1) + (8 \times 0) = -2</math>
 
(2,2): 
<math>(5 \times 0) + (6 \times 1) + (8 \times -1) + (9 \times 0) = -2</math>
 
<math>
O =
\begin{bmatrix} 
-2 & -2 \ 
-2 & -2 
\end{bmatrix}
</math>
 
Sample python code to solve this is shown below
 
<pre>
import numpy as np
 
I = np.array([[1,2,3],[4,5,6],[7,8,9]])
K = np.array([[0,1],[-1,0]])
 
output = np.empty((2,2))
 
for i in range(2):
    for j in range(2):
        output[i,j] = np.sum(I[i:i+2,j:j+2]*K)
</pre>
 
 
2. Convolution:
 
Convolution first flips the filter horizontally and vertically before applying it.
 
<math>
O(i, j) = \sum_{m} \sum_{n} I(i-m, j-n) K(m, n)
= \sum_{m} \sum_{n} I(i+m, j+n) K(-m, -n)
</math>
 
 
Flipped Filter:
<math>
K_{flipped} =
\begin{bmatrix} 
0 & -1 \ 
1 & 0 
\end{bmatrix}
</math>
 
Applying the flipped filter:
 
(1,1): 
<math>(1 \times 0) + (2 \times -1) + (4 \times 1) + (5 \times 0) = 2</math>
 
(1,2): 
<math>(2 \times 0) + (3 \times -1) + (5 \times 1) + (6 \times 0) = 2</math>
 
(2,1): 
<math>(4 \times 0) + (5 \times -1) + (7 \times 1) + (8 \times 0) = 2</math>
 
(2,2): 
<math>(5 \times 0) + (6 \times -1) + (8 \times 1) + (9 \times 0) = 2</math>
 
 
<math>
O =
\begin{bmatrix} 
2 & 2 \ 
2 & 2 
\end{bmatrix}
</math>
 
 
3. In deep learning, we use cross-correlation instead of convolution because flipping the filter (as done in convolution) is not needed. In CNNs, filters are learned automatically, so the model adjusts their weights without requiring a flip. Skipping this step makes computations simpler and faster while still detecting the same features. Since CNNs learn patterns during training, using cross-correlation instead of convolution does not change the results, making it the preferred choice in deep learning.
 
 
4. Imagine you are using a blur filter (like an averaging filter) on an image. You take a small patch of the image and overlay the filter as it is, computing the weighted sum at each step. This process is effectively cross-correlation because we apply the filter without flipping. Now, instead of directly applying the filter, imagine you flip it both horizontally and vertically before using it. In practical applications, this doesn’t change much for symmetric filters (like a Gaussian blur), but for asymmetric filters, flipping alters the output.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 7.6 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
 
1. What architecture makes Convolutional Neural Networks (CNNs) different than a standard feedforward neural networks?
 
2. What type of domain benefits most due to these differences?
 
=== Solution ===
1)
    <ul>
        <li> Local Connectivity: In CNNs, each neuron is only connected to a localized region of the input rather than to all input units as in fully connected layers. This local connectivity make sure the model can be sparse if necessary,making it more efficient and reducing overfitting.
        </li>
        <li> Weight Sharing: A filter with fixed weights is applied across different locations of the input. This reduces the total number of parameters compared to fully connected networks, significantly lowering computational complexity and enhancing generalization.
        </li>
        <li> Translation Equivariance: Because the same filter slides over the input, the model can easily recognize features with different locations.
        </li>
        <li> Pooling Operations: Pooling reduces the dimensions of layers, making the model more robust to small changes. This also helps reduce dimensionality and computation.
        </li>
        <li>Hierarchical Feature Learning: CNNs learn a hierarchy of features, from low-level in the earlier layers to high-level features in the deeper layers. This hierarchical structure makes CNNs highly effective for complex tasks like image recognition and object detection.
        </li>
        </li>
    </ul>
 
2) Due to the above unique properties, CNNs are best suited for data that store information or meaning in a spatial format. The classical example is images, which encode meaning due to the specific spatial arraingments of the pixels. In other words, reordering the pixel data in an image would destroy its information, and hence CNNs perform the best for these types of data.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 7.7 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
==== Question ====
Sobel filter is a popular edge-detection filter. Sobel filter can be seen as combining:
 
A 1D derivative filter, <math>[1 0 1]</math>, in one direction and
a 1D “blur” filter, <math> [121] </math>, in the other direction
 
 
1. Horizontal Sobel Filter
: It is often written as <math> [101202101]. </math>
See how this comes from multiplying <math>[121]</math> by <math>[1 0 1]</math>
 
2. Vertical Sobel Filter
: Construct the <math>3\times 3</math> matrix for the vertical Sobel filter by swapping the roles of “blur” and “derivative,” and write it out explicitly.
 
3. Application
: Given the <math>3\times 3</math> image patch <math> [222257169], </math> apply your vertical Sobel filter to the center pixel (i.e., do a 3×3 convolution) and calculate the filter’s response.
 
''Hint: For the vertical Sobel, think of smoothing left-to-right, then taking the derivative top-to-bottom.''
 
==== Solution ====
 
'''Step 1. Horizontal Sobel Filter (Review)'''
 
We can write a vertical blur filter as <math>B_v = [121]</math> and a horizontal derivative filter as <math>D_h = [101]</math>.
Their outer product gives <math>
S_{\text{horizontal}} = B_v \times D_h = [101202101]</math>.
 
'''Step 2. Vertical Sobel Filter'''
 
For vertical edge detection, we blur horizontally and differentiate vertically.
Thus, let <math>B_h = [1 2 1]</math> (horizontal blur) and <math>D_v = [101]</math> (vertical derivative).
The vertical Sobel kernel is their outer product: <math>
S_{\text{vertical}} = D_v \times B_h = [121000121]. </math>
 
'''Step 3. Applying the Vertical Sobel Filter'''
 
Consider the image patch <math>
I =  [222257169], </math>
 
The filter response at the center pixel is given by the sum of element‐wise products: <math>
\text{Response} = \sum_{i=1}^3\sum_{j=1}^3 \bigl(S_{\text{vertical}}(i,j)\cdot I(i,j)\bigr). </math>
 
Computing row by row:
** Top row: <math>(1\times 2) + (2\times 2) + (1\times 2) = 2 + 4 + 2 = 8</math>
** Middle row: <math>(0\times 2) + (0\times 5) + (0\times 7) = 0</math>
** Bottom row: <math>((-1)\times 1) + ((-2)\times 6) + ((-1)\times 9) = -1 -12 -9 = -22</math>
 
Summing these:
 
<math>
8 + 0 - 22 = -14. </math>
 
Hence, the vertical Sobel filter response at the center pixel is <math>-14</math>, indicating a strong downward-to-upward intensity change in that region.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
== Exercise 7.8 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
==== Question ====
 
Answer whether the following statements about Convolutional Neural Networks (CNNs) are <b>True</b> or <b>False</b>. <br>
 
1.CNNs are designed to work only with grayscale images.<br>
 
2.Pooling layers in CNNs help reduce the spatial dimensions of the input while preserving important features.<br>
 
3.Fully connected layers in a CNN help maintain spatial relationships between pixels.
 
==== Solution ====
 
1.False – CNNs can process images with multiple channels, such as RGB images (three channels) or even hyperspectral images with many channels.
 
2.True – Pooling operations, such as max pooling, downsample the feature maps, reducing computational complexity and helping prevent overfitting while retaining essential features.
 
3.False – Fully connected layers discard spatial relationships since they treat the input as a single vector, unlike convolutional layers that preserve spatial structure. Fully connected layers flatten the feature maps into a one-dimensional vector, discarding spatial relationships. Unlike convolutional layers, which preserve spatial structure, fully connected layers focus on high-level feature abstraction.
 
 
 
</div>
 
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 7.9 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
==== Question ====
In the context of Convolutional Neural Networks (CNNs), explain the following concepts and their significance in image-based deep learning tasks:
 
(a) How do convolutional layers reduce the number of parameters compared to fully connected layers, and why is this advantageous?
 
(b) What role do pooling layers (e.g., max-pooling) play in achieving translation invariance?
 
(c) How does the hierarchical structure of CNNs (e.g., stacking convolutional and pooling layers) enable the learning of complex features from raw pixel data?
 
==== Solution ====
 
(a) Convolutional layers apply small filters (kernels) that slide across the input image, computing dot products locally. These filters are shared across all spatial positions (e.g., a 3×3 kernel uses the same weights for every patch of the image). It can reduce memory requirements, train models faster, and reduce overfitting.
 
(b)Pooling downsamples feature maps by aggregating local regions (e.g., 2×2 windows). Max-pooling selects the maximum activation in each window. It reduces overfitting by compressing spatial dimensions and prioritizes the presence of features over their exact location.
 
(c) Early Layers: Detect low-level features (edges, corners, colors).
 
Example: A 3×3 filter might activate for horizontal edges.
 
Middle Layers: Combine edges into textures or shapes (e.g., circles, stripes).
 
Example: A filter might respond to "eye-like" patterns.
 
Deep Layers: Assemble shapes into high-level semantic features (e.g., faces, objects).
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 7.10 ==
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
<b>References:</b> A. Ghodsi, STAT 940 Deep Learning: Lecture 7, University of Waterloo, Winter 2025.
 
=== Question ===
In Lecture 07a Convolutional Networks, images of the output of a convolution with a 3x3 kernel with the first column being -1, the middle column being 0, and the right column being 1
 
<math>K = [101101101]</math>
 
was shown as a demonstration of how convolutions when applied on images can be used to find vertical edges. (The images of elephants from the MATLAB script shown in the lecture video)
 
Manually implement a script which does this in Python.  Import a random sample image from anywhere, take the mean of the RGB channels (just apply the convolution on a single channel for demonstration purposes), define the 3x3 convolution kernel, then use for loops to traverse the image and apply how the convolution works when implemented on an image
 
=== Solution ===
<pre>
from skimage import data
import numpy as np
import matplotlib.pyplot as plt
 
#Sample image from skimage library
image = data.astronaut()
 
#Convert to greyscale
image_greyscale = np.mean(image, axis=2)
 
#3x3 kernel, the same as was implimented in the lecture
kernel = np.array([[-1, 0, 1], [-1, 0, 1], [-1, 0, 1]])
 
#Normalize the image
image_greyscale = image_greyscale / 255.0
 
#Define an empty np array to store the image, note it will be 2 less pixels as we are not doing any padding
convolution_output = np.empty([image_greyscale.shape[0]-2, image_greyscale.shape[1]-2])
 
#Loop across the x y pixels of the image
for i in range(image_greyscale.shape[0]-2):
    for j in range(image_greyscale.shape[1]-2):
        #Loop across the x y pixels of the kernel
        for k in range(3):
            for l in range(3):
                #Take the sum of the kernel times the pixels at the given window in the image
                convolution_output[i, j] += image_greyscale[i+k, j+l] * kernel[k, l] 
 
#Plot figures               
fig, axs = plt.subplots(1, 3, figsize=(10, 5))
axs[0].imshow(image_greyscale, cmap='gray')
axs[0].set_title('OriginalImage')
axs[0].axis('off')
axs[1].imshow(kernel, cmap='gray')
axs[1].set_title('Kernel')
axs[1].set_ylim(-0.5,2.5)
axs[2].imshow(convolution_output, cmap='gray')
axs[2].set_title('Convolution Output')
axs[2].axis('off')
plt.show()
</pre>
 
 
[[Image:7.10a.png|thumb|300px|center|Output of the script above]]
 
</div>
 
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 7.11 ==
 
<b>Level:</b> * (Easy) 
 
<b>Exercise Types:</b> Novel 
 
=== Question === 
Padding and stride affect the behavior of a convolutional layer.
 
1. Suppose a CNN applies a <math>3 × 3</math> filter to an input of size <math>32 × 32</math> with zero-padding <math>P</math> and stride <math>S</math>. Compute the minimum and maximum values of <math>P</math> and <math>S</math> such that the output feature map remains at least <math>16 × 16</math>.
 
2. Show how "same" padding and "valid" padding affect the output size differently.
 
3. Given the following scenarios, compute the output size:
 
· <math>3 × 3</math> filter, <math>P = 1, S = 1</math> on <math>64 × 64</math> input.
 
· <math>5 × 5</math> filter, <math>P = 2, S = 2</math> on <math>64 × 64</math> input.
 
=== Solution ===
 
Convolution Formula:
<math>O = (W - K + 2P) / S + 1</math>,
where <math>W</math> is the input size, <math>K</math> is the filter size, <math>P</math> is the padding, and <math>S</math> is the stride.
 
1. Condition for a <math>32×32</math> input, <math>3×3</math> filter, and output at least <math>16×16</math>
 
For <math>W = 32</math> and <math>K = 3</math>,
<math>O = (32 - 3 + 2P) / S + 1 = (29 + 2P) / S + 1</math>.
 
Requiring <math>O ≥ 16</math> gives:
<math>(29 + 2P) / S ≥ 15 ⟶ 29 + 2P ≥ 15S</math>.
 
Thus, for a given <math>S</math>, we must have:
<math>P ≥ ⌈(15S - 29) / 2⌉</math>,
and for a given <math>P</math>, the stride must satisfy:
<math>S ≤ (29 + 2P) / 15</math>.
 
2. Same Padding and Valid Padding
 
· Same Padding: Choose
<math>P = (K - 1) / 2</math>.
For a <math>3×3</math> filter, <math>P = 1</math>, so when <math>S = 1</math>,
<math>O = (32 - 3 + 2×1) / 1 + 1 = 32</math>.
 
· Valid Padding: No padding, i.e., <math>P = 0</math>. In this case,
<math>O = (32 - 3 + 0) / 1 + 1 = 30</math>.
 
3. Output size for specific cases
 
· <math>3×3</math> filter, <math>P = 1, S = 1</math>, input <math>64×64</math>:
<math>O = (64 - 3 + 2×1) / 1 + 1 = 64</math>.
 
· <math>5×5</math> filter, <math>P = 2, S = 2</math>, input <math>64×64</math>:
<math>O = ⌊(64 - 5 + 2×2) / 2⌋ + 1
= ⌊(64 - 5 + 4) / 2⌋ + 1
= ⌊(63 / 2)⌋ + 1 = 31 + 1 = 32</math>
 
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 7.12 ==
 
<b>Level:</b> * (Easy) 
 
<b>Exercise Types:</b> Novel 
 
=== Question === 
 
1. Given an input of size 32×32, a 2×2 max-pooling layer with stride 2 is applied. Compute the output size.
 
2. Compare the effects of max pooling, average pooling, and global average pooling in terms of information retention.
 
3. If a CNN has 4 pooling layers (each using 2×2 pooling with stride 2), how does this affect the final feature map size when the original input is 256×256?
 
=== Solution ===
1.
 
Given an input of size 32×32, applying a 2×2 max-pooling layer with stride 2 reduces each spatial dimension by a factor of 2. This is because the pooling window "slides" 2 pixels at a time and computes the maximum value within each non-overlapping 2×2 region.
 
Thus, the output dimensions will be:
 
32/2×32/2=16×16
 
2.
 
·Max Pooling:
 
Operation: For each pooling region, the maximum value is selected.
 
Information Retention:
 
Advantages:
 
Retains the most dominant (i.e., strongest) feature within each region.
Helps the network become invariant to small translations.
 
Disadvantages:
 
Discards other information in the region.
May lose details that could be useful for fine-grained distinctions.
 
·Average Pooling:
 
Operation: For each pooling region, the average (mean) of the values is computed.
 
Information Retention:
 
Advantages:
 
Retains a summary of the entire region by capturing the overall average activation.
Can provide a smoother representation of the features.
 
Disadvantages:
 
Can dilute strong signals since it blends them with lower values.
May not emphasize the presence of a distinctive feature as strongly as max pooling.
 
·Global Average Pooling (GAP):
 
Operation: The average is computed over the entire spatial dimensions of each feature map, reducing each feature map to a single scalar value.
 
Information Retention:
 
Advantages:
 
Reduces the feature map to a vector (one value per channel), which can drastically reduce the number of parameters.
Forces the network to identify the overall presence of a feature rather than its precise location, often acting as a strong regularizer.
Commonly used in the final layer for classification tasks.
 
Disadvantages:
 
Completely removes spatial information, which might be necessary for tasks requiring localization.
Provides a very coarse summary of the feature map.
 
3.
 
After 1st Pooling:
256÷2=128⇒128×128
 
After 2nd Pooling:
128÷2=64⇒64×64
 
After 3rd Pooling:
64÷2=32⇒32×32
 
After 4th Pooling:
32÷2=16⇒16×16
 
Thus, the final feature map size will be 16×16.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 7.13 ==
 
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
 
=== Question ===
 
Given the input image
 
<math>I = [1230145612789231325424135]</math>
 
and single filter
<math>
K=
\begin{bmatrix}
1 & 0 & -1 \
1 & 0 & -1 \
1 & 0 & -1
\end{bmatrix}
</math>
 
The Convolutional layer employs a single filter K of size 3*3, and the filter weights are defined by the matrix K, with no padding, no bias, no activation, and stride=1.
 
 
1. Calculate the output feature map size.
 
2. Compute the output feature map.
 
=== Solution ===
 
1.
 
Since the input size is <math>(5 \times 5)</math> and the filter is <math>(3 \times 3)</math>, the output feature map size is given by the formula:
 
<math>
O = \frac{(I - K + 2P)}{S} + 1
</math>
 
where:
<math>O = Output size</math>
 
<math>I = 5(Input size)</math>
 
<math>K = 3 (Kernel size)</math>
 
<math>P = 0 (Padding)</math>
 
<math>S = 1 (Stride)</math>
 
 
Substituting the values:
<math>O = \frac{(5 - 3 + 2(0))}{1} + 1</math>
 
<math>O = \frac{(5 - 3)}{1} + 1 = \frac{2}{1} + 1 = 3</math>
 
Thus, the output feature map will be <math>3 \times 3</math>.
 
2.
 
Since the input size is <math>(5 \times 5)</math> and the filter is <math>(3 \times 3)</math>, we perform convolution with a stride of 1 and no padding.
 
<math>{Input Image (5×5)}
\begin{bmatrix}
1 & 2 & 3 & 0 & 1 \
4 & 5 & 6 & 1 & 2 \
7 & 8 & 9 & 2 & 3 \
1 & 3 & 2 & 5 & 4 \
2 & 4 & 1 & 3 & 5
\end{bmatrix}</math>
 
<math>{Filter (3×3)}
\begin{bmatrix}
1 & 0 & -1 \
1 & 0 & -1 \
1 & 0 & -1
\end{bmatrix}</math>
 
 
The convolution is performed by sliding the filter over the input and computing the dot product.
 
<math>{First Position (Top-left corner)}
\begin{bmatrix}
1 & 2 & 3 \
4 & 5 & 6 \
7 & 8 & 9
\end{bmatrix}
</math>
 
Applying element-wise multiplication with the filter:
<math>
(1 \times 1) + (2 \times 0) + (3 \times -1) +
(4 \times 1) + (5 \times 0) + (6 \times -1) +
(7 \times 1) + (8 \times 0) + (9 \times -1)
</math>
 
<math>
= 1 + 0 - 3 + 4 + 0 - 6 + 7 + 0 - 9 = -6
</math>
 
<math>{Next Position (Move Right)}
\begin{bmatrix}
2 & 3 & 0 \
5 & 6 & 1 \
8 & 9 & 2
\end{bmatrix}
</math>
 
Applying element-wise multiplication:
<math>
(2 \times 1) + (3 \times 0) + (0 \times -1) +
(5 \times 1) + (6 \times 0) + (1 \times -1) +
(8 \times 1) + (9 \times 0) + (2 \times -1)
</math>
 
<math>
= 2 + 0 + 0 + 5 + 0 - 1 + 8 + 0 - 2 = 12
</math>
 
<math>{Next Position (Move Right)}
\begin{bmatrix}
3 & 0 & 1 \
6 & 1 & 2 \
9 & 2 & 3
\end{bmatrix}
</math>
 
Applying element-wise multiplication:
<math>
(3 \times 1) + (0 \times 0) + (1 \times -1) +
(6 \times 1) + (1 \times 0) + (2 \times -1) +
(9 \times 1) + (2 \times 0) + (3 \times -1)
</math>
 
<math>
= 3 + 0 - 1 + 6 + 0 - 2 + 9 + 0 - 3 = 12
</math>
 
Similarly for the 2nd and 3rd rows......
 
<math>{Final Output Feature Map (3×3)}
\begin{bmatrix}
-6 & 12 & 12 \
-5 & 8 & 8 \
-2 & 5 & 0
\end{bmatrix}
</math>
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 7.14 ==
 
<b>Level:</b> * (Moderate) 
 
<b>Exercise Types:</b> Copied 
 
<b>Reference:</b> Calin, Ovidiu. Deep learning architectures: A mathematical approach. Springer, 2020, page 541 
 
=== Question === 
Explain why between two networks with the same input
and the same depth and width, a CNN is less prone to overfitting than a
fully-connected neural network.
 
=== Solution === 
1. CNN's use less weights due to weight sharing, weights are shared across the inputs resulting in less parameters. CNN's can be viewed as a fully connected layer with a sparse weight matrix. For example, a 2x1 1d convolutional kernel <math>[w_1, w_2]</math> performed on a input vector <math>x=[x_1,...,x_6]^T</math> resulting in an output vector <math>y=[y_1,...,y_5]^T</math>, can be written as a fully connected layer <math>y=\sigma(Wx)</math>, where
 
<math>W =
\begin{pmatrix}
w_1 & w_2 & 0  & 0  & 0  & 0  \
0  & w_1 & w_2 & 0  & 0  & 0  \
0  & 0  & w_1 & w_2 & 0  & 0  \
0  & 0  & 0  & w_1 & w_2 & 0  \
0  & 0  & 0  & 0  & w_1 & w_2
\end{pmatrix}</math>
 
2. CNN's use local connections, meaning each neuron only connects to a small patch of the input. This enforces a prior that nearby pixels in images contain more relevant features, reducing the model's flexibility and making it less likely to memorize random noise. In contrast, fully connected layers assume all input features are equally important by connecting all neurons, leading to more variance in learned patterns and a higher risk of overfitting.
 
3. Convolutional layers are translation-invariant, meaning data augmentation techniques such as rotating, flipping, and cropping images will help CNN's generalize more. In contrast, fully connected layers rely on exact pixel locations.
 
4. CNNs detect edges and other features through convolutions and pooling layers and is spatial invariant, meaning that they can be detected no matter where they appear in the image. In contrast, fully connected layers struggle to detect such features
 
Others are encouraged to add on/modify reasoning to why CNN's are less prone to overfitting.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 7.15 == 
 
'''Level:''' ** (Moderate) 
 
'''Exercise Types:''' Modified
 
'''Reference:''' Mooney, P. T. (2018). Chest X-Ray Images (Pneumonia) [Dataset]. Kaggle. Retrieved from Kaggle. For finding the dataset search the keywords in Google.
 
=== Question ===
 
Train a Convolutional Neural Network (CNN) to classify chest X-ray images as either normal or showing pneumonia. Use data augmentation to improve generalization. Visualize CNN feature maps to understand what the model learns.
Find the dataset in the reference.
 
=== Solution ===
 
First step is the Data Preprocessing:
 
<pre>
 
import tensorflow as tf
from tensorflow.keras.preprocessing.image import ImageDataGenerator
import matplotlib.pyplot as plt
 
# Define dataset paths
dataset_path = "chest_xray/"
 
# Data preprocessing
datagen = ImageDataGenerator(rescale=1./255)
 
train_data = datagen.flow_from_directory(
    dataset_path + "train",
    target_size=(150, 150),
    batch_size=32,
    class_mode='binary'
)
 
val_data = datagen.flow_from_directory(
    dataset_path + "val",
    target_size=(150, 150),
    batch_size=32,
    class_mode='binary'
)
 
test_data = datagen.flow_from_directory(
    dataset_path + "test",
    target_size=(150, 150),
    batch_size=32,
    class_mode='binary',
    shuffle=False
)
</pre>
 
Next, build the model by utilizing multiple convolutional layers to detect pattern in chest X-rays:
 
<pre>
from tensorflow.keras import layers, models
 
# Build CNN model
model = models.Sequential([
    layers.Conv2D(32, (3, 3), activation='relu', input_shape=(150, 150, 3)),
    layers.MaxPooling2D(2, 2),
    layers.Conv2D(64, (3, 3), activation='relu'),
    layers.MaxPooling2D(2, 2),
    layers.Conv2D(128, (3, 3), activation='relu'),
    layers.MaxPooling2D(2, 2),
    layers.Flatten(),
    layers.Dense(128, activation='relu'),
    layers.Dropout(0.5),
    layers.Dense(1, activation='sigmoid')
])
 
# Compile the model
model.compile(optimizer='adam', loss='binary_crossentropy', metrics=['accuracy'])
 
# Train the model
history = model.fit(train_data, validation_data=val_data, epochs=10)
 
# Evaluate the model
test_loss, test_acc = model.evaluate(test_data)
print(f"Test Accuracy: {test_acc:.2f}")
</pre>
 
Now, by visualizing the feature maps of different layers, we are able to understand how the CNN makes decisions:
 
<pre>
import numpy as np
import matplotlib.pyplot as plt
 
# Select a test image
img_path = test_data.filepaths[0]
img = tf.keras.preprocessing.image.load_img(img_path, target_size=(150, 150))
img_array = tf.keras.preprocessing.image.img_to_array(img) / 255.0
img_array = np.expand_dims(img_array, axis=0)
 
# Extract feature maps
layer_outputs = [layer.output for layer in model.layers if 'conv' in layer.name]
activation_model = tf.keras.models.Model(inputs=model.input, outputs=layer_outputs)
activations = activation_model.predict(img_array)
 
# Plot feature maps
fig, axes = plt.subplots(nrows=1, ncols=len(activations), figsize=(20, 5))
for i, activation in enumerate(activations):
    axes[i].imshow(activation[0, :, :, 0], cmap='viridis')
    axes[i].axis('off')
plt.show()
</pre>
 
[[Image:Screenshot 2025-02-07 081441.png|thumb|600px|left|]]
 
<br clear="all">
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 7.16 ==
 
<b>Level:</b> ** (easy) 
 
<b>Exercise Types:</b> Novel 
 
<b>References:</b> Ghodsi, A. (2025). Convolutional Neural Networks. ''Deep Learning.''
 
=== Question === 
Design a simple CNN architecture to understand the structure and parameter efficiency of convolutional layers. Assume you are processing a grayscale image of size 28x28 pixels:
 
1. Create a CNN with:
  - One convolutional layer with 8 filters of size 3x3, stride 1, padding 'valid'.
  - ReLU activation function for the convolutional layer.
  - A max pooling layer after the convolutional layer with pool size 2x2 and stride 2.
 
2. Calculate the total number of parameters that need to be learned in this CNN.
3. Discuss the benefits of using small filter sizes and pooling layers in CNNs.
 
=== Solution === 
 
1. **CNN Architecture Specifications:**
  - Convolutional layer with 8 filters, each filter of size 3x3, applied to the grayscale input image of size 28x28.
  - Each convolutional filter has 9 weights (3x3) and 1 bias, applied without padding ('valid').
  - ReLU activation function is used to introduce non-linearity.
  - Max pooling layer with a pool size of 2x2 reduces spatial dimensions by half, due to stride 2.
 
2. **Parameter Calculation:**
  - **Convolutional Layer Parameters:**
    - Number of filters = 8
    - Weights per filter = 3x3 = 9
    - Biases per filter = 1
    - Total parameters = 8 filters x (9 weights + 1 bias) = 8 x 10 = 80 parameters
 
3. **Discussion on Benefits of Small Filter Sizes and Pooling Layers:**
  - **Small Filter Sizes:**
    - Small filters such as 3x3 allow the network to capture basic visual features such as edges and textures with fewer parameters, enhancing generalization capabilities.
    - Using multiple small filters can effectively capture various aspects of the input data while keeping the network compact and efficient.
  - **Pooling Layers:**
    - Pooling layers reduce the spatial dimensions of the feature maps, which decreases the computational load for subsequent layers.
    - By downsampling the feature maps, pooling layers also help to make the detection of features invariant to small shifts and distortions in the input image, enhancing the model's robustness to variations in input data.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 7.17 ==
 
<b>Level:</b> * (easy) 
 
<b>Exercise Types:</b> Novel
 
=== Question ===
 
Input Matrix:
 
<math> \begin{bmatrix}
1 & 3 & 2 & 4 \
5 & 6 & 8 & 7 \
9 & 10 & 12 & 11 \
13 & 14 & 15 & 16
\end{bmatrix} </math>
 
Perform the max pooling operation on the input matrix with a 2x2 filter and a stride of 2.
 
=== Solution ===
 
=== Question === 
 
Input Matrix: 
 
<math> 
\begin{bmatrix} 
1 & 3 & 2 & 4 \ 
5 & 6 & 8 & 7 \ 
9 & 10 & 12 & 11 \ 
13 & 14 & 15 & 16 
\end{bmatrix} 
</math> 
 
Perform the max pooling operation on the input matrix with a \(2 \times 2\) filter and a stride of 2. 
 
=== Solution === 
 
Step 1: Divide the input matrix into non-overlapping \(2 \times 2\) regions based on the given stride. 
 
- Region 1 (Top-left): 
  <math> 
  \begin{bmatrix} 
  1 & 3 \ 
  5 & 6 
  \end{bmatrix} 
  \Rightarrow \max(1, 3, 5, 6) = 6 
  </math> 
 
- Region 2 (Top-right):
  <math> 
  \begin{bmatrix} 
  2 & 4 \ 
  8 & 7 
  \end{bmatrix} 
  \Rightarrow \max(2, 4, 8, 7) = 8 
  </math> 
 
- Region 3 (Bottom-left):
  <math> 
  \begin{bmatrix} 
  9 & 10 \ 
  13 & 14 
  \end{bmatrix} 
  \Rightarrow \max(9, 10, 13, 14) = 14 
  </math> 
 
- Region 4 (Bottom-right):
  <math> 
  \begin{bmatrix} 
  12 & 11 \ 
  15 & 16 
  \end{bmatrix} 
  \Rightarrow \max(12, 11, 15, 16) = 16 
  </math> 
 
Step 2: Construct the output matrix from the maximum values of each region. 
 
Output Matrix: 
 
<math> 
\begin{bmatrix} 
6 & 8 \ 
14 & 16 
\end{bmatrix} 
</math> 
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 7.18 ==
 
<b>Level:</b> * (Easy)
 
<b>Exercise Type:</b> Novel
 
<b>References:</b> A. Ghodsi, STAT 940 Deep Learning: Lecture 7, University of Waterloo, Winter 2025.
 
=== Question ===
When a Convolutional Neural Network (CNN) is being trained, normalization is a helpful technique to stabilize that process.
 
1. What is one benefit of Filter Response Normalization (FRN) when training a Convolutional Neural Network (CNN)?
 
2. Additionally, some networks are designed to be normalizer-free. Name one normalizer-free technique and a benefit it provides.
 
=== Solution ===
 
1. One benefit of using Filter Response Normalization when training a CNN is that it prevents batch elements from influencing each other by normalizing channels independently, which helps improve the performance of the model. It also supports stable training across various batch sizes and network architectures. Note that, unlike Batch Normalization (BN), FRN does not depend on batch statistics (mean and variance across a batch), making it more robust for small batch sizes and applicable to batch-independent inference.
It ensures positive activations and controls feature scale, which leads to better gradient flow and reducing internal covariate shift.
 
2. One normalizer-free technique is Adaptive Gradient Clipping. This technique ensures that the norm of the gradient never exceeds a certain value by dynamically adjusting the clipping strength during training. It helps prevent CNNs from facing exploding gradients, which makes it useful when training large-scale CNNs.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 7.19 ==
 
<b>Level:</b> ** (Moderate)
 
<b>Exercise Type:</b> Modified
 
<b>References:</b> Calin, Ovidiu. Deep learning architectures: A mathematical approach. Springer, 2020. Exerciese 16.9.3
 
=== Question ===
 
Consider a <math>3\times 3</math> kernel
<math> K = \begin{bmatrix}
1 & 2 & 1 \
0 & 0 & 0 \
-1 & -2 & -1
\end{bmatrix} </math>
 
a) What is the effect of this convolution kernel?
 
b) What is the effect of the transpose kernel <math>K^T</math>?
=== Solution ===
 
a) Suppose we want to perform the convolution to a  <math>3\times 3</math> matrix
<math> \begin{bmatrix}
a_{11} & a_{12} & a_{13} \
a_{21} & a_{22} & a_{23} \
a_{31} & a_{32} & a_{33}
\end{bmatrix} * \begin{bmatrix}
1 & 2 & 1 \
0 & 0 & 0 \
-1 & -2 & -1
\end{bmatrix} = a_{11} - a_{31} + 2(a_{12} - a_{32}) + (a_{13} - a_{33})</math>, the effect is to subtracting the third row from the first row, showing differences in vertical pixel intensity. If there is a sharp intensity change from one row to another, the kernel will produce a large response, highlighting the presence of a horizontal edge. If the intensity remains constant across rows, the convolution will output near zero, meaning no edge is detected.
 
(b) It is similar to part (a), the only difference is that <math>K^T</math> filters the vertical edges.
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 7.20 ==
 
<b>Level:</b> * (Easy)
 
<b>Exercise Type:</b> Novel
 
=== Question ===
Consider a convolutional neural network (CNN) used for image classification. The network consists of a convolutional layer followed by a max-pooling layer. The convolutional layer uses a 3x3 kernel with a stride of 1, and the max-pooling layer uses a 2x2 kernel with a stride of 2. Given an input image of size 32x32 with 3 color channels (RGB), calculate the dimensions of the output feature map after passing through both the convolutional and max-pooling layers.
 
=== Solution ===
 
1. Convolutional Layer:
 
- Input size: <math>32 \times 32 \times 3</math> (height <math>\times</math> width <math>\times</math> channels) <br>
- Kernel size: <math>3 \times 3</math> <br>
- Stride: 1 <br>
- Padding: Assuming no padding (i.e., valid convolution) <br>
 
The formula to calculate the output size after convolution is:<br>
 
<math>
\text{Output size} = \left\lfloor \frac{\text{Input size} - \text{Kernel size}}{\text{Stride}} \right\rfloor + 1
</math>
 
Applying this to the height and width:
<math>
\text{Output height} = \left\lfloor \frac{32 - 3}{1} \right\rfloor + 1 = 30
</math>
<br>
 
<math>
\text{Output width} = \left\lfloor \frac{32 - 3}{1} \right\rfloor + 1 = 30
</math>
 
Therefore, the output feature map after the convolutional layer is <math>30 \times 30 \times N</math>, where <math>N</math> is the number of filters in the convolutional layer.
 
2. Max-Pooling Layer:
 
- Input size: <math>30 \times 30 \times N</math> <br>
- Kernel size: <math>2 \times 2</math> <br>
- Stride: 2 <br>
 
The formula to calculate the output size after max-pooling is:
<math>
\text{Output size} = \left\lfloor \frac{\text{Input size} - \text{Kernel size}}{\text{Stride}} \right\rfloor + 1
</math>
 
<br>
 
Applying this to the height and width:
<math>
\text{Output height} = \left\lfloor \frac{30 - 2}{2} \right\rfloor + 1 = 15 </math>
 
<br>
<math>
\text{Output width} = \left\lfloor \frac{30 - 2}{2} \right\rfloor + 1 = 15
</math>
 
Therefore, the final output feature map after the max-pooling layer is <math>15 \times 15 \times N</math>.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
 
 
== Exercise 7.21 ==
 
<b>Level:</b> * (Moderate)
 
<b>Exercise Type:</b> Novel
 
=== Question ===
<math> X = \begin{bmatrix}
1 & 2 & 3 & 0 & 1 \
4 & 5 & 6 & 1 & 0 \
7 & 8 & 9 & 2 & 1 \
3 & 2 & 1 & 0 & 4 \
5 & 6 & 7 & 8 & 9
\end{bmatrix} </math>. Do convolution operation by kernel feature <math> K = \begin{bmatrix}
1 & 0 & -1 \
1 & 0 & -1 \
1 & 0 & -1
\end{bmatrix} </math> with a stride of 1. Later, apply RELU activation function <math> \text{ReLU}(x) = \max(0, x) </math>. Next, apply 2*2 maxpooling with stride 1.
Finally, flattening then pass vector to a fully connected layer with weights  <math> W = [0.5, -0.5, 1, -1] </math> and bias <math>  b = 2  </math>.
=== Solution ===
After sliding kernel feature K, we obtain <math> C = \begin{bmatrix}
6 & 6 & -6 \
6 & 6 & -6 \
9 & 9 & -9
\end{bmatrix} </math>. After applying RELU to C, we obtain <math> C' = \begin{bmatrix}
6 & 6 & 0 \
6 & 6 & 0 \
9 & 9 & 0
\end{bmatrix} </math>. Applying maxpooling, we obtain <math> P = \begin{bmatrix}
6 & 6 \
9 & 9
\end{bmatrix} </math>. Flattening converts P into <math> V = [6,6,9,9].</math> Passing V to a fully connected layer <math> Z = V \cdot W^T + b </math>, we
obtain Z = (3 - 3 + 9 - 9 + 2) = 2.
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
 
== Exercise 7.22 ==
 
<b>Level:</b> * (Moderate)
 
<b>Exercise Type:</b> Novel
 
=== Question ===
 
Given two 1D signals:
 
<math> x = [3 1 2 1] </math>
 
<math> h = [2 0 1] </math>
 
1. Compute the convolution of x and h.
 
2. Compute the cross-correlation of x and h
 
=== Solution ===
 
Step 1: Compute the Convolution
 
The convolution of x and h is given by:
 
<math> y[n] = (x * h)[n] = \sum_{k}x[k] * h[n-k] </math>
 
This means we flip h and slide it across x, computing the dot product at each position.
 
Flip h: <math> h_{flip} =  [1 0 2]</math>
 
<math> y = [32 30+12 31+10+22 11+20+(1)2 21+(1)0 (1)1] </math>.
 
<math> y = [6 2 7 1 2 1] </math>.
 
Thus, the convolution result is <math> y = [6 2 7 1 2 1] </math>.
 
Step 2: Compute the Cross-Correlation
 
The cross-correlation is <math> r_{x,h}[n] = \sum_{k}x[k]*h[k+n] </math>
 
This time, we do not flip h:
 
<math> r = [31 30+11 32+10+21 12+20+(1)1 22+(1)0 (1)2] </math>
 
<math> r = [3 1 8 1 4 2] </math>
 
The cross-correlation result is <math> r = [3 1 8 1 4 2] </math>.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
 
== Exercise 7.23 ==
 
<b>Level:</b> ** (Moderate)
 
<b>Exercise Type:</b> Novel
 
=== Question ===
 
Let <math>f :\mathbb{R}^{H\times W\times C}\rightarrow \mathbb{R}^{H^\prime \times W^\prime \times C^\prime}</math>
represent a convolutional layer in a CNN with kernel size <math>k\times k</math>, stride s and zero padding p. Assume the layer has <math>C^\prime</math>
output channels and uses a standard linear convolution operation without depthwise separability or dilation. Then, increasing k while keeping s, p and
<math>C^\prime</math> fixed always results in a strictly larger receptive field and an increase in the number of learnable parameters.
 
Is this true?
 
=== Solution ===
 
False.
 
While increasing 𝑘 typically expands the receptive field, the change is not necessarily strictly larger in all cases, especially if the stride or padding is also adjusted to maintain spatial dimensions. Furthermore, the number of parameters increases only if standard convolution is used. If a factorized convolution (e.g., depthwise separable convolution or low-rank approximation) is applied, increasing
k does not necessarily lead to a parameter increase. Additionally, in architectures like dilated CNNs, effective receptive field growth is not solely dependent on
𝑘.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 7.24  == 
 
<b>Level:</b> ** (Moderate) 
 
<b>Exercise Types:</b> Novel 
 
=== Question ===
 
In Convolutional Neural Networks (CNNs), convolution operations exhibit equivariance to input transformations, while pooling operations enhance invariance to such transformations.
 
1. Prove that the convolution operation is equivariant to translation. That is, given an input x(i) and a convolutional kernel w(i), if the input is translated by k, the output feature map is also translated accordingly:
 
<math> (x * w)(i) = \sum_j x(j) w(i - j)</math>
 
Show that:
 
<math> (T_k x * w)(i) = T_k (x * w)(i) </math>
 
Where <math> T_k </math> denotes a translation by k units.
 
2. Explain how pooling operations disrupt equivariance and enhance model invariance.
 
=== Solution ===
1. Proof of Equivariance in Convolution:
 
The convolution operation is defined as:
 
<math> (x * w)(i) = \sum_j x(j) w(i - j) </math>
 
Let <math> T_k x(i) </math> denote a translation by k units:
 
<math> (T_k x)(i) = x(i - k) </math>
 
Computing convolution after translation:
 
<math> (T_k x * w)(i) = \sum_j x(j - k) w(i - j) </math>
 
Computing translation after convolution:
 
<math> T_k (x * w)(i) = (x * w)(i - k) = \sum_j x(j) w(i - k - j) </math>
 
Using a variable substitution <math> j' = j - k </math>, we get:
 
<math> T_k (x * w)(i) = \sum_{j'} x(j') w(i - j') </math>
 
Since both expressions are identical, we conclude that: <math> (T_k x * w)(i) = T_k (x * w)(i) </math>
 
 
2. How Pooling Enhances Invariance
 
- Pooling (such as max pooling or average pooling) operates on local windows (e.g., 2×2 or 3×3) and selects a representative value.
 
- For example, in max pooling, as long as the maximum value in the window stays the same despite small translations, the output remains unchanged.
 
- Small shifts in input may not change the pooling result because the max or average value in the window may remain unchanged.
 
- This makes CNNs more robust to minor translations, improving generalization to real-world variations.
 
 
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 8.1 ==
 
<b>Level:</b> * (Easy) 
 
<b>Exercise Types:</b> Novel 
 
=== Question === 
In relation to Gated Recurrent Units (GRUs), write a Python script to: 
# Simulate a sequence of 20 time steps where the input <math>x_t</math> is a sinusoidal wave. 
# Use a simple GRU cell with randomly initialized weights. 
# Visualize the evolution of the hidden state <math>h_t</math> over time.
 
=== Solution === 
<syntaxhighlight lang="python">
import numpy as np
import matplotlib.pyplot as plt
 
# Sigmoid and tanh activation functions
sigmoid = lambda x: 1 / (1 + np.exp(-x))
tanh = lambda x: np.tanh(x)
 
# Initialize weights randomly
np.random.seed(42)
W_z, U_z, b_z = np.random.randn(3) * 0.5
W_r, U_r, b_r = np.random.randn(3) * 0.5
W_h, U_h, b_h = np.random.randn(3) * 0.5
 
# Generate sinusoidal input sequence
timesteps = 20
x_seq = np.sin(np.linspace(0, 4 * np.pi, timesteps))
 
# Initialize hidden state
h_t = 0
hidden_states = []
 
# GRU forward pass
for x_t in x_seq:
    z_t = sigmoid(W_z * x_t + U_z * h_t + b_z)
    r_t = sigmoid(W_r * x_t + U_r * h_t + b_r)
    h_tilde_t = tanh(W_h * x_t + U_h * (r_t * h_t) + b_h)
    h_t = (1 - z_t) * h_t + z_t * h_tilde_t
    hidden_states.append(h_t)
 
# Plot hidden state evolution
plt.plot(hidden_states, label="Hidden State h_t")
plt.xlabel("Time step")
plt.ylabel("Hidden State Value")
plt.title("GRU Hidden State Evolution")
plt.legend()
plt.show()
</syntaxhighlight>
 
The plot shows how the hidden state <math>h_t</math> evolves over time as it processes the sinusoidal input. 
 
[[Image:Exercise8_1.png|thumb|400px|left]]
<br clear="all">
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 8.2 ==
 
<b>Level:</b> * (Easy) 
 
<b>Exercise Types:</b> Novel
 
=== Question === 
In Lecture 8, about BPTT algorithm, write the expression of <math>\frac{\partial L}{\partial U}</math>. Explain why the vanishing and exploding gradient problem occurs in BPTT and how it affects training.
[[File:Recurrent NN .png|thumb|300px|left]]
<br clear="all">
 
=== Solution === 
 
<math>
\frac{\partial L}{\partial U} = \sum_{t} \frac{\partial L_{t}}{\partial U}
= \sum_{t} \frac{\partial L_{t}}{\partial S_{t}} \cdot \frac{\partial S_{t}}{\partial U}
= \sum_{t} (\text{something computable}) \cdot x_{t}
</math>
 
The vanishing and exploding gradient problem occurs in BPTT because gradients are backpropagated through many time steps. If weights are small, gradients shrink exponentially, making learning slow (vanishing gradients). If weights are large, gradients grow exponentially and leads to instability (exploding gradients). Gradient Clipping can be implemented to limit gradient magnitudes and  prevent instability.
 
The vanishing and exploding gradient problem in BPTT occurs due to repeated multiplication of Jacobian matrices over many time steps.
 
Why It Occurs
 
1. '''Gradient Propagation''' 
During BPTT, the gradient of the hidden state s_t with respect to the initial state \( s_0 \) is calculated as: 
<math>\frac{\partial s_t}{\partial s_0} = \prod_{k=1}^{t} \frac{\partial s_k}{\partial s_{k-1}}.</math> 
 
Each Jacobian matrix <math>\frac{\partial s_k}{\partial s_{k-1}} \</math> is defined as: 
<math>\frac{\partial s_k}{\partial s_{k-1}} = \text{diag}(1 - \tanh^2(a_k)) W</math> ,
where W is the recurrent weight matrix. 
 
2. '''Eigenvalues of W''' 
The eigenvalues of \( W \) determine the behavior of gradients: 
* If <math> ( |\lambda| < 1 ) </math>, the product shrinks exponentially, causing '''vanishing gradients'''. 
* If <math> ( |\lambda| > 1 ) </math>, the product grows exponentially, causing '''exploding gradients'''.
 
How It Affects Training
 
1. '''Vanishing Gradient''' 
* Gradients become too small, slowing learning and preventing the network from capturing long-term dependencies. 
* The model focuses only on short-term relationships. 
 
2. '''Exploding Gradient''' 
* Gradients become excessively large, leading to numerical instability. 
* The optimization process may diverge, making training unreliable.
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 8.3 ==
 
Level: *** (Difficult)
 
Exercise Type: Novel
 
=== Question ===
Recurrent Neural Networks (RNNs) suffer from the vanishing and exploding gradient problem due to the repeated multiplication of Jacobians through time steps.
 
Consider a simple RNN with a hidden state update equation:
 
<math> h_t = \tanh(W h_{t-1} + U x_t + b) </math>
 
where <math> W </math> is the recurrent weight matrix, <math> U </math> is the input weight matrix, and <math> x_t </math> is the input at time step <math> t </math>. Explain why the gradient of the loss with respect to <math> W </math> can either explode or vanish over long time steps.
 
Assume the eigenvalues of <math> W </math> are given by <math> \lambda_1, \lambda_2, ..., \lambda_n </math>. What condition on <math> \lambda_i </math> would lead to the vanishing gradient problem, and what condition would cause the exploding gradient problem?
 
To mitigate these issues, gradient clipping is often applied during backpropagation through time (BPTT). Suppose we apply gradient clipping with a threshold <math> \tau = 1 </math> to a gradient <math> g = (g_1, g_2, g_3) </math> with norm <math> | g | = 5</math>. Compute the clipped gradient vector.
 
=== Solution ===
 
Why Gradients Vanish or Explode:
 
The gradient of the loss with respect to <math> W </math> involves the product of multiple Jacobians through time:
 
<math> \frac{\partial L}{\partial W} \propto \prod_{t=1}^{T} W^T \nabla h_t </math>
 
If <math> W </math> has eigenvalues less than 1, repeated multiplication causes the gradient to shrink exponentially, leading to vanishing gradients. This prevents earlier time steps from having a significant influence on training.
 
If <math> W </math> has eigenvalues greater than 1, repeated multiplication causes the gradient to grow exponentially, leading to exploding gradients, causing unstable updates.
 
Eigenvalue Condition for Vanishing and Exploding Gradients:
 
Vanishing Gradient: If <math> |\lambda_i| < 1 </math>, the gradients diminish exponentially over time.
Exploding Gradient: If <math> |\lambda_i| > 1 </math>, the gradients grow exponentially, causing instability.
Applying Gradient Clipping:
 
Given <math> g = (g_1, g_2, g_3) </math> with norm <math> | g | = 5 </math> and clipping threshold <math> \tau = 1 </math>:
<math> g_{\text{clipped}} = g \cdot \frac{1}{5} = (g_1, g_2, g_3) \times 0.2. </math>
The clipped gradient vector is:
<math> g_{\text{clipped}} = (0.2 g_1, 0.2 g_2, 0.2 g_3). </math>
 
 
Additional note: The matrix <math> W </math> can be decomposed into eigenvectors and eigenvalues. During backpropagation, the gradient is multiplied by <math> W </math> at each layer (or time step in RNNs). This multiplication scales the gradient along the eigenvectors of <math> W </math>, with the scaling factor determined by the corresponding eigenvalues. If <math> W </math> has large eigenvalues (greater than 1), the gradient is stretched exponentially along those eigenvectors, causing the gradient to grow quickly across layers, leading to exploding gradients. Conversely, if <math> W </math> has small eigenvalues (less than 1), the gradient is shrunk exponentially, causing it to vanish as it propagates back through many layers or time steps, leading to vanishing gradients.
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 8.4 ==
 
<b>Level:</b> * (Easy) 
 
<b>Exercise Types:</b> Novel 
 
=== Question === 
 
Train an LSTM-based model to classify movie reviews as positive/negative using the IMDB dataset and compare LSTM with a simple Dense network.
=== Solution === 
<source lang="python">
import numpy as np
import tensorflow as tf
import matplotlib.pyplot as plt
from tensorflow.keras.datasets import imdb
from tensorflow.keras.preprocessing.sequence import pad_sequences
from tensorflow.keras.models import Sequential
from tensorflow.keras.layers import Embedding, LSTM, Dense, Flatten
from tensorflow.keras.optimizers import Adam
 
# Load IMDB dataset with the top 10,000 words
vocab_size = 10000
max_length = 200
(x_train, y_train), (x_test, y_test) = imdb.load_data(num_words=vocab_size)
 
# Pad sequences to ensure uniform length
x_train = pad_sequences(x_train, maxlen=max_length)
x_test = pad_sequences(x_test, maxlen=max_length)
 
lstm_model = Sequential([
    Embedding(input_dim=vocab_size, output_dim=128, input_length=max_length),
    LSTM(64, return_sequences=False),
    Dense(1, activation='sigmoid')
])
 
lstm_model.compile(optimizer=Adam(learning_rate=0.001), loss='binary_crossentropy', metrics=['accuracy'])
 
# Train the LSTM model
history_lstm = lstm_model.fit(x_train, y_train, validation_data=(x_test, y_test), epochs=5, batch_size=64)
 
dense_model = Sequential([
    Embedding(input_dim=vocab_size, output_dim=128, input_length=max_length),
    Flatten(),
    Dense(128, activation='relu'),
    Dense(1, activation='sigmoid')
])
 
dense_model.compile(optimizer=Adam(learning_rate=0.001), loss='binary_crossentropy', metrics=['accuracy'])
 
# Train the Dense model
history_dense = dense_model.fit(x_train, y_train, validation_data=(x_test, y_test), epochs=5, batch_size=64)
 
import matplotlib.pyplot as plt
 
# Plot accuracy comparison
plt.figure(figsize=(12, 6))
plt.plot(history_lstm.history['accuracy'], label='LSTM Train Acc')
plt.plot(history_lstm.history['val_accuracy'], label='LSTM Val Acc')
plt.plot(history_dense.history['accuracy'], label='Dense Train Acc')
plt.plot(history_dense.history['val_accuracy'], label='Dense Val Acc')
plt.xlabel('Epochs')
plt.ylabel('Accuracy')
plt.legend()
plt.title('LSTM vs. Dense Model Accuracy')
plt.show()
</source>
 
The plot shows the accuracy of the lstm model and the dense model. 
 
[[File:LSTM v.s. Dense model.png|thumb|400px|left]]
<br clear="all">
 
It's clear that the training accuracy and validation accuracy of the LSTM model are both better than the dense model. LSTM performs better since it captures sequential dependencies in text by maintaining long-term effects. Dense networks struggle with long-term context and fail to learn any meaningful correspondences, hence the flat accuracy curve which suggests the architecture is not suitable for this problem.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 8.5 ==
 
<b>Level:</b> * (Easy) 
 
<b>Exercise Types:</b> Novel 
 
=== Question ===
 
1. Match the following properties to Leaky Units, RNNs, or Gated RNNs. <br>
(a). Uses explicit gating to control memory flow → ________________  <br>
(b). Memory retention is controlled by a simple decay factor → ________________  <br>
(c). Can suffer from vanishing gradient problems → ________________  <br>
(d). Can learn patterns but has difficulty with long-term dependencies → ________________  <br>
(e). Has a separate cell state to regulate information storage → ________________  <br>
(f). Computationally simplest among all three models → ________________  <br>
(g). Uses reset and update gates to modify memory retention → ________________  <br>
 
 
2.
Here are the formulas for Leaky Units and Gated RNNs (GRU) from Lecture 8.
 
Leaky Units:
 
<math>s_{t,i} = \left(1 - \frac{1}{\tau_i}\right) s_{t-1} + \frac{1}{\tau_i} \sigma(W s_{t-1} + U x_t)</math>
 
where:
- <math>\tau_i</math> controls the memory decay for each component <math>i</math> of the state vector.
- <math>s_t</math> is the state at time <math>t</math>, and <math>\sigma</math> is a nonlinear activation function (e.g., sigmoid).
 
Gated Recurrent Networks (GRU):
 
<math>
\begin{aligned}
r_t &= \sigma(W_r s_{t-1} + U_r x_t) \quad \text{(reset gate)} \
z_t &= \sigma(W_z s_{t-1} + U_z x_t) \quad \text{(update gate)} \
\tilde{s}_t &= \tanh(W \cdot (r_t \odot s_{t-1}) + U \cdot x_t) \quad \text{(temporary state)} \
s_t &= z_t \odot s_{t-1} + (1 - z_t) \odot \tilde{s}_t \quad \text{(final state)}
\end{aligned}
</math>
 
where:
- <math>r_t</math> is the reset gate.
- <math>z_t</math> is the update gate.
- <math>\tilde{s}_t</math> is the temporary state.
- <math>s_t</math> is the final state at time <math>t</math>.
 
Now make a comparison between Leaky Units and Gated RNNs, their similarities and differences.
 
=== Solution === 
 
1.
(a). Gated RNNs  <br>
(b). Leaky Units  <br>
(c). RNNs  <br>
(d). Leaky Units and RNNs  <br>
(e). Gated RNNs  <br>
(f). Leaky Units  <br>
(g). Gated RNNs <br>
 
 
2. 
 
Similarities: 
Both Leaky Units and Gated RNNs are recurrent models that update their states using information from the previous state and current input. They are both designed to handle sequential data and capture long-term dependencies, though they do so in different ways. Additionally, both models use nonlinear activation functions like sigmoid or tanh in their computations.
 
Differences: 
Leaky Units use a fixed decay rate <math>\tau_i</math> to mix past and current states, making them easier and faster to compute, but less effective for handling long-term memory. They can have problems with vanishing gradients when the decay rate is too small and are easier to train, but not as good for complex tasks. On the other hand, Gated RNNs use learnable gates (such as forget, input, and update) to control how much of the previous memory is kept and how much of the new input is used. These gates are learned through training, which makes Gated RNNs more flexible and better at handling long-term dependencies, but also more complex and slower to train.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 8.6 ==
 
<b>Level:</b> * (Medium) 
 
<b>Exercise Types:</b> Novel 
 
=== Question === 
Dataset: https://data.cityofnewyork.us/Environment/Air-Quality/c3uy-2p5r/about_data
Build a Recurrent Neural Network (RNN) to predict the next hour's PM2.5 concentration using the New York City Air Quality Dataset. Use PyTorch to implement the model, and train it on sequences of 24 hours of historical data (including features like temperature, wind speed, and ozone levels).
=== Solution === 
<pre>
import pandas as pd
import numpy as np
from sklearn.preprocessing import RobustScaler
from sklearn.metrics import r2_score, mean_absolute_error
import torch
import torch.nn as nn
from torch.utils.data import Dataset, DataLoader
 
# --------------------------------------------------
# 1. Enhanced Data Preparation with Metrics
# --------------------------------------------------
def load_data(filepath):
    df = pd.read_csv(filepath)
   
    # Filter relevant data
    pm_ozone = df[
        (df['Name'].isin(['Fine particles (PM 2.5)', 'Ozone (O3)'])) &
        (df['Data Value'].notna())
    ].copy()
   
    # Convert to annual data
    pm_ozone['year'] = pm_ozone['Time Period'].str.extract(r'(\d{4})').astype(float)
    pm_ozone = pm_ozone.dropna(subset=['year'])
    pm_ozone['year'] = pm_ozone['year'].astype(int)
   
    # Pivot table with error handling
    try:
        pivot_df = pm_ozone.pivot_table(
            index=['Geo Place Name', 'year'],
            columns='Name',
            values='Data Value',
            aggfunc='mean'
        ).reset_index()
    except ValueError:
        raise RuntimeError("Pivot failed - check for duplicate entries")
   
    # Handle missing values
    pivot_df = pivot_df.groupby('Geo Place Name').apply(
        lambda x: x.ffill().bfill()
    ).reset_index(drop=True)
   
    return pivot_df.dropna()
 
# --------------------------------------------------
# 2. Data Scaling with Validation
# --------------------------------------------------
def scale_data(df):
    scaler = RobustScaler()
    features = scaler.fit_transform(df[['Fine particles (PM 2.5)', 'Ozone (O3)']])
   
    # Ensure no NaNs after scaling
    if np.isnan(features).any():
        raise ValueError("NaN values detected after scaling")
   
    return features, scaler
 
# --------------------------------------------------
# 3. Sequence Creation with Quality Control
# --------------------------------------------------
def create_sequences(features, years, seq_length=3):
    X, y = [], []
   
    # Group by neighborhood
    unique_neighborhoods = years['Geo Place Name'].unique()
   
    for neighborhood in unique_neighborhoods:
        mask = years['Geo Place Name'] == neighborhood
        neighborhood_features = features[mask]
        neighborhood_years = years[mask]['year'].values
       
        # Check for consecutive years
        year_diffs = np.diff(neighborhood_years)
        if len(neighborhood_years) < seq_length + 1 or not np.all(year_diffs == 1):
            continue
           
        # Create sequences
        for i in range(len(neighborhood_features) - seq_length):
            seq = neighborhood_features[i:i+seq_length]
            target = neighborhood_features[i+seq_length][0]  # PM2.5 is first feature
           
            X.append(seq)
            y.append(target)
   
    return np.array(X), np.array(y)
 
# --------------------------------------------------
# 4. Model with Metrics Tracking
# --------------------------------------------------
class AirQualityRNN(nn.Module):
    def __init__(self, input_size=2, hidden_size=16):
        super().__init__()
        self.gru = nn.GRU(input_size, hidden_size, batch_first=True)
        self.fc = nn.Linear(hidden_size, 1)
       
    def forward(self, x):
        out, _ = self.gru(x)
        return self.fc(out[:, -1, :]).squeeze()
 
 
def train_and_validate(model, train_loader, test_loader, epochs=30):
    optimizer = torch.optim.AdamW(model.parameters(), lr=1e-4)
    criterion = nn.MSELoss()
   
    best_r2 = -np.inf
    metrics = {'train_loss': [], 'test_mae': [], 'test_r2': []}
   
    for epoch in range(epochs):
        # Training
        model.train()
        train_loss = 0
        for X_batch, y_batch in train_loader:
            optimizer.zero_grad()
            outputs = model(X_batch)
            loss = criterion(outputs, y_batch)
            loss.backward()
            torch.nn.utils.clip_grad_norm_(model.parameters(), 1.0)
            optimizer.step()
            train_loss += loss.item()
       
        # Validation
        model.eval()
        y_true, y_pred = [], []
        with torch.no_grad():
            for X_batch, y_batch in test_loader:
                preds = model(X_batch)
                y_true.extend(y_batch.numpy())
                y_pred.extend(preds.numpy())
       
        # Calculate metrics
        mae = mean_absolute_error(y_true, y_pred)
        r2 = r2_score(y_true, y_pred)
        metrics['train_loss'].append(train_loss/len(train_loader))
        metrics['test_mae'].append(mae)
        metrics['test_r2'].append(r2)
       
        print(f"Epoch {epoch+1}/{epochs}")
        print(f"Train Loss: {metrics['train_loss'][-1]:.4f}")
        print(f"Test MAE: {mae:.4f} | R²: {r2:.4f}\n")
       
    return metrics
 
# --------------------------------------------------
# 5. Main Execution with Metrics Reporting
# --------------------------------------------------
if __name__ == "__main__":
    # Load and prepare data
    df = load_data("Air_Quality_20250202.csv")
    features, scaler = scale_data(df)
   
    # Create sequences
    X, y = create_sequences(features, df[['Geo Place Name', 'year']])
   
    # Split data
    split = int(0.8 * len(X))
    X_train, X_test = X[:split], X[split:]
    y_train, y_test = y[:split], y[split:]
   
    # Create datasets
    class AirDataset(Dataset):
        def __init__(self, X, y):
            self.X = torch.tensor(X, dtype=torch.float32)
            self.y = torch.tensor(y, dtype=torch.float32)
           
        def __len__(self): return len(self.X)
        def __getitem__(self, idx): return self.X[idx], self.y[idx]
   
    train_loader = DataLoader(AirDataset(X_train, y_train), batch_size=32, shuffle=True)
    test_loader = DataLoader(AirDataset(X_test, y_test), batch_size=32, shuffle=False)
   
    # Initialize and train model
    model = AirQualityRNN()
    metrics = train_and_validate(model, train_loader, test_loader)
   
    # Final evaluation
    print("\nFinal Performance:")
    print(f"Best R² Score: {max(metrics['test_r2']):.4f}")
    print(f"Best MAE: {min(metrics['test_mae']):.4f}")
 
</pre>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 8.7 ==
 
'''Level:''' *** (Difficult)
 
'''Exercise Type:''' Novel
 
'''References:''' Neumann, E. (2016). Double pendulum. web.mit.edu/jorloff/www/chaosTalk/double-pendulum/double-pendulum-en.html
 
This is where the equations of motion came from.
 
=== Question ===
 
This exercise is about using recurrent neural networks (RNNs) to predict the behaviour of chaotic, time-dependent systems. Consider a double pendulum, a well-known problem in physics that consists of one pendulum attached to the end of another. The state of the double pendulum can be fully described using the following variables:
 
<math> \theta_1 </math>: The angle of the first pendulum from the vertical.
 
<math> \theta_2 </math>: The angle of the second pendulum from the vertical.
 
<math> \omega_1 </math>: The angular velocity of the first pendulum.
 
<math> \omega_1 </math>: The angular velocity of the second pendulum.
 
The system is governed by the following system of equations, which do not have closed-form solutions: <br>
 
<math> \omega_1 ' = \frac{-g (2m_1 + m_2) \sin\theta_1 - m_2 g \sin(\theta_1-2\theta_2) - 2\sin(\theta_1 - \theta_2)m_2(\omega_2^2 L_2 + \omega_1^2 L_1 \cos(\theta_1-\theta_2))}{L_1 (2m_1 + m_2 - m_2 \cos(2\theta_1 - 2\theta_2)}</math> <br>
 
<math> \omega_2 ' = \frac{2\sin(\theta_1-\theta_2)(\omega_1^2 L_1 (m_1+m_2) + g(m_1+m_2)\cos\theta_1+ \omega_2^2 L_2 m_2 \cos(\theta_1-\theta_2))}{L_2 (2m_1 + m_2 - m_2 \cos(2\theta_1 - 2\theta_2)}</math> <br>
 
Assume the following parameters:
 
<math> m_1 = m_2 = 1 kg</math> (the masses of the pendulums)
 
<math> L_1 = L_2 = 1 m</math> (the lengths of the pendulums)
 
<math> g = 9.81 m/s^2 </math> (acceleration due to gravity)
 
Initial conditions:
 
<math> \theta_1 (0) = \theta_2 (0) = \pi/2 </math>
<math> \omega_1 (0) = \omega_2 (0) = 0 </math>
 
The task is to predict the next time step of this system given a sequence of previous states.
 
(a) Numerically solve the given system of equations using scipy.integrate.solve_ivp (or similar) for times between 0 and 10 seconds. Generate a dataset by sampling overlapping sequences from the solution. Split the dataset into testing and training sets, using the first half for training and the second half for testing.
 
(b) Write a simple RNN that takes as input a sequence states of the form <math> [\theta_1, \omega_1, \theta_2, \omega_2] </math>, and outputs the next state in the sequence.
 
(c) For the test dataset, plot the model's predictions for each of the 4 variables, <math> [\theta_1, \omega_1, \theta_2, \omega_2] </math>, alongside the true values from the numerical solution.
 
=== Solution ===
 
<pre>
 
g = 9.81 # m/s^2
 
def double_pendulum(t, y):
 
    """Defines the system of differential equations for the double pendulum."""
 
    theta1, w1, theta2, w2 = y
 
    delta_theta = theta1 - theta2
    den = 3 - np.cos(2*delta_theta)
 
    # 1st equation of motion:
    dw1_dt = (-g * (3 * np.sin(theta1) + np.sin(theta1 - 2 * theta2))
        - 2 * np.sin(delta_theta) * (w2**2 + w1**2 * np.cos(delta_theta))) / den
    # 2nd equation of motion:
    dw2_dt = (2 * np.sin(delta_theta) * (
            2 * w1**2 + 2 * g * np.cos(theta1) + w2**2 * np.cos(delta_theta))) / den
 
    return [w1, dw1_dt, w2, dw2_dt]
 
def create_sequences(data, seq_length=10):
    """Prepares time series data."""
    x = []
    y = []
    for i in range(len(data) - seq_length):
        x.append(data[i:i+seq_length])
        y.append(data[i+seq_length])
    return np.array(x), np.array(y)
 
class SimpleRNN(nn.Module):
    def __init__(self, input_size=4, hidden_size=32, num_layers=1, output_size=4):
        super(SimpleRNN, self).__init__()
        self.rnn = nn.RNN(input_size, hidden_size, num_layers, batch_first=True)
        self.fc = nn.Linear(hidden_size, output_size)
 
    def forward(self, x):
        x, _ = self.rnn(x)
        x = self.fc(x[:, -1, :])
        return x
 
theta1_0, w1_0, theta2_0, w2_0 = np.pi / 2, 0, np.pi / 2, 0
y0 = [theta1_0, w1_0, theta2_0, w2_0] # initial conditions
 
t_eval = np.linspace(0, 10, 1000)
data = solve_ivp(double_pendulum, (0, 10), y0, t_eval=t_eval).y.T
 
x, y = create_sequences(data)
x, y = torch.tensor(x, dtype=torch.float32), torch.tensor(y, dtype=torch.float32)
 
train_size = int(0.5 * len(x))
x_train, y_train = x[:train_size], y[:train_size]
x_test, y_test = x[train_size:], y[train_size:]
 
model = SimpleRNN()
criterion = nn.MSELoss()
optimizer = optim.Adam(model.parameters(), weight_decay=0.01)
 
num_epochs = 200
for epoch in range(num_epochs):
    model.train()
    optimizer.zero_grad()
    outputs = model(x_train)
    loss = criterion(outputs, y_train)
    loss.backward()
    optimizer.step()
 
    if (epoch+1) % 5 == 0:
        print(f'Epoch [{epoch+1}/{num_epochs}], Loss: {loss.item():.4f}')
 
model.eval()
predictions_test = model(x_test).detach().numpy()
 
</pre>
 
[[Image:double pendulum test.png|thumb|400px|left|]]
<br clear="all">
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 8.8 ==
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Copied
 
'''Reference:''' Calin, Ovidiu. Deep learning architectures: A mathematical approach. Springer, 2020
 
This question is from exercise 17.10.2 on page 558.
 
=== Question ===
 
(a) Consider the matrix:
 
<math>
W =
\begin{pmatrix}
\frac{1}{10} & \frac{2}{10} \
\frac{3}{10} & -\frac{4}{10}
\end{pmatrix}.
</math>
Show that <math>\lim_{n \to \infty} W^n = O_2</math>, where <math>O_2</math> denotes the <math>2 \times 2</math> zero matrix.
 
(b) Let <math>A</math> be a <math>k \times k</math> symmetric matrix and denote by <math>\rho(A) = \max_{1 \leq i \leq k} |\lambda_i|</math> its spectral radius, where <math>\lambda_i</math> denotes the eigenvalues of <math>A</math>. Consider the matrix <math>W = \frac{1}{1 + \rho(A)} A</math>. Prove that <math>\lim_{n \to \infty} W^n = O_k</math>.
 
(c) Let <math> W </math> be a <math> 2 \times 2 </math> matrix as defined in part (a). Define the sequence:
 
<math> S_n = \sum_{k=1}^{n} W^k </math>
 
Show that as <math>n \to \infty</math>, the sum converges to a finite limit and compute that limit.
 
=== Solution ===
<b>  Part (a) </b>
 
1.Spectral Radius of <math>W</math>:
The spectral radius <math>\rho(W)</math> is defined as the maximum absolute value of the eigenvalues of <math>W</math>: 
<math>
\rho(W) = \max |\lambda|.
</math>
 
2. Eigenvalue Calculation:
To compute the eigenvalues, solve the characteristic equation: 
<math>
\det(W - \lambda I) = 0,
</math>
where: 
<math>
W - \lambda I =
\begin{pmatrix}
\frac{1}{10} - \lambda & \frac{2}{10} \
\frac{3}{10} & -\frac{4}{10} - \lambda
\end{pmatrix}.
</math> 
The determinant is: 
<math>
\det(W - \lambda I) = \left(\frac{1}{10} - \lambda\right)\left(-\frac{4}{10} - \lambda\right) - \frac{6}{100}.
</math> 
Solving this quadratic equation gives the eigenvalues <math>\lambda_1</math> and <math>\lambda_2</math>, both satisfying <math>|\lambda_i| < 1</math>.
 
3. Convergence of <math>W^n</math>:
Since <math>\rho(W) < 1</math>, the powers <math>W^n</math> decay to zero as <math>n \to \infty</math>: 
<math>
\lim_{n \to \infty} W^n = O_2.
</math>
 
<b>  Part (b) </b>
 
1. Spectral Radius of <math>W</math>: 
The matrix
<math>
W = \frac{1}{1 + \rho(A)} A
</math> scales <math>A</math> such that: 
<math>
\rho(W) = \frac{\rho(A)}{1 + \rho(A)}.
</math> 
Since <math>\rho(A) > 0</math>, we have <math>\rho(W) < 1</math>.
 
2. Convergence of <math>W^n</math>: 
For any eigenvalue <math>\lambda_i</math> of <math>A</math>, the eigenvalue of <math>W</math> is: 
<math>
\mu_i = \frac{\lambda_i}{1 + \rho(A)}.
</math> 
Because <math>|\mu_i| < 1</math>, the powers <math>W^n</math> decay to the zero matrix as <math>n \to \infty</math>: 
<math>
\lim_{n \to \infty} W^n = O_k.
</math>
 
<b>  Part (c) </b>
 
1. Geometric Series of <math>W</math>:
Since <math>\rho(W) < 1</math>, the sum of the matrix powers forms a geometric series:
<math> S_n = \sum_{k=1}^{n} W^k = W (I - W^n)(I - W)^{-1} </math>
 
2. Limit of the Sum:
As <math> n \to \infty </math>, we know from part (a) that <math> W^n \to O_2</math>. Therefore, taking the limit in the sum formula:
<math> S = \sum_{k=1}^{\infty} W^k = W (I - O_2)(I - W)^{-1} </math>
 
Simplifying:
 
<math> S = W (I - W)^{-1} </math>
 
This shows that the sum converges to a finite limit, given by <math> W (I - W)^{-1} </math>. Since <math>\rho(W) < 1</math>, the matrix <math>(I - W)</math> is invertible, ensuring that the sum remains finite.
 
</pre>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 8.9 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Type:''' Novel
 
'''References:'''
 
[1] K. P. Murphy, Probabilistic Machine Learning: An introduction. MIT Press, 2022. [Online]. Available: http://probml.github.io/book1
 
[2] A. Ghodsi, STAT 940 Deep Learning: Lecture 7, University of Waterloo, Winter 2025.
 
=== Question ===
Explain how gated RNN's help prevent the exploding or vanishing gradient problem experienced by vanilla RNN networks.
 
=== Solution ===
In a standard RNN, the hidden state is updated multiplicatively, givne by the equation [2]
 
<math>
s_t = \sigma (W s_{t-1} + U x_t)
</math>
 
Since we multiply the hidden state <math> s_t </math> by the weight matrix <math> W </math> at each time step, we face gradient explosion if the eigenvalues <math> \lambda </math> are greater than one, and decay if <math> \lambda </math> are less than 1.
 
Gated RNNs update the hidden state in an additive rather than a multiplicative way, and therefore, since the weight updated to the hidden states are no longer multiplicative, the issue with gradient descent from vanilla RNNs is avoided.
 
The equations to update a Gated RNN are given as
 
<math>
z_t = \sigma (U^{(z)}x_t + W^{(z)}s_{t-1})
</math>
 
<math>
r_t = \sigma (U^{(r)}x_t + W^{(r)}s_{t-1})
</math>
 
<math>
\tilde{s}_t = tanh(Ux_t + r_t \circ Ws_{t-1})
</math>
 
<math>
s_t = z_t \circ s_{t-1} + (1-z_t) \circ \tilde{s}_t
</math>
 
The gated RNN puts additional controls on which help prevent vanishing gradient or gradient explosion.  while <math> \tilde{s} </math> still contains a <math> Ws_{t-1} </math> term, the reset gate <r_t> helps to prevent an exploding gradient by forgetting some previous terms of the state, and limiting infinite multiplication.  Meanwhile, the update gate <math> z_t </math> is capable of maintaining gradient from the previous state therefore preventing the gradient from vanishing entirely in the case of W having eigenvalues less than 1.
 
Therefore, rather than being purely multiplicative like a vanilla RNN, by using the reset and update gates and updating the state in an additive manner, gated RNNs are able to help reduce the risk of vanishing gradients or gradient explosion in recurrent neural networks [1]
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 8.10 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
 
Answer whether the following statements about Recurrent Neural Networks (RNNs) are <b>True</b> or <b>False</b>. <br>
 
1. RNNs are designed to handle sequential data by maintaining a hidden state that gets updated at each time step. <br>
 
2. RNNs are unable to handle long-term dependencies in data due to the vanishing gradient problem. <br>
 
3. RNNs are generally faster to train than feedforward neural networks because they process sequences in parallel.
 
4. How do Long Short-Term Memory (LSTM) networks and Gated Recurrent Units (GRUs) address the vanishing gradient problem in RNNs? Explain their key mechanisms.
 
=== Solution ===
 
1. <b>True</b> – RNNs are specifically designed to process sequential data, where the hidden state is updated at each time step to capture information from previous steps.
The hidden state acts as a memory of past information, enabling RNNs to capture dependencies in the data over time.
 
2. <b>True</b> – RNNs can struggle with long-term dependencies because of the vanishing gradient problem, where gradients become too small to effectively update weights over long sequences (updates for very early layers will be very small).
 
3. <b>False</b> – RNNs are generally slower to train than feedforward networks because they process sequences step by step, making parallelization more difficult (This is one of the advantages of transformer over RNN). RNNs must process sequences sequentially since each time step's computation depends on the hidden state from the previous step, this dependency prevents efficient parallelization, . While CNNs or Transformers can process entire sequences simultaneously.
 
4. LSTMs and GRUs are advanced types of RNNs designed to mitigate the vanishing gradient problem by introducing mechanisms that help retain long-term dependencies.
 
LSTM (Long Short-Term Memory) Mechanisms: <br>
Forget Gate: Decides how much past information should be discarded.<br>
Input Gate: Determines how much new information should be stored.<br>
Cell State: Acts as a long-term memory, allowing gradients to flow over long sequences.<br>
Output Gate: Controls the final output based on the cell state.<br>
 
By using gates and a cell state, LSTMs allow important information to persist over long sequences, preventing gradients from becoming too small.<br>
 
GRU (Gated Recurrent Unit) Mechanisms:<br>
Reset Gate: Helps forget irrelevant past information.<br>
Update Gate: Controls how much of the past information should be passed forward.<br>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 8.11 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
=== Question ===
Write a Python code to demonstrate the vanishing gradient problem using a simple RNN model. The code should include the following:
 
- Define a simple RNN model.
 
- Generate a random sequence as input data.
 
- Implement a training loop where you calculate and store the gradient norm at each epoch.
 
- Plot the gradient norm over the epochs to visualize the vanishing gradient problem.
 
=== Solution===
 
<pre>
import torch
import torch.nn as nn
import torch.optim as optim
import matplotlib.pyplot as plt
 
# Define a simple RNN model
class SimpleRNN(nn.Module):
    def __init__(self, input_size, hidden_size, output_size):
        super(SimpleRNN, self).__init__()
        self.rnn = nn.RNN(input_size, hidden_size, batch_first=True)
        self.fc = nn.Linear(hidden_size, output_size)
 
    def forward(self, x):
        out, _ = self.rnn(x)
        out = self.fc(out[:, -1, :])  # Get the output from the last time step
        return out
 
# Generate some dummy data (sequence length = 10)
sequence_length = 10
input_size = 1  # Just one feature
hidden_size = 5  # Small hidden size to observe vanishing gradients
output_size = 1  # Single output for simplicity
batch_size = 1
 
# Random input sequence
x = torch.randn(batch_size, sequence_length, input_size)
y = torch.randn(batch_size, output_size)  # Random target for demonstration
 
# Initialize the model, loss function, and optimizer
model = SimpleRNN(input_size, hidden_size, output_size)
criterion = nn.MSELoss()
optimizer = optim.SGD(model.parameters(), lr=0.01)
 
# To store the gradients over time
gradients = []
 
# Training loop
for epoch in range(500):
    optimizer.zero_grad()  # Zero gradients
    output = model(x)  # Forward pass
    loss = criterion(output, y)  # Compute loss
    loss.backward()  # Backpropagation
 
    # Store the gradient of the first RNN layer (hidden state)
    if epoch % 100 == 0:
        grad_norm = torch.norm(model.rnn.all_weights[0][0].grad).item()
        gradients.append(grad_norm)
 
    optimizer.step()  # Update weights
 
# Plot the gradients over time
plt.plot(range(0, 500, 100), gradients, marker='o')
plt.xlabel('Epoch')
plt.ylabel('Gradient Norm')
plt.title('Vanishing Gradient in RNN')
plt.show()
</pre>
 
[[Image:Screenshot 2025-02-07 093140.png|thumb|450px|left|]]
<br clear="all">
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 8.12 ==
 
<b>Level:</b> * (easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
Consider a simple dynamic system where the state of the system at any time <math>t</math> is defined by <math>s_t = 0.9s_{t-1} + 0.1x_t</math>, where <math>x_t</math> is the input at time <math>t</math> and the initial state <math>s_0</math> is zero. Simulate the response of the system over 50 time steps assuming <math>x_t</math> is a random signal with values uniformly distributed between 0 and 1. Plot the state <math>s_t</math> over time to visualize the system's response to the random inputs.
 
=== Solution ===
<pre>
import numpy as np
import matplotlib.pyplot as plt
 
# Define the length of the simulation
num_steps = 50
 
# Generate random input
x_t = np.random.uniform(0, 1, num_steps)
 
# Initialize the state
s_t = np.zeros(num_steps)
 
# Simulate the system's response over time
for t in range(1, num_steps):
    s_t[t] = 0.9 * s_t[t-1] + 0.1 * x_t[t]
 
# Plot the state over time
plt.figure(figsize=(10, 5))
plt.plot(s_t, label='State $s_t$')
plt.plot(x_t, label='Input $x_t$', linestyle='--')
plt.xlabel('Time step')
plt.ylabel('Value')
plt.title('System Response to Random Input')
plt.legend()
plt.grid(True)
plt.show()
</pre>
 
[[Image:ouput.png|thumb|450px|left|]]
 
<br clear="all">
 
</div>
 
 
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 8.13 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
 
We have a simple RNN with the following parameters:
 
Input:<math> x=(x1x2) =(0.50.3)</math>
 
Weight matrices:
 
<math> W= (0.50.20.30.7) </math>(for previous hidden state to current hidden state)
 
<math> U= (0.10.4) </math> (for input to hidden)
 
<math> V= (0.60.5) </math> (for hidden to output)
 
Hidden state s is passed through the tanh activation tanh(x).
 
Output at each timestep is o.
 
Target output for time step 1 is 0.8. Target output for time step 2 is 0.6.
 
Initial hidden state s= 0.
 
Compute gradient of the loss with respect to V for the first timestep.
 
=== Solution===
 
<b> Refenence: </b> Source: GeeksforGeeks. (n.d.). Implementing Recurrent Neural Networks in PyTorch.
 
<b>  Forward Pass </b>
 
<math>
s_1 = \tanh(Ws_0 + Ux_1) = \tanh \left( [0.50.20.30.7] [0.50.3] + [0.10.4] \cdot 0 \right) = [0.1880.345]</math>
 
<math>
o_1 = V s_1 = [0.60.5] \cdot [0.1880.345] = 0.2853
</math>
 
<b> Gradient calculation </b>
 
<math>
\delta_1 = \frac{\partial \text{Loss}}{\partial o_1} = o_1 - \text{target}_1 = -0.5147</math>
 
<math>
\frac{\partial \text{Loss}}{\partial V} = \delta_1 \cdot s_1 = -0.5147 \cdot [0.1880.345] = [0.09680.1776]
</math>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 8.14 ==
 
<b>Level:</b>  ** (Moderate)
 
<b>Exercise Types:</b> Modified
 
<b>Reference:</b> GeeksforGeeks. (n.d.). Implementing Recurrent Neural Networks in PyTorch.
 
=== Question ===
 
Analyze the implementation of a simple RNN in PyTorch for sine wave prediction. The model uses nn.RNN with 20 hidden units and a fully connected layer, trained with MSE loss and the Adam optimizer. The input is a sequence of 50 time steps, and the target is the next 50 steps. After training, the model's predictions are compared to the true sine wave values in a plot.
 
=== Solution ===
 
<pre>
 
import torch
import torch.nn as nn
import torch.optim as optim
import numpy as np
import matplotlib.pyplot as plt
 
# Generate sine wave data
def generate_data(seq_length, num_samples):
    X = []
    y = []
    for i in range(num_samples):
        x = np.linspace(i * 2 * np.pi, (i + 1) * 2 * np.pi, seq_length + 1)
        sine_wave = np.sin(x)
        X.append(sine_wave[:-1])  # input sequence
        y.append(sine_wave[1:])  # target sequence
    return np.array(X), np.array(y)
 
seq_length = 50
num_samples = 1000
X, y = generate_data(seq_length, num_samples)
 
# Convert to PyTorch tensors
X = torch.tensor(X, dtype=torch.float32)
y = torch.tensor(y, dtype=torch.float32)
 
print(X.shape, y.shape)  # Output: (1000, 50), (1000, 50)
 
class SimpleRNN(nn.Module):
    def __init__(self, input_size, hidden_size, output_size):
        super(SimpleRNN, self).__init__()
        self.rnn = nn.RNN(input_size, hidden_size, batch_first=True)
        self.fc = nn.Linear(hidden_size, output_size)
   
    def forward(self, x):
        h0 = torch.zeros(1, x.size(0), hidden_size).to(x.device)
        out, _ = self.rnn(x, h0)
        out = self.fc(out)
        return out
 
input_size = 1
hidden_size = 20
output_size = 1
model = SimpleRNN(input_size, hidden_size, output_size)
 
criterion = nn.MSELoss()
optimizer = optim.Adam(model.parameters(), lr=0.001)
 
# Training loop
num_epochs = 100
for epoch in range(num_epochs):
    model.train()
    outputs = model(X.unsqueeze(2))  # Add a dimension for input size
    loss = criterion(outputs, y.unsqueeze(2))
   
    optimizer.zero_grad()
    loss.backward()
    optimizer.step()
   
    if (epoch + 1) % 10 == 0:
        print(f'Epoch [{epoch+1}/{num_epochs}], Loss: {loss.item():.4f}')
 
# Make predictions
model.eval()
with torch.no_grad():
    predictions = model(X.unsqueeze(2)).squeeze(2).numpy()
 
# Plot results
plt.figure(figsize=(10, 6))
plt.plot(y[0].numpy(), label='True')
plt.plot(predictions[0], label='Predicted')
plt.legend()
plt.show()
 
</pre>
 
Output:
 
<pre>
torch.Size([1000, 50]) torch.Size([1000, 50])
Epoch [10/100], Loss: 0.3295
Epoch [20/100], Loss: 0.2356
Epoch [30/100], Loss: 0.1260
Epoch [40/100], Loss: 0.0716
Epoch [50/100], Loss: 0.0468
Epoch [60/100], Loss: 0.0317
Epoch [70/100], Loss: 0.0187
Epoch [80/100], Loss: 0.0102
Epoch [90/100], Loss: 0.0061
Epoch [100/100], Loss: 0.0050
</pre>
 
 
[[Image:RNN plot.png|thumb|600px|left|Figure 8.14]]
<br clear="all">
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 8.15 ==
 
<b>Level:</b>  ** (Moderate)
 
<b>Exercise Types:</b> Modified
 
<b>Reference:</b> Calin, Ovidiu. Deep learning architectures: A mathematical approach. Springer, 2020. Exercise 17.10.5
 
=== Question ===
 
Consider a state update <math>h_n = f(h_{n-1};\theta), n\geq 1</math>, where the transition function is <math>f(x;\theta)=tanh(\theta x), |\theta| <1 </math>. Find <math>\lim_{n\rightarrow \infty }h_n</math> the hidden state of the system in the long run
 
=== Solution ===
The transition function <math> f(x; \theta) = \tanh(\theta x) </math> satisfies the contraction mapping property. Specifically, a function <math> f </math> is a contraction if there exists a constant <math> 0 \leq k < 1 </math> such that for any <math> x, y </math> in its domain, we have: 
 
<math> |f(x) - f(y)| \leq k |x - y|. </math> 
 
For <math> f(x; \theta) = \tanh(\theta x) </math>, we compute its derivative: 
 
<math> f'(x; \theta) = \theta \text{sech}^2(\theta x). </math> 
 
Since <math> |\theta| < 1 </math> and <math> 0 \leq \text{sech}^2(\theta x) \leq 1 </math> for all <math> x </math>, we obtain: 
 
<math> |f'(x; \theta)| \leq |\theta| < 1. </math> 
 
Thus, <math> f </math> is a contraction mapping. By Banach’s Fixed Point Theorem, the sequence <math> h_n </math> converges to the unique fixed point of <math> f </math>, which satisfies: 
 
<math> \tanh(\theta a) = a. </math> 
 
The function <math> g(a) = \tanh(\theta a) - a </math> has a unique solution at <math> a = 0 </math> because <math> \tanh(\theta a) </math> is strictly increasing and satisfies <math> \tanh(0) = 0 </math>. 
 
Therefore, 
 
<math> \lim_{n\rightarrow \infty} h_n = 0. </math> 
 
=== Extended Question ===
 
Consider a modified state update <math> h_n = f(h_{n-1}; \theta, c) </math>, where the transition function is given by
 
<math> f(x; \theta, c) = \tanh(\theta x + c), \quad |\theta| < 1, \quad c \in \mathbb{R}. </math>
 
Find <math> \lim_{n\rightarrow \infty} h_n </math>, the hidden state of the system in the long run.
 
=== Extended Solution ===
 
We analyze the convergence of the sequence <math> h_n </math> by finding the fixed points of <math> f(x; \theta, c) = \tanh(\theta x + c) </math>.
 
A fixed point satisfies:
 
<math> a = \tanh(\theta a + c). </math>
 
Define <math> g(a) = \tanh(\theta a + c) - a </math>. The function <math> g(a) </math> is continuous and strictly increasing. Since <math> |\theta| < 1 </math>, the function <math> f(x; \theta, c) </math> remains a contraction mapping. By Banach’s Fixed Point Theorem, there exists a unique fixed point <math> a^* </math> satisfying the equation above.
 
To approximate the fixed point, note that for small <math> c </math>, we expand <math> \tanh(x) \approx x </math> for small <math> x </math>, leading to:
 
<math> a^* \approx \frac{c}{1 - \theta}. </math>
 
Thus, in the long run, the hidden state stabilizes at:
 
<math> \lim_{n\rightarrow \infty} h_n = a^*, </math>
 
where <math> a^* </math> is the unique solution to <math> a = \tanh(\theta a + c) </math>.
 
 
</div>
 
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 8.16 ==
 
<b>Level:</b>  ** (Moderate)
 
<b>Exercise Types:</b> Modified
 
===Question===
 
Let <math>J</math> be the Jacobian matrix of an Echo State Network (ESN) at a given time step, describing the local linearization of the system’s state transition dynamics. That is, given a small change <math> \Delta s </math> in the state vector, the evolution of this perturbation is given by:
 
<math>
\begin{align}
    \Delta s_{t+1} = J  \Delta  s_t
\end{align}
  </math>
 
where <math> s_t </math> represents the perturbation at time <math> t </math>. Prove that if all eigenvalues of <math> J </math>  satisfy <math> |\lambda_i | < 1 </math> for all <math> i </math> then the mapping is a contraction.
 
===Proof.===
 
To prove that the transformation is contractive when all eigenvalues of <math>J</math> satisfy <math>|\lambda_i| < 1</math>, we analyze the evolution of perturbations using the spectral decomposition of <math>J</math>. Assuming <math>J</math> is diagonalizable, it can be written as:
 
<math>
    \begin{align}
    J = V \Lambda V^{-1}
    \end{align}
  </math>
 
where <math>V</math> is the matrix of eigenvectors and <math>\Lambda</math> is the diagonal matrix of eigenvalues <math>\lambda_1, \lambda_2, \dots, \lambda_n</math>. Any initial perturbation can be expressed in terms of the eigenvectors as
 
<math>\Delta \mathbf{s}_0 = c_1 \mathbf{v}_1 + c_2 \mathbf{v}_2 + \dots + c_n \mathbf{v}_n.</math> . Applying the recurrence relation iteratively,
 
<math>
    \begin{align}
    \Delta \mathbf{s}_t = J^t \Delta \mathbf{s}_0 = (V \Lambda^t V^{-1}) \Delta \mathbf{s}_0.
    \end{align}
  </math>
 
Since <math>J</math> acts linearly on the eigenvectors, this simplifies to
 
<math>
    \begin{align}
    \Delta \mathbf{s}_t = c_1 \lambda_1^t \mathbf{v}_1 + c_2 \lambda_2^t \mathbf{v}_2 + \dots + c_n \lambda_n^t \mathbf{v}_n.
    \end{align}
  </math>
 
Now, taking the norm on both sides and applying the triangle inequality,
 
<math>
    \begin{align}
    \|\Delta \mathbf{s}_t\| \leq \sum_{i=1}^{n} |c_i| |\lambda_i|^t \|\mathbf{v}_i\|.
    \end{align}
  </math>
 
Since we assumed that <math>|\lambda_i| < 1</math> for all <math>i</math>, it follows that <math>|\lambda_i|^t \to 0</math> as <math>t \to \infty</math>. Consequently, each term in the summation approaches zero, implying that
 
<math>
    \begin{align}
    \|\Delta \mathbf{s}_t\| \to 0 \quad \text{as} \quad t \to \infty.
    \end{align}
  </math>
 
Thus, the mapping <math>\Delta \mathbf{s}_{t+1} = J \Delta \mathbf{s}_t</math> is a contraction, meaning that any small perturbation in the state space is gradually forgotten over time. This ensures the stability of the Echo State Network.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 8.17 ==
 
<b>Level:</b>  * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
Consider this recurrent neural net with input at time t: <math> x_t = 0.5 </math>, previous hidden state: <math> h_{t-1} = 0.2 </math>,
weights for hidden state: <math> W_h = 0.7 </math>, weights for input: <math> W_x = 0.3 </math>, bias: <math> b = 0.1 </math>, and Activation function: <math>tanh</math>.
Compute new hidden state and output <math> y_t </math> using an output weight <math>  W_y = 0.6.</math>
=== Solution ===
The hidden state is updated using the formula:  <math> h_t = \tanh(W_x*x_t + W_h*h_{t-1} + b)  </math>
<math> h_t = \tanh( (0.3*0.5) + (0.7*0.2) + 0.1 ) </math> = <math> \tanh(0.39) </math> = 0.37
 
The output is computed as: <math> y_t = W_y*h_t </math> = 0.6*0.37 = 0.222.
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 8.18 ==
 
<b>Level:</b>  *** (Difficult)
 
<b>Exercise Types:</b> Novel
 
=== Question === 
Consider a recurrent neural network (RNN) with the hidden state update equation: 
 
<math> h_t = \sigma(W_h h_{t-1} + W_x x_t + b) </math> 
 
where <math> W_h \in \mathbb{R}^{n \times n} </math> and <math> W_x \in \mathbb{R}^{n \times d} </math> are weight matrices, 
<math> b \in \mathbb{R}^{n} </math> is a bias vector, and <math> \sigma \</math> is an activation function (e.g., tanh). 
 
The output at each time step is given by: 
 
<math> y_t = W_y h_t + c </math> 
 
where <math> W_y \in \mathbb{R}^{m \times n} </math> is an output weight matrix and <math> c \in \mathbb{R}^{m} </math> is a bias vector. 
 
The network is trained using Backpropagation Through Time (BPTT) with a loss function: 
 
<math> \mathcal{L} = \sum_{t=1}^{T} \ell(y_t, \hat{y}_t) </math> 
 
where <math> \ell(\cdot) </math> is a differentiable loss function. 
 
1. Gradient Behavior Analysis: 
 
(a) Show that the gradient of the loss with respect to <math> W_h </math> can be expressed as:
<math> \frac{\partial \mathcal{L}}{\partial W_h} = \sum_{t=1}^{T} \sum_{k=t}^{T} \frac{\partial \mathcal{L}}{\partial h_k} \frac{\partial h_k}{\partial h_t} \frac{\partial h_t}{\partial W_h} </math> 
where <math> \frac{\partial h_k}{\partial h_t} \</math> depends on repeated multiplications of <math> W_h </math>. 
 
(b) Derive the conditions under which this term leads to the **vanishing gradient problem**. 
 
(c) Derive the conditions under which this term leads to the **exploding gradient problem**. 
 
2. Spectral Radius Condition:
 
(a) Prove that if the spectral radius <math> \rho(W_h) < 1 </math>, then the gradient vanishes exponentially. 
 
(b) Prove that if <math> \rho(W_h) > 1 </math>, then the gradient explodes exponentially. 
 
 
3. Mitigation Strategies:
 
(a) Explain how gradient clipping prevents unstable updates. 
 
(b) Consider an LSTM cell with the update equation for the cell state <math> c_t </math>: 
 
<math> c_t = f_t \odot c_{t-1} + i_t \odot \tilde{c}_t </math> 
where <math> f_t </math> and <math> i_t </math> are gate activations. Explain why this structure mitigates vanishing gradients. 
 
(c) Discuss the impact of **orthogonal weight initialization** (where <math> W_h W_h^T = I </math>) on gradient propagation. 
 
===Solution===
 
1. Gradient Behavior Analysis 
 
(a) Gradient of the Loss w.r.t W_h
 
The loss function is: 
 
<math> \mathcal{L} = \sum_{t=1}^{T} \ell(y_t, \hat{y}_t) </math> 
 
Using Backpropagation Through Time (BPTT), the gradient of the loss with respect to <math> W_h </math> is: 
 
<math> \frac{\partial \mathcal{L}}{\partial W_h} = \sum_{t=1}^{T} \sum_{k=t}^{T} \frac{\partial \mathcal{L}}{\partial h_k} \frac{\partial h_k}{\partial h_t} \frac{\partial h_t}{\partial W_h} </math> 
 
where: 
 
<math> \frac{\partial h_k}{\partial h_t} = \prod_{j=t}^{k-1} W_h \sigma'(W_h h_j + W_x x_j + b) </math> 
 
This term involves repeated multiplications of <math> W_h </math>, which affects gradient stability. 
 
(b) Vanishing Gradient Condition 
If <math> W_h </math> has eigenvalues <math> \lambda_i </math> such that <math> |\lambda_i| < 1 </math>, then: 
 
<math> W_h^n \approx \lambda_{\max}^n I, \quad \text{as } n \to \infty </math> 
 
where <math> \lambda_{\max} </math> is the largest eigenvalue in magnitude. Since <math> \lambda_{\max}^n \to 0 </math> as <math> n \to \infty </math>, the gradients shrink exponentially, leading to the **vanishing gradient problem**. 
 
(c) Exploding Gradient Condition 
If <math> W_h </math> has eigenvalues <math> \lambda_i </math> such that <math> |\lambda_i| > 1 </math>, then: 
 
<math> W_h^n \approx \lambda_{\max}^n I, \quad \text{as } n \to \infty </math> 
 
Since <math> \lambda_{\max}^n \to \infty </math>, the gradients grow exponentially, causing the **exploding gradient problem**. 
 
2. Spectral Radius Condition
 
(a) Vanishing Gradients 
The spectral radius <math> \rho(W_h) </math> is the largest absolute eigenvalue of <math> W_h </math>. If <math> \rho(W_h) < 1 </math>, then: 
 
<math> \|W_h^n\| \leq C \rho(W_h)^n, \quad \text{for some constant } C </math> 
 
which implies that the gradient norms decay exponentially. 
 
(b) Exploding Gradients 
 
If <math> \rho(W_h) > 1 </math>, then: 
 
<math> \|W_h^n\| \geq C \rho(W_h)^n </math> 
 
which causes exponential growth in gradients, leading to unstable weight updates. 
 
3. Mitigation Strategies
 
(a) Gradient Clipping 
Instead of using raw gradients <math> g </math>, we clip them if they exceed a threshold <math> \tau </math>: 
 
<math> g' = \frac{g}{\|g\|} \tau, \quad \text{if } \|g\| > \tau </math> 
 
This prevents excessively large updates and stabilizes training. 
 
(b) LSTM Mitigation of Vanishing Gradients 
LSTMs introduce a **cell state** <math> c_t </math> that is updated as: 
 
<math> c_t = f_t \odot c_{t-1} + i_t \odot \tilde{c}_t </math> 
 
where <math> f_t </math> (forget gate) allows information to persist over time. Since: 
 
<math> \frac{\partial c_t}{\partial c_{t-1}} = f_t </math> 
 
and <math> f_t</math> can be close to 1, the gradient can remain close to 1, preventing vanishing gradients. 
 
(c) Orthogonal Weight Initialization 
If <math> W_h </math> is initialized as an **orthogonal matrix**, then: 
 
<math> W_h W_h^T = I </math> 
 
which ensures that: 
 
<math> \|W_h^n\| = 1 \text{ for all } n </math> 
 
This stabilizes gradient propagation and prevents vanishing/exploding gradients. 
 
 
</div>
 
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 8.19 ==
 
<b>Level:</b>  * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
 
Suppose you have a neural network layer with an input vector x = [3, -2, 5, -1] and you are using the Leaky ReLU activation function with <math>\alpha </math> = 0.1. (i.e. For negative inputs, the output is <math>0.1 * x</math>). Please compute the output vector after applying the activation function.
 
===Solution===
 
The Leaky ReLU activation function is defined as:
 
<math>
f(x) =
\begin{cases}
x & \text{if } x > 0 \
\alpha \cdot x & \text{if } x \leq 0
\end{cases}
</math>
 
Given the input vector x = [3, -2, 5, -1], and <math> \alpha</math> = 0.1, we can compute the output for each element in the vector:
 
1. For value is 3:
 
<math>f(3) = 3 \quad (\text{since } 3 > 0) </math>
 
2. For value is -2:
 
<math>f(-2) = 0.1 \times (-2) = -0.2 \quad (\text{since } -2 \leq 0)</math>
 
3. For value is 5:
 
<math>f(5) = 5 \quad (\text{since } 5 > 0) </math>
 
4. For value is -1:
 
<math>f(-1) = 0.1 \times (-1) = -0.1 \quad (\text{since } -1 \leq 0)</math>
 
Thus, the output vector after applying the Leaky ReLU activation function is:
 
<math>\mathbf{y} = [3, -0.2, 5, -0.1]</math>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 8.20 ==
 
<b>Level:</b>  ** (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
 
(a) Explain gradient clipping and how it is applied during RNN training.
 
(b) Explain how LSTMs and GRUs reduce the vanishing gradient problem using gating mechanisms. Provide key mathematical equations to support your explanation.
 
=== Solution ===
 
(a) Gradient Clipping:
 
Gradient clipping is a technique used to prevent the exploding gradient problem, which occurs when gradients grow exponentially during backpropagation through time (BPTT) in recurrent neural networks (RNNs). If the gradients become too large, weight updates can become unstable, leading to poor convergence or numerical issues.
 
- When gradients become too large, normalize them:
 
<math> \tilde{g} = \frac{g}{\|g\|} \times \tau, \quad \text{if } \|g\| > \tau </math>
 
- where <math> \tilde{g} </math> is the clipped gradient, and <math> \tau </math> is a predefined threshold to prevent gradient explosion
 
(b) How LSTMs and GRUs Mitigate Vanishing Gradients:
 
<b> (1) LSTM </b>
 
- <b> How LSTM Mitigates Vanishing Gradients:</b>
 
LSTMs introduce memory cells and gating mechanisms to control the flow of information, preventing gradients from vanishing.
 
Key LSTM Equations:
 
LSTMs maintain a cell state <math> c_t </math> that accumulates information over time:
 
<math> c_t = f_t \odot c_{t-1} + i_t \odot \tilde{c}_t </math>
 
where:
 
<math> f_t = \sigma(W_f h_{t-1} + U_f x_t + b_f)</math> (Forget Gate)
<math> i_t = \sigma(W_i h_{t-1} + U_i x_t + b_i)</math> (Input Gate)
<math> o_t = \sigma(W_o h_{t-1} + U_o x_t + b_o) </math> (Output Gate)
<math> \tilde{c}_t = \tanh(W_c h_{t-1} + U_c x_t + b_c) </math> (Candidate Cell State)
 
The hidden state is then computed as:
 
<math> h_t = o_t \odot \tanh(c_t) </math>
 
- <b> Why LSTMs Reduce Vanishing Gradients: </b>
 
1. Cell state <math> c_t </math> enables long-term memory storage.
 
If the forget gate <math> F_t </math> ≈1, past information remains for many time steps.
 
This prevents information from vanishing as gradients remain close to 1.
 
2. Gates regulate information flow
 
The forget gate decides how much past information to keep.
 
The input gate determines how much new information to store.
 
This ensures a balance between old and new information.
 
<b> (2) GRU </b>
 
-<b> How GRUs Reduce Vanishing Gradients </b>
 
GRUs are a simplified version of LSTMs with fewer parameters but similar effectiveness.
 
Key GRU Equations
 
GRUs combine the forget and input gates into a single update gate <math> z_t </math>:
 
<math> z_t = \sigma(W_z h_{t-1} + U_z x_t + b_z) </math>
 
The reset gate <math> r_t </math> controls how much past information to discard:
 
<math> r_t = \sigma(W_r h_{t-1} + U_r x_t + b_r) </math>
 
The new candidate hidden state:
 
<math> \tilde{h}_t = \tanh(W_h (r_t \odot h_{t-1}) + U_h x_t + b_h) </math>
 
Final hidden state update:
 
<math> h_t = (1 - z_t) \odot h_{t-1} + z_t \odot \tilde{h}_t </math>
 
- <b> Why GRUs Reduce Vanishing Gradients </b>
 
1.The update gate <math> z_t </math> determines how much past information to retain. If <math> z_t </math> ≈1, the model keeps previous information for longer.
 
2.The reset gate <math> r_t </math> allows selective forgetting which his improves adaptability while still mitigating vanishing gradients.
 
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 8.21 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
=== Question ===
Recurrent Neural Networks (RNNs) suffer from the *vanishing gradient problem* due to repeated multiplications of the Jacobian matrix over long sequences. Consider an RNN with the hidden state update:
 
<math> h_t = \sigma(W_h h_{t-1} + W_x x_t + b) </math>
 
where:
- <math> W_h \in \mathbb{R}^{n \times n} </math> is the recurrent weight matrix.
- <math> W_x \in \mathbb{R}^{n \times d} </math> is the input weight matrix.
- <math> b \in \mathbb{R}^{n} </math> is the bias vector.
- <math> \sigma(\cdot) </math> is an activation function (e.g., tanh or ReLU).
 
The loss function is:
 
<math> \mathcal{L} = \sum_{t=1}^{T} \ell(y_t, \hat{y}_t) </math>
 
where <math> \ell(\cdot) </math> is a differentiable loss function.
 
==== (a) Gradient Propagation Analysis ====
1. Show that the gradient of the loss with respect to <math> W_h </math> is:
 
  <math> \frac{\partial \mathcal{L}}{\partial W_h} = \sum_{t=1}^{T} \sum_{k=t}^{T} \frac{\partial \mathcal{L}}{\partial h_k} \frac{\partial h_k}{\partial h_t} \frac{\partial h_t}{\partial W_h} </math>
 
  where <math> \frac{\partial h_k}{\partial h_t} </math> involves repeated multiplications of <math> W_h </math>.
 
2. Explain why this multiplication leads to the vanishing or exploding gradient problem based on the eigenvalues of <math> W_h </math>.
 
<b>  (b) Mitigation Strategies </b>
1. Gradient Clipping: Explain how it prevents the exploding gradient problem.
2. Leaky Units: Discuss how leaky units mitigate vanishing gradients.
3. Gated RNNs: Compare the structures of GRUs and LSTMs, explaining why they help prevent vanishing gradients.
 
=== Solution Outline ===
1. Backpropagation shows gradients depend on <math> (W_h)^t </math>. If <math> \lambda_{\max} </math> (largest eigenvalue of <math> W_h </math>) satisfies:
  - <math> |\lambda_{\max}| < 1 </math>, gradients shrink exponentially → vanishing gradient.
  - <math> |\lambda_{\max}| > 1 </math>, gradients grow exponentially → exploding gradient.
 
2. Mitigation Strategies:
  - Gradient Clipping: Caps gradients to prevent instability.
  - Leaky Units: Retain controlled past-state influence.
  - Gated RNNs (GRUs, LSTMs): Use gating mechanisms to maintain relevant long-term dependencies.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 9.1 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Copied
 
'''References:''' https://machinelearningmastery.com/the-attention-mechanism-from-scratch/
 
=== Question ===
Write a Python code to demonstrate the general attention mechanism using NumPy and SciPy libraries in Python. For simplicity, you will initially calculate the attention for the first word in a sequence of four. You will then generalize the code to calculate an attention output for all four words in matrix form.
 
=== Solution===
Let’s start by first defining the word embeddings of the four different words to calculate the attention. In actual practice, these word embeddings would have been generated by an encoder; however, for this particular example, you will define them manually.
<pre>
# encoder representations of four different words
word_1 = array([1, 0, 0])
word_2 = array([0, 1, 0])
word_3 = array([1, 1, 0])
word_4 = array([0, 0, 1])
</pre>
Next step is generate the weight matrices randomly. However, in actual practice, these would have been learned during training.
<pre>
...
# generating the weight matrices
random.seed(42) # to allow us to reproduce the same attention values
W_Q = random.randint(3, size=(3, 3))
W_K = random.randint(3, size=(3, 3))
W_V = random.randint(3, size=(3, 3))
 
...
# generating the queries, keys and values
query_1 = word_1 @ W_Q
key_1 = word_1 @ W_K
value_1 = word_1 @ W_V
 
query_2 = word_2 @ W_Q
key_2 = word_2 @ W_K
value_2 = word_2 @ W_V
 
query_3 = word_3 @ W_Q
key_3 = word_3 @ W_K
value_3 = word_3 @ W_V
 
query_4 = word_4 @ W_Q
key_4 = word_4 @ W_K
value_4 = word_4 @ W_V
</pre>
 
Considering only the first word for the time being, the next step scores its query vector against all the key vectors using a dot product operation.
<pre>
...
# scoring the first query vector against all key vectors
scores = array([dot(query_1, key_1), dot(query_1, key_2), dot(query_1, key_3), dot(query_1, key_4)])
</pre>
 
The score values are subsequently passed through a softmax operation to generate the weights. Before doing so, it is common practice to divide the score values by the square root of the dimensionality of the key vectors (in this case, three) to keep the gradients stable.
<pre>
...
# computing the weights by a softmax operation
weights = softmax(scores / key_1.shape[0] ** 0.5)
 
print("Attention Weights:", weights)
Attention Weights: [0.23608986 0.00738988 0.74913039 0.00738988]
</pre>
 
 
We see that the attention weights are higher for word 3, implying that it has a stronger influence than the other words with word 1. Finally, the attention output is calculated by a weighted sum of all four value vectors.
<pre>
...
# computing the attention by a weighted sum of the value vectors
attention = (weights[0] * value_1) + (weights[1] * value_2) + (weights[2] * value_3) + (weights[3] * value_4)
 
print(attention)
[0.98522025 1.74174051 0.75652026]
</pre>
 
For faster processing, the same calculations can be implemented in matrix form to generate an attention output for all four words in one go:
<pre>
from numpy import array
from numpy import random
from numpy import dot
from scipy.special import softmax
 
# encoder representations of four different words
word_1 = array([1, 0, 0])
word_2 = array([0, 1, 0])
word_3 = array([1, 1, 0])
word_4 = array([0, 0, 1])
 
# stacking the word embeddings into a single array
words = array([word_1, word_2, word_3, word_4])
 
# generating the weight matrices
random.seed(42)
W_Q = random.randint(3, size=(3, 3))
W_K = random.randint(3, size=(3, 3))
W_V = random.randint(3, size=(3, 3))
 
# generating the queries, keys and values
Q = words @ W_Q
K = words @ W_K
V = words @ W_V
 
# scoring the query vectors against all key vectors
scores = Q @ K.transpose()
 
# computing the weights by a softmax operation
weights = softmax(scores / K.shape[1] ** 0.5, axis=1)
 
# computing the attention by a weighted sum of the value vectors
attention = weights @ V
 
print(attention)
[[0.98522025 1.74174051 0.75652026]
[0.90965265 1.40965265 0.5      ]
[0.99851226 1.75849334 0.75998108]
[0.99560386 1.90407309 0.90846923]]
</pre>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 9.2 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Transformer Models and Sentence Similarity ===
 
Transformers are deep learning models designed for natural language processing (NLP) tasks. They use self-attention mechanisms to capture contextual relationships between words in a sequence, making them highly effective for tasks like machine translation, text classification, and sentence similarity analysis.
 
In this exercise, we use the <b>all-MiniLM-L6-v2</b> model, a lightweight and efficient transformer designed for sentence embeddings. It is optimized for tasks like sentence similarity and clustering, providing high-quality embeddings with reduced computational cost.
 
Below is a Python script that uses this model to compute sentence embeddings and visualize their similarity.
 
<pre>
import numpy as np
import matplotlib.pyplot as plt
from sentence_transformers import SentenceTransformer
from sklearn.metrics.pairwise import cosine_similarity
 
# Example sentences
sentences = [
    "The cat sits on the mat.",
    "A dog is running in the park.",
    "The feline is resting on a rug.",
    "An animal moves through the field.",
    "I love programming with Python.",
]
 
# Load a pre-trained transformer model
model = SentenceTransformer("all-MiniLM-L6-v2")
 
# Convert sentences to embeddings
embeddings = model.encode(sentences)
 
# Compute similarity matrix
similarity_matrix = cosine_similarity(embeddings)
 
# Plot the similarity matrix
plt.figure(figsize=(8, 6))
plt.imshow(similarity_matrix, cmap="coolwarm", interpolation="nearest")
plt.colorbar(label="Cosine Similarity")
plt.xticks(ticks=np.arange(len(sentences)), labels=range(len(sentences)))
plt.yticks(ticks=np.arange(len(sentences)), labels=range(len(sentences)))
plt.title("Sentence Similarity Matrix")
plt.show()
</pre>
 
[[File:sentence_similarity_matrix.png|605px|center|thumb|Sentence Similarity Matrix]]
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 9.3 ==
 
<b>Level:</b> * (Easy) 
 
<b>Exercise Types:</b> Modified, STAT 940 Lecture Notes, Lecture 9 Slide 431, Ali Ghodsi, Winter 2025
 
=== Question ===
A box with a size of 500 cubic inches needs its weight estimated. The weights and sizes of two reference boxes are:
- Box 1: Size = 480 cubic inches, Weight = 20 pounds
- Box 2: Size = 520 cubic inches, Weight = 30 pounds
 
1. Calculate the similarity scores for sizes "480" and "520" with respect to size "500".
2. Compute the coefficients <math>a_1</math> and <math>a_2</math> for the two reference boxes.
3. Calculate the weighted average weight of the box with size "500".
4. Implement a Python function to compute the estimated weight of any box given two reference boxes and their weights.
 
=== Solution ===
 
Step 1: Calculate the Similarity Scores
The **similarity scores** are calculated as:
<math>
\text{Similarity} = \frac{1}{|\text{Target Size} - \text{Reference Size}|}.
</math>
 
- For size **480**:
<math>
\text{Similarity} = \frac{1}{|500 - 480|} = \frac{1}{20}.
</math>
 
- For size **520**:
<math>
\text{Similarity} = \frac{1}{|500 - 520|} = \frac{1}{20}.
</math>
 
Step 2: Compute the Coefficients
The coefficients <math>a_1</math> and <math>a_2</math> are normalized similarity scores:
<math>
a_1 = \frac{\frac{1}{20}}{\frac{1}{20} + \frac{1}{20}} = \frac{1}{2},
</math>
<math>
a_2 = \frac{\frac{1}{20}}{\frac{1}{20} + \frac{1}{20}} = \frac{1}{2}.
</math>
 
Step 3: Calculate the Weighted Average Weight
The weighted average weight is computed as:
<math>
\text{Weighted Average Weight} = (a_1 \cdot \text{Weight of Box 1}) + (a_2 \cdot \text{Weight of Box 2}).
</math>
 
Substituting values:
<math>
\text{Weighted Average Weight} = \left(\frac{1}{2} \cdot 20\right) + \left(\frac{1}{2} \cdot 30\right) = 10 + 15 = 25 \, \text{pounds}.
</math>
 
Final Answer
The estimated weight of the box with size 500 cubic inches is:
<math>
25 \, \text{pounds}.
</math>
Since the target size (500) is exactly between the two reference sizes (480 and 520), the estimated weight is the average of 20 and 30 pounds, which intuitively makes sense.
 
 
</pre>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 9.4 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
=== Question ===
 
==== RNN Architecture and Weight Calculation ====
 
Recurrent Neural Networks (RNNs) are essential for processing sequences in tasks such as language modelling and time series prediction. They are designed to maintain a 'memory' of previous inputs by using the output of a layer as input for the next step. In this exercise, you will manually compute the output of a simple RNN layer over a single time step.
 
Given a simple RNN with:
 
* One input neuron <math>x_t</math>
 
* One recurrent neuron with a hidden state <math>h_{t-1}</math>
 
* Weight from input to hidden <math>w_{ih} = 0.5</math>
 
* Recurrent weight <math>w_{hh} = 0.8</math>
 
* Initial hidden state <math>h_{0} = 0</math>
 
Calculate the hidden state <math>h_1</math> after processing the first input <math>x_1 = 1.0</math>.
 
=== Solution ===
 
1. '''Calculate Activation:'''
 
The RNN uses the formula:
 
<math>
  h_t = \text{tanh}(x_t \cdot w_{ih} + h_{t-1} \cdot w_{hh})
</math>
 
where <math> \text{tanh} </math> is the hyperbolic tangent function, providing the activation for the hidden state.
 
2. '''Compute:'''
 
<math>
  h_1 = \text{tanh}(1.0 \cdot 0.5 + 0.0 \cdot 0.8) = \text{tanh}(0.5) \approx 0.462
</math>
 
Thus, <math> h_1 \approx 0.462 </math>, which is the new hidden state after processing the first input.
 
This exercise demonstrates how the RNN updates its hidden state by combining the input and the previous state, allowing the network to "remember" past information through its recurrent connections.
 
Below is a Python function that computes the estimated weight of any target box given two reference boxes and their weights:
 
<pre>
import numpy as np
 
def estimate_weight(target_size, ref_sizes, ref_weights):
    similarities = [1 / abs(target_size - size) for size in ref_sizes]
    coefficients = similarities / np.sum(similarities)
    estimated_weight = np.dot(coefficients, ref_weights)
    return estimated_weight
 
# Example Usage:
target_size = 500
ref_sizes = [480, 520]
ref_weights = [20, 30]
print("Estimated weight:", estimate_weight(target_size, ref_sizes, ref_weights), "pounds")
 
</pre>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 9.4 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Copied
 
'''References:''' https://fenix.tecnico.ulisboa.pt/downloadFile/1407993358918464/practical_10.pdf
 
=== Question ===
In this exercise, you will rewrite the attention mechanism without using matrix-matrix multiplications:
 
1. First, write the output of the dot product attention mechanism <math>z_i</math> as a function of the query vector <math>q_i \in R^{d_Q}</math>, the keys <math>k_j \in R^{d_K}</math> (for <math>j \in \{1, . . . , L\}</math>) and the values <math>v_k \in R^{d_V}</math> (for
<math>k \in \{1, . . . , L\}</math>). In this exercise, consider only a single head and disregard the projection matrices.
 
2. Now, write the full multi-head attention mechanism output <math>z_i</math> as a function of the input vectors <math>x_i \in R^{D}</math> and <math>x_j \in R^{D}</math> (for <math>i, j \in \{1, . . . , L\}</math>). Consider <math>H</math> heads and the projection
matrices <math>W^{(h)}_{Q} \in R^{D \times d_{Q}}</math> , <math>W^{(h)}_{K} \in R^{D \times d_{K}}</math>, <math>W^{(h)}_{V} \in R^{D \times d_{V}}</math> and <math>W^{(h)}_{O} \in R^{Hd_{V} \times d_{O}}</math>.
 
=== Solution===
 
1. Firstly, we compute dot products for each key-query pair:
<math>s_{ij} = \sum_{d=1}^{d_Q} q_i^{(d)} k_j^{(d)}</math> where <math>q_i^{(d)}</math> and <math>k_j^{(d)} </math> are the <math>d</math>-th components of <math>\mathbf{q}_i</math> and <math>\mathbf{k}_j</math>, respectively.
 
Then, we apply softmax normalization:
<math>\alpha_{ij} = \frac{\exp(s_{ij})}{\sum_{m=1}^{L} \exp(s_{im})}</math>
 
Finally, we compute the weighted sum of values:
<math>z_i^{(d)} = \sum_{j=1}^{L} \alpha_{ij} v_j^{(d)}</math> for each component <math>d \in \{1, \dots, d_V\}</math> of <math>\mathbf{z}_i</math>.
 
Thus, we have expressed attention computation in an element-wise fashion without matrix multiplications.
 
2. Firstly, we compute the projection into queries, keys, and values:
<math>q_i^{(h,d)} = \sum_{m=1}^{D} W_{Q,m,d}^{(h)} x_i^{(m)}</math>;
<math>k_j^{(h,d)} = \sum_{m=1}^{D} W_{K,m,d}^{(h)} x_j^{(m)}</math>;
<math>v_j^{(h,d)} = \sum_{m=1}^{D} W_{V,m,d}^{(h)} x_j^{(m)}</math> where <math>W_{Q,m,d}^{(h)}</math> is the <math>(m,d)</math>-th element of <math> \mathbf{W}_Q^{(h)}</math>, and similarly for <math>\mathbf{W}_K^{(h)}</math> and <math>\mathbf{W}_V^{(h)}</math>.
 
Then, we compute attention for each head:
<math>s_{ij}^{(h)} = \sum_{d=1}^{d_Q} q_i^{(h,d)} k_j^{(h,d)}</math>,
<math>\alpha_{ij}^{(h)} = \frac{\exp(s_{ij}^{(h)})}{\sum_{m=1}^{L} \exp(s_{im}^{(h)})}</math>,
<math>z_i^{(h,d)} = \sum_{j=1}^{L} \alpha_{ij}^{(h)} v_j^{(h,d)}</math>.
 
Finally, we concatenate all heads and apply output projection:
<math>z_i^{(d)} = \sum_{h=1}^{H} \sum_{m=1}^{d_V} W_{O,m,d}^{(h)} z_i^{(h,m)}
  </math>where <math> W_{O,m,d}^{(h)}</math> is the <math>(m,d)</math>-th element of <math>\mathbf{W}_O^{(h)}</math>.
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 9.5 ==
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
Consider a self-attention mechanism in a transformer model.
 
(a) Derive the dimensions of the attention matrix A and the final self-attention output.
 
(b) If we increase the number of attention heads from h = 4 to h = 8, explain how this affects computational cost and representation power.
 
(c) If the sequence length <math>  n </math> increases from <math> n = 10 </math> to <math> n = 20 </math>, how does this affect the size of the attention matrix <math> A </math> and the computational cost?
 
=== Solution ===
(a) The query matrix Q has shape <math>(n \times d_k)</math>, and the key matrix K has shape <math>(n \times d_k)</math>. The dot-product QK^T results in a matrix of shape <math>(n \times n)</math>. Applying the softmax function does not change this shape, so the attention matrix A has shape <math>(n \times n)</math>. The final self-attention output, computed as <math>AV</math>, has shape <math>(n \times d_k)</math>.
 
(b) Increasing the number of attention heads allows the model to learn more diverse representations but increases the computational cost. The number of parameters in <math> W_Q, W_K, W_V </math> increases, and more dot-products and softmax operations are required. However, the multi-head mechanism enables the model to capture different aspects of dependencies in the sequence.
 
(c) The attention matrix <math>A</math> has shape <math>(n \times n)</math>. When <math>n = 10</math>, <math>A</math> has size <math>10 \times 10 = 100</math>. When <math>n = 20</math>, <math>A</math> has size <math>20 \times 20 = 400</math>. This results in a 4 times increase in the size of <math>A</math>.
Computing <math>QK^T</math> involves multiplying <math>Q</math> (<math>n \times d_k</math>) with <math>K^T</math> (<math>d_k \times n</math>), requiring <math>O(n^2 \cdot d_k)</math> operations.
When <math>n = 10</math>, the cost is proportional to <math>10^2 \cdot d_k = 100 \cdot d_k</math>. When <math>n = 20</math>, the cost becomes <math>20^2 \cdot d_k = 400 \cdot d_k</math>. The computational cost increases by a factor of 4.
 
=== Additional Comments ===
Note that the increase by a factor of 4 is no coincidence. When n is increase by a factor of k, the computational cost will always be increased by a factor of <math>k^2</math>. This is due to the structure of the attention mechanism in transformers, where in the self-attention layer, each token in the sequence must attend to every other token, resulting in a matrix of size <math>n \times n</math> for the attention scores. As a result, when the sequence length doubles, the attention matrix grows quadratically in size which makes the computational cost for both memory and processing increase significantly with additional sequence length.
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 9.6 ==
 
<b>Level:</b> ** (Moderate)
 
<b>Exercise Types:</b> Application
 
=== Question ===
Explain how a simple Recurrent Neural Network (RNN) processes an input to update its hidden state. Provide a calculation for two consecutive time steps given specific weights and inputs.
 
=== Solution ===
Consider a simple RNN with one input neuron (<math>x_1</math>), one recurrent neuron with a hidden state (<math>h_0</math>), and given weights:
- Weight from input to hidden (<math>w_{ih} = 0.5</math>)
- Recurrent weight from hidden to hidden (<math>w_{hh} = 0.8</math>)
- Initial hidden state (<math>h_0 = 0</math>)
 
<b>Objective:</b> Calculate the hidden states for two time steps given:<math>x_1 = 1.0</math> and <math>x_2 = -0.5 </math>
 
<b>step 1: Calculation:</b>
1. Input to Hidden Calculation:
  <ul>
    <li><math>h_1 = \text{tanh}(x_1 \cdot w_{ih} + h_0 \cdot w_{hh})</math></li>
    <li><math>h_1 = \text{tanh}(1.0 \cdot 0.5 + 0.0 \cdot 0.8)</math></li>
    <li><math>h_1 = \text{tanh}(0.5)</math></li>
    <li><math>h_1 \approx 0.462</math></li>
  </ul>
 
<b>step 2: Calculation:</b>
1. Input to Hidden Calculation:
  <ul>
    <li><math>h_2 = \text{tanh}(x_2 \cdot w_{ih} + h_1 \cdot w_{hh})</math></li>
    <li><math>h_2 = \text{tanh}(-0.5 \cdot 0.5 + 0.462 \cdot 0.8)</math></li>
    <li><math>h_2 = \text{tanh}(-0.25 + 0.37)</math></li>
    <li><math>h_2 \approx 0.119</math></li>
  </ul>
 
This demonstrates how the RNN updates its hidden state by combining the current input with the previous state's output through a hyperbolic tangent function, which helps to keep the values between -1 and 1.
 
Thus, after two time steps, the hidden state has evolved from <math>h_0 = 0</math> to <math>h_1 \approx 0.462</math> and then to <math>h_2 \approx 0.119</math>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 9.7 ==
 
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
 
Attention Mechanism Exercise:
 
Consider the following simple example where we have:
 
Query vector (Q): <math>Q = [10]</math>
 
Key vector (K): <math>K = [11]</math>
 
Value vector (V): <math>V = [23]</math>
 
Conduct attention computation.
 
=== Solution===
 
<math>Q^T \cdot K = 1 \times 1 + 0 \times 1 = 1</math>
 
<math>\text{Scaled Score} = \frac{1}{\sqrt{2}} \approx \frac{1}{1.414} \approx 0.707</math>
 
<math>\text{Softmax}(z) = \frac{e^z}{\sum e^z} = \frac{e^{0.707}}{e^{0.707}} = 1</math>
 
<math>\text{Attention Output} = 1 \times [23] = [23]</math>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 9.8 ==
 
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Modified
 
'''References:''' https://www.analyticsvidhya.com/blog/2020/08/top-4-sentence-embedding-techniques-using-python/
 
=== Question ===
 
Sentence BERT (SBERT) is a modification of the BERT model designed to efficiently generate meaningful sentence embeddings. Unlike BERT, which focuses on token-level embeddings, SBERT is specifically optimized for semantic similarity tasks by producing fixed-size vector representations of entire sentences.
 
Use Sentence BERT and cosine similarity to calculate the similarity scores of sentences in Python
 
=== Solution===
 
Load the pre-trained Sentence BERT model using the sentence_transformers python library. Install sentence_transformers with pip.
<pre>
$ pip install sentence-transformers
</pre>
 
Load the Sentence BERT model
<pre>
from sentence_transformers import SentenceTransformer
sbert_model = SentenceTransformer('bert-base-nli-mean-tokens')
</pre>
 
Import cosine_similarity function from sklearn
<pre>
from sklearn.metrics.pairwise import cosine_similarity
</pre>
 
Define the input sentence and the sentences to calculate the similarity score to. Feel free to modify the sentences to explore similarity scores of different sentences.
<pre>
input_sentence = ["The FBI is chasing a criminal"]
 
sentences = [
    "The FBI is investigating a crime",
    "The police arrested a suspect",
    "A person stole a car",
    "A cat is chasing a mouse",
    "A cat is sleeping on the couch"
]
</pre>
 
Use the Sentence BERT model to get the sentence embeddings, and then use cosine similarity to calculate the similatities
<pre>
sentence_embeddings = sbert_model.encode(sentences)
input_embedding = sbert_model.encode(input_sentence)
similarities = cosine_similarity(input_embedding, sentence_embeddings)[0]
</pre>
 
Print the results
<pre>
print(f"\nComparing: {input_sentence[0]}")
print("-" * 50)
for i, _ in enumerate(similarities):
    print(f"Similarity: {similarities[i]:.4f} | \"{sentences[i]}\"")
</pre>
 
Supplement: This is the result that I get
 
<pre>
 
Comparing: The FBI is chasing a criminal
--------------------------------------------------
Similarity: 0.8160 | "The FBI is investigating a crime"
Similarity: 0.7057 | "The police arrested a suspect"
Similarity: 0.6137 | "A person stole a car"
Similarity: 0.2972 | "A cat is chasing a mouse"
Similarity: -0.0454 | "A cat is sleeping on the couch"
 
</pre>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 9.9 ==
 
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
 
Suppose you have 2 vectors <math>v_1 = (1,2,3), v_2 = (0,-1,0)</math>, what is the cosine similarity between the two?
 
=== Solution ===
 
<math>similarity = -2/(\sqrt{14})</math>
 
=== Extended Question ===
Consider a set of three vectors:
 
<math> v_1 = (1,2,3), \quad v_2 = (0,-1,0), \quad v_3 = (-1, 4, -2) </math>.
 
Compute the cosine similarity between <math> v_1 </math> and <math> v_3 </math>.
Determine which of <math> v_2 </math> or <math> v_3 </math> is more similar to <math> v_1 </math>.
=== Extended Solution ===
 
The cosine similarity formula is:
 
<math> \cos(\theta) = \frac{v_1 \cdot v_3}{| v_1 | | v_3 |} </math>
 
First, compute the dot product:
 
<math> v_1 \cdot v_3 = (1 \times -1) + (2 \times 4) + (3 \times -2) = -1 + 8 - 6 = 1 </math>
 
Next, compute the magnitudes:
 
<math> | v_1 | = \sqrt{1^2 + 2^2 + 3^2} = \sqrt{14} </math>
 
<math> | v_3 | = \sqrt{(-1)^2 + 4^2 + (-2)^2} = \sqrt{21} </math>
 
Thus,
 
<math> \cos(\theta) = \frac{1}{\sqrt{14} \times \sqrt{21}} = \frac{1}{\sqrt{294}} \approx 0.058 </math>
 
Comparing with <math> v_2 </math>:
 
<math> \cos(v_1, v_2) = \frac{-2}{\sqrt{14}} \approx -0.535 </math>
 
Since <math> 0.058 > -0.535 </math>, <math> v_3 </math> is more similar to <math> v_1 </math> than <math> v_2 </math>.
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 9.10 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
=== Question ===
You are given an image of a handwritten mathematical equation, and your task is to build a system that converts the handwritten equation into a LaTeX representation using a Seq2Seq model with attention.
The input to the system is an image of a handwritten equation.
The encoder extracts visual features from the image.
The decoder generates the corresponding LaTeX sequence.
The attention mechanism helps the decoder focus on specific parts of the image while generating each LaTeX symbol.
 
 
Questions:
(a) Explain why a standard Seq2Seq model (without attention) might struggle with this task.
 
(b) How does attention improve the performance of the decoder in this problem?
 
(c) Suppose the model outputs an incorrect LaTeX sequence. How can visualizing the attention weights help debug the issue?
 
=== Solution===
(a) A standard Seq2Seq model without attention processes the entire image into a fixed-length vector representation. This compressed representation may lose important spatial details, making it difficult for the decoder to accurately generate long and complex LaTeX expressions. Also, handwritten equations exhibit significant variability in stroke styles, spacing, and distortions. Without attention, the model has to rely solely on the compressed representation, which may not capture these variations effectively.
 
(b) Attention allows the decoder to dynamically focus on different parts of the image at each decoding step. Instead of relying on a single fixed representation, the decoder attends to the most relevant regions of the image when predicting each LaTeX token, leading to better accuracy.
 
(c) Visualizing attention weights can help identify which regions of the image the model is focusing on while generating each LaTeX token. If the model misinterprets a character, checking the attention heatmap can reveal whether it was looking at the wrong part of the image. This can guide improvements, such as refining the attention mechanism or preprocessing the images differently.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 9.11 ==
 
<b>Level:</b> ** (Moderate)
 
<b>Reference:</b> Novel
 
=== Question ===
 
Consider a sequence-to-sequence model with attention for machine translation. The attention mechanism computes a weighted sum of encoder hidden states to form the context vector for each decoder step. The attention weights are calculated using the softmax function applied to the similarity scores between the decoder state and encoder hidden states:
 
<math> a_{tj} = \frac{\exp(s(h_j, s_t))}{\sum_{j'} \exp(s(h_{j'}, s_t))} </math>
 
where <math> s(h_j, s_t) </math> is a similarity function, commonly defined as a dot product, additive function, or scaled dot product.
 
Conceptual: Explain why attention improves long-range dependency handling compared to a standard sequence-to-sequence model without attention.
 
Computational: Given the encoder hidden states
 
<math> h_1 = [0.2, 0.5], \quad h_2 = [0.3, 0.1] </math>
 
and the decoder hidden state
 
<math> s_1 = [0.4, 0.2] </math>,
 
compute the attention weights using the dot product similarity function.
 
=== Solution ===
 
Conceptual Answer
Attention improves long-range dependency handling by dynamically weighting the importance of different encoder hidden states during each decoding step. Without attention, the decoder relies solely on the final hidden state of the encoder, which may lose crucial information from earlier timesteps. With attention, the model can selectively focus on relevant past states, mitigating information bottlenecks and reducing vanishing gradient effects in deep networks.
 
Computational Answer
Using the dot product similarity function, the attention scores are computed as:
 
<math> s(h_j, s_t) = h_j \cdot s_t </math>
 
For each encoder hidden state:
 
<math> s(h_1, s_1) = (0.2 \times 0.4) + (0.5 \times 0.2) = 0.08 + 0.10 = 0.18 </math>
 
<math> s(h_2, s_1) = (0.3 \times 0.4) + (0.1 \times 0.2) = 0.12 + 0.02 = 0.14 </math>
 
Applying the softmax function:
 
<math> a_{t1} = \frac{\exp(0.18)}{\exp(0.18) + \exp(0.14)} </math>
 
<math> a_{t2} = \frac{\exp(0.14)}{\exp(0.18) + \exp(0.14)} </math>
 
Approximating exponentials:
 
<math> \exp(0.18) \approx 1.197, \quad \exp(0.14) \approx 1.150 </math>
 
<math> a_{t1} \approx \frac{1.197}{1.197 + 1.150} = \frac{1.197}{2.347} \approx 0.51 </math>
 
<math> a_{t2} \approx \frac{1.150}{2.347} \approx 0.49 </math>
 
Thus, the attention weights are:
 
<math> a_{t1} \approx 0.51, \quad a_{t2} \approx 0.49 </math>
 
These values indicate that the decoder slightly favors the first hidden state over the second when forming the context vector for translation.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 9.12 ==
 
<b>Level:</b> ** (Easy)
 
<b>Reference:</b> Novel
 
=== Question ===
 
This question is relatively simple, but will serve as an additional example of the Query Approximations and SoftMax function applications, and will hopefully reinforce the concepts. Given the following keys and values (which are non linear in nature), approximate the query key <math> Q = 170 </math>. What properties do the SoftMax alpha coefficients have? Is this a reasonable approximation?
 
<math> k_1 = \frac{1}{90} \quad k_2 = \frac{1}{150} \quad k_3 = \frac{1}{200} </math>
<math> v_1 = 55 \quad v_2 = 70 \quad v_3 = 100 </math>
 
=== Solution ===
 
Let us begin by calculating the similarities of each key and the query: <math> \frac{1}{|Q - k_i|} </math>
 
<math> k_1 \implies \frac{1}{|170 - 80|} = \frac{1}{90} </math>
<math> k_2 \implies \frac{1}{|170 - 150|} = \frac{1}{20} </math>
<math> k_3 \implies \frac{1}{|170 - 200|} = \frac{1}{30} </math>
 
Now, let us calculate the SoftMax of each similarities: <math> s(v_i) = \frac{e^{v_i}}{\sum_i e^{v_i}} </math>
 
<math> \alpha_1 \implies \frac{e^{1/90}}{e^{1/90} + e^{1/20} + e^{1/30}} = .3266 </math>
<math> \alpha_2 \implies \frac{e^{1/20}}{e^{1/90} + e^{1/20} + e^{1/30}} = .3395 </math>
<math> \alpha_3 \implies \frac{e^{1/30}}{e^{1/90} + e^{1/20} + e^{1/30}} = .3339 </math>
 
<math> \alpha_1 + \alpha_2 + \alpha_3 = 1 </math>
 
Now, let us calculate the query approximation:
<math> \alpha_1 * v_1 + \alpha_2 * v_2 + \alpha_3 * v_3 = 55*.3266 + 70*.3395 + 100*.3339 = 75.1187 </math>
 
 
Now, we can effectively conclude that this is indeed a good approximation. Moreover, the SoftMax function holds its sum to unit property even in the case of non-linear Key-Values relations.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
== Exercise 9.13 ==
 
<b>Level:</b> * (Easy)
 
<b>Reference:</b> Novel
 
=== Question ===
 
What is the role of the Self-Attention in the Transformer model and why is it more suitable than traditional RNN in terms of long sequence data?
 
=== Solution ===
 
The self-attention mechanism is used to calculate the relationship of each element in the input sequence to the other elements, thus capturing global dependencies. This mechanism allows Transformer to consider all elements of a sequence at the same time, rather than relying on step-by-step calculations like RNNS.
 
Compared with RNN, Transformer has the advantages of
 
1. Stronger interpretability: The influence of input parts on the model can be observed through the distribution of attention.
 
2. Higher computing efficiency: RNN needs to be calculated step by step while Transformer can be calculated in parallel. Thus, transformer can capture global dependencies more efficiently.
 
3. Better focus on long-distance information: RNN has gradient disappearance problem is difficult to capture long-distance information, but self-attention can directly consider the global information. Self-attention mechanisms provide a way for each token to focus on relevant words irrespective of their position.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 9.14 ==
 
<b>Level:</b>  * (Easy)
 
<b>Exercise Types:</b> Modified
 
<b>Reference:</b> Modified, STAT 940 Lecture Notes, Lecture 9, Ali Ghodsi, Winter 2025
 
=== Question ===
 
Consider a machine translation task where the phrase “European Economic Area” is translated into French as “zone économique européenne.”
 
(a) Describe how the attention mechanism would likely align words between the source and target languages in this case.
 
(b) How does this alignment impact the generated translation?
 
(c) Given the softmax-based attention mechanism, calculate the attention weight <math> \( a_{ij} \) </math> for the i-th target word given the j-th source word using the formula:
 
<math>
\begin{align}
a_{ij} = \frac{e^{s_{ij}}}{\sum_k e^{s_{ik}}}
\end{align}
</math>
 
Assume the similarity scores \( s_{ij} \) between the hidden state of the i-th target word and the j-th source word are:
 
<math>
s =
\begin{bmatrix}
2.5 & 1.2 & 0.8 \
1.0 & 2.2 & 1.8 \
0.9 & 1.5 & 2.0
\end{bmatrix}
</math>
 
where rows correspond to target words ("Zone", "économique", "européenne") and columns correspond to source words ("The", "European", "Economic Area").
 
 
=== Solution ===
 
(a)
 
In a standard sequence-to-sequence model without attention, the decoder generates words sequentially, relying only on the final context vector produced by the encoder. This can lead to loss of information, especially for long sentences.
With the attention mechanism, the model learns to assign weights to different parts of the input sequence while generating each output word. This helps it focus on the most relevant words at each decoding step.
For example, in translating “European Economic Area” into French “zone économique européenne”, the attention mechanism learns to align:
 
- 'European' with 'européenne'
 
- 'Economic' with 'économique'
 
- 'Area' with 'zone'
 
 
Since the word order in French differs from English, the attention mechanism dynamically shifts focus to the correct word at each step.
 
(b)
 
The attention mechanism ensures that words are placed in the correct order according to the target language’s syntax. Without attention, the model might generate incorrect word order or lose important details due to fixed-length context vectors.
With attention, each output word is generated based on the most relevant parts of the input sequence, leading to accurate translations that preserve meaning and grammatical structure.
For the translation of ''European Economic Area'':
 
- The attention mechanism recognizes that ''European'' comes last in French.
 
- It correctly generates ''zone économique européenne'' instead of a direct word-for-word translation.
 
Thus, attention allows the model to adapt dynamically to word reordering, improve fluency, and ensure meaning is accurately transferred across languages.
 
 
(c)
 
To compute the attention weights <math> a_{ij} </math>, we use the softmax formula:
 
<math>
\begin{align}
a_{ij} = \frac{e^{s_{ij}}}{\sum_k e^{s_{ik}}}
\end{align}
</math>
 
 
For the first row:
 
<math>
\begin{align}
e^{2.5} \approx 12.18, \quad
e^{1.2} \approx 3.32, \quad
e^{0.8} \approx 2.23
\end{align}
</math>
 
Sum of exponentials:
 
<math>
\begin{align}
12.18 + 3.32 + 2.23 = 17.73
\end{align}
</math>
 
Compute individual attention weights:
 
<math>
\begin{align}
a_{11} = \frac{12.18}{17.73} \approx 0.69, \quad
a_{12} = \frac{3.32}{17.73} \approx 0.19, \quad
a_{13} = \frac{2.23}{17.73} \approx 0.13
\end{align}
</math>
 
For the second row:
 
<math>
\begin{align}
e^{1.0} \approx 2.72, \quad
e^{2.2} \approx 9.03, \quad
e^{1.8} \approx 6.05
\end{align}
</math>
 
Sum:
 
<math>
\begin{align}
2.72 + 9.03 + 6.05 = 17.80
\end{align}
</math>
 
Attention weights:
 
<math>
\begin{align}
a_{21} = \frac{2.72}{17.80} \approx 0.15, \quad
a_{22} = \frac{9.03}{17.80} \approx 0.51, \quad
a_{23} = \frac{6.05}{17.80} \approx 0.34
\end{align}
</math>
 
For the third row:
 
<math>
\begin{align}
e^{0.9} \approx 2.46, \quad
e^{1.5} \approx 4.48, \quad
e^{2.0} \approx 7.39
\end{align}
</math>
 
Sum:
 
<math>
\begin{align}
2.46 + 4.48 + 7.39 = 14.33
\end{align}
</math>
 
Attention weights:
 
<math>
\begin{align}
a_{31} = \frac{2.46}{14.33} \approx 0.17, \quad
a_{32} = \frac{4.48}{14.33} \approx 0.31, \quad
a_{33} = \frac{7.39}{14.33} \approx 0.52
\end{align}
</math>
 
<math>
\begin{bmatrix}
0.69 & 0.19 & 0.13 \
0.15 & 0.51 & 0.34 \
0.17 & 0.31 & 0.52
\end{bmatrix}
</math>
 
This matrix represents the attention weights, where each row sums to 1 and indicates how much each source word contributes to the target words.
 
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 9.15 ==
 
<b>Level:</b>  * (Easy)
 
<b>Exercise Types:</b> Modified
 
<b>Reference:</b> Deep Learning - Foundations and Concepts, by Christopher M. Bishop and Hugh Bishop. Exercise 12.2
 
=== Question ===
Show that the softmax function <math>a_{nm}=\frac{exp(X_n^TX_m)}{\sum_{i=1}^N exp(X_n^T X_i)}</math> satisfies
 
<math>\begin{align}
a_{nm}\geq 0 \
\sum_{m=1}^N a_{nm} = 1
\end{align}</math>
 
=== Solution ===
 
Note that the exponential function is non-negative, so the first condition is trivial. For the second condition
 
<math>\begin{align}
 
\sum_{m=1}^N a_{nm} &= \sum_{m=1}^N  \frac{exp(X_n^TX_m)}{\sum_{i=1}^N exp(X_n^T X_i)}\
&= \frac{\sum_{m=1}^N exp(X_n^TX_m)}{\sum_{i=1}^N exp(X_n^T X_i)} = 1
\end{align}</math> 
 
as desired.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
 
== Exercise 9.16 ==
 
<b>Level:</b>  * (Easy)
 
<b>Exercise Types:</b> Modified
 
===Question===
Consider a Recurrent Neural Network (RNN) model with a hidden state of size <i>h</i>.<br>
<b>(a)</b> Derive the dimensions of the hidden state and the output at each time step for an RNN model.<br>
<b>(b)</b> If we increase the number of layers in the RNN from <i>L = 1</i> to <i>L = 2</i>, explain how this affects the computational cost and the model's ability to capture long-term dependencies.<br>
<b>(c)</b> If the sequence length <i>n</i> increases from <i>n = 50</i> to <i>n = 100</i>, how does this affect the size of the weight matrices and the computational cost?<br>
===Solution===
 
<b>(a)</b> In an RNN, at each time step <i>t</i>, the hidden state <i>h<sub>t</sub></i> is updated based on the previous hidden state <i>h<sub>t-1</sub></i> and the input at time step <i>x<sub>t</sub></i>. The hidden state <i>h<sub>t</sub></i> has shape <i>(h)</i>, where <i>h</i> is the size of the hidden state. The output <i>y<sub>t</sub></i> at each time step has shape <i>(o)</i>, where <i>o</i> is the output dimension.<br>
 
Thus, the hidden state and the output at each time step have shapes:<br>
- Hidden state: <i>h<sub>t</sub> &in; ℝ<sup>h</sup></i><br>
- Output: <i>y<sub>t</sub> &in; ℝ<sup>o</sup></i><br>
<b>(b)</b> Increasing the number of layers <i>L</i> in the RNN allows the model to learn more complex representations of the sequence, capturing higher-level abstractions. However, this also increases the computational cost, as more matrix multiplications and hidden state updates are needed. The model's ability to capture long-term dependencies improves with more layers, but there is also an increased risk of vanishing or exploding gradients, especially for deeper networks.<br>
<b>(c)</b> The weight matrices in the RNN model include <i>W<sub>hh</sub></i> (size <i>h × h</i>) and <i>W<sub>xh</sub></i> (size <i>d × h</i>), where <i>d</i> is the input dimension. When the sequence length <i>n</i> increases from 50 to 100, the size of the weight matrices remains unchanged, but the number of time steps the RNN must process increases.<br>
Computing the hidden state at each time step involves matrix multiplications, and the computational cost for each time step is proportional to <i>O(h² + dh)</i> (depending on whether the input <i>x<sub>t</sub></i> or hidden state <i>h<sub>t</sub></i> is dominant).<br>
Thus, the total computational cost for processing a sequence of length <i>n</i> is proportional to <i>O(n ⋅ (h² + dh))</i>.<br>
When <i>n = 50</i>, the cost is proportional to <i>50 ⋅ (h² + dh)</i>, and when <i>n = 100</i>, the cost is proportional to <i>100 ⋅ (h² + dh)</i>. The computational cost increases by a factor of 2.
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 9.17 ==
 
<b>Level:</b>  * (Easy)
 
<b>Exercise Types:</b> Novel
 
===Question===
In the Attention Mechanism, attention scores <math>a_{ij}</math> are computed based on the similarity between query vectors and key vectors.These scores are used to compute a weighted sum over the value vectors to form the context vector <math>c_i</math>.
 
1. Computing Attention Scores: Given a query vector q and a set of key vectors K = {k1, k2, k3}, compute similarity using dot product: si = q * ki; and compute the attention weights: <math> a_i = \frac{\exp(s_i)}{\sum_j \exp(s_j)} </math>.
 
If: q = [1,2], k1 = [2,1], k2 = [0,1], k3 = [1,1], compute s1, s2, s3 and corresponding attention weights a1, a2, a3.
 
2. Computing the Context Vector: given the value vector set: V = {v1,v2,v3}, v1 = [1,0], v2 = [0,2], v3 = [1,1], compute the context vector: <math> c = \sum_i a_iv_i </math>
 
===Solution===
<b>1. Computing Attention Scores </b>
 
(a) Compute Dot-Product Similarity
 
<math> s_1 = q \cdot k_1 = (1,2) \cdot (2,1) = 1 \times 2 + 2 \times 1 = 4 </math>
 
<math> s_2 = q \cdot k_2 = (1,2) \cdot (0,1) = 1 \times 0 + 2 \times 1 = 2 </math>
 
<math> s_3 = q \cdot k_3 = (1,2) \cdot (1,1) = 1 \times 1 + 2 \times 1 = 3 </math>
 
(b) Compute Softmax Attention Weights
 
<math> a_i = \frac{\exp(s_i)}{\sum_j \exp(s_j)} </math>
 
Compute exponentials: <math> \exp(4) \approx 54.60, \quad \exp(2) \approx 7.39, \quad \exp(3) \approx 20.09 </math>
 
Compute normalization denominator: <math> Z = \exp(4) + \exp(2) + \exp(3) = 54.60 + 7.39 + 20.09 = 82.08 </math>
 
Compute attention weights:
 
<math> a_1 = \frac{54.60}{82.08} \approx 0.6652, \quad </math>
<math> a_2 = \frac{7.39}{82.08} \approx 0.0900, \quad </math>
<math> a_3 = \frac{20.09}{82.08} \approx 0.2448 </math>
 
<b>2. Computing the Context Vector </b>
 
<math> c = \sum_{i} a_i v_i </math>
 
<math> c = (0.6652 \times [1, 0]) + (0.0900 \times [0, 2]) + (0.2448 \times [1, 1]) </math>
 
<math> c = [0.6652, 0] + [0, 0.1800] + [0.2448, 0.2448] </math>
 
<math> c = [0.91, 0.42] </math>
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 9.18 ==
 
<b>Level:</b>  * (Easy)
 
<b>Exercise Types:</b> Novel
 
===Question===
In a standard sequence-to-sequence (Seq2Seq) model for tasks like machine translation, we often face difficulties when trying to deal with long input sequences. How does adding an attention mechanism help the decoder focus on the most relevant parts of the encoder output at each step, and why does this improve performance compared to a Seq2Seq model without attention?
===Solution===
In a traditional Seq2Seq model (without attention), we have an encoder (often an RNN) that processes the input sequence to produce a final hidden state (or context vector). However, as the input sequence gets longer, it becomes increasingly difficult for the model to encode all relevant information into one fixed-dimensional vector, leading to potential loss of important context and degraded performance.
Attention addresses the bottleneck of a single context vector by allowing the decoder to have direct access to all encoder hidden states rather than only the last one. Each encoder hidden state can be seen as a representation of the input token along with its context in the sequence. At every decoding step, the model learns attention weights that indicate how relevant each encoder hidden state is to predict the next output token. Thus, this improves performance in terms of its ability to handle long sequences and to provide better interpretabilities.
 
The <b>attention mechanism</b> addresses this bottleneck by allowing the decoder to dynamically focus on different parts of the encoder’s output at each decoding step. Instead of relying only on the final context vector, attention gives the decoder access to all encoder hidden states, treating them as a weighted sum where the weights are learned dynamically for each time step.
This is achieved through the following steps:
<ul>
    <li> At each decoding step, the decoder computes alignment scores between the current decoder state and each encoder hidden state. These scores measure the relevance of each encoder state to the current decoding step.<uli>
      <li> The alignment scores are then normalized using a softmax function, producing a set of attention weights that sum to 1.</li>
      <li>The decoder uses these weights to compute a context vector, which is a weighted sum of all encoder hidden states. </li>
      <li>This context vector is then combined with the decoder’s current state to generate the next output token.</li>
</ul>
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 9.19 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
 
Use Python to implement a simplified self-attention layer. Assume the input is a matrix
 
<math>x \in R^{n * d}</math>
 
Implement self-attention using PyTorch:
 
Compute Q, K, V (obtained through learnable linear transformations).
Compute attention weights and apply them to the value vectors.
 
=== Solution===
 
<pre>
import torch
import torch.nn.functional as F
</pre>
 
<pre>
class SelfAttention(torch.nn.Module):
    def __init__(self, d_model):
        super().__init__()
        self.W_q = torch.nn.Linear(d_model, d_model)
        self.W_k = torch.nn.Linear(d_model, d_model)
        self.W_v = torch.nn.Linear(d_model, d_model)
 
    def forward(self, X):
        Q = self.W_q(X)
        K = self.W_k(X)
        V = self.W_v(X)
 
        scores = torch.matmul(Q, K.T) / (X.shape[1] ** 0.5)
        attn_weights = F.softmax(scores, dim=-1)
        output = torch.matmul(attn_weights, V)
       
        return output
 
X = torch.tensor([[1.0, 0.0, 2.0], [0.5, 1.5, -1.0]])
attention_layer = SelfAttention(d_model=3)
output = attention_layer(X)
print(output)
</pre>
 
The output is:
<pre>
tensor([[-0.4841,  0.1482, -0.1839],
        [-0.3213,  0.7625,  0.4199]], grad_fn=<MmBackward0>)
</pre>
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 9.20 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
 
How does the attention mechanism help overcome the limitations of traditional sequence models like RNNs and LSTMs in handling long-range dependencies?
 
=== Solution===
 
The attention mechanism addresses the limitations of traditional sequence models like RNNs and LSTMs by allowing the model to directly focus on relevant parts of the input sequence, regardless of their distance from the current position. In RNNs and LSTMs, information must be passed sequentially through hidden states, making it difficult to capture long-range dependencies due to vanishing gradients and memory constraints. As a result, these models struggle with long sentences or complex relationships between words that are far apart.
 
In contrast, attention mechanisms, particularly self-attention in Transformers, compute contextual relationships between all words in a sequence simultaneously. This eliminates the need for sequential processing, enabling direct connections between distant words and significantly improving the retention of long-range dependencies. Furthermore, attention mechanisms can dynamically adjust their focus based on contextual importance, making them more flexible and interpretable. By leveraging parallel computation and reducing reliance on recurrent connections, attention-based architectures achieve better performance in tasks such as language modeling, machine translation, and text generation, where capturing global context is essential.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
== Exercise 9.21 ==
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Copied with modifications
 
'''References:''' https://machinelearningmastery.com/the-attention-mechanism-from-scratch/
 
=== Question ===
Write a Python code to demonstrate the general attention mechanism using NumPy and SciPy libraries in Python. For simplicity, you will initially calculate the attention for the first word in a sequence of four. You will then generalize the code to calculate an attention output for all four words in matrix form.
=== Solution===
Let’s start by defining the word embeddings of the four different words to calculate the attention. In actual practice, these word embeddings would have been generated by an encoder; however, for this particular example, you will define them manually.
<pre>
# encoder representations of four different words
word_1 = array([1, 0, 0])
word_2 = array([0, 1, 0])
word_3 = array([1, 1, 0])
word_4 = array([0, 0, 1])
</pre>
Next, generate the weight matrices randomly. In actual practice, these would have been learned during training.
<pre>
# generating the weight matrices
random.seed(42)  # to allow reproducibility
W_Q = random.randint(3, size=(3, 3))
W_K = random.randint(3, size=(3, 3))
W_V = random.randint(3, size=(3, 3))
</pre>
Generate the queries, keys, and values:
<pre>
# generating the queries, keys, and values
query_1 = word_1 @ W_Q
key_1 = word_1 @ W_K
value_1 = word_1 @ W_V
query_2 = word_2 @ W_Q
key_2 = word_2 @ W_K
value_2 = word_2 @ W_V
query_3 = word_3 @ W_Q
key_3 = word_3 @ W_K
value_3 = word_3 @ W_V
query_4 = word_4 @ W_Q
key_4 = word_4 @ W_K
value_4 = word_4 @ W_V
</pre>
Now, score the first query vector against all key vectors using the dot product operation.
<pre>
# scoring the first query vector against all key vectors
scores = array([dot(query_1, key_1), dot(query_1, key_2), dot(query_1, key_3), dot(query_1, key_4)])
</pre>
The score values are subsequently passed through a softmax operation to generate the weights. Before doing so, it is common practice to divide the score values by the square root of the dimensionality of the key vectors (in this case, three) to keep the gradients stable.
<pre>
# computing the weights using a softmax operation
weights = softmax(scores / key_1.shape[0] ** 0.5)
print("Attention Weights:", weights)
</pre>
Finally, compute the attention output by a weighted sum of all four value vectors.
<pre>
# computing the attention output
attention = (weights[0] * value_1) + (weights[1] * value_2) + (weights[2] * value_3) + (weights[3] * value_4)
print("Attention Output:", attention)
</pre>
For faster processing, the same calculations can be implemented in matrix form to generate an attention output for all four words in one go:
<pre>
from numpy import array, random, dot
from scipy.special import softmax
# encoder representations of four different words
word_1 = array([1, 0, 0])
word_2 = array([0, 1, 0])
word_3 = array([1, 1, 0])
word_4 = array([0, 0, 1])
# stacking the word embeddings into a single array
words = array([word_1, word_2, word_3, word_4])
# generating the weight matrices
random.seed(42)
W_Q = random.randint(3, size=(3, 3))
W_K = random.randint(3, size=(3, 3))
W_V = random.randint(3, size=(3, 3))
# generating the queries, keys, and values
Q = words @ W_Q
K = words @ W_K
V = words @ W_V
# scoring the query vectors against all key vectors
scores = Q @ K.transpose()
# computing the weights using a softmax operation
weights = softmax(scores / K.shape[1] ** 0.5, axis=1)
# computing the attention output
attention = weights @ V
print("Attention Output:\n", attention)
</pre>
 
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 9.21 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Copied with modifications
 
'''References:''' https://machinelearningmastery.com/the-attention-mechanism-from-scratch/
 
=== Question ===
Write a Python code to demonstrate the general attention mechanism using NumPy and SciPy libraries in Python. For simplicity, you will initially calculate the attention for the first word in a sequence of four. You will then generalize the code to calculate an attention output for all four words in matrix form.
 
=== Solution===
 
Let’s start by defining the word embeddings of the four different words to calculate the attention. In actual practice, these word embeddings would have been generated by an encoder; however, for this particular example, you will define them manually.
 
<pre>
# encoder representations of four different words
word_1 = array([1, 0, 0])
word_2 = array([0, 1, 0])
word_3 = array([1, 1, 0])
word_4 = array([0, 0, 1])
</pre>
 
Next, generate the weight matrices randomly. In actual practice, these would have been learned during training.
 
<pre>
# generating the weight matrices
random.seed(42)  # to allow reproducibility
W_Q = random.randint(3, size=(3, 3))
W_K = random.randint(3, size=(3, 3))
W_V = random.randint(3, size=(3, 3))
</pre>
 
Generate the queries, keys, and values:
 
<pre>
# generating the queries, keys, and values
query_1 = word_1 @ W_Q
key_1 = word_1 @ W_K
value_1 = word_1 @ W_V
 
query_2 = word_2 @ W_Q
key_2 = word_2 @ W_K
value_2 = word_2 @ W_V
 
query_3 = word_3 @ W_Q
key_3 = word_3 @ W_K
value_3 = word_3 @ W_V
 
query_4 = word_4 @ W_Q
key_4 = word_4 @ W_K
value_4 = word_4 @ W_V
</pre>
 
Now, score the first query vector against all key vectors using the dot product operation.
 
<pre>
# scoring the first query vector against all key vectors
scores = array([dot(query_1, key_1), dot(query_1, key_2), dot(query_1, key_3), dot(query_1, key_4)])
</pre>
 
The score values are subsequently passed through a softmax operation to generate the weights. Before doing so, it is common practice to divide the score values by the square root of the dimensionality of the key vectors (in this case, three) to keep the gradients stable.
 
<pre>
# computing the weights using a softmax operation
weights = softmax(scores / key_1.shape[0] ** 0.5)
 
print("Attention Weights:", weights)
</pre>
 
Finally, compute the attention output by a weighted sum of all four value vectors.
 
<pre>
# computing the attention output
attention = (weights[0] * value_1) + (weights[1] * value_2) + (weights[2] * value_3) + (weights[3] * value_4)
 
print("Attention Output:", attention)
</pre>
 
For faster processing, the same calculations can be implemented in matrix form to generate an attention output for all four words in one go:
 
<pre>
from numpy import array, random, dot
from scipy.special import softmax
 
# encoder representations of four different words
word_1 = array([1, 0, 0])
word_2 = array([0, 1, 0])
word_3 = array([1, 1, 0])
word_4 = array([0, 0, 1])
 
# stacking the word embeddings into a single array
words = array([word_1, word_2, word_3, word_4])
 
# generating the weight matrices
random.seed(42)
W_Q = random.randint(3, size=(3, 3))
W_K = random.randint(3, size=(3, 3))
W_V = random.randint(3, size=(3, 3))
 
# generating the queries, keys, and values
Q = words @ W_Q
K = words @ W_K
V = words @ W_V
 
# scoring the query vectors against all key vectors
scores = Q @ K.transpose()
 
# computing the weights using a softmax operation
weights = softmax(scores / K.shape[1] ** 0.5, axis=1)
 
# computing the attention output
attention = weights @ V
 
print("Attention Output:\n", attention)
</pre>
 
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.1 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
A Transformer does not inherently understand word order. Positional encoding helps provide information about sequence position.
 
Given the positional encoding formula:
<math>PE_{(pos, 2i)} = \sin \left( \frac{pos}{10000^{2i/d}} \right)</math>, <math>PE_{(pos, 2i+1)} = \cos \left( \frac{pos}{10000^{2i/d}} \right)</math>
 
1. Compute the positional encoding for position 3 with an embedding size of 4.
 
2. What happens if we remove positional encodings from a Transformer model?
 
3. How would the positional encoding change if we used a larger embedding size (e.g., 6 instead of 4)?
 
=== Solution===
 
1. For the first pair we can compute as follows:
<math>PE_{(3,0)} = \sin(3/1) = \sin(3) \approx 0.1411</math>,
<math>PE_{(3,1)} = \cos(3/1) = \cos(3) \approx -0.9899</math>.
 
For the second pair we also have:
<math>PE_{(3,2)} = \sin(3/100) = \sin(0.03) \approx 0.03</math>,
<math>PE_{(3,3)} = \cos(3/100) = \cos(0.03) \approx 0.9996</math>.
 
Therefore, final positional encoding vector for <math>pos = 3</math>, <math>d = 4</math> is
<math>PE(3) = [0.1411, -0.9899, 0.03, 0.9996]</math>.
 
2. If we remove positional encodings, the Transformer loses its ability to distinguish word order, leading to the following issues:
 
(i) Loss of Sequential Information: Since self-attention treats all tokens equally (it's permutation-invariant), the model wouldn’t know if "The cat caught the fish" or "The fish caught the cat" are different sentences.
 
(ii) Poor Performance in NLP Tasks: Many NLP tasks require word order understanding, without positional encoding, performance in these tasks would degrade significantly.
 
(iii) Attention Weights Become Meaningless for Order-Sensitive Tasks: The attention mechanism would still learn token relationships but wouldn’t understand which token comes before or after. This makes tasks like language modelling (predicting the next word) much harder.
 
3. When using a larger embedding size, the positional encoding formula applies more dimensions for the position encoding. In the case of <math>d = 6</math>, the positional encoding will be calculated for 6 values instead of 4, using the same sine and cosine functions for higher dimensions. This allows the model to represent richer, more granular information about the relative positions of tokens.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.2 ==
 
'''Level:''' **(Moderate)
 
'''Exercise Types:''' Novel
 
===Question===
'''1. Why does a Transformer use attention instead of just processing words sequentially like RNNs?'''
 
'''2. What is the purpose of multi-head attention?'''
 
'''3. Why do we need positional encoding in a Transformer model?'''
 
=== Solution ===
'''1.
Transformers use attention because it allows them to process all words in a sentence at the same time instead of sequentially. This enables faster training and better handling of long-range dependencies, where words that are far apart in a sentence can still influence each other effectively. In contrast, RNNs struggle with vanishing gradients, making it difficult for them to retain information across long sequences.
 
'''2.
Multi-head attention allows the model to focus on different aspects of the sentence at the same time. Each attention head captures different types of relationships between words, helping the model learn richer and more complex representations. By combining multiple perspectives, the model forms richer, more robust representations of the input sequence, which improves performance on tasks like translation and text generation.It also allows parallelization and makes computation more efficient.
 
'''3.
Since Transformers do not process words sequentially like RNNs, they need a way to know the order of words in a sentence. Positional encoding adds information about word positions, enabling the model to understand word order and meaning within the sequence. Unlike learned position embeddings, which introduce additional trainable parameters, sinusoidal encodings allow the model to generalize better to longer sequences not seen during training.
 
=== Additional comments ===
For question 1, I would say rather than simply processing all words in a sentence at the same time, the biggest strength of attention is the fact that it is a changing weighted average, rather than just an average. This allows the model to be able to focus more on some words rather than others depending on the situation.
 
=== Question ===
Compute the softmax probabilities for the following attention scores:
 
<math>s_1 = 2, s_2 = 1, s_3 = 0.</math>
 
=== Solution ===
 
Softmax function:
 
<math>a_i = \frac{e^{s_i}}{\sum_{j} e^{s_j}}</math>
 
Computing exponentials:
 
<math>e^{s_1} = e^2 \approx 7.389, e^{s_2} = e^1 \approx 2.718, e^{s_3} = e^0 = 1.</math>
 
Summing these:
 
<math>\sum_{j} e^{s_j} = 7.389 + 2.718 + 1 = 11.107.</math>
 
Thus, the probabilities are:
 
<math>a_1 = \frac{7.389}{11.107} \approx 0.665, a_2 = \frac{2.718}{11.107} \approx 0.245, a_3 = \frac{1}{11.107} \approx 0.090.</math>
 
=== Question ===
Given:
 
<math>Q = [12], K = [34], V = [56],</math>
 
compute the attention-weighted value using dot-product attention.
 
=== Solution ===
 
Dot-product attention score:
 
<math>s = Q^T K = [12] [34] = (1)(3) + (2)(4) = 3 + 8 = 11.</math>
 
Attention weight (assuming a single score):
 
<math>a = \frac{e^{11}}{e^{11}} = 1.</math>
 
Weighted value:
 
<math>a V = 1 \cdot [56] = [56].</math>
 
 
 
 
=== Question ===
A Transformer does not inherently understand word order. Positional encoding helps provide information about sequence position.
 
Given the positional encoding formula:
 
<math>PE_{(pos, 2i)} = \sin \left( \frac{pos}{10000^{2i/d}} \right)</math>,
<math>PE_{(pos, 2i+1)} = \cos \left( \frac{pos}{10000^{2i/d}} \right)</math>
 
1. Compute the positional encoding for position 10 with an embedding size of 512.
 
2. What happens if we remove positional encodings from a Transformer model?
 
=== Solution ===
 
1. For <math>pos = 10</math>, <math>d = 512</math>, and <math>i = 5</math>, compute:
 
<math>10000^{2(5)/512} = 10000^{10/512} = 10000^{0.0195} \approx 1.4678.</math>
 
Thus,
 
<math>PE(10, 2(5)) = \sin \left( \frac{10}{1.4678} \right) = \sin(6.816) \approx 0.480.</math>
 
<math>PE(10, 2(5) + 1) = \cos \left( \frac{10}{1.4678} \right) = \cos(6.816) \approx 0.877.</math>
 
Final positional encoding vector:
 
<math>PE(10) = [0.480, 0.877].</math>
 
2. If we remove positional encodings, the Transformer loses its ability to distinguish word order, leading to:
 
(i) **Loss of Sequential Information**: Since self-attention treats all tokens equally, the model wouldn’t know if "The cat caught the fish" or "The fish caught the cat" are different sentences.
 
(ii) **Poor Performance in NLP Tasks**: Many NLP tasks require word order understanding, without positional encoding, performance in these tasks would degrade significantly.
 
(iii) **Attention Weights Become Meaningless for Order-Sensitive Tasks**: The attention mechanism would still learn token relationships but wouldn’t understand which token comes before or after. This makes tasks like language modelling (predicting the next word) much harder.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.3 ==
 
<b>Level:</b> ** (Moderate)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
A transformer model consists of multiple encoder and decoder layers, where each encoder layer contains a self-attention mechanism and a feed-forward network (FFN).
 
(a) Explain the purpose of layer normalization in transformer models. Where is it applied within the encoder and decoder layers?
 
(b) For a transformer with N = 6 encoder layers, if the input sequence has a length of T = 50 and an embedding dimension of d_model = 512, calculate the number of parameters required for the multi-head self-attention layer in one encoder, assuming h = 8 attention heads.
 
(c) Explain how the residual connections affect gradient flow in deep transformer models.
 
=== Solution ===
(a) Layer normalization is used to stabilize training and improve convergence by normalizing activations across features. It is applied before the self-attention and feed-forward layers in each encoder and decoder block. Unlike batch normalization, it does not depend on the batch size and works well for sequential data.
 
(b) Each attention head requires three weight matrices: <math>W_Q, W_K, W_V</math> of shape <math>(d_{\text{model}} \times d_k)</math>. Since <math>d_k = d_{\text{model}}</math> / h = 512 / 8 = 64, each matrix has 512 × 64 = 32,768 parameters. With 8 heads, the total number of parameters is 3 x 32,768 x 8 = 786,432. Additionally, there is an output projection matrix <math> W_O </math> of shape <math> (d_{\text{model}} \times d_{\text{model}}) </math>, contributing another 262,144 parameters. Therefore, the total number of parameters in the multi-head self-attention layer of one encoder block is 1,048,576.
 
(c) Residual connections help combat vanishing gradients by allowing gradients to flow directly through layers. This enables better optimization in deep transformers, preventing degradation of performance as the model depth increases. It is essential for stabilizing training, improving convergence, and enabling deeper models to learn complex representations effectively.
 
 
=== Extended Question ===
(d) In a transformer model, positional encoding is used to introduce order information into the input sequence. Given the sine-cosine positional encoding formula:
 
<math> PE(pos, 2i) = \sin \left(\frac{pos}{10000^{2i/d_{\text{model}}}} \right) </math>
 
<math> PE(pos, 2i+1) = \cos \left(\frac{pos}{10000^{2i/d_{\text{model}}}} \right) </math>
 
explain why this encoding allows the model to generalize to longer sequences than seen during training.
 
=== Extended Solution ===
(d) The sine-cosine positional encoding ensures that each position in the sequence has a unique representation, while also encoding relative distances between positions. The key properties that allow generalization to longer sequences are:
 
Smooth Continuity: Since sine and cosine functions are continuous and periodic, the model can extrapolate positional information beyond the training data.
Relative Position Representation: The encoding ensures that nearby positions have similar representations, allowing the model to generalize the learned attention patterns to longer sequences.
Scale Invariance: Since the denominators in the exponent scale exponentially, large positional indices still produce meaningful representations within the same functional space.
This allows the transformer to handle sequences longer than those encountered during training without requiring additional learned embeddings.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.4 ==
 
<b>Level:</b> ** (Moderate)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
Consider a Transformer model with a self-attention mechanism applied to a sequence of three tokens, <math>
X = [x_1, x_2, x_3]
</math>. The attention mechanism computes the output in the following 3 steps:
 
1. Similarity scores:
 
<math>
s_i = q^T k_i
</math>
 
2. Softmax attention weights:
 
<math>
a_i = \frac{e^{s_i}}{\sum_j e^{s_j}}
</math>
 
3. Final attention output:
 
<math>
  \sum_i a_i v_i
</math>
 
You are given the following vectors:
 
Query and key vectors:
 
<math>
  q = [12], \quad
  k_1 = [11], \quad
  k_2 = [22], \quad
  k_3 = [13]
</math>
 
Value vectors:
 
<math>
  v_1 = [10], \quad
  v_2 = [01], \quad
  v_3 = [11]
</math>
 
'''Find:'''
 
1. The similarity scores <math> s_1, s_2, s_3 </math>.
 
2. The attention weights <math> a_1, a_2, a_3 </math>.
 
3. The final attention output.
 
=== Solution ===
 
'''Computing the similarity scores:'''
 
<math>
s_1 = q^T k_1 = [12] [11] = 3
</math>
 
<math>
s_2 = q^T k_2 = [12] [22] = 6
</math>
 
<math>
s_3 = q^T k_3 = [12] [13] = 7
</math>
 
'''Computing the attention weights:'''
 
<math>
a_1 = \frac{e^3}{e^3 + e^6 + e^7}
</math>
 
<math>
a_2 = \frac{e^6}{e^3 + e^6 + e^7}
</math>
 
<math>
a_3 = \frac{e^7}{e^3 + e^6 + e^7}
</math>
 
'''Computing the attention output:'''
 
<math>
\sum_i a_i v_i =
a_1 v_1 + a_2 v_2 + a_3 v_3
</math>
<math>
=
\left(\frac{e^3}{e^3 + e^6 + e^7} \right) [10] +
\left(\frac{e^6}{e^3 + e^6 + e^7} \right) [01] +
\left(\frac{e^7}{e^3 + e^6 + e^7} \right) [11]
=
 
\begin{bmatrix}
\frac{e^3 + e^7}{e^3 + e^6 + e^7} \
\frac{e^6 + e^7}{e^3 + e^6 + e^7}
\end{bmatrix}
</math>
 
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.5 ==
 
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
 
Given the following sequence of words (represented as indices), calculate the positional encoding for each word at a specific dimension.
 
· Sequence of words: ["go", "to", "school"]
 
· Let the embedding dimension d=4
 
· The position indices pos will be 0, 1, and 2 (corresponding to each word).
 
=== Solution ===
 
<math>\text{For position} \, pos = 0</math>:
 
<math>PE(0, 0) = \sin\left( \frac{0}{10000^{2 \times 0 / 4}} \right) = \sin(0) = 0</math>
 
<math>PE(0, 1) = \cos\left( \frac{0}{10000^{2 \times 0 / 4}} \right) = \cos(0) = 1</math>
 
<math>PE(0, 2) = \sin\left( \frac{0}{10000^{2 \times 2 / 4}} \right) = \sin(0) = 0</math>
 
<math>PE(0, 3) = \cos\left( \frac{0}{10000^{2 \times 2 / 4}} \right) = \cos(0) = 1</math>
 
<math>\text{So, } PE(0) = [0, 1, 0, 1]</math>
 
 
<math>\text{For position} \, pos = 1</math>:
 
<math>PE(1, 0) = \sin\left( \frac{1}{10000^{2 \times 0 / 4}} \right) \approx 0.841</math>
 
<math>PE(1, 1) = \cos\left( \frac{1}{10000^{2 \times 0 / 4}} \right) \approx 0.540</math>
 
<math>PE(1, 2) = \sin\left( \frac{1}{10000^{2 \times 2 / 4}} \right) \approx 0.01</math>
 
<math>PE(1, 3) = \cos\left( \frac{1}{10000^{2 \times 2 / 4}} \right) \approx 0.9999</math>
 
<math>\text{So, } PE(1) \approx [0.841, 0.540, 0.01, 0.9999]</math>
 
 
<math>\text{For position} \, pos = 2</math>:
 
<math>PE(2, 0) = \sin\left( \frac{2}{10000^{2 \times 0 / 4}} \right) \approx 0.909</math>
 
<math>PE(2, 1) = \cos\left( \frac{2}{10000^{2 \times 0 / 4}} \right) \approx -0.416</math>
 
<math>PE(2, 2) = \sin\left( \frac{2}{10000^{2 \times 2 / 4}} \right) \approx 0.02</math>
 
<math>PE(2, 3) = \cos\left( \frac{2}{10000^{2 \times 2 / 4}} \right) \approx 0.9998</math>
 
<math>\text{So, } PE(2) \approx [0.909, -0.416, 0.02, 0.9998]</math>
 
The positional encodings for each word in the sequence ["go", "to", "school"] are:
 
Position 0: [0, 1, 0, 1]
 
Position 1: [0.841, 0.540, 0.01, 0.9999]
 
Position 2: [0.909, -0.416, 0.02, 0.9998]
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.6 ==
 
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
Explain in details the relationship between the binary encoder of position and the cosine/sine function used in a tranformer.
 
=== Solution ===
Suppose we encode n vectors using the binary encoder, and have it repressented in a matrix B where each column vector is the binary encoding for 1 vector, ordering from left to right.
Then we look at the resulting matrix row by row. For each row, the frequency where it the elements changes from 0 to 1 decreases as we go down each row. Since we need the functions
to be differentiable, we mimic this behavior in the positional embedding through the functions discussed in class. Even rows we use cosine function, and odd rows we use sine function.
The position is then the column of the element.
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.7 ==
 
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Modified
 
'''References:''' Nishad, N. (2024). Positional Encoding: Adding Sequence Awareness to Transformers. ''DEV''. dev.to/nareshnishad/positional-encoding-adding-sequence-awareness-to-transformers-24pg
 
=== Question ===
Describe the connection between the positional encoding used in transformers and the sine/cosine functions, highlighting how the encoding scheme represents position in a differentiable manner.
 
=== Solution ===
Consider a matrix <math>P</math> that contains the positional encodings for <math>n</math> vectors, where each column in <math>P</math> represents the encoding of a vector's position. As we analyze the rows of this matrix, we notice that the rate at which the bits flip from 0 to 1 becomes slower as we move down the rows. To ensure smooth and differentiable transitions between position encodings, we replicate this behaviour using sinusoidal functions. Specifically, the cosine function is applied to even-indexed rows, and the sine function is applied to odd-indexed rows. The positional encoding is then determined by the specific column index, with the sine and cosine functions capturing the gradual change in position. The use of sine and cosine ensures that the model can distinguish between positions without explicitly needing to learn this information. The encoding is also designed to allow the model to handle both short- and long-range dependencies in the sequence.
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.8 ==
 
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
Given a simple transformer model with the following inputs:<br>
 
- Query (Q) = <math>[10]</math><br>
 
- Key (K) = <math>[1001]</math><br>
 
- Value (V) =<math>[1234]</math><br>
 
1. Compute the attention weights. <br>
2. Calculate the output of the attention mechanism using the attention weights.
 
=== Solution ===
The attention mechanism in transformers uses a scaled dot-product attention method. We perform the following steps:
 
1. Compute the Attention Scores:<br>
  We compute the attention scores by taking the dot product of the Query (Q) and the transpose of the Key (K):
  <br>
  <code>Q · K<sup>T</sup> = [1, 0] · [[1, 0], [0, 1]] = [1, 0]</code>
 
2. Scale the Attention Scores:<br>
  The attention scores are scaled by the square root of the dimension of the key vector (d<sub>k</sub> = 2):
  <br>
  <code>Scaled attention scores = [1, 0] / sqrt(2) = [0.7071, 0]</code>
 
3. Apply Softmax:<br>
  We apply the softmax function to the scaled attention scores:
  <br>
  <code>Softmax([0.7071, 0]) = [0.6682, 0.3318]</code>
 
4. Compute the Output:<br>
  The final output is computed by multiplying the attention weights with the Value (V) matrix:
  <br>
  <code>Output = [0.6682, 0.3318] · [[1, 2], [3, 4]] = [1.6682, 2.6682]</code>
 
Thus, the final output is:<br>
<code>[1.6682, 2.6682]</code>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.9 ==
 
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
 
This exercise is about processing an input through a '''multi-headed attention''' mechanism in a transformer. Suppose the architecture contains 2 attention heads.
 
(a) Given the following input matrix, <math>X</math>, and learned weight matrices, calculate the scaled dot product attention output, <math>Z_1</math>, for the first head:
 
<math> X = [110021201121] </math>, <math> W_Q^1 = [11100110] </math>, <math> W_K^1 = [01011011] </math>, <math> W_V^1 = [01111101] </math>
 
(b) The output for the second attention head is given as follows:
 
<math> Z_2 = [112312] </math>
 
Concatenate <math>Z_1</math> and <math>Z_2</math> and apply the following linear transformation:
 
<math> W_O = [01111110] </math>
 
(c) As a conceptual follow-up question, what are the advantages of having many attention heads in a transformer?
 
=== Solution ===
 
(a) The query, key, and value matrices are computed below:
 
<math> Q = W_Q^{1T} X =  [11011010] [110021201121] = [210311] </math>
 
<math> K = W_K^{1T} X = [00111101] [110021201121] = [322210] </math>
 
<math> V = W_V^{1T} = [01101111] [110021201121] = [222051] </math>
 
These are used to calculate the attention output, <math> Z_1 </math>, which is shown below rounded to 2 decimal places. The softmax function is computed over the ''rows'' of the matrix <math> \frac{Q^{1T} K_1}{\sqrt{2}} </math>.
 
<math> Z_1 = V_1 \text{softmax}\left(\frac{Q^{1T} K_1}{\sqrt{2}}\right) = [3.242.010.752.582.291.13] </math>
 
(b) <math> Z_1 </math> and <math> Z_2 </math> are concatenated and multiplied by the given weight matrix.
 
<math> Z = W_O^T \text{Concat}(Z_1, Z_2) = [01111110] [3.242.010.752.582.291.13112312] = [0.582.291.131.660.721.62] </math>
 
(c) Having many attention heads can allow the model to learn more complicated patterns in text (or other data). For example, one head might focus on overall sentence structure while another head can focus on word meaning, or distinguishing identical words that have different meanings. The model can also learn long-range dependencies (i.e., the relationships between words that are far apart from each other in an input sentence). Another advantage is the computational speed; each attention head has its computations done in parallel, which is faster than having just one attention head with many weights.
 
To further elaborate on the benefits of multiple heads, enhancing the X data with various weights and schemes which is fed to a particular weights can help capture additional relationships and details that a singular head could not capture, thereby further increasing the understanding of say, a sentence.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.10 ==
<b>Level:</b> * (Moderate)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
 
'''Multi-head attention in Python'''
 
Write a function multi_head_attention(Q, K, V, num_heads) in Python that:
 
1. Splits the query, key, and value matrices into multiple heads.
 
2. Applies the Scaled Dot-Product Attention to each head.
 
3. Concatenates the outputs from all heads.
 
4. Projects the concatenated output back to the original dimensionality using a linear transformation.
 
Example input:
 
<pre>
Q = np.array([[[1, 0, 1, 0],
              [0, 1, 0, 1]]])  # Shape: (1, 2, 4)
 
K = np.array([[[1, 1, 0, 0],
              [0, 1, 1, 0],
              [1, 0, 1, 0]]])  # Shape: (1, 3, 4)
 
V = np.array([[[1, 2, 0, 1],
              [0, 3, 1, 0],
              [4, 1, 0, 2]]])  # Shape: (1, 3, 4)
 
num_heads = 2
</pre>
 
Function signature:
<pre>
import numpy as np
def multi_head_attention(Q: np.ndarray, K: np.ndarray, V: np.ndarray, num_heads: int) -> np.ndarray:
    """
    Compute multi-head attention.
   
    Parameters:
    Q (np.ndarray): Query matrix of shape (batch_size, seq_len, d_model)
    K (np.ndarray): Key matrix of shape (batch_size, seq_len, d_model)
    V (np.ndarray): Value matrix of shape (batch_size, seq_len, d_model)
    num_heads (int): Number of attention heads
   
    Returns:
    np.ndarray: Multi-head attention output of shape (batch_size, seq_len, d_model)
    """
    pass
</pre>
 
=== Solution ===
<pre>
import numpy as np
 
def scaled_dot_product_attention(Q, K, V):
    d_k = K.shape[-1]
    scores = np.matmul(Q, K.transpose(0, 1, 3, 2)) / np.sqrt(d_k)
    exp_scores = np.exp(scores - np.max(scores, axis=-1, keepdims=True))  # Stability
    attention_weights = exp_scores / np.sum(exp_scores, axis=-1, keepdims=True)
    return np.matmul(attention_weights, V)
 
def split_heads(X, num_heads):
    batch_size, seq_len, d_model = X.shape
    d_head = d_model // num_heads
    X = X.reshape(batch_size, seq_len, num_heads, d_head)
    return X.transpose(0, 2, 1, 3)  # (batch_size, num_heads, seq_len, d_head)
 
def multi_head_attention(Q, K, V, num_heads):
    batch_size, seq_len, d_model = Q.shape
    d_head = d_model // num_heads
   
    # Step 1: Split Q, K, V into multiple heads
    Q_heads = split_heads(Q, num_heads)
    K_heads = split_heads(K, num_heads)
    V_heads = split_heads(V, num_heads)
   
    # Step 2: Apply scaled dot-product attention to each head
    attention_outputs = scaled_dot_product_attention(Q_heads, K_heads, V_heads)
   
    # Step 3: Concatenate heads
    attention_outputs = attention_outputs.transpose(0, 2, 1, 3).reshape(batch_size, seq_len, d_model)
   
    # Step 4: Final linear projection (for simplicity, we use an identity matrix)
    W_o = np.eye(d_model)
    output = np.matmul(attention_outputs, W_o)
   
    return output
 
# Test Example
Q = np.array([[[1, 0, 1, 0],
              [0, 1, 0, 1]]])  # (1, 2, 4)
K = np.array([[[1, 1, 0, 0],
              [0, 1, 1, 0],
              [1, 0, 1, 0]]])  # (1, 3, 4)
V = np.array([[[1, 2, 0, 1],
              [0, 3, 1, 0],
              [4, 1, 0, 2]]])  # (1, 3, 4)
 
num_heads = 2
 
output = multi_head_attention(Q, K, V, num_heads)
print("Multi-Head Attention Output:", output)
</pre>
 
Explanation:
* Each of the <math> Q, K, V </math> matrices is split into 2 heads with dimentions <math> (1, 2, 2) </math> for Q, and <math> (1, 3, 2) </math> for K and V.
 
* Scaled dot-product attention is applied independently to each head, capturing different aspects of the input sequences.
 
* The outputs from both heads are concatenated and projected back to the original dimensionality.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.11 ==
<b>Level:</b> ** (Moderate)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
Positional encoding additively encodes positional information with given input vectors.  By using sinusoidal functions to encode positional information, positions are able to be encoded smoothly while retaining the information from the original vector. 
 
To better understand how the positional encoding affects a vector, try visualizing it.
 
Generate a random vector <math> x \in \mathbb{R}^3 </math>.  Using Python, apply positional encoding for indices 1 through 8 and add them to this vector.  Using MatPlotLib, visualize the original vector in 3D and the modified vector after applying positional encoding for various indices.
 
=== Solution ===
 
The Python code to impliment the solution to this problem is shown below
 
<pre>
import numpy as np
import matplotlib.pyplot as plt
from mpl_toolkits.mplot3d import Axes3D
 
#Generate a random 3D vector
x = np.random.rand(3)*15
 
# Create 3D plot
fig = plt.figure(figsize=(10, 7))
ax = fig.add_subplot(111, projection='3d')
 
# Scatter plot the origin as a black dot
ax.scatter(0, 0, 0, color='black', s=100, label="Origin")
 
# Plot original vector x
ax.scatter(*x, color='red', s=100, label="Original Vector (Position Encoding 1)")
#Plot an line from origin to X (turns our adding arrowheads to vectors in 3D is not easy in Matplotlib surprisingly)
ax.plot([0, x[0]], [0, x[1]], [0, x[2]], linestyle="solid", alpha=0.5)
 
#Loop through indicies 2 through 8, generate positinal encoding vectors, add them to x, and plot them
for pos in range(2, 8):
 
    #Use the same position embedding encoding from the class lecture slides
    #NOTE - RATHER THAN 10000 IN DENOMINATOR WHICH HELPS FOR LONG FEATURES, I USED 1 AS IT'S A SIMPLE R3 VECTOR
    position_embedding = np.array([np.sin(pos/1**(2*1/3)), np.cos(pos/1**(2*1/3)), np.sin(pos/1**(2*2/3))])
   
    #Add the positional encoding to the original vector
    x_position_encoded = x + position_embedding
 
    #Plot
    ax.scatter(*x_position_encoded, label=f"Position Encoding {pos}", s=50)
    ax.plot([0, x_position_encoded[0]],  [0, x_position_encoded[1]],  [0, x_position_encoded[2]], linestyle="dashed", alpha=0.5)
 
#Add plot labels
ax.set_xlabel('X')
ax.set_ylabel('Y')
ax.set_zlabel('Z')
ax.set_title('Positional Encoding Visualized for a Random 3D Vector')
ax.legend()
 
plt.show()
</pre>
 
[[Image:10.11.png|thumb|300px|center|Script output showing randomly generated 3D vector x and how x changes after adding positional encoding for positions 1 through 8]]
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.12 ==
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
Consider a self-attention mechanism where the attention scores are computed using the scaled dot-product:
 
<math> s_i = \frac{q^T k_i}{\sqrt{p}} </math>,
 
where <math> q </math> is the query vector, <math> k_i </math> is the key vector, and <math> p </math> is the dimensionality of the key vectors. The attention weights are then computed as:
 
<math> a_i = \frac{\exp(s_i)}{\sum_j \exp(s_j)}. </math>
 
(a) Show that if all key vectors are orthogonal and have the same norm, the attention scores <math> s_i </math> are evenly distributed.
 
(b) If <math> q </math> is aligned with one of the keys, what happens to the attention weight distribution?
 
(c) What happens to the attention weights if we apply a scaling factor to <math>s_i</math>? How does this affect the way attention is distributed among different keys?
 
(d) In a Transformer model, why do we add positional encodings to the input embeddings?
 
=== Solution ===
(a) If all key vectors <math> k_i </math> are orthogonal and have the same norm, say <math> |k_i| = C </math>, then their dot products satisfy:
 
<math> k_i^T k_j = C^2 \delta_{ij}, </math>
 
where <math> \delta_{ij} </math> is the Kronecker delta. This implies that the attention scores <math> s_i </math> are of similar magnitude, leading to nearly uniform attention weights.
 
(b) If <math> q </math> is aligned with one key vector <math> k_m </math>, then:
 
<math> s_m = \frac{q^T k_m}{\sqrt{p}} = \frac{|q| |k_m|}{\sqrt{p}}. </math>
 
This value dominates the exponentiation in softmax, leading to <math> a_m \approx 1 </math> while all other attention weights approach zero. Thus, attention concentrates on <math> k_m </math>.
 
(c) Applying a scaling factor to <math>s_i</math> changes how the softmax function distributes attention.
If the scaling factor increases, the differences between scores become larger, leading to more focused attention on certain keys.
If the scaling factor decreases, the differences between scores shrink, making attention weights more evenly spread across all keys.
 
(d) Unlike RNNs, Transformers do not have a built-in sense of order since they process tokens in parallel.
Positional encodings inject sequential information into token embeddings, allowing the model to learn relative positioning and maintain sentence structure.
Without positional encodings, the model would treat all tokens as an unordered set, which is ineffective for structured data like language.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.13 ==
 
<b>Level:</b>  * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
 
1. Why does Transformer use multi-head attention? (Why not just use a single head?)
 
2. Why does Transformer use different weight matrices for Q (Query) and K (Key)? Why can't the same value be used for self dot-product?
 
3. Why does Transformer scale the attention scores before applying softmax (why divide by <math> \sqrt{p} </math>)
 
=== Solution ===
 
1. Multi-head attention can:
 
(a) Enhances representation power: Different heads can focus on different features, such as long-range dependencies and local information.
 
(b) Improves learning ability: Multiple heads can learn diverse semantic relationships, improving the model’s performance.
 
(c) Reduces information loss: A single attention head might overlook crucial details, while multiple heads can capture them.
 
(d) Maintains computational efficiency: Since each head has a lower dimension than a single head, the total computation remains manageable.
 
In general, a single attention head is limited in capacity and may fail to learn diverse features effectively. Multi-head attention allows the model to capture richer semantic information.
 
2. Using different weight matrices for Q (Query) and K (Key) can increase learning capability and prevent degradation.
 
If Q and K share the same weight matrix, then Q=K, and the attention computation: <math> Attention(Q,K,V) = softmax(\frac{QK^T}{\sqrt{p}}) \cdot V </math>
results in <math> QK^T </math> becoming a symmetric matrix, limiting the flexibility of attention mechanisms and reducing its expressiveness. Using separate weight matrices for Q and K allows the model to project queries and keys into different subspaces, enhancing the flexibility of attention scoring.
 
3. It can prevent excessively large values that lead to vanishing gradients.
 
Since <math> QK^T </math> values can be large, directly applying softmax can cause extreme probability distributions, making gradient updates ineffective. So, a scaling factor <math> \sqrt{p} </math> is required to ensure that attention scores have a variance close to 1, which stabilizing training.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.14 ==
 
<b>Level:</b>  * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
Consider an Attention Mechanism Network with a query matrix <i>Q</i> of size <i>n × d<sub>q</sub></i>, a key matrix <i>K</i> of size <i>n × d<sub>k</sub></i>, and a value matrix <i>V</i> of size <i>n × d<sub>v</sub></i>.<br>
(a)Derive the dimensions of the attention matrix <i>A</i> and the final attention output.<br>
(b)If we increase the number of attention heads from <i>h = 4</i> to <i>h = 8</i>, explain how this affects computational cost and the model's ability to represent different parts of the input sequence.<br>
(c)If the sequence length <i>n</i> increases from <i>n = 10</i> to <i>n = 20</i>, how does this affect the size of the attention matrix <i>A</i> and the computational cost?<br>
 
===Solution===
 
<b>(a)</b> In an Attention Mechanism Network, the query matrix <i>Q</i> has shape <i>(n × d<sub>q</sub>)</i>, and the key matrix <i>K</i> has shape <i>(n × d<sub>k</sub>)</i>. The dot-product between <i>Q</i> and <i>K<sup>T</sup></i> results in an attention matrix <i>A</i> of shape <i>(n × n)</i>, where each element represents the similarity between a pair of positions in the sequence. Applying the softmax function does not change the dimensions, so the attention matrix <i>A</i> remains <i>(n × n)</i>.
 
The final attention output is computed by multiplying the attention matrix <i>A</i> with the value matrix <i>V</i>:
 
<i>Output = A × V</i>, which has shape <i>(n × d<sub>v</sub>)</i>.<br><br>
 
<b>(b)</b> Increasing the number of attention heads from <i>h = 4</i> to <i>h = 8</i> allows the model to learn more diverse representations of the input by computing multiple attention distributions for different parts of the sequence. This enables the model to focus on different aspects of the input simultaneously.
 
However, this comes at the cost of increased computational complexity. Each attention head involves a set of matrix multiplications and softmax operations, so the number of operations increases with the number of heads. In particular, the number of parameters in the projection matrices <i>W<sub>Q</sub>, W<sub>K</sub>, W<sub>V</sub></i> increases, which leads to higher memory and computational costs. Despite the increased cost, the model's capacity to represent richer information improves.<br><br>
 
<b>(c)</b> The attention matrix <i>A</i> has shape <i>(n × n)</i>. When the sequence length <i>n</i> increases from 10 to 20, the size of the attention matrix increases as follows:
 
- When <i>n = 10</i>, the attention matrix has size <i>10 × 10 = 100</i>.
 
- When <i>n = 20</i>, the attention matrix has size <i>20 × 20 = 400</i>.
This results in a 4 times increase in the size of the attention matrix.
 
Computing <i>A = Q × K<sup>T</sup></i> involves a matrix multiplication between <i>Q</i> (<i>n × d<sub>q</sub></i>) and <i>K<sup>T</sup></i> (<i>d<sub>k</sub> × n</i>), which requires <i>O(n² ⋅ d<sub>q</sub>)</i> operations.
 
When <i>n = 10</i>, the cost is proportional to <i>10² ⋅ d<sub>q</sub> = 100 ⋅ d<sub>q</sub></i>, and when <i>n = 20</i>, the cost becomes <i>20² ⋅ d<sub>q</sub> = 400 ⋅ d<sub>q</sub></i>. The computational cost increases by a factor of 4.
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.15 ==
 
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
What is the advantage of positional encoding compared to using the positions in the sequence directly?
 
=== Solution ===
Using raw positions would only yield a scalar output that would not align well with the high-dimensional word embeddings of a transformer model. Sinusoidal positional encoding maps a scalar position to a multi-dimensional vector by computing sine and cosine of varying frequencies. This approach offers us a smooth, continuous representation that captures absolute and relative positions, naturally integrates in embedding space, and generalizing to longer sequences is easy without having to introduce additional parameters. Sinusoidal encodings are based on periodic functions (sine and cosine), which means they extend smoothly to unseen sequence lengths without requiring retraining.
 
</div> <div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.16 ==
 
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
Transformers use self-attention to process sequences, allowing each token to attend to every other token in parallel. However, this structure does not inherently encode information about where a token appears in the sequence.
 
1) Why do we need a positional encoding mechanism in such models
 
2) What is the key idea behind sinusoidal positional encoding?
=== Solution ===
1) In self-attention, each token “looks at” other tokens via attention weights. However, if the model only sees a set of token embeddings without positional information, it has no inherent notion of how tokens are ordered or spaced. Note that word order is critical for language understanding (e.g “the cat chased the mouse” vs “the mouse chased the cat”). Therefore, to maintain sequence structure, transformers must have a strategy to incorporate position awareness. Without positional encodings, the model would treat the input sequence as a bag of embeddings, losing crucial syntactic/semantic relationships tied to word order.
 
2) Each position is mapped to a p dimensional vector of sines and cosines with varying wavelengths. Phase shifts encode position because different dimensions advance through sine/cosine waves at different rates, so each position gets a unique pattern of values. Since sine/cosine functions have well-defined phase shifts, the model can infer not just absolute positions but also relative distances (the difference in phases between positions).
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.17 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Modified
 
Prince, Simon J.D. ''Understanding Deep Learning''. The MIT Press, 2023, p. 239, udlbook.com. Accessed 10 Feb. 2025.
 
=== Question ===
What is the masked multi-head attention and why do we need it? Why do we need to do masked attention instead of non-masked attention? If we add a new token to a precomputed masked mechanism, what is the extra computation we need to do?
 
=== Solution ===
The masked multi-head attention is the self-attention mechanism that is applied in parallel to different aspects of the input, with a mask matrix added to the linear transformation of the input. For each head, there will be a set of queries, keys and values.
 
This will increase the robustness and improve the results given bad initializations. It can also learn the input from different perspectives. It also increases efficiency by running multiple self attentions in parallel.
 
The masked attention ensures that the token does not attend to future words.
 
For the new token, we need to compute its query, key and value matrices. Then we need to expand the dimension of the attention matrix and the masked matrix. Finally compute the weighted sum of the output.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.18 ==
 
'''Level:''' ** (Medium)
 
'''Exercise Types:''' Modified
 
=== Question ===
Show that the positional encoding for a given position <math>n</math> defined by
<math> r_{n,i} =
\begin{cases}
\sin\left(\frac{n}{L^{i/D}}\right), & \text{if } i \text{ is even,} \
\cos\left(\frac{n}{L^{(i-1)/D}}\right), & \text{if } i \text{ is odd.}
\end{cases}</math>
 
has the property that, for a fixed offset <math>k</math>, the encoding at position <math>n+k</math> can be represented as a linear combination of the encoding at position <math>n</math> with coefficients that depend only on <math>k</math> and not on <math>n</math>.
=== Solution ===
At position <math>n+k</math> we have <math>r_{n+k,i} =
\begin{cases}
\sin\left(\frac{n+k}{L^{i/D}}\right), & \text{if } i \text{ is even,} \
\cos\left(\frac{n+k}{L^{(i-1)/D}}\right), & \text{if } i \text{ is odd.}
\end{cases}</math>
 
When <math>i</math> is even, we can use the trigonometric identity <math>\sin(A+B)=\cos A\sin B+\sin A\cos B</math> and get <math>\sin\left(\frac{n+k}{L^{i/D}}\right) = \sin\left(\frac{n}{L^{i/D}}\right)\cos\left(\frac{k}{L^{i/D}}\right)+\cos\left(\frac{n}{L^{i/D}}\right)\sin\left(\frac{k}{L^{i/D}}\right)=\cos\left(\frac{k}{L^{i/D}}\right)r_{n,i}+\sin\left(\frac{k}{L^{i/D}}\right)r_{n,i}</math> as desired. We can apply the trigonometric identity <math>\cos(A+B)=\cos A\cos B-\sin A\sin B</math> to the case when <math>i</math> is odd and obtain the desired result.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.19 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
 
1. Why do Transformer models use a Feed-Forward Network (FFN) after the attention layer?  <br>
2. The FFN applies the following transformation to an input vector <math> h </math>:
 
<math>
\begin{align}
FFN(h) = \max(0, hW + b)
\end{align}
</math>
 
where <math> W </math> is a weight matrix and <math> b </math> is a bias.
 
(a) What is the purpose of the ReLU activation function <math> \max(0, x) </math>?  <br>
(b) If the input is:
 
<math>
\begin{align}
h = [21]
\end{align}
</math>
 
and the parameters are:
 
<math>
\begin{align}
W = [0.50.30.70.2], \quad
b = [0.10.2]
\end{align}
</math>
 
Compute the output of <math> FFN(h) </math>.
 
 
=== Solution ===
1. The FFN processes each token independently to refine representations, and it introduces non-linearity and helps learn more complex patterns.
 
2. ReLU <math> \max(0, x) </math> removes negative values, preventing them from propagating. It helps avoid the vanishing gradient problem and speeds up learning.
 
3. To compute <math> hW + b </math>
 
<math>
\begin{align}
hW =
[21]
[0.50.30.70.2]
\end{align}
</math>
 
Multiplication:
 
<math>
\begin{align}
= [(2×0.5)+(1×0.7),(2×0.3)+(1×0.2)]
\end{align}
</math>
 
<math>
\begin{align}
= [1.00.7,0.60.2]
\end{align}
</math>
 
<math>
\begin{align}
= [0.3,0.8]
\end{align}
</math>
 
Adding bias <math> b </math>:
 
<math>
\begin{align}
hW + b = [0.3+0.1,0.8+0.2]
\end{align}
</math>
 
<math>
\begin{align}
= [0.4,0.6]
\end{align}
</math>
 
Applying ReLU:
 
<math>
\begin{align}
\max(0, [0.4,0.6]) = [0.4,0]
\end{align}
</math>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.20 ==
 
'''Level:''' * (Easy) 
 
'''Exercise Types:''' Novel 
 
=== Question ===
Transformers rely on positional encoding to introduce word order information since they do not inherently process sequences in order. Given the positional encoding formula:
 
<math>
PE_{(pos, 2i)} = \sin \left( \frac{pos}{10000^{2i/d}} \right), \quad PE_{(pos, 2i+1)} = \cos \left( \frac{pos}{10000^{2i/d}} \right)
</math>
 
1. Compute the positional encoding for position 5 with an embedding size of 6.
 
 
=== Solution ===
 
1. Computing the positional encoding for position 5, d = 6:
 
<pre>
import numpy as np
 
def positional_encoding(pos, d):
    pe = np.zeros(d)
    for i in range(0, d, 2):
        pe[i] = np.sin(pos / (10000 ** (2 * i / d)))
        if i + 1 < d:
            pe[i + 1] = np.cos(pos / (10000 ** (2 * i / d)))
    return pe
 
# Compute positional encoding for position 5, embedding size 6
pos = 5
d = 6
pe_vector = positional_encoding(pos, d)
print("Positional Encoding for position 5, d=6:", pe_vector)
</pre>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.21 ==
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
 
The Transformer Encoder primarily consists of Multi-Head Attention, Feedforward Network, Layer Normalization, and Residual Connection. Suppose we modify the Encoder so that after computing Multi-Head Attention, the output is passed directly to Layer Normalization without using Residual Connection. What potential issue might arise?
 
A. Reduced computational complexity, leading to faster training
 
B. Unstable gradient propagation, making training difficult
 
C. Gradient vanishing during attention computation
 
D. Minimal impact, Transformer can still train normally
 
=== Solution ===
 
B. Unstable gradient propagation, making training difficult
 
Residual Connection plays a crucial role in balancing information flow, ensuring stable training of the Transformer model. If the residual connection is removed, each layer’s output will fully depend on the Multi-Head Attention computation, potentially leading to unstable gradient propagation. This issue is particularly problematic in deep transformers, where it may result in gradient explosion or vanishing, making training more difficult.
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
 
== Exercise 10.22 ==
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
 
1. Explain how multi-head attention improves the model’s expressive power.
 
2. Discuss why multi-head attention is better suited than single-head attention for capturing different patterns in sequences.
 
=== Solution ===
 
1. Multi-head attention enhances a model’s expressive power by allowing multiple attention heads to focus on different aspects of the input simultaneously. Each head captures unique dependencies, such as short-range and long-range relationships, leading to richer feature representations and improved contextual understanding. By applying independent attention mechanisms, multi-head attention ensures that different features are learned in parallel, preventing a single dominant pattern from overpowering the learning process.
 
2. Compared to single-head attention, multi-head attention is better at capturing diverse patterns in sequences. Each head operates in a different subspace, enabling the model to extract multiple linguistic or structural features. This improves generalization and adaptability, making it particularly effective for tasks like machine translation and sequential modeling. Different attention heads can focus on different syntactic and semantic relationships, making multi-head attention more suitable for complex NLP tasks like coreference resolution, dependency parsing, and named entity recognition.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 10.23 ==
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
  <p> In a Transformer model, the multi-head attention mechanism applies a learnable weight matrix <math>W</math> to transform the input embeddings. Suppose we model this transformation using a linear system: </p>
 
<div style="text-align: center;">
<math display="block">
      X^\prime = WX
</math>
</div>
 
where
  <ul>
    <li> <math>X</math> is the original input embeddings of shape <math>(n \times d)</math> </li>
    <li> <math>W</math> is the learned weight matrix of size <math>d \times d </math> </li>
    <li> <math>X^\prime</math> is the transformed embedding matrix </li>
  </ul>
A necessary condition for stable training in deep learning is that the spectral norm (largest eigenvalue magnitude) of <math>W</math> remains bounded.
 
Given the weight matrix:
 
<div style="text-align: center;">
<math display="block">
      W = \begin{bmatrix}
          2 & -1 \ -1 & 2
          \end{bmatrix}
</math>
</div>
 
  <ul>
    <li> Compute the eigenvalues of <math>W</math>. </li>
    <li> Determine if the transformation is stable under the condition <math> | \lambda_{\text{max}}| \leq 2 </math>. </li>
  </ul>
 
=== Solution ===
 
The eigenvalues of a matrix <math>W</math> can be computed by solving the characteristic equation
 
<div style="text-align: center;">
<math display="block">
      \text{det}(W - \lambda I) = 0
</math>
</div>
 
where <math>I</math> is the identity matrix. We leave computing the eigenvalues as an exercise for the reader. The eigenvalues of <math>W</math> are:
 
<div style="text-align: center;">
<math display="block">
      \lambda_1 = 3, \quad \lambda_2 = 1
</math>
</div>
 
The transformation isn't stable since the largest eigenvalue magnitude is <math>3 > 2</math>.
 
 
This result suggests that in a Transformer, weight normalization or spectral regularization may be needed to control instability during training.
 
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 11.1 ==
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
Anwser the following questions:
 
(a) Explain the CLS token in BERT. Why is it important?
 
(b) Explain the difference between BERT and GPT.
 
(c) How do BERT and GPT perform differently on NLP tasks?
 
=== Solution ===
(a) In BERT, CLS is a special classification token that is prepended to every input sequence. BERT inserts a CLS token at the beginning of every input text. The idea is that the final hidden representation of this CLS token will serve as a summary or aggregate representation of the entire sequence. Because BERT's self-attention mechanism can incorporate contextual information from all tokens into the representation of CLS, this single embedding captures information about the entire sentence or document. CLS is crucial because it provides a dedicated, trainable summary representation of the entire input sequence.
 
Example:
The CLS token is primarily used for classification tasks. For instance, in sentiment analysis, a model trained on movie reviews can take the CLS token’s final hidden state and use it to determine whether a review is positive or negative. Similarly, in document classification, the CLS token helps categorize text into predefined classes, such as spam detection in emails. 
 
(b) BERT is built using only the Transformer encoder stack. In the encoder, each token can attend to all other tokens in the sequence simultaneously. This allows BERT to build a bidirectional representation of language. BERT introduces the concept of Masked Language Modeling, where a subset of tokens in the input are randomly masked, and the model learns to predict these masked tokens.  In contrast, GPT uses only the Transformer decoder stack. Each token can only attend to the tokens before it, making GPT a left-to-right language model. GPT has the autoregressive feature such that it is trained to predict the next token in the sequence, based on the context of all tokens to the left. They stem from the same fundamental Transformer concept but diverge in how they use attention (bidirectional vs. unidirectional) and which part of the transformer block they rely on (encoder vs. decoder).
 
(c) BERT excels at tasks that require a deep understanding of the entire input, such as question answering, sentence classification, and named entity recognition (NER). Since it captures bidirectional context, it is particularly useful for tasks where meaning depends on both preceding and following words. For example, in question answering, BERT can analyze both the question and passage simultaneously to locate the most relevant answer span.
 
Example Applications:
 
- Search Engines (Google Search): BERT improves search results by understanding the full context of user queries rather than just matching keywords
 
- Biomedical NLP (PubMedBERT): In medical research, BERT-based models help extract relevant information from clinical texts and research papers
 
On the other hand, GPT performs well in text generation, dialogue modelling, and creative writing tasks because of its autoregressive nature. Since it generates text token by token from left to right, it is ideal for producing coherent and contextually relevant responses in applications like chatbots, story generation, and machine translation. While BERT is more suited for understanding-based tasks, GPT is better for tasks involving natural language generation.
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 11.2 ==
<b>Level:</b> ** (Moderate)
 
<b>Exercise Types:</b> Novel
 
<b>Refrences:</b>
 
[1] ‘PyTorch-Transformers’, PyTorch. Accessed: Feb. 12, 2025. [Online]. Available: https://pytorch.org/hub/huggingface_pytorch-transformers//
 
[2] ‘google-bert/bert-base-uncased · Hugging Face’. Accessed: Feb. 12, 2025. [Online]. Available: https://huggingface.co/google-bert/bert-base-uncased
 
[3] D. Dhami, ‘Understanding BERT — Word Embeddings’, Medium. Accessed: Feb. 12, 2025. [Online]. Available: https://medium.com/@dhartidhami/understanding-bert-word-embeddings-7dc4d2ea54ca
 
=== Question ===
In Lecture 11, we learned about BERT, it's theoretical background, and the types of tasks it is capable of doing.
 
For this question, try actually loading a BERT model locally on your computer using , and use this model to predict a masked word in the middle of a sentence
 
=== Solution ===
<source lang="python">
from transformers import pipeline #Refernece [2] Google BERT Hugging Face
 
#The unmasker pipeline directly allows us to fill in a missing word in a sentence. 
 
unmasker = pipeline('fill-mask', model='bert-base-uncased')
 
unmasker("The weather outside is [MASK] so I wore a winter jacket.")
 
'''Example Output
 
[{'score': 0.35114386677742004,
  'token': 3147,
  'token_str': 'cold',
  'sequence': 'the weather outside is cold so i wore a winter jacket.'},
{'score': 0.1606239229440689,
  'token': 4010,
  'token_str': 'warm',
  'sequence': 'the weather outside is warm so i wore a winter jacket.'},
{'score': 0.06689444184303284,
  'token': 12809,
  'token_str': 'freezing',
  'sequence': 'the weather outside is freezing so i wore a winter jacket.'},
{'score': 0.059740614145994186,
  'token': 4658,
  'token_str': 'cool',
  'sequence': 'the weather outside is cool so i wore a winter jacket.'},
{'score': 0.056616757065057755,
  'token': 10256,
  'token_str': 'mild',
  'sequence': 'the weather outside is mild so i wore a winter jacket.'}]'''
 
  #However, this does not give us much insight about how to tokenizer works or what's going on behind the scenes,
  #So let's try implimenting the tokenization and doing this manually
 
import torch
 
#Reference [1] Pytorch Transformers
 
#Load tokenizer
tokenizer = torch.hub.load('huggingface/pytorch-transformers', 'tokenizer', 'bert-base-uncased') 
 
#Load pretrained BERT model
model = torch.hub.load('huggingface/pytorch-transformers', 'model', 'bert-base-uncased')
 
#Tokenize strings
text_1 = "The weather outside is cold."
text_2 = "I wore a winter jacket."
 
#Using encode_plus gives tokens and token type IDs needed for BERT
indexed_tokens = tokenizer.encode_plus(text_1, text_2, add_special_tokens=True,return_tensors="pt") #Add special tokens adds [CLS] and [SEP] tokens as required by BERT.  Return tensores = 'pt' returns a pytorch tensor
 
#Get the tensors
segments_tensors = indexed_tokens["token_type_ids"]
 
masked_index = 5 #Mask the word 'cold'
 
#Code from Pytorch Documentation [1]
#Re_index tokens directly as a list not a dictionary like encode_plus
indexed_tokens = tokenizer.encode(text_1, text_2, add_special_tokens=True)
indexed_tokens[masked_index] = tokenizer.mask_token_id
tokens_tensor = torch.tensor([indexed_tokens])
 
masked_lm_model = torch.hub.load('huggingface/pytorch-transformers', 'modelForMaskedLM', 'bert-base-uncased')
 
with torch.no_grad():
    predictions = masked_lm_model(tokens_tensor, token_type_ids=segments_tensors)
 
# Get the predicted token
predicted_index = torch.argmax(predictions[0][0], dim=1)[masked_index].item()
predicted_token = tokenizer.convert_ids_to_tokens([predicted_index])[0]
 
print(predicted_token)
 
#Output is 'cold', exactly like we expect!!
 
#If we change 'winter jacket' to 'swimsuit', the output of the masked word changed to 'warm' too, just like we'd expect!
</source>
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 11.3 ==
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
 
Here are some-short answer questions about BERT, GPT, T5:
 
1. How does the size of a Transformer model (e.g., number of parameters) impact its performance and computational cost?
 
2. How does T5 unify different NLP tasks under a single framework?
 
3. How does the training process of BERT differ from that of GPT?
 
4. Which of GPT and BERT is bidirectional, and why is that important?
 
5. How does fine-tuning impact the performance of large pre-trained Transformer models like BERT, GPT, and T5?
 
=== Solution ===
1. From the size of transformer models like GPT, it’s clear that there’s a trend where the larger the model, the better its generalization. For example, GPT-1 had 117 million parameters, GPT-2 had around 1.5 billion, GPT-3 has 175 billion, and rumors suggest GPT-4 might have about 1.76 trillion parameters. So, the major improvement in GPT’s performance comes from the size of the model, though other factors like multimodal data or new algorithms (such as the chain of thought approach) might also contribute. Empirical studies (e.g., OpenAI’s scaling laws) suggest that performance improves predictably with increases in model size, data, and compute, but diminishing returns set in at extreme scales. However, as the model size increases, so do its computational cost. Larger models need more memory and processing power, and training them can take weeks or months on GPUs/TPUs.
 
2. T5 (Text-to-Text Transfer Transformer) treats different NLP tasks all as "text-to-text" problems. This means that no matter what the task is, like translation, summarization, or answering questions, the input and output are always just text. E.g., for translation, the input could be “translate English to German: Hello," and the model would give the German translation as output. If the task is summarization, the input might be “summarize: [long text]," and the model would create a short summary. By using the same format for everything, T5 can do a lot of different tasks with the same model, making it easy to train and use for many different applications.
 
3. BERT is trained by hiding some words in a sentence with a [MASK] and asking the model to guess what the missing word is. It looks at the words before and after the [MASK] to understand the full meaning of the sentence, which makes it bidirectional. GPT, on the other hand, is trained by learning to predict the next word in a sentence based on the words that came before it. It reads the sentence from left to right and tries to guess what comes next, so it only uses the words before the target word, which makes it unidirectional.
 
4. BERT is bidirectional, which means it looks at the words before and after a word to understand the meaning. E.g., in the sentence “Mona Lisa is a [MASK] by Leonardo da Vinci,” BERT can use the words around the [MASK] like “Mona Lisa is a " and "by Leonardo da Vinci" to guess that the missing word might be “portrait”. This helps BERT understand the whole sentence better. It’s important because it lets BERT use all the context to make a better prediction.
 
5. Fine-tuning allows large pre-trained Transformer models to specialize in specific tasks by training them further on smaller, task-specific datasets. Instead of training from scratch, the model starts with a strong general understanding of language from its pre-training phase and then adapts to a specific domain, such as medical or legal text, by adjusting its weights based on new data. Fine-tuning helps improve performance on targeted tasks, reduces the need for massive labeled datasets, and allows the model to achieve state-of-the-art results with relatively fewer updates. However, careful tuning is necessary to avoid overfitting, where the model becomes too specialized in the fine-tuning dataset and loses generalization ability.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 11.4 ==
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
BERT's input representations consist of three distinct embeddings: token, segment, and position.
 
(a) Explain the purpose of each of these embeddings.
 
(b) Using the Hugging Face Transformers library, write a short Python script that:
  - Loads the `bert-base-uncased` tokenizer.
  - Tokenizes the following two-sentence input:
    "BERT is a powerful model architecture."
    "It revolutionized modern natural language processing."
  - Prints out the resulting input IDs and token type IDs (segment IDs).
 
(c) Discuss a potential limitation of using fixed position embeddings.
 
=== Solution ===
(a)
- Token Embeddings: Represent individual words or parts of words, captering the semantic meaning of individual tokens.
- Segment Embeddings: Distinguish between different sentences in an input, helping the model determine which tokens belong to which sentence / idea.
- Position Embeddings: Encode the position of each token in the sequence such that the order can be accounted for.
 
(b)
 
<source lang="python">
 
from transformers import BertTokenizer
 
tokenizer = BertTokenizer.from_pretrained('bert-base-uncased')
 
# Define the input
text_1 = "BERT is a powerful model architecture."
text_2 =  "It revolutionized modern natural language processing."
 
# Tokenize the input and get input IDs and token type IDs (segments)
encoded_input = tokenizer.encode_plus(
    text_1, text_2,
    add_special_tokens=True,  # adds [CLS] and [SEP]
    return_token_type_ids=True
)
 
print("Input IDs:", encoded_input['input_ids'])
print("Token Type IDs:", encoded_input['token_type_ids'])
 
</source>
 
The result we got is:
 
<pre>
Input IDs: [101, 14324, 2003, 1037, 3928, 2944, 4294, 1012, 102, 2009, 4329, 3550, 2715, 3019, 2653, 6364, 1012, 102]
Token Type IDs: [0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1]
</pre>
 
(c) Fixed position embeddings dont generalize to sequences longer than those in the training dataset. This can limit a models ability to handle very long sequences or contexts of variable length.
 
Additional note: Fixed position embeddings give each word a set position, but they don’t consider how words connect based on their distance. This makes it harder for the model to understand long sentences, like matching a pronoun to the right noun or following a thought across multiple sentences. Since these embeddings stay the same no matter the context, they aren’t as flexible as relative position embeddings, which adjust based on how words relate to each other.
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 11.5 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Copied
 
'''Reference:''' https://www.restack.io/p/agentgpt-answer-python-gpt2-cat-ai
 
=== Question ===
 
Write a Python code that demonstrates how GPT can be used to generate text based on a given prompt using the transformers library. What is the basic functionality of the code, and how does the GPT model generate the continuation of the prompt?
 
=== Solution ===
 
The code below uses the transformers library by Hugging Face to load a pre-trained GPT-2 model and tokenizer. The model generates text based on a given prompt. The main functionality of the code is to feed the prompt into the GPT-2 model and use the model to predict the next tokens, which are then decoded into readable text.
 
<source lang="python">
 
from transformers import GPT2LMHeadModel, GPT2Tokenizer
 
# Load pre-trained GPT-2 model and tokenizer
tokenizer = GPT2Tokenizer.from_pretrained("gpt2")
model = GPT2LMHeadModel.from_pretrained("gpt2")
 
# Define the prompt
prompt = "Once upon a time, in a land far, far away,"
 
# Encode the prompt into tokens
input_ids = tokenizer.encode(prompt, return_tensors="pt")
 
# Generate text continuation
output = model.generate(input_ids, max_length=100, num_return_sequences=1, no_repeat_ngram_size=2)
 
# Decode the output tokens to text
generated_text = tokenizer.decode(output[0], skip_special_tokens=True)
 
print("Generated Text: ")
print(generated_text)
 
</source>
 
Output
 
Generated Text:
Once upon a time, in a land far, far away, the world was a place of great beauty and great danger. The world of the gods was the land of darkness and darkness. And the darkness of this world, which was far from the light of day, was not the place where the sun and the moon met. It was in the midst of all the worlds, and in all that was beyond the earth.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 11.6 ==
 
<b>Level:</b>  ** (Moderate)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
 
How to use the o3-mini-high API in Python for a mathematical reasoning task? Provide a complete code example.
 
=== Solution ===
 
Below is a complete Python example.
 
<source lang="python">
 
import openai
 
openai.api_key = "YOUR_API_KEY"
 
# Give the math problem in the code
messages = [
    {"role": "system", "content": "You are a helpful math assistant."},
    {"role": "user", "content": "Simplify the expression (x^3 - x) / (x^2 - 1)."}
]
 
# Send a request using API to get the solution
response = openai.ChatCompletion.create(
    model="o3-mini",
    reasoning_effort="high",  # Enables the high reasoning mode
    messages=messages,
    temperature=0.2            # Lower temperature for math problems
)
 
# Print the answer.
assistant_message = response.choices[0].message.content
print("Assistant's answer:", assistant_message)
 
</source>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 11.7 ==
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
What is the key innovation of the BERT algorithm in natural language processing, and how does its bidirectional context capture improve performance on downstream tasks compared to previous models like Word2Vec or GPT?
 
=== Solution ===
BERT introduces bidirectional context capture through Bidirectional Pre-training using the Transformer architecture.
 
1) MLM
 
Unlike traditional left-to-right or right-to-left models, BERT uses a bidirectional training approach by randomly masking some words in a sentence. The model then predicts the masked words using both left and right context. This allows it to learn richer word representations by incorporating dependencies from both directions.
 
2)Transformer's Self-Attention Mechanism
 
BERT uses multi-head self-attention in its Transformer encoder, allowing each token to attend to all other tokens in the sentence. This enables deeper contextual understanding, as each word is represented with respect to the full sentence, rather than just previous or next words.
 
3)Next Sentence Prediction (NSP)
 
To further enhance contextual learning, BERT also trains on a task where it determines whether one sentence follows another in natural text. This helps it understand longer-range dependencies beyond single sentences.
 
Unlike Word2Vec (static embeddings) or GPT (unidirectional context), BERT's bidirectional training allows it to understand better word meaning based on full sentence context, leading to superior performance on tasks like question answering, sentiment analysis, and named entity recognition.
 
=== Additional Comment ===
Later researchers realized that the sentence order task was not as significant compared to the cost that it incurred 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 11.8 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
References: A. Ghodsi, STAT 940 Deep Learning: Lecture 11, University of Waterloo, Winter 2025.
 
=== Question ===
List 5 ways to improve BERT.
 
BERT uses bidirectional attention, while GPT relies on unidirectional attention. 
Why does BERT’s bidirectional attention make it better for understanding sentence meaning compared to GPT?
 
=== Solution ===
1. Train BERT with more data, larger batch sizes, and longer training time. (RoBERTa)<br />
2. Train BERT on specific domain. (BioBERT, SciBERT, BERTweet, FinBERT)<br />
3. Use more hidden layers, attention heads and parameters to capture more complex patterns. (BERT large)<br />
4. Use fewer parameters to reduce the resources needed. (TinyBERT)<br />
5. Fine-tuning.
 
 
BERT’s bidirectional attention allows it to use both left and right context when encoding words, making it more effective for tasks requiring sentence understanding (e.g., text classification, question answering). 
 
In contrast, GPT’s unidirectional attention processes text from left to right, which is better suited for generative tasks like text completion. 
 
<b>Additional Comment:</b>
 
Since BERT can take into account the left and right context of the word being encoded, it is able to capture dependencies across the entire sentence, helping the model make sense of the meaning based on the surrounding words. On the other hand, GPT's consideration of previous words only limits the ability to capture the full context in situations where the meaning of a word might depend on future words in a sentence. Since bidirectional models are better able to resolve ambiguities and generate more accurate word representations, including better representation of sentence-level meaning and relationships between words, this results in better results across various linguistic domains such as question answering and sentiment analysis.
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 11.9 ==
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
=== Question ===
How do you decide whether a task is more suited for a GPT or a BERT model?
 
=== Solution ===
Due to the inherent difference between GPT and BERT (unidirectional vs bidirectional), BERT has a lot more weights that is being trained.
As a result, tasks that requires less of a bidirectional relationship such as summarization, which can be done by taking into account of the
previous words (the words coming after doesn't influence much of what the next word should be), GPT is a great choice. It would be more efficient
as there are less weights to train. However, for something like sentimental analysis, BERT would be a better choice as you are trying to extract
some sort of understanding/meaning of an entire sentence, so every word should be considered with respect to all the words before and after within the text.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 11.10 ==
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
Reference: Lecture 11 on LEARN
=== Question ===
Explain the key architectural difference between BERT and GPT in terms of how they process text.
 
=== Solution ===
BERT uses encoder blocks to process text bidirectionally, meaning it considers both left and right context when encoding a sentence.
GPT uses decoder blocks and processes text unidirectionally, meaning it only considers past tokens (left-to-right) when generating text.
Encoders (BERT) are better for understanding context, while decoders (GPT) are better for generating coherent sequences.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 11.11 ==
<b>Level:</b> ** (Medium)
 
<b>Exercise Types:</b> Slightly Modified
 
Reference: Understanding Deep Learning
=== Question ===
Write the mathematical formulation of the Multiple Head Self Attention mechanism and provide code that would calculate this multi-head self attention for 2 heads.
 
=== Solution ===
 
To begin, let us provide the mathematical formulation of Multiple Head Self Attention:
 
<math>  V_h = \beta_{vh} \textbf{1}^T + \Omega_{vh}X </math>
<math> K_h = \beta_{kh} \textbf{1}^T + \Omega_{kh}X </math>
<math> Q_h = \beta_{qh} \textbf{1}^T + \Omega_{qh}X </math>
 
Therefore,
<math> SA_h(X) = V_h \text{Softmax} \Big(\frac{K^T_hQ_h}{\sqrt{D_q}} \Big) </math>
 
 
Where we have different parameters for each head: <math> \{\beta_{vh}, \Omega_{vh} \}, \{\beta_{kh}, \Omega_{kh} \}$ </math> and <math> $\{\beta_{qh}, \Omega_{qh} \} </math>
 
If the dimension of the <math> \textbf{x}_m </math> inputs is of D, and there are H heads, the keys, values and queries will all be of size D/H. Let us also note that the outputs of these self-attention mechanisms are vertically concatenated and another linear transformation is applied to combine them. This linear combination <math> \Omega_c </math> concludes the Multi-head self-attention:
 
<math> MhSa(X) = \Omega_c \Big( Sa_1(X)^T, ... , Sa_H(X)^T\Big) ^T </math>
 
 
 
Now, let is provide the pseudo codes to implement this scheme. Let us begin by defining our softmax function:
 
<pre>
def softmax_cols(X):
    exp_values = np.exp(X)
    denom = np.sum(exp_values, axis = 0)
    softmax = exp_values / denom
    return softmax
 
 
def multihead_scaled_self_attention(X,omega_v1, omega_q1, omega_k1, beta_v1, beta_q1, beta_k1, omega_v2, omega_q2, omega_k2, beta_v2, beta_q2, beta_k2, omega_c):
 
    one_vec_T = np.transpose(np.ones(N, dtype=int))
 
    V1 = np.outer(beta_v1, one_vec_T) + omega_v1 @ X
    Q1 = np.outer(beta_q1, one_vec_T) + omega_q1 @ X
    K1 = np.outer(beta_k1, one_vec_T) + omega_k1 @ X
 
    V2 = np.outer(beta_v2, one_vec_T) + omega_v2 @ X
    Q2 = np.outer(beta_q2, one_vec_T) + omega_q2 @ X
    K2 = np.outer(beta_k2, one_vec_T) + omega_k2 @ X
 
    SA_1 = V1 @ softmax_cols((np.transpose(K1) @ Q1)/np.sqrt(D))
    SA_2 = V2 @ softmax_cols((np.transpose(K2) @ Q2)/np.sqrt(D))
 
    X_prime = omega_c @ np.vstack((SA_1, SA_2))
 
    return X_prime
</pre>
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 11.12 ==
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
Use a pretrained BERT model to perform sentiment analysis on the following review of a wireless keyboard:
 
“works great, very nice to have the keyboard and the mouse built in. only thing is I wish it was backlit because its hard to see the keys in the dark, otherwise very nice! also very lightweight.”
 
Output the sentiment label (positive, neutral, or negative) and the model’s confidence in its prediction.
 
=== Solution ===
 
<source lang="python">
 
from transformers import BertForSequenceClassification, BertTokenizer
from transformers import pipeline
 
# Load the pretrained BERT model for sentiment analysis
model_name = "nlptown/bert-base-multilingual-uncased-sentiment"
model = BertForSequenceClassification.from_pretrained(model_name)
tokenizer = BertTokenizer.from_pretrained(model_name)
 
# Create a sentiment analysis pipeline
sentiment_pipeline = pipeline("sentiment-analysis", model=model, tokenizer=tokenizer)
 
# Perform sentiment analysis
sentence = "works great, very nice to have the keyboard and the mouse built in. only thing is I wish it was backlit because its hard to see the keys in the dark, otherwise very nice! also very lightweight."
result = sentiment_pipeline(sentence)
 
# Output:
print(result)
 
</source>
 
Output:
 
[{'label': '4 stars', 'score': 0.8854855895042419}]
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 11.13 ==
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Modified
 
<b>Reference:</b> Deep Learning - Foundations and Concepts, by Christopher M. Bishop and Hugh Bishop. Exercise 12.16
 
=== Question ===
The BERT-Large model (Devlin et al., 2018) has a maximum input length of 512 tokens, each of dimensionality <math>D = 1024</math> and taken from a vocabulary of 30,000. It has 24 transformer layers each with 16 self-attention heads with <math>D_q = D_k = D_v = 64</math>, and the MLP position-wise networks have two layers with 4096 hidden nodes. Show that the total number of parameters in the BERT encoder transformer language model is approximately 340 million.
 
=== Solution ===
Token embeddings: 30,000 × 1024 = 30.72 million
 
Position embeddings: 512 × 1024 = 0.524 million
 
Segment embeddings: typically 2 × 1024 = 0.002 million
 
<b>Embedding layer total: </b> ~31.25 million
 
Each transformer layer has:
 
Query, key, value projection matrices: 1024 × 1024 = 1.048 million
 
Output projection: 1024 × 1024 = 1.048 million
 
First dense layer: 1024 × 4096 = 4.194 million
 
Second dense layer: 4096 × 1024 = 4.194 million
 
Total per transformer layer: 4 × 1.048 + 4.194 + 4.194 = 12.58 million
 
<b>24 transformer layers:</b> 24 × 12.58 = 301.92 million
 
<b>Final classification layer:</b> 1024 × 30000 = 30.72 million
 
<b>Total number of parameters:</b> 31.25 + 301.92 + 30.72 is approximately 340 million.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 11.14 ==
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
 
1. What was the key improvement in GPT 2 compared to GPT 1?
 
2. How did GPT 3 enhance the capabilities of GPT 2?
 
3. In what ways did GPT 4 surpass GPT 3 in terms of performance?
 
=== Solution ===
 
1. GPT 2 had 48 layers which is significantly more than GPT 1 (14 layers), which improved its ability to generate coherent and contextually relevant text. GPT 1 focuses on unsupervised pre-training, Transformer architecture, large-scale language modeling, while GPT 2 focuses on transformer architecture, self-attention mechanism.
 
2. GPT3 took the idea of scaling even further with 175 billion parameters, compared to GPT 2's 1.5 billion. This allowed GPT 3 to perform more complex tasks with fewer examples (few-shot learning), and it improved its performance on a variety of NLP tasks without task-specific fine-tuning.
 
3. GPT 4 has about 1.76 billion parameters and improved upon GPT 3 by incorporating better handling of nuanced language, reducing hallucinations, and providing more reliable and contextually appropriate outputs. It also introduced better multimodal capabilities, meaning it can process and generate both text and images. GPT 4 also enhanced its ability to follow user intent with better alignment and reduced bias compared to GPT 3.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
 
 
== Exercise 11.15 ==
 
<b>Level:</b>  * (Easy)
 
<b>Exercise Types:</b> Novel
 
<b>Reference:</b> (Jacob Devlin, Ming-Wei Chang, Kenton Lee, and Kristina Toutanova) BERT: Pre-training of Deep Bidirectional Transformers for Language Understanding (2018)
 
 
=== Question ===
 
1. What are the two main tasks of BERT, and what are their purposes?
 
2. When computing the loss function for the MLM pretraining task, which tokens participate in the calculation? Is it all 15% of the words or only the tokens that are actually masked?
 
3. How does the implementation of the loss function ensure that unmasked tokens do not participate in loss calculation?
 
=== Solution ===
 
1.
 
BERT has two primary tasks:
 
- Masked Language Model (MLM): This task aims to predict the original form of certain words in a sentence. During training, BERT randomly selects some words and replaces them with the “[MASK]” token. The model's task is to predict the original words that were replaced. This approach allows BERT to learn both the semantics of sentences and the relationships between words.
 
- Next Sentence Prediction (NSP): This task aims to predict whether one sentence follows another. During training, BERT takes two sentences and determines whether the second sentence is the actual next sentence of the first one. This helps the model better understand the contextual relationship between sentences.
 
2.
 
Only the tokens that are actually masked participate in the loss calculation.
 
Specifically, during training, BERT randomly selects 15% of the tokens and replaces some of them with the “[MASK]” token. The model is then trained to predict the original words. When computing the loss function, only the tokens that were actually replaced by “[MASK]” are included in the calculation, while the others are ignored.
 
3.
 
To ensure that only masked tokens contribute to the loss function, a mask vector is used to indicate which tokens are masked and which are not.
 
The mask vector assigns a value of 1 to masked tokens and 0 to unmasked tokens.
When computing the loss, the mask vector is multiplied with the predicted tokens and actual tokens, ensuring that the loss for unmasked tokens is set to 0.
 
In PyTorch, this can be implemented as follows:
<pre>
loss_mask = torch.tensor(mask, dtype=torch.float32)  # mask is the mask vector
predictions = model(tokens)  # tokens are the input tokens
loss = loss_function(predictions, labels)
masked_loss = torch.sum(loss * loss_mask) / torch.sum(loss_mask)
</pre>
 
This ensures that only masked tokens are included in the loss calculation.
 
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 12.1 ==
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
Describe the three phase training approach of RLHF to allow models such as BERT and GPT to be able to interact with users and follow instructions while remaining ethical.
 
=== Solution ===
 
1. Supervise fine tuning
This allows a pre-trained model to understand specific tasks and guidelines through prompts. For example "summarize", "describe the process", etc. These prompts are given to the model along with the desire output to allow the model to understand different tasks.
Some examples of types of prompts include brainstorming: e.g "list 5 ideas", classification: e.g "rate on a scale from 1 to 10", generation: e.g "write a story about...".
 
The model is able to generalize quite well to these types of prompts. For example, when trained on the prompt: Q: "what is the capital of France", A: "Paris", the model is able to generalize and know what token to predict next when asked a prompt such as "what is the capital of Canada", as it is able to generalize what the capital of a country is, and search through its corpus to predict the correct answer "Ottawa".
 
2. Training a reward model
After supervise fine tuning (SFT), we next try to improve this model by rewarding the model for producing good responses. Given a prompt, the SFT model produces different responses. For each possible pair given the different responses, a human than ranks which response is better. We then train a separate model, which follows the same architecture as the SFT, but the last linear layer is removed, and replaced with a different linear layer, which will then output a scalar value, which represents the "reward" of the answer to the prompt. Given a pair of answers, our loss function is then <math>loss(\theta)= \mathbb{E}[\log(\sigma(r_w - r_l)]</math>. That is, our loss function works to maximize the difference between the winning vs losing responses, in order to tune our reward model.
 
3. Reinforcement learning from human feedback
Now that we have 2 models, a SFT model and a reward model, we can create a new reinforcement learning model that is able to learn on the go.
 
The first step is to clone the SFT model. We then update the weights of this new model in order to maximize the reward. More specifically, the process goes as follows:
 
a. The model generates a token <math>x_t</math> based on previous tokens <math>x_{t-1},,...,x_0</math>, and continues to generate tokens until the sequence is complete.
 
b. After finishing generating the sequence, the reward model assigns a reward <math>r(x)</math>
 
c. The weights of the reinforcement learning model are updated using policy gradient update.
 
The final loss function used to update the reinforcement model is:
 
<math>w \leftarrow w+\alpha\nabla_wJ(p_w)</math>, where <math>J(p_w) = \mathbb{E}_{x\sim p_w} [r(x) - \beta KL (p_w(x), p_{SFT}(x))] + \gamma \mathbb{E}_{x\sim pretrain}[\log(p_w(x))]</math>.
 
Note that the KL divergence term is subtracted so that the reinforcement model does not deviate too much from the SFT model. (KL divergence is closer to 0 if the probability distributions are more similar). The final term is added to ensure the RL model aligns with the original pretrained base. This terms ensure our RL model does not change too drastically. After updating the RL model for some steps, we initialize a new reward model from it and retrain the reward model in order to keep finetuning the RL model.
 
4. Ethical Considerations and Real-World Applications
 
Incorporating human feedback in RLHF presents ethical advantages but also challenges:
 
a. Avoiding Bias: Ensuring feedback is diverse to prevent reinforcing harmful biases is critical to training fair models.
 
b. Transparency and Accountability: Clear documentation on how feedback is incorporated builds trust and allows for accountability in AI systems.
 
c. Applications in Sensitive Areas: RLHF is used in areas like healthcare and education, but it’s crucial to ensure AI systems provide accurate, evidence-based information, particularly when patient safety is involved.
 
d. Ethical User Interaction: Models like BERT and GPT should avoid generating harmful content. The reward model should include ethical guidelines to maintain socially accepted norms.
 
Conclusion: By considering ethical standards in RLHF, we can ensure that models perform effectively while remaining responsible and beneficial to society.
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 12.2 ==
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
What is achieved in each of the three phases of reinforcement learning with human feedback (RLHF), how are these 3 phases implimented, and how does direct preference optimzation (DPO) improve upon RLHF as the current state-of-the-art model?
 
=== Solution ===
 
The first phase of RLHF is Supervised Fine Tuning (SFT).  This is done on top of a pre-trained LLM to further refine it's training.  Without SFT, LLMs are primarily suited for predicting the statistically most likely next token.  However, just predicting the statistically most likely next token isn't well suited for many applications of these models, such as the chat like nature of ChatGPT.  To make the LLM more suited for chat-like applications, during SFT the model is refined to be able to respond well to typical human entered prompts with reasonable responses.  To do this, prompts and sample responses are generated manually then fed into the model to be trained on.  As a result of this, the model better responds to human prompts in an expected conversation-like manner, rather than just predicting the most likely next word based on the training dataset.
 
 
The second phase of RLHF is training a Reward Model (RM).  Whereas SFT helped the LLM generate a response formatted in the desired manner, it doesn't necessarily always follow the user's intent or ethical requirements.  A reward model is therefore developed to predict how a human would rate a given response.  To achieve this, the last linear embedding layer is removed from the transformer, and replaced with a new randomly initialized linear layer with a single output value, the predicted reward of the model.  This new model is trained based on human feedback of sample generated responses to generate a numeric value for how well a response would be perceived by humans.  This reward model is then used in the next phase to optimize the model.
 
 
The third phase of RLHF training is the RLHF phase.  SFT produces responses to questions, but the responses may not necessarily abide by what is desired by the output of the LLM.  The RM model is able to predict a numeric score of the quality of the model output, but does nothing to actually train the LLM and adjust it's weights to produce more preferential outputs.  The reinforcement learning model combines these two to train a model which produces responses to the questions which align with the human scored values where were trained during the RM phase.  This is handles through a reinforcement-learning approach.  The state (previous encoded words), action (next generated word) and rewards (output of the RM) are known.  Reinforcement learning is then used to generate a new loss function which maximizes the reward from the RM model while satisfying the SFT tuned model and original model outputs.  The model is then retrained with this new loss function and learns to produce better responses which still satisfy the original model, SFT model, while maximizing the RM.
 
 
Direct preference optimization uses the same SFT phase as mentioned above like RLHF.  Human-labelled pairs of preferred output responses are created, similar to the reward model step in RLHF.  However, for DPO, a loss is used which is able to directly update the weights of the LLM without the requirement to generate a RM to numerically score outputs, and without the requirement to use reinforcement learning to update the weights. As a result, DPO reduces the complexity and increases stability over DPO. 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 12.3 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
'''Reference:''' https://www.ibm.com/think/topics/rlhf
 
=== Question ===
 
How does reinforcement learning from human feedback (RLHF) work, and why is it particularly useful for tasks with complex or ill-defined goals?
 
=== Solution ===
 
Reinforcement learning from human feedback (RLHF) is an advanced machine learning paradigm where the optimization of an artificial intelligence (AI) agent is achieved through a reward model that is trained using direct human feedback. In this approach, human evaluators provide feedback on the AI's actions or outputs, which is then translated into numerical values used to update the agent's behavior. This feedback serves as the basis for refining the model's decision-making process via reinforcement learning algorithms, where the agent learns to maximize rewards over time.
 
RLHF is particularly advantageous for tasks where the goals or desired outcomes are complex, subjective, or difficult to formally define in a mathematical framework. For example, when dealing with abstract tasks like humor, creativity, or ethical behavior—domains where traditional reinforcement learning struggles due to the absence of well-defined success metrics—human feedback can provide nuanced guidance. Rather than relying on rigid objectives, RLHF allows the system to be trained to align with human preferences and values by incorporating subjective judgments into the reward function.
 
The process typically involves multiple phases: initially, the model is pre-trained on large datasets, followed by supervised fine-tuning to guide its responses according to human expectations. In the RLHF phase, human evaluators provide comparative feedback on the model’s outputs, which is used to construct a reward model. This reward model translates qualitative human preferences into a scalar reward signal, which the reinforcement learning algorithm uses to adjust the model’s policy and improve performance. Through iterative feedback and optimization, the AI agent refines its responses to better reflect human values and achieve more contextually appropriate outcomes.
 
RLHF has been instrumental in enhancing large language models (LLMs) by improving their ability to generate coherent, accurate, and contextually sensitive text, surpassing previous limitations in traditional supervised learning. For instance, LLMs such as OpenAI's InstructGPT have shown remarkable improvements in following instructions, avoiding model hallucinations, and maintaining factual accuracy, largely due to the integration of RLHF techniques.
 
=== Additional Commments ===
I think the key that distinguishes the RLHF to DOP for ill defined goals is that usage of a reward model. When we humans are not too sure, the extra complexity of the RLHF architecture may lead us to better results. If the model deviates a bit away from what the humans fine tuned it as,
it may be optimal since the labelers are not completely confident either.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 12.4 ==
 
<b>Level:</b>  ** (Moderate)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
In reinforcement learning with human feedback (RLHF),<math>w_{k+1} = w_k + \alpha \nabla_w J(\pi_w),
</math>
 
where:
<math>w_k</math> represents the policy parameters at step <math>k</math>,
<math>\alpha</math> is the learning rate,
<math>\nabla_w J(\pi_w)</math> is the policy gradient.
 
However, instead of standard policy gradient updates, we use a reward model (RM) to refine policy updates based on human feedback:
 
<math>
m_{k+1} = \beta m_k + (1 - \beta) \nabla_w J_{RM}(\pi_w)
</math>
 
<math>
w_{k+1} = w_k + \alpha m_{k+1}
</math>
 
where:
<math>m_k</math> is the momentum term, which accumulates past gradients,
<math>\beta</math> is the momentum coefficient,
<math>J_{RM}(\pi_w)</math> is the reward-adjusted policy gradient based on human feedback.
 
Given:
 
- Initial policy weight: <math>w_0 = 1.0</math>
 
- Initial momentum: <math>m_0 = 0.0</math>
 
- Learning rate: <math>\alpha = 0.1</math>
 
- Momentum coefficient: <math>\beta = 0.9</math>
 
- Reward-adjusted policy gradients at each step: <math>\nabla_w J_{RM}(\pi_w) = [2.0, 1.8, 1.6, 1.5]</math>
 
a. Compute the first three iterations (<math>w_1, w_2, w_3</math>) using the momentum-based policy gradient ascent with reward-adjusted updates.
 
b. Compare the results with vanilla gradient ascent (without momentum). Which method converges faster?
 
c. If the learning rate increases to <math>\alpha = 0.5</math>, what risks arise, and how does it affect convergence?
 
=== Solution ===
 
a. Iteration 1 (<math>k = 0</math>):
<math>
m_1 = (0.9 \times 0) + (1 - 0.9) \times 2.0 = 0.2
</math>
<math>
w_1 = 1.0 + 0.1 \times 0.2 = 1.02
</math>
 
Iteration 2 (<math>k = 1</math>):
<math>
m_2 = (0.9 \times 0.2) + (1 - 0.9) \times 1.8 = 0.38
</math>
<math>
w_2 = 1.02 + 0.1 \times 0.38 = 1.058
</math>
 
Iteration 3 (<math>k = 2</math>):
<math>
m_3 = (0.9 \times 0.38) + (1 - 0.9) \times 1.6 = 0.502
</math>
<math>
w_3 = 1.058 + 0.1 \times 0.502 = 1.1082
</math>
 
 
b. <math>
w_3 = 1.38 + 0.1 \times 1.6 = 1.54
</math>
 
Comparison:
Momentum-based updates smooth policy updates, avoiding abrupt changes.
Vanilla gradient ascent updates faster initially but lacks stability.
 
 
c. If <math>\alpha</math> is increased, updates become larger:
<math>
w_{k+1} = w_k + 0.5 \times m_{k+1}
</math>
 
Potential Risks:
Divergence: If updates overshoot the optimal value, learning becomes unstable.
 
Oscillations: The policy may fluctuate between actions without settling.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 12.5 ==
 
<b>Level:</b>  * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
What are the top models in the world across various tasks—including general reasoning, mathematical reasoning, code generation and how do their performances compare?
 
=== Solution ===
 
 
Below is a comparative table outlining key performance metrics for several leading AI models. For language and reasoning tasks, the benchmarks include MMLU (general reasoning), GSM8K (mathematical reasoning), and HumanEval (code generation).
 
<table border="1" cellspacing="0" cellpadding="5">
  <tr style="background-color: #e6f2ff;">
    <th>Model</th>
    <th>Provider</th>
    <th>MMLU (General Reasoning)</th>
    <th>GSM8K (Math)</th>
    <th>HumanEval (Code)</th>
  </tr>
  <tr>
    <td>GPT-4</td>
    <td>OpenAI</td>
    <td>~86.4%</td>
    <td>92.0%</td>
    <td>~67%</td>
  </tr>
  <tr>
    <td>GPT o3‑mini‑high</td>
    <td>OpenAI</td>
    <td>~86.9%</td>
    <td>~97.9%</td>
    <td>Top Code ELO</td>
  </tr>
  <tr>
    <td>Claude 2</td>
    <td>Anthropic</td>
    <td>~80–82%</td>
    <td>88%</td>
    <td>71.2%</td>
  </tr>
  <tr>
    <td>Gemini Ultra</td>
    <td>Google</td>
    <td>&gt;88%</td>
    <td>&gt;92%</td>
    <td>&gt;88%</td>
  </tr>
  <tr>
    <td>LLaMA 2 70B Chat</td>
    <td>Meta</td>
    <td>~70%</td>
    <td>~55%</td>
    <td>~30%</td>
  </tr>
  <tr>
    <td>Mistral 7B Instruct</td>
    <td>Mistral AI</td>
    <td>~65% (est.)</td>
    <td>~35% (est.)</td>
    <td>~20–30% (est.)</td>
  </tr>
  <tr>
    <td>DBRX</td>
    <td>Databricks</td>
    <td>73.7%</td>
    <td>66.9%</td>
    <td>70.1%</td>
  </tr>
  <tr>
    <td>DeepSeek V3</td>
    <td>DeepSeek</td>
    <td>~88%</td>
    <td>~89%</td>
    <td>~83%</td>
  </tr>
  <tr>
    <td>ChatGPT o1 Pro mode</td>
    <td>OpenAI</td>
    <td>92.3%​</td>
    <td>~95%</td>
    <td>92.4%</td>
  </tr>
</table>
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 12.6 ==
 
<b>Level:</b>  * (Easy)
 
<b>Exercise Types:</b> Novel
 
=== Question ===
What are the advantages and disadvantages of Reinforcement Learning from Human Feedback compared to Direct Preference Optimization?
 
=== Solution ===
Due to the architectural differences between the two, RLHF has more flexibility with its reward model. RLHF handles various types of human feedback, such as numerical ratings, textual corrections, or scalar reward values, while DPO requires binary preferences (A vs. B comparisons). This can be an advantage or a disadvantage depending on the situation. But this also means that it takes a lot longer to train using RLHF as it may run into divergence issues due to its complexity. In other words, DPO is simpler and more efficient. This simplicity also ensures that the resulting model sticks to the human preferences inputs
rather than deviating too far away which may happen with RLHF.
 
One of the main differences between RLHF and DPO is how they scale in real-world applications. RLHF requires training and fine-tuning a separate reward model, which increases computational costs and makes the process more resource-intensive. In contrast, DPO directly optimizes policy parameters based on human preferences without requiring a learned reward function, making it more computationally efficient. However, because DPO only relies on explicit preference pairs, it may struggle when preference data is limited or inconsistent, whereas RLHF can generalize better by leveraging soft reward signals that allow for more nuanced learning.
 
Another key distinction is how each method balances exploration and exploitation during training. Since RLHF continuously refines its policy using an evolving reward model, it can generalize to a wider range of tasks, even when explicit preference labels are not available for every scenario. On the other hand, DPO strictly follows provided human preferences and does not introduce additional reward shaping, which means it is less flexible in adapting to unseen cases. This difference makes RLHF more effective for open-ended tasks like dialogue modeling, where human preferences can be ambiguous or context-dependent, while DPO is better suited for structured ranking tasks where binary preferences provide a clear supervision signal.
 
Example Applications:
 
- RLHF: Used in chatbots (ChatGPT, Claude) to refine conversational AI by incorporating diverse human feedback, such as ranking multiple completions or providing free-text corrections
 
- DPO: Used in ranking systems (search engine results, content recommendations) where pairwise preference data helps optimize content ordering efficiently
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 12.7 ==
 
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
References: A. Ghodsi, STAT 940 Deep Learning: Lecture 12, University of Waterloo, Winter 2025.
 
=== Question ===
Explain the purpose of alignment in LLMs and how this affects LLMs ability to complete tasks. List some examples of training methods for alignment.
 
=== Solution ===
The alignment aims to align GPT's responses with users' instructions and ethical standards. It makes sure that the GPT can produce responses that are not only gramatically correct and statistically relevant, but also meet users' intentions and are not harmful. The purpose is to make the model more useful and trustworthy.
 
The alignment in LMs train the models with users' intentions, it helps to produce accurate and relevant results following users' instructions, and avoids bais, toxicity, or harm.
 
Some training methods are: <br />
1. Filtering pretraining datasets: remove harmful data from the input to the LLMs.<br />
2. Fine-tuning on value-targeted datasets: train the model with data from a specific domain.<br />
3. Learn from human feedback.<br />
4. Reinforcement learning: using reward functions that optimize for ethicality and factuality.
 
 
Additional note:
 
Adversarial training is another method that can be used to improve alignment: the model is given tough examples that are specifically designed to challenge it, like situations where it might give biased or harmful responses; By training with these tricky examples, the model learns to handle such situations better and becomes stronger at avoiding bad or undesirable outputs.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 12.8 ==
 
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
=== Question ===
 
Answer the following 2 questions:
 
1. How does KL Divergence explain the trade-off between SFT and RL model distributions?
 
2. How does DPO improve a model with human feedback, and how is it different from RLHF?
 
=== Solution ===
 
1. KL Divergence measures how different the output distributions of two models are. Here, we’re comparing the SFT model (trained with labeled data) and the RLHF model (trained with human feedback). The formula for KL Divergence is:
 
<math> D_{KL}(P \parallel Q) = \sum_{x} P(x) \log\left(\frac{P(x)}{Q(x)}\right) </math>
 
Where:
 
- <math>P(x)</math> is the probability distribution of the SFT model.
 
- <math>Q(x)</math> is the probability distribution of the RLHF model.
 
So,
 
- Small KL Divergence: If the KL Divergence is small, it means the RLHF model is very close to the original SFT model. This shows the model hasn’t changed much and still behaves similarly but may not fully reflect human preferences.
 
- Large KL Divergence: A large KL Divergence means the RLHF model has shifted significantly from the SFT model. This happens because RLHF introduces human feedback, making the model more likely to produce responses that align with human preferences, but it might not be as consistent with the original SFT model anymore.
 
In short, KL Divergence helps us understand the trade-off between keeping the model close to the original SFT model and adapting to human preferences.
 
 
2. The main difference between DPO and RLHF is how they use feedback. In DPO, feedback is gathered through pairwise comparisons. This means humans are shown two responses to the same question and pick the one they like better. The model then adjusts itself based on this feedback to generate answers that better match what people want. On the other hand, RLHF is more complex. It uses a reward system that assigns a score to each response depending on how well it matches human preferences. The model aims to maximize that score. It also requires exploration, where the model tries different responses, gets rewards, and adjusts over time to improve. This makes RLHF slower and more resource-heavy because the model needs to explore a wide range of possible answers before finding the best ones. DPO simplifies the process by focusing on pairwise comparisons only, so it doesn’t need exploration. Instead of giving scores to responses, DPO directly uses the feedback more efficiently. It fine-tunes a pre-trained model, which means it doesn’t need to be retrained from scratch, making DPO a faster way to align the model with human preferences.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 12.9 ==
 
'''Level:''' * (Medium)
 
'''Exercise Types:''' Novel
 
=== Question ===
What is AI agent? Explain how RLHF and DPO can be useful in training AI agent. Provide a sample python code training AI agent with RLHF.
 
=== Solution ===
AI agents are systems where LLMs dynamically direct their own processes and tool usage, maintaining control over how they accomplish tasks. RLHF and DPO can be useful in the "evaluator-optimizer" workflow in building an AI agent to fine-tuning the original model weights. Below is a python code example: 
<source lang="python">
import gym
from stable_baselines3 import PPO
from stable_baselines3.common.vec_env import DummyVecEnv
 
# Step 1: Create a Gym environment
env = gym.make("CartPole-v1")
env = DummyVecEnv([lambda: env])  # Wrap for compatibility
 
# Step 2: Train a base PPO model
model = PPO("MlpPolicy", env, verbose=1)
model.learn(total_timesteps=10000)
 
# Simulated human feedback function
def human_feedback(obs, action):
    """
    Simulates human feedback: penalizes large pole angles.
    Returns +1 for good actions, -1 for bad ones.
    """
    pole_angle = obs[2]  # Extract pole angle from observation
    return -1 if abs(pole_angle) > 0.2 else 1
 
# Step 3: Fine-tune the model using human feedback
def train_with_human_feedback(model, env, feedback_epochs=5, episodes_per_epoch=10):
    for epoch in range(feedback_epochs):
        total_human_reward = 0
        observations, actions, rewards = [], [], []
       
        for _ in range(episodes_per_epoch):
            obs = env.reset()
            done = False
            episode_rewards = []
           
            while not done:
                action, _ = model.predict(obs)  # Get action
                obs, reward, done, _ = env.step(action)  # Apply action
                feedback = human_feedback(obs[0], action)  # Get human feedback
               
                adjusted_reward = reward + feedback  # Adjust reward
               
                observations.append(obs)
                actions.append(action)
                rewards.append(adjusted_reward)
                episode_rewards.append(adjusted_reward)
 
            total_human_reward += sum(episode_rewards)
 
        print(f"Epoch {epoch + 1}/{feedback_epochs}: Total Adjusted Reward = {total_human_reward}")
       
        # Fine-tune PPO model with new rewards
        model.learn(total_timesteps=2000)
 
# Step 4: Apply human feedback training
train_with_human_feedback(model, env, feedback_epochs=5)
 
# Step 5: Test the final agent
obs = env.reset()
done = False
while not done:
    action, _ = model.predict(obs)
    obs, reward, done, _ = env.step(action)
    env.render()
 
env.close()
 
</source>
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 12.10 ==
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
=== Question ===
Pause and think on the limitations of AI alignment through supervised fine tuning and RLHF. Why can we never be sure that a language model will not behave an unethical way when it is the victim of prompt injection and other more sophisticated techniques? Due to what architectural / fundamental reasons might this be the case?
 
=== Solution ===
 
1. Distributional Limits:
 
When fine-tuning language models using RLHF, we are using a finite distribution of human preferences. However, the space in which we deploy them is effectively unbounded. The result is that no matter how comprehensive the RLHF training is, one cannot cover all exploitable gaps. Additionally, adversarial attacks and novel inputs outside the training distribution can still manipulate or trick the model into undesirable behaviors.
 
2. Problems in optimizing for a proxy objective:
 
When performing RLHF, we are optimizing for a proxy of human values with our reward model. This is not the same as training on human values themselves. There is no guarantee that this model does not contain spurious optima that might optimize our proxy for human values while actually violating the intended values of the model.
 
3. Base Capabilities:
 
No matter what, our core capabilities learned during pre-training are retained in the model weights, including many dangerous pieces of information. The alignment effort amounts to a thin behavioral safeguard, and if bypassed, one has unfettered access to model capabilities. Fine-tuning and RLHF primarily modify the output distribution rather than fundamentally changing the model’s internal knowledge, meaning that misalignment risks persist.
 
<b>Additional Comment:</b>
 
Because we do not fully understand how deep learning models are able to generalize knowledge internally, it is difficult to anticipate all possible failure cases, even with rigorous fine-tuning. Additionally, if a model learns to optimize for human values, it may not be truly aligned with those values, leading to unpredictable behavior in new situations.
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 12.11 ==
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
=== Question ===
'''Deterministic vs Stochastic Policy'''
 
Consider a reinforcement learning agent navigating a grid world where the agent can move left or right.
 
Two policies are defined:
 
Policy '''A''' (Deterministic): Always move right.
 
Policy '''B''' (Stochastic): Move right with probability 0.7 and left with probability 0.3.
 
Compute the expected return if the agent starts at <math> s_{0} </math> and receives a reward of +1 for reaching <math> s_{1} </math> and -1 for reaching
<math> s_{2} </math>.
 
=== Solution ===
* Policy '''A''' (Deterministic): Always moves right, so the expected return is +1.
* Policy '''B''' (Stochastic):
With probability 0.7, the agent moves right and gets +1.
 
With probability 0.3, the agent moves left and gets -1.
 
Expected return: 0.7×(+1)+0.3×(−1)=0.7−0.3=0.4
 
Thus, the expected return for:
* Policy '''A''' (Deterministic) = +1
* Policy '''B''' (Stochastic) = +0.4
 
This highlights that deterministic policies can be optimal but may lack exploration, while stochastic policies balance exploration and exploitation.
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 12.12 ==
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
=== Question ===
Provide an example about reinforcement learning
 
=== Solution ===
Reinforcement Learning Example: The Cartpole Problem
 
Reinforcement learning (RL) is a method where an agent learns to take actions in an environment in order to maximize cumulative rewards. A classic example of RL is the cartpole balancing problem.
 
Imagine a cart on a track with a pole attached to its top by a hinge. The goal is to keep the pole from falling by moving the cart left or right.
 
How It Works
 
The agent receives a state vector that might include the cart's position, velocity, the pole's angle, and its angular velocity.
 
Actions: Based on the state, the agent decides whether to move the cart left or right.
 
Reward: The agent gets a positive reward (often +1) for each time step the pole stays upright. If the pole falls, the episode ends.
 
Learning:Algorithms update the agent's policy. The agent uses the rewards to adjust its strategy, improving over many episodes.
 
Python example:
 
<pre>
import gym
import numpy as np
 
def run_cartpole_episode(max_steps=500):
    env = gym.make("CartPole-v1")
    state, info = env.reset()
   
    for t in range(max_steps):
        env.render()
        action = env.action_space.sample()
        next_state, reward, done, truncated, info = env.step(action)
        print(f"Time Step {t}: State: {state}, Reward: {reward}")
        state = next_state
        if done or truncated:
            print(f"Episode finished after {t+1} timesteps")
            break
    env.close()
run_cartpole_episode()
  </pre>
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 12.13 ==
'''Level:''' ** (Moderate)
 
'''Exercise Types:''' Novel
 
'''References:''' Deep Learning Lecture 12 Slide 92, Ali Ghodsi
 
This problem generalized Problem 4.10 in this textbook to <math>N</math> inputs and <math>M</math> outputs.
 
=== Question ===
 
As discussed in Lecture 12, provide in on your own a summary of the relationships between the <math> \pi </math> functions in the DPO loss function. Moreover, provide a description of the functions and what they represent. This will serve as an easy reference for you in the future.
 
=== Solution ===
 
Let us begin by re-stating the DPO loss function:
 
<math> L_{DPO} = - \mathbb{E}_{(x,y_w, y_l)\sim D} \Bigg[ \ln(\sigma) \Bigg( \beta \ln \Bigg( \frac{\pi_\theta(y_w|x)}{\pi_{ref}(y_w|x)} \Bigg) - \beta \ln \Bigg( \frac{\pi_\theta(y_l|x)}{\pi_{ref}(y_l | x)} \Bigg) \Bigg) \Bigg] = - \mathbb{E}_{(x,y_w, y_l)\sim D} \Bigg[ \ln(\sigma) \Bigg( \beta \ln \Bigg( \frac{\frac{\pi_\theta(y_w|x)}{\pi_{ref}(y_w|x)}}{\frac{\pi_\theta(y_l|x)}{\pi_{ref}(y_l | x)}} \Bigg)  \Bigg) \Bigg] = - \mathbb{E}_{(x,y_w, y_l)\sim D} \Bigg[ \ln(\sigma) \Bigg( \beta \ln \Big( \frac{\pi_\theta(y_w|x) \cdot \pi_{ref}(y_l | x) }{\pi_{ref}(y_w|x) \cdot \pi_\theta(y_l|x)}\Big)  \Bigg) \Bigg] </math>
 
 
In the DPO function,
 
 
<math> x </math> represents the prompt
 
 
<math> y_w </math> is the preferred response
 
 
<math> y_l </math> is the less preferred response
 
 
Let us note that response preferences are generated by human rankings.
 
<math> \pi_\theta </math> is the current model's output probabilities
 
 
<math> \pi_{ref} </math> is the model's frozen probabilities
 
 
<math> \beta </math> is the scaling factor
 
 
It is important to note that <math> \pi_\theta(y_w|x) + \pi_\theta(y_l|x) = 1 </math> and <math> \pi_{ref}(y_w|x) + \pi_{ref} (y_l|x) = 1 </math>.
 
 
 
Now, let us assume that <math> \pi_{ref}(y_w|x) = \pi_{ref} (y_l|x) = .5 </math> (the reference has no preference) and that we hold <math> \beta </math> constant:
 
If <math> \pi_\theta(y_w|x) </math> increases, which indicates that a models current output probabilities of the prompt given the preferred response:
 
The Loss function decreases
 
If <math> \pi_\theta(y_l|x) </math> increases, which indicates that a models current output probabilities of the prompt given the less preferred response:
 
The Loss function increases
 
 
Now, let us assume that <math> \pi_\theta(y_w|x) > \pi_\theta(y_l|x) </math>:
 
If <math> \pi_{ref}(y_w|x) </math> increases:
 
The Loss function increases
 
If <math> \pi_{ref}(y_w|x) </math> decreases:
 
The Loss function decreases
 
 
This allows the model to retain memory, and fine tune adjustments without needing to train a reward model, is more stable, and easier to train.
 
 
</div>
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 12.14 ==
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
'''References:''' Deep Learning Lecture 12, Ali Ghodsi
 
===Question ===
What are the key differences between Supervised Fine-Tuning (SFT) and Reinforcement Learning from Human Feedback (RLHF)?
 
===Solution===
{| class="wikitable"
|+ Key Differences Between Supervised Fine-Tuning (SFT) and Reinforcement Learning from Human Feedback (RLHF)
|-
! Feature !! Supervised Fine-Tuning (SFT) !! Reinforcement Learning from Human Feedback (RLHF)
|-
| '''Training Method''' || Trains on a labeled dataset where responses are directly provided by human annotators. || Uses human feedback to rank model outputs, then optimizes using reinforcement learning.
|-
| '''Feedback Type''' || Direct human-provided labels (e.g., a single "correct" response). || Pairwise comparisons or rankings of AI-generated responses.
|-
| '''Learning Approach''' || '''Supervised learning''': The model learns by mimicking human-labeled examples. || '''Reinforcement learning''': The model improves by receiving a reward signal based on human preferences.
|-
| '''Flexibility''' || Limited to the quality and diversity of labeled training data. || More adaptive—learns from human preferences across diverse interactions.
|-
| '''Response Nuance''' || Tends to be formulaic and limited by training data. || Produces more nuanced and context-aware responses.
|-
| '''Training Complexity''' || Simpler: Uses conventional loss functions (e.g., cross-entropy). || More complex: Requires training a '''reward model (RM)''' and reinforcement learning optimization (e.g., Proximal Policy Optimization, PPO).
|-
| '''Computational Cost''' || '''Lower''': Only requires standard model fine-tuning. || '''Higher''': Involves multiple training steps, including reward model learning and RL optimization.
|-
| '''Use Case''' || Best for '''task-specific''' improvements (e.g., classification, summarization). || Best for aligning AI with '''human values and preferences''' (e.g., conversational AI).
|-
| '''Common Weakness''' || Model can '''overfit''' to its training data and struggle with open-ended generation. || Can develop '''reward hacking''', where the model optimizes for the reward function rather than true alignment.
|}
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
== Exercise 12.15 ==
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
===Question ===
 
(a) Explain the main objective of Reinforcement Learning with Human Feedback (RLHF) in the context of training large language models. Why is human feedback important in this setting?
 
(b) Suppose you have a reward model <math>R_\phi</math> parameterized by <math>\phi</math> that is trained to predict human preferences between two model outputs. Describe how you would update <math>\phi</math> using a pairwise ranking loss.
===Solution===
 
(a) The main objective of RLHF is to align the model's outputs with human preferences by using human-generated feedback as a reward signal. This helps ensure the model generates helpful, safe, and high-quality responses that match what users expect, particularly in ambiguous or subjective scenarios where traditional supervised learning might fail.
 
(b) The reward model <math>R_\phi</math> is trained with a pairwise ranking loss. Given two model outputs <math>y_1</math> and <math>y_2</math> with a human preference label indicating which output is better, the loss is:
<math>L(\phi)=-\log \sigma(R_\phi(y_1)-R_\phi(y_2))</math> where <math>\sigma</math> is the sigmoid function. The model learns to assign higher rewards to preferred outputs.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 12.16 ==
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
===Question ===
 
Assuming we are training an intelligent learning assistant, where the assistant presents a question to a student and rewards the student based on their answer. This reward will be used to induct assistant in future learning and optimizing processes. The data you have is as follows:
 
A correct answer gets a reward:
 
<math> r_w </math> = 1
 
A wrong answer gets a reward:
 
<math> r_l </math> = 0
 
Assume the learning assistant predicts the student's answer with a score of <math> r_w </math> = 0.8, meaning the predicted probability of a correct answer is 0.8, and the predicted probability of a wrong answer is 0.2.
 
1. Calculate the loss value for this example.
 
2. Based on the loss, compute the gradient and update the model parameter <math>\theta</math>.
 
===Solution===
 
1. Calculate the loss value:
 
Given the loss function:
loss(<math>\theta</math>) = E[log(<math>\sigma</math>(r_w - r_l))]
 
In this case, we know: <math> r_w</math> = 1, <math> r_l</math> = 0, the predicted reward is <math>r_w</math> = 0.8
 
To calculate <math>r_w - r_l</math>:
 
<math>r_w - r_l = 1 - 0 = 1</math>
 
Then, <math>\sigma</math> (1) = <math>\frac{1}{1+ e(-1)}</math><math>\approx</math> 0.731
 
To calculate the loss:
 
loss(<math>\theta</math>) = log(0.731) <math>\approx</math> -0.313
 
2. Calculate the gradient:
 
Using the gradient formula:
 
<math>\frac{\partial}{\partial \theta}</math>loss(<math>\theta</math>) = (1 -  <math>\sigma (r_w - r_l)</math>) *<math>\frac{\partial}{\partial \theta (r_w - r_l)}</math>
 
1 - <math>\sigma</math>(1) = 1-0.731 = 0.269
 
<math>\sigma (r_w - r_l)</math> = 1
 
<math>\frac{\partial}{\partial \theta}</math>loss(<math>\theta</math>) = 0.269 * 1 = 0.269
 
3. Update the model parameter:
 
<math>\theta_{new} </math> = <math>\theta_{old} </math> - <math>\alpha </math> * <math>\frac{\partial}{\partial \theta} </math>, where <math>\alpha</math> is learning rate.
 
 
 
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
 
== Exercise 12.17 ==
 
<b>Level:</b>  * (Easy)
 
<b>Exercise Types:</b> Novel
 
 
 
=== Question ===
 
1. What are the key principles for ensuring AI alignment in language models?
 
2. How does training a Reward Model (RM) improve GPT’s alignment with human preferences?
 
=== Solution ===
 
1.
 
Aligned language models should adhere to three core principles:
 
1. Helpful: The model should provide useful and relevant responses.
 
2. Honest: It should avoid fabricating information and provide accurate answers.
 
3. Harmless: The model must avoid generating biased, toxic, or harmful content.
 
These principles ensure that language models remain reliable and ethical in real-world applications.
 
2.
 
A Reward Model (RM) is trained to rank responses based on human feedback. It improves alignment by:
 
1. Generating multiple responses for a given prompt using a fine-tuned GPT model.
 
2. Pairing and ranking responses – Humans rank pairs of responses to indicate which one is preferable.
 
3. Training the Reward Model to predict human preferences, which helps reinforce better responses.
 
4. Using the RM in Reinforcement Learning (RLHF) – The reward model guides the reinforcement learning process by scoring outputs, ensuring the model learns to prioritize helpful, ethical, and accurate responses.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 13.1 ==
 
<b>Level:</b> * (Easy)
 
<b>Exercise Types:</b> Novel
 
<b>References:</b> Ou, T. (2022). Variational AutoEncoder, and a bit KL Divergence, with PyTorch. ''Medium.'' medium.com/@outerrencedl/variational-autoencoder-and-a-bit-kl-divergence-with-pytorch-ce04fd55d0d7
 
This is where I got the KL divergence for two Gaussians.
 
=== Question ===
 
(a) For two Gaussians with means <math>\mu_1</math>, <math>\mu_2</math> and variances <math>\sigma_1^2</math>, <math>\sigma_2^2</math>, the KL divergence can be written as:
 
<math>D_{KL} =  \log \frac{\sigma_2}{\sigma_1} + \frac{\sigma_1^2 + (\mu_1 - \mu_2)^2}{2\sigma_2^2} - \frac{1}{2} </math>
 
Suppose the learned latent distribution of a variational autoencoder is the Gaussian <math>\mathcal{N}(\mu = 2, \sigma^2 = 1)</math>. Calculate the KL divergence between this distribution and the standard normal distribution, <math>\mathcal{N}(0, 1)</math>.
 
(b) Calculate the total loss:
 
<math>L = \text{Reconstruction loss} + \beta D_{KL} (\mathcal{N}(2, 1) | \mathcal{N}(0, 1))</math>
 
For <math>\beta = 1</math> and a reconstruction loss of 1.5.
 
(c) In practice, the KL divergence may be weighted by the hyperparameter <math>\beta</math>. What might you observe if <math>\beta</math> is very large? And what might you observe is <math>\beta</math> is very small?
 
(d) Suppose the latent dimension is increased, and the KL divergence is now computed as the sum over multiple independent Gaussian dimensions. How does this affect the total loss, and what does it imply for the model’s behavior?
 
=== Solution ===
 
'''(a) The KL divergence'''
 
<math>D_{KL} (\mathcal{N}(2, 1) | \mathcal{N}(0, 1)) =  0 + \frac{1 + (2 - 0)^2}{2} - \frac{1}{2} = 2 </math>
 
'''(b) The total loss'''
 
<math> L = 1.5 + 1 \times 2 = 2.5</math>
 
'''(c) The hyperparameter, <math> \beta </math>'''
 
If <math>\beta</math> is too large, then the model will learn a latent space that is very similar to the prior (e.g., the standard normal distribution). The reconstructions might be blurry and generic, and look like the average of the training data.
 
If <math>\beta</math> is too small, then reconstruction accuracy is prioritized. In this case, the model may memorize individual images from the training data and will not be able to generalize. Furthermore, the latent space might not have a smooth/coherent organization (if you wanted to interpolate between two data points, you would not get a smooth transition).
 
'''(d)
In a multi-dimensional latent space, the total KL divergence is computed as the sum of the KL divergences for each independent Gaussian dimension:
<math>
D_{KL} = \sum_{i=1}^{d} \left( \log \frac{\sigma_{2,i}}{\sigma_{1,i}} + \frac{\sigma_{1,i}^2 + (\mu_{1,i} - \mu_{2,i})^2}{2\sigma_{2,i}^2} - \frac{1}{2} \right)
</math>
 
As the latent dimension increases, the KL divergence term in the total loss increases proportionally. This means that if 𝛽 remains constant, the regularization effect of the prior (forcing the latent space to be similar to the standard normal) will be stronger.
 
</div>
 
<div style="border: 2px solid #0073e6; background-color: #f0f8ff; padding: 10px; margin: 10px 0; border-radius: 5px;">
 
== Exercise 13.2 ==
'''Level:''' * (Easy)
 
'''Exercise Types:''' Novel
 
This problem serves as a practice to better understand KL Divergence for discrete distributions.
 
=== Question ===
 
Suppose you have the following discrete probability distributions:
 
<math> P = [0.3, 0.3, 0.4] </math>
 
<math> Q = [0.25, 0.4, 0.35] </math>
 
Now compute the <math> D_{KL}[P||Q] </math>
 
=== Solution ===
 
<math> D_{KL}[P||Q] = -\sum^3_{I=1} P_i \ln(\frac{P_i}{Q_i}) \approx 0.0218 </math>
 
 
 
</div>
 
== Fundamental Problems ==
 
=== Classification ===
 
Consider data <math>\{(x_i, y_i)\}_{i=1}^n</math> where <math>x \in \mathbb{R}^d</math> and <math>y_i \</math> takes values in some finite set.
 
Find a function <math>f</math>, such that when we observe a new <math>x</math> we predict <math>y</math> to be <math>f(x)</math>.
 
=== Regression ===
 
Consider data <math>\{(x_i, y_i)\}_{i=1}^n</math> where <math>\mathbf{x} \in \mathbb{R}^d</math> and <math>y_i</math> takes values in <math>\mathbb{R}</math>.
 
Find a function <math>f</math>, such that when we observe a new <math>\mathbf{x}</math> we predict <math>y</math> to be <math>f(\mathbf{x})</math>.
 
=== Clustering ===
 
Consider data <math>\{x_i\}_{i=1}^n</math> where <math>\mathbf{x} \in \mathbb{R}^d</math>.
 
Find a function <math>f</math>, when we observe a new <math>\mathbf{x}</math> we predict <math>y</math> to be <math>f(\mathbf{x})</math>, such that for similar <math>\mathbf{x}</math>, <math>y</math> is the same.
 
== Perceptron ==
 
Define a cost function, <math>\phi(\beta, \beta_0)</math>, as a summation of the distance between all misclassified points and the hyperplane, or the decision boundary.
 
To minimize this cost function, we need to estimate <math>\beta</math>, <math>\beta_0</math>:
<math>\min_{\beta, \beta_0} \phi(\beta, \beta_0) = \{\text{distance of all misclassified points}\}</math>.
 
(1) A hyperplane <math>L</math> can be defined as
<math>L = \{ \mathbf{x} : f(\mathbf{x}) = \beta^T \mathbf{x} + \beta_0 = 0 \}</math>,
For any two arbitrary points <math>\mathbf{x}_1</math> and <math>\mathbf{x}_2</math> on <math>L</math>, we have
 
<math>\beta^T \mathbf{x}_1 + \beta_0 = 0</math>, 
<math>\beta^T \mathbf{x}_2 + \beta_0 = 0</math>, 
 
such that 
<math>\beta^T (\mathbf{x}_1 - \mathbf{x}_2) = 0</math>.
 
Therefore, <math>\beta</math> is orthogonal to the hyperplane and it is the normal vector.
 
(2) For any point <math>\mathbf{x}_0</math> in <math>L</math>, 
 
<math>\beta^T \mathbf{x}_0 + \beta_0 = 0</math>, which means <math>\beta^T \mathbf{x}_0 = -\beta_0</math>.
 
(3) We set <math>\beta^* = \frac{\beta}{\|\beta\|}</math> as the unit normal vector of the hyperplane <math>L</math>. For simplicity, we call <math>\beta^*</math> the norm vector. The distance of point <math>\mathbf{x}</math> to <math>L</math> is given by 
 
<math>\beta^T (\mathbf{x} - \mathbf{x}_0) = \beta^T \mathbf{x} - \beta^T \mathbf{x}_0 = \frac{\beta^T \mathbf{x}}{\|\beta\|} + \frac{\beta_0}{\|\beta\|} = \frac{\beta^T \mathbf{x} + \beta_0}{\|\beta\|}</math> 
 
Where <math>\mathbf{x}_0</math> is any point on <math>L</math>. Hence, <math>\beta^T \mathbf{x} + \beta_0</math> is proportional to the distance of the point <math>\mathbf{x}</math> to the hyperplane <math>L</math>.
 
(4) The distance from a misclassified data point <math>x_i</math> to the hyperplane <math>L</math> is 
 
<math>d_i = -y_i (\beta^T x_i + \beta_0)</math> 
 
where <math>y_i</math> is a target value, such that <math>y_i = 1</math> if <math>\beta^T x_i + \beta_0 < 0</math>, <math>y_i = -1</math> if <math>\beta^T x_i + \beta_0 > 0</math>. 
 
Since we need to find the distance from the hyperplane to the misclassified data points, we need to add a negative sign in front. When the data point is misclassified, <math>\beta^T x_i + \beta_0</math> will produce an opposite sign of <math>y_i</math>. Since we need a positive sign for distance, we add a negative sign.
 
== Backpropagation ==
 
Backpropagation procedure is done using the following steps:
 
<li>First arbitrarily choose some random weights (preferably close to zero) for your network.</li>
 
<li>Apply <math>\mathbf{x}</math> to the FFNN's input layer, and calculate the outputs of all input neurons.</li>
 
<li>Propagate the outputs of each hidden layer forward, one hidden layer at a time, and calculate the outputs of all hidden neurons.</li>
 
<li>Once <math>\mathbf{x}</math> reaches the output layer, calculate the output(s) of all output neuron(s) given the outputs of the previous hidden layer.</li>
 
<li>At the output layer, compute <math>\delta_k = -2(y_k - \hat{y}_k)</math> for each output neuron(s). </li>
 
<li>Compute each <math>\delta_i</math>, starting from <math>i = k - 1</math> all the way to the first hidden layer, where <math>\delta_i = \sigma'(a_i) \sum_j \delta_j \cdot u_{ji}</math>.</li>
 
<li>Compute <math>\frac{\partial \| \mathbf{y} - \hat{\mathbf{y}} \|^2}{\partial u_{il}} = \delta_i z_i</math> for all weights <math>u_{jl}</math>.</li>
 
<li>Then update <math>u_{il}^{\text{new}} \leftarrow u_{il}^{\text{old}} - \rho \cdot \frac{\partial \| \mathbf{y} - \hat{\mathbf{y}} \|^2}{\partial u_{il}}</math> for all weights <math>u_{il}</math>.</li>
 
<li>Continue for next data points and iterate on the training set until weights converge.</li>
 
== Epochs ==
 
It is common to cycle through all of the data points multiple times in order to reach convergence. An epoch represents one cycle in which you feed all of your data points through the neural network. It is good practice to randomize the order you feed the points to the neural network within each epoch; this can prevent your weights from changing in cycles. The number of epochs required for convergence depends greatly on the learning rate and convergence requirements used.
 
== Stein's Unbiased Risk Estimator ==
 
=== Model Selection ===
 
<ul>
<li>The general task in machine learning is estimating a function.
  <ul>
    <li>We want to estimate: <math>\hat{f}(x)</math> (estimated function).</li>
    <li>Where there is a true underlying function: <math>f(x)</math> (true function).</li>
  </ul>
</li>
</ul>
 
 
=== Definitions and Notations ===
 
Assume <math>T = \{(x_i, y_i)\}_{i=1}^n</math> be the training set. 
 
<math>f(.) \rightarrow</math> True function 
<math>\hat{f}(.) \rightarrow</math> Estimated function 
 
Also assume: 
<math>y_i = f(x_i) + \epsilon_i</math>, 
 
where <math>\epsilon_i \sim \mathcal{N}(0, \sigma^2)</math>
 
<math>\hat{y}_i = \hat{f}(x_i)</math> </br>
<math>f_i \equiv f(x_i)</math>  </br>
<math>\hat{f}_i \equiv \hat{f}(x_i)</math>
 
For point <math>(x_0, y_0)</math>, we are interested in: 
 
<math>E[(\hat{y}_0 - y_0)^2] = E[(\hat{f}_0 - f_0 - \epsilon_0)^2]</math> 
 
<math>= E\left[ \left( \hat{f}_0 - f_0 - \epsilon_0 \right)^2 \right]</math> 
 
<math>= E[(\hat{f}_0 - f_0)^2 + \epsilon_0^2 - 2\epsilon_0 (\hat{f}_0 - f_0)]</math> 
 
<math>= E[(\hat{f}_0 - f_0)^2] + E[\epsilon_0^2] - 2E[\epsilon_0 (\hat{f}_0 - f_0)]</math> 
 
<math>= E[(\hat{f}_0 - f_0)^2] + \sigma^2 - 2E[\epsilon_0 (\hat{f}_0 - f_0)]</math>
 
<b>Case 1</b> 
Assume: <math>(x_0, y_0) \notin T</math> 
 
In this case, since <math>\hat{f}</math> is estimated only based on points in the training set, therefore it is completely independent from <math>(x_0, y_0)</math>. 
 
<math>\Rightarrow E[(y_0 - f)(\hat{f} - f)] = \text{cov}(y_0, \hat{f}_0) = 0</math> 
 
If summing up all <math>m</math> points that are not in <math>T</math>: 
 
<math>\underbrace{\sum_{i=1}^m (\hat{y}_i - y_i)^2}_{\text{err}} = \underbrace{\sum_{i=1}^m (\hat{f}_i - f_i)^2}_{\text{Err}} + m \sigma^2</math>
 
Empirical error (<math>\text{err}</math>) is a good estimator of true error (<math>\text{Err}</math>) if the point <math>(x_0, y_0)</math> is not in the training set.
 
<b>Case 2</b> 
Assume: <math>(x_0, y_0) \in T</math> 
 
Then: <math>2E[\epsilon_0 (\hat{f}_0 - f_0)] \neq 0</math> 
 
=== Stein's Lemma ===
If: 
<math>x \sim \mathcal{N}(\theta, \sigma^2)</math> and <math>g(x)</math> is differentiable, 
 
then: 
<math>E[g(x)(x - \theta)] = \sigma^2 E\left[\frac{\partial g(x)}{\partial x}\right]</math>
 
 
Our problem:
<math>E[\epsilon_0 (\hat{f}_0 - f_0)] = \sigma^2 E\left[\frac{\partial (\hat{f}_0 - f_0)}{\partial \epsilon_0}\right]</math> 
 
<math>= \sigma^2 E\left[\frac{\partial \hat{f}_0}{\partial \epsilon_0} - \frac{\partial f_0}{\partial \epsilon_0}\right]</math> 
 
<math>= \sigma^2 E\left[\frac{\partial \hat{f}_0}{\partial \epsilon_0}\right]</math> 
 
<math>= \sigma^2 E\left[\frac{\partial \hat{f}_0}{\partial y_0} \cdot \frac{\partial y_0}{\partial \epsilon_0}\right]</math> 
 
<math>= \sigma^2 E\left[\frac{\partial \hat{f}_0}{\partial y_0}\right]</math>
 
<math>E[(\hat{y}_0 - y_0)^2] = E[(\hat{f}_0 - f_0)^2] + \sigma^2 - 2\sigma^2 E[D_0]</math> 
 
 
<p>Sum over all <math>n</math> data points:</p> 
 
<math>\underbrace{\sum_{i=1}^n (\hat{y}_i - y_i)^2}_{\text{err}} = \underbrace{\sum_{i=1}^n (\hat{f}_i - f_i)^2}_{\text{Err}} + n\sigma^2 - 2\sigma^2 \sum_{i=1}^n D_i</math> 
 
<math>\text{Err} = \text{err} - n\sigma^2 + \underbrace{2\sigma^2 \sum_{i=1}^n D_i}_{\text{Complexity of model}}</math>
 
<math>\text{Err}</math> is Stein's Unbiased Risk Estimator (SURE).
 
== Regularization in Deep Learning ==
 
=== Introduction ===
 
Regularization is a fundamental concept in machine learning, particularly in deep learning, where models with a high number of parameters are prone to overfitting. Overfitting occurs when a model learns the noise in the training data rather than the underlying distribution, leading to poor generalization on unseen data. Regularization techniques aim to constrain the model’s capacity, thus preventing overfitting and improving generalization. This chapter will explore various regularization methods in detail, complete with mathematical formulations, intuitive explanations, and practical implementations.
 
=== Classical Regularization: Parameter Norm Penalties ===
 
==== L2 Regularization (Weight Decay) ====
 
== L2 Parameter Regularization (Weight Decay) ==
 
=== Overview ===
 
L2 parameter regularization, commonly known as weight decay, is a technique used to prevent overfitting in machine learning models by penalizing large weights. This penalty helps in constraining the model's complexity.
 
The regularization term is given by:
 
<math> \mathcal{R}(w) = \frac{\lambda}{2} \|w\|_2^2 </math>
 
where:
* <math> \lambda </math> is the regularization strength (a hyperparameter),
* <math> w </math> represents the model weights,
* <math> \|w\|_2 </math> denotes the L2 norm of the weight vector.
 
=== Gradient of the Total Objective Function ===
 
The gradient of the total objective function, which includes both the loss and the regularization term, is given by:
 
<math> \nabla_w \mathcal{L}_{\text{total}}(w; X, y) = \lambda w + \nabla_w \mathcal{L}(w; X, y) </math>
 
The weight update rule with L2 regularization using gradient descent is:
 
<math> w := w - \eta (\lambda w + \nabla_w \mathcal{L}(w; X, y)) </math>
 
where <math> \eta </math> is the learning rate.
 
=== Quadratic Approximation to the Objective Function ===
 
Consider a quadratic approximation to the objective function:
 
<math> \mathcal{L}(w) \approx \mathcal{L}(w^*) + \frac{1}{2} (w - w^*)^\top H (w - w^*) </math>
 
where:
* <math> w^* </math> is the optimum weight vector,
* <math> H </math> is the Hessian matrix of second derivatives.
 
The modified gradient equation becomes:
 
<math> \lambda w + H (w - w^*) = 0 </math>
 
Solving for <math> w </math>, we get:
 
<math> w = (H + \lambda I)^{-1} H w^* </math>
 
where <math> I </math> is the identity matrix.
 
=== Eigenvalue Decomposition ===
 
Assume <math> H = Q \Lambda Q^\top </math> where <math> Q </math> is the orthogonal matrix of eigenvectors and <math> \Lambda </math> is the diagonal matrix of eigenvalues.
 
Then the weight vector can be expressed as:
 
<math> w = Q(\Lambda + \lambda I)^{-1} \Lambda Q^\top w^* </math>
 
The effect of weight decay is to rescale the coefficients of the eigenvectors. The <math> i </math>-th component is rescaled by a factor of <math> \frac{\lambda_i}{\lambda_i + \lambda} </math>, where <math> \lambda_i </math> is the <math> i </math>-th eigenvalue.
 
* If <math> \lambda_i > \lambda </math>, the effect of regularization is relatively small.
* Components with <math> \lambda_i < \lambda </math> will be shrunk to have nearly zero magnitude.
 
=== Effective Number of Parameters ===
 
Directions along which the parameters contribute significantly to reducing the objective function are preserved. A small eigenvalue of the Hessian indicates that movement in this direction will not significantly increase the gradient.
 
The effective number of parameters can be defined as:
 
<math> \text{Effective Number of Parameters} = \sum_i \frac{\lambda_i}{\lambda_i + \lambda} </math>
 
As <math> \lambda </math> increases, the effective number of parameters decreases, which reduces the model's complexity.
 
''(Placeholder for Image)''
(Include an image illustrating the effect of weight decay on the eigenvalues and the effective number of parameters)
 
=== Dataset Augmentation ===
 
==== Overview ====
 
Dataset augmentation is a technique used to improve the generalization ability of machine learning models by artificially increasing the size of the training dataset. This is particularly useful when the amount of available data is limited. The idea is to create new, synthetic data by applying various transformations to the original dataset.
 
* '''Key Idea:''' The best way to make a machine learning model generalize better is to train it on more data. When the amount of available data is limited, creating synthetic data (e.g., by applying transformations like rotation, translation, and noise addition) and adding it to the training set can be effective.
 
* '''Practical Example:''' Operations like translating training images a few pixels in each direction can greatly improve generalization. Another approach is to train neural networks with random noise applied to their inputs, which also serves as a form of dataset augmentation. This technique can be applied not only to the input layer but also to hidden layers, effectively performing dataset augmentation at multiple levels of abstraction.
 
---
 
=== Noise Injection ===
 
==== Overview ====
 
Noise injection is a regularization strategy that can be applied in two main ways:
 
1. '''Adding Noise to the Input:''' This method can be interpreted as a form of dataset augmentation and also has a direct connection to traditional regularization methods.
2. '''Adding Noise to the Weights:''' This method is primarily used in the context of recurrent neural networks and can be viewed as a stochastic implementation of Bayesian inference over the weights.
 
==== Mathematical Proof for Injecting Noise at the Input ====
 
Consider a regression setting where we have an input-output pair \( (x, y) \) and the goal is to minimize the expected loss function:
 
<math> J = \mathbb{E}_{x, y} \left[(f(x) - y)^2\right] </math>
 
Now, suppose we inject noise into the input \( x \), where the noise \( \epsilon \) is drawn from a distribution with mean zero (e.g., Gaussian noise \( \epsilon \sim \mathcal{N}(0, \sigma^2) \)). The modified objective function with noise-injected inputs becomes:
 
<math> J_{\text{noise}} = \mathbb{E}_{x, y, \epsilon} \left[(f(x + \epsilon) - y)^2\right] </math>
 
To understand the effect of noise injection, we can expand the function \( f(x + \epsilon) \) around \( x \) using a Taylor series:
 
<math> f(x + \epsilon) = f(x) + \epsilon^\top \nabla_x f(x) + \frac{1}{2} \epsilon^\top \nabla_x^2 f(x) \epsilon + \mathcal{O}(\|\epsilon\|^3) </math>
 
Since the expectation of the noise \( \epsilon \) is zero:
 
<math> \mathbb{E}[\epsilon] = 0 </math>
 
and assuming that the noise is isotropic with covariance matrix \( \sigma^2 I \), the expectation of the second-order term becomes:
 
<math> \mathbb{E}[\epsilon \epsilon^\top] = \sigma^2 I </math>
 
Substituting the Taylor expansion into the objective function:
 
<math> J_{\text{noise}} = \mathbb{E}_{x, y} \left[(f(x) - y)^2\right] + \frac{\sigma^2}{2} \mathbb{E}_{x, y} \left[\|\nabla_x f(x)\|^2\right] + \mathcal{O}(\sigma^4) </math>
 
This shows that the objective function with noise injection is equivalent to the original objective function plus a regularization term that penalizes large gradients of the function \( f(x) \). Specifically, the added term <math> \frac{\sigma^2}{2} \mathbb{E}_{x, y} \left[\|\nabla_x f(x)\|^2\right] </math> reduces the sensitivity of the network's output to small variations in its input.
 
'''Key Result:'''
 
For small noise variance \( \sigma^2 \), the minimization of the loss function with noise-injected input is equivalent to minimizing the original loss function with an additional regularization term that penalizes large gradients:
 
<math> J_{\text{noise}} \approx J + \frac{\sigma^2}{2} \mathbb{E}_{x, y} \left[\|\nabla_x f(x)\|^2\right] </math>
 
This regularization term effectively reduces the sensitivity of the output with respect to small changes in the input \( x \), which is beneficial in avoiding overfitting.
 
'''Connection to Weight Decay:'''
 
In linear models, where \( f(x) = w^\top x \), the gradient \( \nabla_x f(x) \) is simply the weight vector \( w \). Therefore, the regularization term becomes:
 
<math> \frac{\sigma^2}{2} \|w\|^2 </math>
 
which is equivalent to L2 regularization or weight decay.
 
=== Manifold Tangent Classifier ===
 
==== Overview ====
 
The Manifold Tangent Classifier (MTC) is a classification technique that leverages the idea that data often lies on a lower-dimensional manifold within the high-dimensional input space. The key assumption is that examples on the same manifold share the same category, and the classifier should be invariant to local factors of variation that correspond to movements on the manifold.
 
* '''Key Idea:''' The classifier should be invariant to variations along the manifold while being sensitive to changes that move the data off the manifold.
 
==== Tangent Propagation Algorithm ====
 
One approach to achieve invariance to manifold variations is to use the Tangent-Prop algorithm (Simard et al., 1992). The main idea is to add a penalty to the loss function that encourages the neural network's output to be locally invariant to known factors of variation. This is achieved by requiring the gradient of the output with respect to the input to be orthogonal to the known manifold tangent vectors \( v_i \) at each point \( x \).
 
The regularization term can be expressed as:
 
<math> \text{Regularizer} = \lambda \sum_{i} \left(\frac{\partial f(x)}{\partial x} \cdot v_i \right)^2 </math>
 
where:
* \( \frac{\partial f(x)}{\partial x} \) is the gradient of the neural network output with respect to the input,
* \( v_i \) are the known tangent vectors of the manifold,
* \( \lambda \) is the regularization strength.
 
This regularization ensures that the directional derivative of \( f(x) \) in the directions \( v_i \) is small, promoting invariance along the manifold.
 
==== Manifold Tangent Classifier (MTC) ====
 
A more recent approach, introduced by Rifai et al. (2011), eliminates the need to know the tangent vectors a priori. The Manifold Tangent Classifier automatically learns these tangent vectors during training, making it more flexible and applicable to a wider range of problems.
 
---
 
=== Early Stopping as a Form of Regularization ===
 
==== Overview ====
 
Early stopping is one of the most commonly used forms of regularization in deep learning. Instead of running the optimization algorithm until it reaches a local minimum of the training error, early stopping involves monitoring the validation error during training and halting the process when the validation error stops improving.
 
* '''Key Idea:''' During training, whenever the error on the validation set improves, a copy of the model parameters is stored. The training is stopped when the validation error has not improved for a predetermined amount of time, and the best model parameters (those that resulted in the lowest validation error) are returned.
 
==== Mathematical Formulation ====
 
Assume that \( w \) represents the model weights (ignoring bias parameters). We take a quadratic approximation to the objective function \( J(w) \) around the empirically optimal value of the weights \( w^* \):
 
<math> J(w) \approx J(w^*) + \frac{1}{2} (w - w^*)^\top H (w - w^*) </math>
 
where:
* \( H \) is the Hessian matrix of second derivatives.
 
The gradient of the objective function is:
 
<math> \nabla_w J(w) = H(w - w^*) </math>
 
During training, the parameter vector is updated according to:
 
<math> w^{(t+1)} = w^{(t)} - \eta \nabla_w J(w^{(t)}) </math>
 
Substituting the expression for the gradient:
 
<math> w^{(t+1)} - w^* = (I - \eta H) (w^{(t)} - w^*) </math>
 
where \( \eta \) is the learning rate. If we assume that the initial weights are zero (i.e., \( w^{(0)} = 0 \)), we can express the weight update after \( t \) iterations as:
 
<math> w^{(t)} - w^* = (I - \eta H)^t (w^{(0)} - w^*) </math>
 
If we perform an eigenvalue decomposition of \( H \), we get:
 
<math> H = Q \Lambda Q^\top </math>
 
where \( Q \) is the orthogonal matrix of eigenvectors, and \( \Lambda \) is the diagonal matrix of eigenvalues. The weight update can then be rewritten as:
 
<math> w^{(t)} - w^* = Q (I - \eta \Lambda)^t Q^\top (w^{(0)} - w^*) </math>
 
Assuming \( w^{(0)} = 0 \) and that \( |1 - \eta \lambda_i| < 1 \) for all eigenvalues \( \lambda_i \), after \( t \) training updates, we have:
 
<math> Q^\top w^{(t)} \approx [I - (1 - \eta \Lambda)^t] Q^\top w^* </math>
 
Taking the logarithm and using the series expansion for \( \log(1 + x) \), it can be shown that the number of training iterations \( t \) plays a role inversely proportional to the L2 regularization parameter \( \lambda \), and the inverse of \( t \) plays the role of the weight decay coefficient.
 
'''Key Insight:'''
 
This result shows that early stopping can be interpreted as a form of implicit regularization, where the number of training iterations controls the effective complexity of the model.
 
=== Early Stopping as a Form of Regularization ===
 
==== Overview ====
 
Early stopping is one of the most commonly used forms of regularization in deep learning. Instead of running the optimization algorithm until it reaches a local minimum of the training error, early stopping involves monitoring the validation error during training and halting the process when the validation error stops improving.
 
* '''Key Idea:''' During training, whenever the error on the validation set improves, a copy of the model parameters is stored. The training is stopped when the validation error has not improved for a predetermined amount of time, and the best model parameters (those that resulted in the lowest validation error) are returned.
 
==== Mathematical Formulation ====
 
Assume that \( w \) represents the model weights (ignoring bias parameters). We take a quadratic approximation to the objective function \( J(w) \) around the empirically optimal value of the weights \( w^* \):
 
<math> J(w) \approx J(w^*) + \frac{1}{2} (w - w^*)^\top H (w - w^*) </math>
 
where:
\( H \) is the Hessian matrix of second derivatives.
 
The gradient of the objective function is:
 
<math> \nabla_w J(w) = H(w - w^*) </math>
 
During training, the parameter vector is updated according to:
 
<math> w^{(t+1)} = w^{(t)} - \eta \nabla_w J(w^{(t)}) </math>
 
Substituting the expression for the gradient:
 
<math> w^{(t+1)} - w^* = (I - \eta H) (w^{(t)} - w^*) </math>
 
where \( \eta \) is the learning rate. If we assume that the initial weights are zero (i.e., \( w^{(0)} = 0 \)), we can express the weight update after \( t \) iterations as:
 
<math> w^{(t)} - w^* = (I - \eta H)^t (w^{(0)} - w^*) </math>
 
If we perform an eigenvalue decomposition of \( H \), we get:
 
<math> H = Q \Lambda Q^\top </math>
 
where \( Q \) is the orthogonal matrix of eigenvectors, and \( \Lambda \) is the diagonal matrix of eigenvalues. The weight update can then be rewritten as:
 
<math> w^{(t)} - w^* = Q (I - \eta \Lambda)^t Q^\top (w^{(0)} - w^*) </math>
 
Assuming \( w^{(0)} = 0 \) and that \( |1 - \eta \lambda_i| < 1 \) for all eigenvalues \( \lambda_i \), after \( t \) training updates, we have:
 
<math> Q^\top w^{(t)} \approx [I - (1 - \eta \Lambda)^t] Q^\top w^* </math>
 
Taking the logarithm and using the series expansion for \( \log(1 + x) \), it can be shown that the number of training iterations \( t \) plays a role inversely proportional to the L2 regularization parameter \( \lambda \), and the inverse of \( t \) plays the role of the weight decay coefficient.
 
'''Key Insight:'''
 
This result shows that early stopping can be interpreted as a form of implicit regularization, where the number of training iterations controls the effective complexity of the model.
 
 
== Label Smoothing ==
 
Label smoothing is a technique to prevent a model from becoming over-confident on a specific class by not forcing the model to fit the data exactly. This approach provides more flexibility and generalization abilities.
 
Suppose the predicted output is <math>y = [0, 1, 0]</math>, then after applying label smoothing, it becomes <math>y = [0.033, 0.933, 0.033]</math>.
 
The formula for label smoothing is:
 
<math> y_{\text{smooth}} = (1 - a) \cdot y + \frac{a}{k} </math>
 
where:
* <math>a</math> is the smoothing factor,
* <math>y</math> is the original label,
* <math>k</math> is the number of classes.
 
The reason for using label smoothing:
* '''Prevents overfitting''': By preventing the model from becoming too confident in its predictions, label smoothing reduces the likelihood of overfitting.
* '''Improves generalization''': Label smoothing can help the model generalize better to unseen data, as it discourages overconfidence in training.
 
== Bagging/Ensemble ==
 
Bagging (short for bootstrap aggregating) is a machine learning  ensemble technique for reducing generalization error by combining several models (Breiman, 1994)
 
Explanation: Aggregating is to ombine the predictions of each model, often using voting (for classification) or averaging (for regression).
 
It works by training several different models separately, and then have all of the models vote on the output for test examples. For example, random forest, which is a popular bagging algorithm that builds multiple decision trees on different bootstrap samples of the data and aggregates their predictions.
 
The reason why bagging works:
* '''Variance reduction''': By training multiple models on different data subsets, bagging reduces the variance of the predictions. This means that it helps models generalize better to new, unseen data.
* '''Handling overfitting''': Bagging is particularly useful for high-variance models (e.g., decision trees) as it helps reduce overfitting.
 
 
While bagging is highly useful for traditional machine learning models, it is less commonly used in deep learning because modern neural networks are already highly expressive. Instead, other ensemble methods, such as model ensembling or dropout, are used.
 
Code Sample:
 
from sklearn.ensemble import RandomForestClassifier
 
from sklearn.datasets import load_iris
 
from sklearn.model_selection import train_test_split
 
- Load a dataset (Iris dataset for example)
data = load_iris()
 
X_train, X_test, y_train, y_test = train_test_split(data.data, data.target, test_size=0.3, random_state=42)
 
- Train a random forest classifier (bagging technique)
 
rf_model = RandomForestClassifier(n_estimators=100, random_state=42)
 
rf_model.fit(X_train, y_train)
 
- Make predictions
 
y_pred = rf_model.predict(X_test)
 
- Evaluate the model
 
accuracy = rf_model.score(X_test, y_test)
 
== Dropout ==
 
=== Overview ===
Dropout is one of the techniques for preventing overfitting in deepneural network which contains a large number of parameters.
 
The key idea is to randomly drop units from the neural networkduring training.
* During training, dropout samples from number of different “thinned” network.
* At test time, we approximate the effect of averaging the predictions of all these thinned networks
 
=== Model ===
 
Consider a neural network with <math>L</math> hidden layers:
* Let <math>z^{(l)}</math> denote the vector inputs into layer <math>l</math>.
* Let <math>y^{(l)}</math> denote the vector of outputs from layer <math>l</math>.
* Let <math>W^{(l)}</math> and <math>b^{(l)}</math> represent the weights and biases at layer <math>l</math>.
 
With dropout, the feed-forward operation becomes:
 
<math> r^{(l)} \sim \text{Bernoulli}(p) </math>
 
<math> y^{(l)} = r^{(l)} \odot y^{(l)} </math>
 
where <math>\odot</math> denotes element-wise multiplication.
 
The feed-forward equation for layer <math>l+1</math> becomes:
 
<math> z^{(l+1)} = W^{(l+1)} y^{(l)} + b^{(l+1)} </math>
 
<math> y^{(l+1)} = f(z^{(l+1)}) </math>
 
where <math>f</math> is the activation function.
 
For any layer <math>l</math>, <math>r^{(l)}</math> is a vector of independent Bernoulli random variables, each of which has a probability <math>p</math> of being 1. The vector <math>y^{(l)}</math> is the input after some hidden units are dropped. The rest of the model remains the same as a regular feed-forward neural network.
 
=== Training ===
Dropout neural network can be trained using stochastic gradient descent.
The only difference here is that we only back propagate on eachthinned network.
The gradient for each parameter are averaged over the training cases in each mini-batch.
 
=== Test Time ===
Use a single neural net without dropout
If a unit is retained with probability p during training, the outgoing weights of that unit are multiplied by p at test time. <math>p \cdot w</math>
 
== Additional Regularization ==
 
=== L1 norm ===
L1 norm regularization, also known as Lasso, is a technique that adds a penalty equal to the absolute value of the magnitude of coefficients to the loss function. This encourages sparsity in the learned weights, meaning it forces some of the weights to become exactly zero, effectively selecting important features and reducing model complexity.
 
=== Mixup ===
Mixup is a data augmentation technique that creates new training examples by taking convex combinations of pairs of input data and their labels. By blending images and labels together, the model learns smoother decision boundaries and becomes more robust to adversarial examples and noise.
 
=== Cutout ===
Cutout is a form of data augmentation where random square regions are masked out (set to zero) in input images during training. This forces the model to focus on a broader range of features across the image rather than relying on any single part, leading to better generalization and robustness.
 
=== Gradient Clipping ===
Gradient clipping is a technique used to prevent the gradients from becoming too large during training, which can cause the model to diverge. This is done by capping the gradients at a predefined threshold, ensuring that updates remain stable, especially in models like recurrent neural networks (RNNs) where exploding gradients are a common issue.
 
=== DropConnect ===
DropConnect is a variation of Dropout, but instead of dropping neurons, it randomly drops connections (weights) between neurons during training. This prevents the co-adaptation of neurons while allowing individual neurons to contribute to learning.
 
=== Data Augmentation (beyond Mixup and Cutout) ===
* '''Random Flips and Rotations''': Randomly flipping (either vertical or horizontal) or rotating images during training to make the model invariant to certain transformations.
* '''Color Jittering''': Modifying the brightness, contrast, saturation, and hue of images to make the model more robust to variations in color.
* '''Random Cropping and Scaling''': Randomly cropping and scaling images to force the model to learn from different perspectives and contexts within the data.
 
For PyTorch augmentation, one can refer https://pytorch.org/vision/stable/transforms.html
 
== Generalization Paradox ==
* Models with many parameters tend to overfit
* However, deep neural network, despite using many parameters, works well with unseen data (look up the Double Descent Curve), the reason remains unknown
 
This phenomenon is illustrated by the '''Double Descent Curve''', where after reaching a peak in test error (due to overfitting), the error decreases again with further model complexity. The precise reasons remain uncertain, but hypotheses include implicit regularization from optimization methods like SGD, hierarchical feature learning, and the redundancy offered by overparameterization.
 
Despite the generalization paradox, applying regularization techniques are still beneficial due to a couple of reasons: Deep neural networks can still overfit in specific cases, especially with small datasets or noisy data. As a result, regularization techniques can act as a safeguard. Moreover, regularization techniques can improve the model consistency, performing well across different datasets and tasks. Finally, regularization helps prevent the model from fitting outliers/data points that should be irrelevant.
 
== Batch Normalization ==
 
=== Overview ===
Batch normalization is a technique used to improve the training process of deep neural networks by normalizing the inputs of each layer. Despite the initial intuition for the method being somewhat incorrect, it has proven to be highly effective in practice. Batch normalization speeds up convergence, allows for larger learning rates, and makes the model less sensitive to initialization, resulting in more stable and efficient training.
 
Batch normalization motivated by internal covariate shift (2015 lofee & Szegedy)
 
=== Internal Covariance Shift ===
Batch normalization was originally proposed as a solution to the internal covariance shift problem, where the distribution of inputs to each layer changes during training. This shift complicates training because the model must constantly adapt to new input distributions.
 
The transformation of layers can be described as:
 
<math> l = F_2(F_1(u, \theta_1), \theta_2) </math>
 
For a mini-batch of activations <math>X = \{x_1, x_2, \dots, x_m\}</math> from a specific layer, batch normalization proceeds as follows:
 
1. '''Compute the mean''': <math> \mu_B = \frac{1}{m} \sum_{i=1}^{m} x_i </math>
 
2. '''Compute the variance''': <math> \sigma_B^2 = \frac{1}{m} \sum_{i=1}^{m} (x_i - \mu_B)^2 </math>
 
3. '''Normalize the activations''': <math> \hat{x}_i = \frac{x_i - \mu_B}{\sqrt{\sigma_B^2 + \epsilon}} </math>
 
4. '''Scale and shift''' the normalized activations using learned parameters <math>\gamma</math> (scale) and <math>\beta</math> (shift): <math> y_i = \gamma \hat{x}_i + \beta </math>
 
where:
* <math>x_i</math> represents the activations in the mini-batch,
* <math>\mu_B</math> is the mean of the mini-batch,
* <math>\sigma_B^2</math> is the variance of the mini-batch,
* <math>\epsilon</math> is a small constant added for numerical stability,
* <math>\hat{x}_i</math> is the normalized activation,
* <math>\gamma</math> and <math>\beta</math> are learned parameters for scaling and shifting.
 
The batch normalization improves validation accuracy by removing the dropout and enables higher learning rate
 
=== Batch Normalization ===
 
As mentioned earlier, the original intuition behind batch normalization was found to be incorrect after further research. A paper by Santurkar, S., Tsipras, D., Ilyas, A., & Madry, A. (NeurIPS 2019) contradicted the original 2015 paper on BatchNorm by highlighting the following points:
 
* Batch normalization does not fix covariate shift.
* If we fix covariate shift, it doesn't help.
* lf we intentionally increase lCS, it doesn't harm.
* Batch Norm is not the only possible normalization. There are alternatives.
 
Instead, they argue that Batch normalization works better due to other factors, particularly related to its effect on the optimization process:
 
1. '''Reparameterization of the loss function:'''
* Improved Lipschitzness: Batch normalization improves the Lipschitz continuity of the loss function, meaning that the loss changes at a smaller rate, and the magnitudes of the gradients are smaller. This makes the gradients of the loss more "Lipschitz."
* Better β-smoothness: The loss exhibits significantly better smoothness, which aids in optimization by preventing large, erratic changes in the gradient.
 
2. '''Variation of the loss function''': BatchNorm reduces the variability of the value of the loss. Consider the variation of the loss function:
<math> \mathcal{L}(x + \eta \nabla \mathcal{L}(x)) </math> where <math> \eta \in [0.05, 0.4] </math>.
A smaller variability of the loss indicates that the steps taken during training are less likely to cause the loss to increase uncontrollably.
 
3. '''Gradient predictiveness''': BatchNorm enhances the predictiveness of the gradients, meaning the changes in the loss gradient are more stable and predictable. This can be expressed as:
<math> || \nabla \mathcal{L}(x) - \nabla \mathcal{L}(x + \eta \nabla \mathcal{L}(x)) || </math>, where <math> \eta \in [0.05, 0.4] </math>.
A good gradient predictiveness implies that the gradient evaluated at a given point remains relevant over longer distances, which allows for larger step sizes during training.
 
=== Alternatives to Batch Norm ===
 
'''Weight Normalization''': Weight normalization is a technique where the weights, instead of the activations, are normalized. This method reparameterizes the weight vectors to accelerate the training of deep neural networks.
 
Tim Salimans and Diederik P. Kingma, "Weight Normalization: A Simple Reparameterization to Accelerate Training of Deep Neural Networks," 2016.
 
'''ELU (Exponential Linear Unit) and SELU (Scaled Exponential Linear Unit)''': ELU and SELU are two proposed activation functions that have a decaying slope instead of a sharp saturation. They can be used as alternatives to BatchNorm by providing smoother, non-linear activation without requiring explicit normalization.
 
Djork-Arné Clevert, Thomas Unterthiner, and Sepp Hochreiter, "Fast and Accurate Deep Network Learning by Exponential Linear Units (ELUs)," In International Conference on Learning Representations (ICLR), 2016.
Günter Klambauer, Thomas Unterthiner, Andreas Mayr, and Sepp Hochreiter, "Self-Normalizing Neural Networks," ICLR, 2017.
 
== Convolutional Neural Network (CNN) ==
=== Introduction ===
Convolutional networks are simply neural networks that use convolution instead of general matrix multiplication in at least one of their layers. CNN is mainly used for image processing.
 
=== Convolution ===
In ML, convolution means dot product
 
<math> h = \sigma(\langle x, w\rangle+b)</math>
* Same x, different w -- multi-layer perception (MLP)
* Different x, same w --  CNN (weight sharing)
 
From class, the following operation is called convolution
 
<math> s(t) = \int x(a)w(t-a)ds </math>
 
The convolution operation is typically denoted with an asterisk:
 
<math> s(t) = (x \ast w)(t) </math>
 
=== Discrete Convolution ===
If we now assume that x and w are defined only on integer t, we can define the discrete convolution:
 
<math>
s[t] = (x \ast w)(t) = \sum_{a=-\infty}^{\infty} x[a] \, w[t-a]
</math>
 
<math>w[t-a]</math> represents the sequence <math>w[t]</math> shifted by <math>a</math> units.
 
=== In practice ===
We often use convolutions over more than one axis at a time.
 
<math>
s[i,j] = (I * K)[i,j] = \sum_m \sum_n I[m,n] K[i-m, j-n]
</math>
 
* '''Input''': usually a multidimensional array of data.
 
* '''Kernel''': usually a multidimensional array of parameters that should be learned.
 
We assume that these functions are zero everywhere but the finite set of points for which we store the values.
 
We can implement the infinite summation as a summation over a finite number of array elements.
 
=== Convolution and Cross-Correlation ===
Convolution is commutative:
 
<math>
s[i,j] = (I * K)[i,j] = \sum_m \sum_n I[i-m, j-n] K[m, n]
</math>
 
Cross-correlation:
 
<math>
s[i,j] = (I * K)[i,j] = \sum_m \sum_n I[i+m, j+n] K[m, n]
</math>
 
Many machine learning libraries implement cross-correlation but call it convolution. In the context of backpropagation in neural networks, cross-correlation simplifies the computation of gradients with respect to the input and kernel.
 
Visualization of Cross-Correlation and Convolution with Matlab (https://www.youtube.com/v/Ma0YONjMZLI)
 
=== Image to Convolved Feature ===
* '''Kernel\filter size''': weight <math>\times</math> height, e.g. 3 <math>\times</math> 3 in below example
* '''Stride''': how many pixels to move the filter each time
* '''Padding''': add zeros (or any other value) around the boundary of the input
 
=== Example ===
The following image illustrates a 2D convolution operation between an input image and a filter to produce a convolved feature map.
 
'''Image (Input)''':
The grid on the left represents a 5<math>\times</math>5 matrix of pixel values. The orange-highlighted 3<math>\times</math>3 region is part of the image currently being convolved with the filter.
 
'''Convolution Operation''':
The filter values are applied to the selected region in an element-wise multiplication followed by a summation. The operation is as follows:
 
<math> (1 \times 1) + (1 \times 0) + (1 \times 1) + (0 \times 0) + (1 \times 1) + (1 \times 0) + (0 \times 1) + (0 \times 0) + (1 \times 1) = 4 </math>
 
'''Convolved Feature Map''':
The result value <math>4</math>, is placed in the corresponding position (top-left) of the convolved feature map on the right.
 
[[Image:conv_example.png|thumb|400px|center|One Convolution Example]]
 
This process is repeated as the filter slides across the entire image. The final feature map is shown below.
 
[[Image:conv_example_final.png|thumb|400px|center|Final Feature Map]]
 
=== Sparse Interactions===
In feed forward neural network '''every''' output unit interacts with every input unit.
* When we have <math>m</math> inputs and <math>n</math> outputs, then matrix multiplication requires <math> (m \times n) </math> parameters. and the algorithms used in practice have <math> O(m \times n) </math> runtime (per example)
 
Convolutional networks, typically have sparse connectivity (sparse weights). This is accomplished by making the kernel smaller than the input.
* Limit the number of connections each output may have to <math>k</math>, then requires only <math> (k \times n) </math> parameters and <math> O(k \times n) </math> runtime
 
=== Parameter Sharing ===
* In a traditional neural net, each element of the weight matrix is multiplied by one element of the input. i.e. It is used once when computing the output of a layer.
* In CNNs, each member of the kernel is used at every position of the input
* Instead of learning a separate set of parameters for every location, we learn only one set
 
=== Equivariance ===
A function <math>f(x)</math> is '''equivaraint''' to a function <math>g</math> is the following holds:
 
<math>f(g(x)) = g(f(x))</math>
 
'''In simple terms''': Applying the function <math>f</math> after <math>g</math> is equivalent to applying <math>g</math> after <math>f</math>
 
[[Image:equivariance.png|thumb|300px|center|Equivariance]]
 
==== Equivariance in CNNs ====
* CNNs are naturally equivariant to translation (Covlution = Shift)
* If an input image is shifted, the output feature map shifts correspondingly, preserving spatial structure
* Importance: This property ensures that CNNs can detect features like edges or corners, no matter where they appear in the image
 
A convolutional layer has equivariance to translation. For example,
 
<math>g(x)[i] = x[i-1]</math>
 
 
If we apply this transformation to x, then apply convolution, the result will be the same as if we applied convolution to x, then applied the transformation to the output.
 
For images, convolution creates a 2-D map of where certain features appear in the input. Note that convolution is not equivariant to some other transformations, such as changes in the scale (rescaling) or rotation of an image.
 
==== Importance of Data Augmentation ====
Data augmentation is commonly used to make CNNs robust against variations in scale, rotation, or other transformations. This involves artificially modifying the training data by applying transformations like flipping, scaling, and rotating to expose the network to different variations of the same object.
 
=== Convolutional Networks ===
'''The first stage (Convolution):''' The layer performs several convolutions in parallel to produce a set of preactivations. The convolution stage is designed to detect local features in the input image, such as edges and patterns. It does this by applying filters/kernels across the input image.
 
'''The second stage (Detector): ''' Each preactivation is run through a nonlinear activation function (e.g. rectified linear). This stage introduces nonlinearity into the model, enabling it to learn complex patterns. Without this nonlinearity, the model would be limited to learning only linear relationships.
 
'''The third stage (Pooling)''' Pooling reduces the spatial dimensions of the feature maps (height and width), helping to make the model more invariant to small translations and distortions in the input image. It also reduces computational load and helps prevent overfitting.
 
[[Image:cnn.png|thumb|400px|center|CNN Structure]]
 
=== Pooling===
Down-sample input size to reduce computation and memory
 
==== Popular Pooling functions ====
* The maximum of a rectangular neighborhood (Max pooling operation)
* The average of a rectangular neighborhood
* The L2 norm of a rectangular neighborhood
* A weighted average based on the distance from the central pixel
 
==== Pooling with Downsampling ====
Max-pooling with a pool width of 3 and a stride between pools of 2. This reduces the representation size by a factor of 2, which reduces the the computational and statistical burden on the next layer.
 
==== Pooling and Translations ====
Pooling helps to make the representation become invariant to small translations of the input. Invariance to local translation can be a very useful property if we care more about whether some feature is present than exactly where it is. For example: In a face, we need not know the exact location of the eyes.
==== Input of Varying Size ====
Example: we want to classify images of variable size.
 
The input to the classification layer must have a fixed size. In the final pooling output (for example) four sets of summary statistics, one for each quadrant of an image, regardless of the image size. Feature after pooling is <math>2 \times 2</math>.
 
It is also possible to dynamically pool features together, for example, by running a clustering algorithm on the locations of interesting features (Boureau et al., 2011).
 
i.e. a different set of pooling regions for each image.
 
Learn a single pooling structure that is then applied to all images (Jia et al., 2012)
 
=== Convolution and Pooling as an Infinitely Strong Prior ===
* '''Weak Prior''':  a prior distribution that has high entropy, which means there is a high level of uncertainty or spread in the distribution. An example of this would be a Gaussian distribution with high variance
* '''Strong Prior''':  has very low entropy, which implies a high level of certainty or concentration in the distribution. An example of this would be a Gaussian distribution with low variance
* '''Infinitely Strong Prior''': places zero probability on some parameters and says a convolutional net is similar to a fully connected net with an infinitely strong prior over its weights
 
 
The weights for one hidden unit must be identical to the weights of its neighbor, but shifted in space. The weights must be zero, except for in the small, spatially contiguous receptive field assigned to that  hidden unit.
 
Use of convolution as infinitely strong prior probability distribution over the parameters of a layer. This prior says that the function the layer should learn contains only local interactions and is equivariantto translation.
 
The use of pooling is infinitely strong prior that each unit should be invariant to small translations. Convolution and pooling can cause underfitting.
 
=== Practical Issues ===
The input is usually not just a grid of real values. It is a grid of vector-valued observations. For example, a color image has a red, green, and blue intensity at each pixel.
 
When working with images, we usually think of the input and output of the convolution as 3-D tensors. One index into the different channels and two indices into the coordinates of each channel.
 
Software implementations usually work in batch mode, so they will actually use 4-D tensors, with the fourth axis indexing different examples in the batch.
 
=== Connection to underfitting ===
By so drastically restricting the network’s form (via weight sharing and pooling), we reduce the total number of free parameters. While this often helps regularize the model (and is hugely beneficial in vision tasks), it can also cause underfitting if our task actually needs more flexible, less translation‐invariant representations.
 
=== Training ===
Suppose we want to train a convolutional network that incorporates convolution of kernel stack <math>K</math> applied to multi-channel image <math>V</math> with stride <math>s</math>:<math>c(K; V; s)</math>
 
Suppose we want to minimize some loss function <math>J(V; K)</math>. During forward propagation, we will need to use <math>c</math> itself to output <math>Z</math>.
 
<math>Z</math> is propagated through the rest of the network and used to compute <math>J</math>.
 
* During backpropagation, we receive a tensor <math>\mathbf{G}</math> such that:
<math> G_{i,j,k} = \frac{\partial}{\partial Z_{i,j,k}} J(V, K) </math>
 
*To train the network, we compute the derivatives with respect to the weights in the kernel:
<math> g(\mathbf{G}, \mathbf{V}, s)_{i,j,k,l} = \frac{\partial}{\partial Z_{i,j,k}} J(V, K) = \sum_{m,n} G_{i,m,n} V_{j,ms+k,ns+l} </math>
 
*If this layer is not the bottom layer of the network, we compute the gradient with respect to <math>\mathbf{V}</math> to backpropagate the error further:
<math> h(\mathbf{K}, \mathbf{G}, s)_{i,j,k} = \frac{\partial}{\partial V_{i,j,k}} J(V, K) = \sum_{l,m \lvert s l + m = j} \sum_{n,p \lvert s n + p = k} \sum_{q} K_{q,i,m,p} G_{i,l,n} </math>
 
 
=== Random or Unsupervised Features ===
The most computationally expensive part of training a convolutional network is learning the features.
 
* Supervised training with gradient descent requires full forward and backward propagation through the entire network for every gradient update.
* One approach to reduce this cost is to use features that are not learned in a supervised manner, such as random or unsupervised features.
 
==== Random Initilizations ====
Simply initialize the convolution kernels randomly. In high-dimension space, random vectors are almost orthogonal to each other (correlated). Features captured by different kernels are independent.
 
==== Unsupervised Learning ====
Learn the convolution kernels using an unsupervised criterion.
 
==== Key insight ====
Random filters can perform surprisingly well in convolutional networks.
* Layers composed of convolution followed by pooling naturally become frequency-selective and translation-invariant, even with random weights.
 
Inexpensive architecture selection
* Evaluate multiple convolutional architectures by training only the last layer.
* Choose the best-performing architecture and then fully train it using a more intensive method.
 
 
== Residual Networks (ResNet) ==
=== Overview ===
Deeper models are harder to train due to vanishing/exploding gradients and can be worse than shallower networks if not properly trained. There are advanced networks to deal with the degradation problem.
 
ResNet, short for Residual Networks, was introduced by Kaiming He et al. from Microsoft Research in 2015. It brought a significant breakthrough in deep learning by enabling the training of much deeper networks, addressing the vanishing gradient problem.
 
[[Image:resnet.png|thumb|400px|center|ResNet Structure]]
 
* ResNet introduces the concept of skip connections (or residual connections) that allow the gradient to be directly backpropagated to earlier layers
* Skip connections help in overcoming the degradation problem, where the accuracy saturates and then degrades rapidly as the network depth increases
 
=== Markovian Assumption ===
In '''vanilla RNNs''', we update the hidden state by
\begin{align*}
s_{t} &= f(s_{t-1}, x_{t}) \
\end{align*}
 
so that <math>s_{t}</math> depends only on the previous hidden state <math>s_{t-1}</math> and the current input <math>x_{t}</math>. This means that, once we know
<math>\{s_{t-1}, x_{t} \} </math> , the model treats any earlier time steps as irrelevant.
 
In other words, the '''conditional distribution''' over <math>s_{t}</math>
given all past hidden states and inputs
<math>
\{ s_{t-1}, s_{t-2}, \ldots, x_{t}, x_{t-1}, \ldots \}
</math> , actually '''reduces''' to only
<math>
\{ s_{t-1}, x_{t} \}
</math>
. That is the Markov assumption: future states depend on the past only through the immediately preceding state (plus the new input).
 
Under this assumption, an RNN can be viewed as a '''first‐order Markov chain''' in terms of its hidden state. Of course, in practice the hidden state <math>s_{t}</math> is supposed to encode or “remember” all relevant historical information, so that even though the update has a Markov form, it can (in principle) capture dependencies over long time spans. But mathematically, the recurrency is first‐order Markov: the history “feeds forward” only via the state transition from <math>(s_{t-1}, x_{t} )</math> to <math>s_{t}</math>.
 
===  Variants ===
Several variants of ResNet have been developed, including ResNet-50, ResNet-101, and ResNet-152, differing in the number of layers.
 
=== Application ===
ResNet has been widely adopted for various computer vision tasks, including image classification, object detection, and facial recognition.
 
== DenseNet ==
=== Overview ===
* DenseNet, short for Densely Connected Networks, was introduced by Gao Huang et al. in 2017.
* It is known for its efficient connectivity between layers, which enhances feature propagation and reduces the number of parameters
 
[[Image:densenet.png|thumb|500px|center|DenseNet Structure]]
 
=== Key Feature ===
The key feature is '''Dense Connectivity'''.
* In DenseNet, each layer receives feature maps from all preceding layers and passes its own feature maps to all subsequent layers
* This dense connectivity improves the flow of information and gradients throughout the network, mitigating the vanishing gradient problem
 
== Echo State Network ==
 
In RNNs, the ability to capture long-term dependencies is crucial. Set the recurrent and input weights such that the recurrent hidden units do a good job of capturing the history of past inputs, and only learn the output weights. The goal is to access the information from the past implicitly.
 
The hidden state at time <math>t</math> can be expressed as:
 
<math>s_t = \sigma(W s_{t-1} + U x_t)</math>
 
where:
* <math>W</math> represents the recurrent weight matrix, which connects previous hidden states to the current state,
* <math>U</math> is the input weight matrix, responsible for incorporating the current input <math>x_t</math>,
* <math>\sigma</math> is an activation function, like a non-linear function such as a sigmoid or tanh.
 
It is important to control how small changes in the hidden state propagate through time to ensure the network does not become unstable.
 
If a change <math>\Delta s</math> in the state at time <math>t</math> is aligned with an eigenvector <math>v</math> of the Jacobian <math>J</math> with eigenvalue <math>\lambda > 1</math>, then the small change <math>\Delta s</math> becomes <math>\lambda \Delta s</math> after one-time step, and <math>\lambda^t \Delta s</math> after <math>t</math> time steps.
 
If the largest eigenvalue <math>\lambda < 1</math>, the map from <math>t</math> to <math>t+1</math> is contractive.
 
The network forgets information about the long-term past.
 
Set the weights to make the Jacobians slightly contractive. This allows the network to gradually forget irrelevant information while still remembering key long-term dependencies.
 
[[Image:echo_state_net.png|thumb|500px|center|Echo State Network]]
 
== Long Delays ==
 
RNNs often fail to capture these dependencies due to the vanishing gradient problem. Long delays use recurrent connections. It knows something from the past, help vanishing gradient - even if gradient get vanished during the path, it still has the direct information from the past.
 
[[Image:long delay.png|thumb|500px|center|Long Delays]]
 
== Leaky Units ==
 
In some cases, we do need to forget the path while in some we do not since we do not want to remember redundant information.
 
Recall that:
 
<math>s_t = \sigma(W s_{t-1} + U x_t)</math>
 
Then consider the following refined form of the equation (convex combination of the current state and previous through a new parameter):
 
<math>s_{t,i} = \left(1 - \frac{1}{\tau_i}\right) s_{t-1} + \frac{1}{\tau_i} \sigma(W s_{t-1} + U x_t)</math>
 
where
* <math>1 \leq \tau_i \leq \infty</math>
* <math>\tau_i = 1</math> corresponds to an ordinary RNN
* <math>\tau_i > 1</math> allows gradients to propagate more easily
* <math>\tau_i \gg 1</math> means the state changes very slowly, integrating past values associated with the input sequence over a long duration
 
Infinity means the current state is the previous state while one means completely forgetting the previous steps and only depends on the current observations.
 
== Gated RNNs ==
=== Defnition ===
 
It might be useful for the neural network to forget the old state in some cases like if we only care about if the current letter is a or b.
 
Example: <math>a\ a\ b\ b\ b\ b\ a\ a\ a\ a\ b\ a\ b</math>
 
It might be useful to keep the memory of the past.
 
Example:
 
Instead of manually deciding when to clear the state, we want the neural network to learn to decide when to do it.
 
=== Long-Short-Term-Memory (LSTM) ===
 
The Long-Short-Term-Memory (LSTM) algorithm was proposed in 1997 (Hochreiter and Schmidhuber, 1997). It is a type of recurrent neural network designed for approaching the vanishing gradient problem.
 
Several variants of the LSTM are found in the literature:
 
*Hochreiter and Schmidhuber, 1997
*Graves, 2012
*Graves et al., 2013
*Sutskever et al., 2014
 
The principle is always to have a linear self-loop through which gradients can flow for a long duration.
 
== Gated Recurrent Units (GRU) ==
 
Here is the plain text version of the new image content:
 
Recent work on gated RNNs, Gated Recurrent Units (GRU), was proposed in 2014.
 
* Cho et al., 2014
* Chung et al., 2014, 2015
* Jozefowicz et al., 2015
* Chrupala et al., 2015
 
Standard RNN computes the hidden layer at the next time step directly:
 
<math>s_t = \sigma(W s_{t-1} + U x_t)</math>
 
There are two gates: the update gate and the reset gate. Update gate for the case that we want to keep the information around while reset gate is the case when forgetting. A temporary state locks down some of the values of the current state.
 
GRU first computes an update gate (another layer) based on the current input vector and hidden state:
 
<math>z_t = \sigma(U^{(z)} x_t + W^{(z)} s_{t-1})</math>
 
It also computes the reset gate similarly but with different weights:
 
<math>r_t = \sigma(U^{(r)} x_t + W^{(r)} s_{t-1})</math>
 
New memory content is calculated as:
 
<math>\tilde{s_t} = \tanh(U x_t + r_t \odot W s_{t-1})</math>
 
which has current observations and forgetting something from the past
 
If the reset gate is close to 0, this causes the network to ignore the previous hidden state, effectively allowing the model to drop irrelevant information.
 
The final memory at time step <math>t</math> is a combination of the current and previous time steps:
 
<math>s_t = z_t \odot s_{t-1} + (1 - z_t) \odot \tilde{s_t}</math>
 
If the reset gate is close to 0, it will ignore the previous hidden state, allowing the model to discard irrelevant information.
 
The update gate <math>z_t</math> controls how much of the past state should matter in the current time step. If <math>z_t</math> is close to 1, then we can effectively copy information from the past state across multiple time steps.
 
Units that need to capture short-term dependencies often have highly active reset gates.
 
== Cliping Gradients ==
 
A simple solution for clipping the gradient. (Mikolov, 2012; Pascanu et al., 2013):
 
* Clip the parameter gradient from a mini-batch element-wise (Mikolov, 2012) just before the parameter update.
* Clip the norm <math>g</math> of the gradient <math>g</math> (Pascanu et al., 2013a) just before the parameter update.
 
The formula for clipping the gradient is:
 
<math>g' = \min\left(1, \frac{c}{|g|}\right) g</math>
 
where c is a constant.
 
== Attention ==
 
The attention mechanism was introduced to improve the performance of the encoder-decoder model for machine translation.
 
=== Common Representation ===
 
A single 'concept' is universally represented, transcending specific languages or forms.
 
* '''Encoder''': Processes the word 'elephant' from its original source.
* '''Output''': A universal representation vector (the abstract 'concept' of an elephant).
* '''Decoders''': Translate this concept into various domains or applications.
 
The 'concept' is an abstract entity that exists independently of any particular language or representation.
 
For example, if we want to translate from English to Spanish
 
* '''Encoder (English Input)''': The system processes the word "elephant."
* '''Output (Universal Representation)''': The system generates an abstract concept or vector representing an "elephant," independent of any specific language.
* '''Decoder (Spanish Output)''': The system decodes this concept and outputs the equivalent Spanish word: "elefante."
 
[[Image:attn_exmaple.png|thumb|500px|center|Common Representation]]
 
 
=== Sequence-to-Sequence Model ===
 
In the sequence-to-sequence model, every word <math>x_i</math> produces a hidden vector <math>h_i</math> in the encoder part of the autoencoder. The hidden vector of every word, <math>h_i</math>, is fed to the next hidden vector, <math>h_{i+1}</math>, by a projection matrix <math>W</math>.
 
In this model, for the whole sequence, there is only one context vector <math>c</math>, which is equal to the last hidden vector of the encoder, i.e., <math>c = h_n</math>.
 
[[Image:sqe2seq.png|thumb|800px|center|Sequence-to-Sequence Model]]
 
Challenges:
 
1. '''Long-range dependencies''': As the model processes long sequences, it can struggle to remember and utilize information from earlier steps, especially in cases where long-term context is crucial.
 
2. '''Sequential processing''': Since these models process data step by step in sequence, they can't take full advantage of parallel processing, which limits the speed and efficiency of training.
 
These are the core challenges that newer architectures, such as transformers, aim to address.
 
=== Attention Definition ===
 
The basic idea behind the attention mechanism is directing the focus on important factors when processing data. Attention is a fancy name for '''weighted average'''.
 
=== Sequence-to-Sequence Model with Attention ===
 
* Sequence-to-sequence models:
Multiple RNN units serve as the encoder. They encode information into the context vectors. Multiple RNN units decode the concept in the context vector to different domain information. The limitations of this approach are long-range dependencies and prevention of parallelization.
 
<math>p(y_i | y_1, \ldots, y_{i-1}) = g(y_{i-1}, l_i, c)</math>
 
* Sequence-to-sequence with attention:
Pass multiple context vectors to the decoder.
 
<math>p(y_i | y_1, \ldots, y_{i-1}) = g(y_{i-1}, l_i, c_i)</math>
 
 
[[Image:sqe2seq attn.png|thumb|800px|center|Sequence-to-Sequence Model with Attention]]
 
There are some calculations:
 
1. Similarity score:
<math>s_{ij} = similarity(l_{i-1}, h_j)</math>
 
2. Attention weight:
<math>a_{ij} = \frac{e^{s_{ij}}}{\sum_{k=1}^{T} e^{s_{ik}}}</math>
 
The attention weight <math>a_{ij}</math> is obtained by applying a softmax function to the similarity scores. This normalizes the scores across all encoder hidden states, turning them into a probability distribution.
 
3. Context vector:
<math>c_i = \sum_{j=1}^{T} a_{ij} h_j</math>
 
The effectiveness of the correlation between inputs around position <math>j</math> and the output at position <math>i</math> is crucial.
 
This score is determined based on:
* The RNN hidden state <math>l_{i-1}</math> just before emitting <math>y_i</math>.
* The <math>j^{th}</math> hidden state <math>h_j</math> of the input sentence.
 
==== CNN Kernels VS Attention Mechanism ====
'''CNN Kernels:'''
* They only consider '''local''' neighborhoods.
*The weights of the kernel are learned during training but remain '''fixed''' when applied across the entire input.
*This weight-sharing gives CNNs their '''translation invariance''' (the ability to detect the same feature anywhere in the input).
*Computationally ''' efficient''' because they only operate on local regions.
'''Attention Mechanisms:'''
*Attention computes relationships between '''all''' pairs of elements in the input, regardless of their positions.
*There’s no fixed-size window—the model dynamically learns which parts of the input to focus on for each output.
*Attention is '''data-dependent''' —the focus shifts based on the current input, enabling the model to adapt flexibly.
*Computationally more '''expensive''' because they involve operations between all pairs of elements (quadratic complexity).
 
 
== Transformer Architecture ==
The basic concept behind transformers is attention as summarized in the paper by Vaswani et. al [https://arxiv.org/abs/1706.03762 'Attention is all you need']. This paper claims that all you need is attention and with the structure of attentions, basically you can handle the sequential data. It was based on GPT and many other models that we use in LLM and imaging processing. Transformer is an example of an encoder-decoder architecture.  Unlike RNNs, Transformers can process sequences in parallel, making them faster to train on large datasets. Transformers have applications beyond NLP, such as Vision Transformers (ViT) in computer vision and protein structure prediction in biology (AlphaFold). Transformers' ability to capture long-range dependencies efficiently has made them the standard for many modern AI models.
 
=== Encoder ===
The encoder consists of two main components: Self Attention and Feed Forward Neural Network. The architecture of the Encoder is given below:
[[File:Encoder.png|center|thumb|Encoder architecture of the Transformer]]
 
==== Self Attention ====
Understanding the individual words in a sentence is not enough to understand the whole sentence and one needs to understand how the words relate to each other. The attention mechanism forms composite representations. We aim to have embeddings of words and embeddings of compositions at the same time in different levels. Unlike word2vec introduced in 2013 by Mikolov et al., which captures the vector representations of words in an embedding space such that words that are similar are represented closer to each other, self-attention aims to capture the similarity between words based on context and in relation to each other. Self-attention captures the similarity within the same sequence. Multiple layers help form complex concept representations. For example, the context of the word "bank" differs based on if the surrounding words involve "money" or "river".
 
[[File:word2vec.jpg|center|thumb|Illustration of word2vec where "King" - "Man" + "Woman" produces a vector close to the word "Queen"]]
 
Self-attention is analogous to the fundamental retrieval strategy in databases where given a query, and key-value pairs, we use the query to identify the key and retrieve the corresponding value. The generalized definition for calculating the attention of a target word with respect to the input word: use the '''Query''' of the target and the '''Key''' of the input and then calculate a matching score. These matching scores act as the weights of the '''Value''' vectors.
 
 
Then we look at the definition if matrix form. Given an input vector <math>\mathbf{x} \in \mathbb{R}^d</math>, the weights for the query, key, and value transformations are defined as:
 
* <b>Query weight matrix</b>:  <math>\mathbf{W}_q \in \mathbb{R}^{d \times p}</math>
 
* <b>Key weight matrix</b>:  <math>\mathbf{W}_k \in \mathbb{R}^{d \times p}</math>
 
* <b>Value weight matrix</b>:  <math>\mathbf{W}_v \in \mathbb{R}^{d \times r}</math>
 
The transformations for the query (<math>\mathbf{q}</math>), key (<math>\mathbf{k}</math>), and value (<math>\mathbf{v}</math>) vectors are given by:
 
* <b>Query vector</b>:  <math>\mathbf{q} = \mathbf{W}_q^T \mathbf{x}</math> where <math>\mathbf{q} \in \mathbb{R}^{p \times 1}</math>, since <math>\mathbf{W}_q^T \in \mathbb{R}^{p \times d}</math>, and <math>\mathbf{x} \in \mathbb{R}^{d \times 1}</math>
 
* <b>Key vector</b>:  <math>\mathbf{k} = \mathbf{W}_k^T \mathbf{x}</math> where <math>\mathbf{k} \in \mathbb{R}^{p \times 1}</math>, since <math>\mathbf{W}_k^T \in \mathbb{R}^{p \times d}</math>, and <math>\mathbf{x} \in \mathbb{R}^{d \times 1}</math>
 
* <b>Value vector</b>:  <math>\mathbf{v} = \mathbf{W}_v^T \mathbf{x}</math> where <math>\mathbf{v} \in \mathbb{R}^{r \times 1}</math>, since <math>\mathbf{W}_v^T \in \mathbb{R}^{r \times d}</math>, and <math>\mathbf{x} \in \mathbb{R}^{d \times 1}</math>
 
The transformations allow the attention mechanism to compute similarity scores between the query and key vectors and to use the value vectors to produce the final weighted output as <math>\mathbf{z_1} = \alpha_1 \mathbf{v}_1 + \alpha_2 \mathbf{v}_2 + \ldots + \alpha_n \mathbf{v}_n</math>, where <math>\mathbf{v}_i</math> are similar to the input in CNNs, and <math>\alpha_i</math> are similar to the kernels in CNNs.
 
However, unlike the kernels in CNNs, the <math>\alpha_i</math>'s are data-dependent and given by: 
<math>\alpha_i = \text{softmax}\left(\frac{\mathbf{q}^T \mathbf{k}_i}{\sqrt{p}}\right)</math>.
 
Extending this to the entire dataset, the equations are:
 
<math>
\mathbf{X} = [\mathbf{x}_1, \mathbf{x}_2, \ldots, \mathbf{x}_n] \in \mathbb{R}^{d \times n}
</math>
 
<math>
\mathbf{Q} = [\mathbf{q}_1, \mathbf{q}_2, \ldots, \mathbf{q}_n] \in \mathbb{R}^{p \times n}
</math>
 
<math>
\mathbf{K} = [\mathbf{k}_1, \mathbf{k}_2, \ldots, \mathbf{k}_n] \in \mathbb{R}^{p \times n}
</math>
 
<math>
\mathbf{V} = [\mathbf{v}_1, \mathbf{v}_2, \ldots, \mathbf{v}_n] \in \mathbb{R}^{r \times n}
</math>
 
The transformations are defined as:
 
<math>
\mathbf{Q}_{p \times n} = \mathbf{W}_{q}^{T_{p \times d}} \mathbf{X}_{d \times n}
</math>
 
<math>
\mathbf{K}_{p \times n} = \mathbf{W}_{k}^{T_{p \times d}} \mathbf{X}_{d \times n}
</math>
 
<math>
\mathbf{V}_{r \times n} = \mathbf{W}_{v}^{T_{r \times d}} \mathbf{X}_{d \times n}
</math>
 
Therefore the output,
<math>
\mathbf{Z}_{r \times n} = \mathbf{V}_{r \times n} \cdot \text{softmax}\left(\frac{\mathbf{Q}^{T} \mathbf{K}}{\sqrt{p}}\right)_{n \times n}
</math>
 
Additionally, we have:
 
<math>
\mathbf{Q}^{T} \mathbf{K} = \mathbf{X}^{T} \mathbf{W}_{q} \mathbf{W}_{k}^{T} \mathbf{X} \quad \text{(an asymmetric kernel extracting the global similarity between words)}
</math>
 
Let us take a closer look at how one word is processed in the encoder.
[[File:Encoder-Deeper-View.jpg|center|thumb|Deeper view of the Encoder]]
The input vector x is passed through a linear transformation layer which transforms the input into query q, key k, and value v vectors, given by the equations above. This is passed through a stacked multi-head self-attention layer which extracts global information across pairwise sequence of words to produce the output vector Z also given by the equation above. The equation for Z can be compared to how similarity is computed between the key and value pairs in databases. This output is added to the residual input x to preserve the meaning of individual words in addition to the pairwise representations. This is normalized to produce the output <math>\mathbf{(Z+x)} \in \mathbb{R}^{h \times r}</math>. This serves as the input to the feed forward neural network.
 
==== Feed Forward Neural Network ====
The structure of the feed forward network (FFN) is Linear Layer 1, followed by ReLU activation and then another linear layer 2. While the attention mechanism captures global information between words and hence aggregates across columns, the feed forward neural network aggregates across rows and takes a more broader look at each word independently. Depsite the individual processing, all positions share the same set of weights and biases in the FFN. In a classroom environment, the attention mechanism is similar to the teacher observing the interactions among students in a group, whereas the feed forward neural network resembles the teacher evaluating each student independently for their understanding of the assignment. The output of the feed forward layer r also has a residual connection from the previous layer which is normalized and passed as the input of the decoder as <math>\mathbf{(r+(z+x))}</math>. The encoder also has a positional encoding component which captures information about the position of words in a sequence.
 
While the above figure zooms in at how a word vector x is processed by the encoder, the major advantage of the transformer architecture is its ability to handle multiple words in a sequence in parallel and so in practice, the above zoomed in version of the encoder is usually stacked to handle a group of words in parallel.
 
==== Global v.s. Local Information
 
For Attention Mechanism:
 
* '''Global Understanding''': Captures relationships among different positions in the sequence.
* '''Context Aggregation''': Spreads relevant information across the sequence, enabling each position to see a broader context.
 
For Feed-Forward Networks (FFN):
 
* '''Local Processing''': While attention looks across the entire sequence, FFN zooms back in to process each position independently.
* '''Individual Refinement''': Enhances the representation of each position based on its own value, refining the local information gathered so far.
 
=== Decoder ===
The decoder consist of three main components: Masked Self Attention, Cross Attention and Linear Layer. The architecture of the Decoder is given below:
[[File:Transformer-Decoder.png|center|thumb|Decoder architecture of the Transformer]]
 
==== Masked Self Attention ====
In masked self attention, we add a mask matrix <math>\mathbf{M} \in \mathbb{R}^{n \times n}</math> to the normalized argument within the softmax of <math>\mathbf{Z}</math> given by
<math>
\mathbf{Z}_{r \times n} = \mathbf{V}_{r \times n} \cdot \text{softmax}\left(\frac{\mathbf{Q}^{T} \mathbf{K} + \mathbf{M}}{\sqrt{p}}\right)_{n \times n}
</math>
The reason for adding a mask matrix M is to ensure that the output is informed only by the past words and not by the words further along in the sequence. The mask matrix therefore is given by:
 
<math>M(i,j) = \begin{cases}
0 & \text{if } j \leq i \
-\infty & \text{if } j > i
\end{cases}</math>
 
This is because <math>\mathbf{Z}</math> is an upper triangular matrix with values for previous words since <math>softmax(x + 0)</math> is the same as <math>softmax(x)</math>, but <math>softmax(x - \infty)</math> will be equal to 0.
 
==== Cross Attention ====
The intuition behind cross attention is similar to sequence-to-sequence models where the context vector is passed from the encoder to the decoder capturing relevant information from the input sequence. The residual connection plus the output of the masked self attention is passed as the query to the cross attention block, whereas the key and value pairs are the same as the output of the encoder. The relationship and relevance between words in different sentences are captured.
 
==== Linear Layer ====
The linear layer is applied to the output of the feed forward neural network of the decoder and its primary role is to adjust the dimensionality of the network to match the size of the vocabulary. It involves learning a set of parameters - a matrix of dimension equal to <math> p \times len(vocab)</math>. This results in a <math> p \times 1</math> vector which is then passed through a probabilistic softmax layer to predict the next word in the sequence.
 
====  Softmax Activation ====
The function transforms the linear layer's output into probabilities as mentioned above. The output represents the likelihood of a respective word being the next word in the sequence.
 
=== Positional Encoding ===
So far, the encoder and decoder has no sense of the order of the words in the sequence. The sentences "I am a teacher", "Teacher I am", "Am I a teacher?" are processed the same way, even though the meaning may not be the same. To circumvent this issue, and due to the lack of the convolution or recurrence operations, a positional encoding scheme is embedded within the encoder and decoder. In this encoding, the position of the words in a sequence is encoded by a vector. The even positions are represented by a sinusoidal wave with 1 representing the peaks and 0 representing the troughs. Similarly, the odd positions are represented by a cosine wave. Thus, each position is encoded by a unique binary vector and each unique binary vector represents a specific position.
 
=== Why use Sine and Cosine? ===
1. Sine and cosine functions provide a smooth, continuous representation of position. Smootheness ensures that gradient can be found( i. e. can't find a gradient of a discrete binary encoding).
 
2. '''Relative positions''' can be easily derived. Model can learn relationships like <math> sin (a+b) = sin(a)*cos(b)+cos(a)*sin(b) </math> .This property allows the model to learn the relative distance between words. For example, in the sentence "The cat sat on the mat", the difference between "The cat" and "cat sat" can be inferred by the shift in sine and cosine values.
 
3. Because sine and cosine functions are periodic, positional encodings can '''generalize to longer sequences''' even if they weren’t seen during training.
 
4. Multi-frequency approach allows the model to learn both local (short-term) and global (long-term) dependencies:
High-frequency components might help the model distinguish words that are close together.
Low-frequency components help capture the broader structure of the sentence.
 
 
== Bidirectional Encoder Representations from Transformers (BERT) ==
[https://arxiv.org/abs/1810.04805 BERT] introduced by Google is built by repeating the encoder of the transformer multiple times. The Bidirectional in BERT refers to its ability to attend to the future and past words in the sequence unlike Transformers which only looks at the past to make predictions about the future. The fundamental principles behind BERT are Masked Language Modeling, and Next Sentence Prediction. The architecture of BERT is given below.
 
[[File:BERT.png|center|thumb|Masked Language Modeling]]
 
=== Masked Language Modeling ===
BERT masks words in a corpus as shown in the figure below and makes the model learn to predict these words. It thereby pays attention to both words before and after the masked word and fills in the blank given the entire context. It is the same as a Transformer Encoder where 12 encoders (in contrast to the 6 in the original paper of Transformers) are stacked on top of each other. The output of the encoder is passed to s linear dense layer and softmax to predict the most probable word from the vocabulary of the corpus.
 
[[File:MLM.png|center|thumb|Masked Language Modeling]]
 
=== Next Sentence Prediction ===
It was also used to identify if given two sentences A and B, B logically follows the sentence A. This is possible due to the ability to fine-tune the weights of the pretrained BERT model for downstream prediction tasks. The pre-trained model can also be used to represent the input of a sentiment analysis task (for example) to a neural network in a better manner. The [CLS] token is prepended to the input sequence and is used to capture the context of the whole sentence such that during fine-tuning, the prediction may be conditioned on the representation of the [CLS] token. For sentence-level tasks, the final hidden state of the [CLS] token is used as the sentence representation.
 
There are various flavors of BERT based on slight modifications to the original architecture and training processes. The advantage of fine tuning pretrained models is the opportunity to finetune them on a domain specific corpus leading to additional variants of BERT as BioBERT retrained on a biomedical corpus, BERTweet trained on around 850 million tweets and so on.
 
== Transformers and GPT Models ==
 
=== Overview of Transformers ===
 
* Transformers consist of two main components:
** Encoder
** Decoder
* BERT utilizes a stack of encoders, while GPT uses a stack of decoders.
* GPT models are neural network-based language prediction models built on Transformer architecture.
 
=== Decoder Structure ===
 
* The decoder has three parts:
*# Masked Multi-Head Attention: Attends only to the left.
*# Cross Attention: Attends to encoded inputs (removed in GPT).
*# Feed Forward Neural Network.
 
=== Differences Between BERT and GPT ===
 
* Both BERT and GPT use masked multi-head attention, but unlike BERT that masks a word in the middle of the sentence, and tries to predict the mask, GPT masks all the future words and tries to predict them.
* Training methods differ:
** BERT masks tokens in sentences.
** GPT predicts the next token in a sequence.
 
=== Training Process ===
 
* In GPT, the model predicts the next token based on the previous tokens, treating the input as a sequence.
* The first GPT model (2018) had 117 million parameters and was trained on 7,000 books.
* It was seen that larger models tend to generalize better and have better "emergent abilities", although the reason is still unclear.
 
=== Evolution of GPT Models ===
 
 
==== GPT-1 ====
 
* '''Released''': 2018
* '''Parameters''': 117 Million
* '''Layers''': 12
* '''Training Data''': Books1 Corpus (7,000 books)
* '''Focus''': Unsupervised pre-training, Transformer architecture, large-scale language modeling.
 
==== GPT-2 ====
* '''Released''': 2019
* '''Parameters''': ~1.5 Billion
* '''Layers''': 48
* '''Training Data''': 40GB (English)
* '''Focus''': Transformer architecture, self-attention mechanism.
 
==== GPT-3 ====
* '''Released''': 2020
* '''Parameters''': 175 Billion
* '''Layers''': 175
* '''Training Data''': 570GB (Multilingual)
* '''Focus''': Few-shot learning, prompt engineering, Python support.
 
==== GPT-4 ====
* '''Release''': March 2023 (ChatGPT Plus, Microsoft Copilot)
* '''Parameters''': ~1.76 Trillion (rumored, Mixture of Experts)
* '''Layers''': Unknown
* '''Training Data''': More diverse, larger scale
* '''Focus''': Multimodal (text and image inputs), improved few-shot learning, reasoning, and NLU/NLG.
 
==== GPT-4o and GPT-4o1 ====
 
* '''Release''': GPT-4o is currently available; GPT-4o1 is in preview.
 
* '''Capabilities''':
  * '''GPT-4o''': Enhanced multimodal capabilities for text, image, and voice. Improved speed and refined reasoning.
  * '''GPT-4o1''': Designed for deeper reasoning, particularly for complex science, math, and coding challenges.
 
* '''Training Data''': Utilizes an expanded and diverse dataset to improve understanding and adaptability.
 
 
Larger models tend to generalize better. This trend suggests that increasing model size allows for deeper contextual understanding.
 
=== Chain of Thought Reasoning ===
 
* GPT-4 introduced a method called “chain of thought,” allowing the model to predict intermediate steps in reasoning tasks. It involves multi-step thinking: The model generates a series of logical steps to arrive at the final answer, rather than answering in a single sentence.
* Example: Problem: What is the result of 5 + 5 + 5? It is clear to see the answer is 15. With the chain of thought reasoning - Step 1: The first 5 plus the second 5 gives 10 (i.e. <math>5+5=10</math>). Step 2: add the last 5 to the result from Step 1  (i.e. <math>10+5=15</math>).
 
=== Alignment and Instruction Following ===
 
* ChatGPT is designed to follow instructions and align with user preferences, addressing issues like harmful or politically incorrect outputs.
* InstructGPT is a variant of GPT that focuses on following instructions using human feedback via Reinforcement Learning from Human Feedback (RLHF).
 
=== Text-Text Transfer Transformer (T5) ===
 
* T5 combines encoder and decoder structures and treats various NLP tasks as text-to-text problems, allowing for diverse applications like translation and summarization.
* NLP tasks such as sentiment analysis which were primarily treated as classification problems are cast as text-to-text problems.
* Next span prediction is used where a set of sequential tokens are removed and replaced with sentinel tokens.
* T5 architecture operates on an encoder-decoder model and encoder input padding can be performed on both left and right.
 
=== Training Techniques in T5 ===
 
* T5 masks spans of tokens rather than individual tokens, focusing on global context rather than local dependencies. 15% of tokens are randomly removed and replaced with sentinel tokens.
 
=== Benchmarking and Performance ===
 
* Models are often evaluated against benchmarks like GLUE and SuperGLUE, which consist of various NLP tasks.
 
=== Training and Fine-Tuning LLMs ===
 
* LLMs are trained on massive datasets of unlabeled text using unsupervised learning.
* The training process involves predicting the next token in a sequence.
* Fine-tuning is done on labeled data to align the model with specific tasks or instructions. This process is called Supervised Fine-Tuning (SFT).
 
=== Aligning LLMs with Human Feedback ===
 
* Reinforcement Learning with Human Feedback (RLHF) is used to ensure LLMs produce safe and ethical outputs.
* RLHF involves generating multiple responses for a given prompt and having humans rank them.
* A reward model is trained on this ranked data to predict the quality of a response.
* The original LLM is then fine-tuned using this reward model.
* RLHF was introduced in 2017 and has been widely used in LLMs like ChatGPT.
 
=== Direct Preference Optimization (DPO) ===


== Bidirectional Encoder Representations from Transformers (BERT) ==
* DPO is a newer approach that aims to replace RLHF.
[https://arxiv.org/abs/1810.04805 BERT] introduced by Google is built by repeating the encoder of the transformer multiple times. The Bidirectional in BERT refers to its ability to attend to the future and past words in the sequence unlike Transformers which only looks at the past to make predictions about the future. The fundamental principles behind BERT are Masked Language Modeling, and Next Sentence Prediction. The architecture of BERT is given below.
* It directly collects user preferences for different responses, eliminating the need for a reward model.
 
* DPO is easier to implement and more stable than RLHF.
[[File:BERT.png|center|thumb|Masked Language Modeling]]
 
=== Masked Language Modeling ===
BERT masks words in a corpus as shown in the figure below and makes the model learn to predict these words. It thereby pays attention to both words before and after the masked word and fills in the blank given the entire context. It is the same as a Transformer Encoder where 12 encoders (in contrast to the 6 in the original paper of Transformers) are stacked on top of each other. The output of the encoder is passed to s linear dense layer and softmax to predict the most probable word from the vocabulary of the corpus.  
 
[[File:MLM.png|center|thumb|Masked Language Modeling]]
 
=== Next Sentence Prediction ===
It was also used to identify if given two sentences A and B, B logically follows the sentence A. This is possible due to the ability to fine-tune the weights of the pretrained BERT model for downstream prediction tasks. The pre-trained model can also be used to represent the input of a sentiment analysis task (for example) to a neural network in a better manner. The [CLS] token is prepended to the input sequence and is used to capture the context of the whole sentence such that during fine-tuning, the prediction may be conditioned on the representation of the [CLS] token.
 
There are various flavors of BERT based on slight modifications to the original architecture and training processes. The advantage of fine tuning pretrained models is the opportunity to finetune them on a domain specific corpus leading to additional variants of BERT as BioBERT retrained on a biomedical corpus, BERTweet trained on around 850 million tweets and so on.
 
== Transformers and GPT Models ==
 
=== Overview of Transformers ===
 
* Transformers consist of two main components:
** Encoder
** Decoder
* BERT utilizes a stack of encoders, while GPT uses a stack of decoders.
* GPT models are neural network-based language prediction models built on Transformer architecture.
 
=== Decoder Structure ===
 
* The decoder has three parts:
*# Masked Multi-Head Attention: Attends only to the left.
*# Cross Attention: Attends to encoded inputs (removed in GPT).
*# Feed Forward Neural Network.
 
=== Differences Between BERT and GPT ===
 
* Both BERT and GPT use masked multi-head attention, but unlike BERT that masks a word in the middle of the sentence, and tries to predict the mask, GPT masks all the future words and tries to predict them.
* Training methods differ:
** BERT masks tokens in sentences.
** GPT predicts the next token in a sequence.
 
=== Training Process ===
 
* In GPT, the model predicts the next token based on the previous tokens, treating the input as a sequence.
* The first GPT model (2018) had 117 million parameters and was trained on 7,000 books.
* It was seen that larger models tend to generalize better and have better "emergent abilities", although the reason is still unclear.
 
=== Evolution of GPT Models ===
 
* GPT-2 (2019) had 1.5 billion parameters.
* GPT-3 (2020) had 175 billion parameters.
* Larger models tend to generalize better. This trend suggests that increasing model size allows for deeper contextual understanding.


=== Chain of Thought Reasoning ===
Direct policy optimization directly optimizes the policy based on preferred human ranked responses without required the application of a reward model (RM) or reinforcement learning (RL).


* GPT-4 introduced a method called “chain of thought,” allowing the model to predict intermediate steps in reasoning tasks. It involves multi-step thinking: The model generates a series of logical steps to arrive at the final answer, rather than answering in a single sentence.
The loss function for direct policy optimization is given by
* Example: Problem: What is the result of 5 + 5 + 5? It is clear to see the answer is 15. With the chain of thought reasoning - Step 1: The first 5 plus the second 5 gives 10 (i.e. <math>5+5=10</math>). Step 2: add the last 5 to the result from Step 1  (i.e. <math>10+5=15</math>).


=== Alignment and Instruction Following ===
<math>L_{DPO} = - \mathbb{E}_{(x, y_w, y_l) \sim D} \left[ \log \sigma \left( \beta \log \frac{\pi_{\theta}(y_w | x)}{\pi_{\text{ref}}(y_w | x)} - \beta \log \frac{\pi_{\theta}(y_l | x)}{\pi_{\text{ref}}(y_l | x)} \right) \right]
</math>


* ChatGPT is designed to follow instructions and align with user preferences, addressing issues like harmful or politically incorrect outputs.
Where
* InstructGPT is a variant of GPT that focuses on following instructions using human feedback via Reinforcement Learning from Human Feedback (RLHF).


=== Text-Text Transfer Transformer (T5) ===
<math>x</math> is the prompt used to generate the two responses


* T5 combines encoder and decoder structures and treats various NLP tasks as text-to-text problems, allowing for diverse applications like translation and summarization.
<math> y_w </math> is the winning response chosen by human rankers to be superior
* NLP tasks such as sentiment analysis which were primarily treated as classification problems are cast as text-to-text problems.
* Next span prediction is used where a set of sequential tokens are removed and replaced with sentinel tokens.
* T5 architecture operates on an encoder-decoder model and encoder input padding can be performed on both left and right.


=== Training Techniques in T5 ===
<math> y_l</math>  is the losing response generated by the LLM deemed worse by human rankers


* T5 masks spans of tokens rather than individual tokens, focusing on global context rather than local dependencies. 15% of tokens are randomly removed and replaced with sentinel tokens.
<math> \pi_\theta </math> is the model's output probabilities of the current model being trained


=== Benchmarking and Performance ===
<math> \pi_{ref} </math> is the frozen probabilities of the reference model prior to DPO training


* Models are often evaluated against benchmarks like GLUE and SuperGLUE, which consist of various NLP tasks.
<math>\beta</math> is the temperature scaling factor.


=== Training and Fine-Tuning LLMs ===
This loss function can be rearranged to the form below, due to the laws of logarithms


* LLMs are trained on massive datasets of unlabeled text using unsupervised learning.
<math>L_{DPO} = - \mathbb{E}_{(x, y_w, y_l) \sim D} \left[ \log \sigma \left( \beta \log \left( \frac{\frac{\pi_{\theta}(y_w | x)}{\pi_{\text{ref}}(y_w | x)}}{\frac{\pi_{\theta}(y_l | x)}{\pi_{\text{ref}}(y_l | x)}} \right) \right) \right] </math>
* The training process involves predicting the next token in a sequence.
* Fine-tuning is done on labeled data to align the model with specific tasks or instructions. This process is called Supervised Fine-Tuning (SFT).


=== Aligning LLMs with Human Feedback ===
And in the case where the reference probabilities are equal, they can be cancelled out and the equation can be written as


* Reinforcement Learning with Human Feedback (RLHF) is used to ensure LLMs produce safe and ethical outputs.
<math>L_{DPO} = - \mathbb{E}_{(x, y_w, y_l) \sim D} \left[ \log \sigma \left( \beta \log \left( \frac{\pi_{\theta}(y_w | x)}{\pi_{\theta}(y_l | x)} \right) \right) \right] </math>
* RLHF involves generating multiple responses for a given prompt and having humans rank them.
* A reward model is trained on this ranked data to predict the quality of a response.
* The original LLM is then fine-tuned using this reward model.
* RLHF was introduced in 2017 and has been widely used in LLMs like ChatGPT.


=== Direct Preference Optimization (DPO) ===
This produces a gradient which adjusts the models weights in the direction of producing human preferred responses directly.
 
* DPO is a newer approach that aims to replace RLHF.
* It directly collects user preferences for different responses, eliminating the need for a reward model.
* DPO is easier to implement and more stable than RLHF.


=== Project Ideas for Deep Learning ===
=== Project Ideas for Deep Learning ===
Line 3,339: Line 16,569:
** Variational auto-encoders maximize ELBO which is similar to minimizing KL divergence since <math> log(p(x)) </math> is a constant.
** Variational auto-encoders maximize ELBO which is similar to minimizing KL divergence since <math> log(p(x)) </math> is a constant.
** Maximizing ELBO ensures <math>q</math> closely approximates <math>p</math>, meaning maximizing ELBO ensures that the learned latent distribution is close to the target distribution. This approach allows VAEs to generate new samples by sampling from the latent space.
** Maximizing ELBO ensures <math>q</math> closely approximates <math>p</math>, meaning maximizing ELBO ensures that the learned latent distribution is close to the target distribution. This approach allows VAEs to generate new samples by sampling from the latent space.
==== DPO (Direct Preference Optimization) ====
DPO is a technique for fine-tuning LLMs using human preference data without reinforcement learning.
'''Core Concept of DPO'''
* Directly aligns the model's behavior with human preferences without using Reinforcement Learning.
* Uses '''pairwise comparisons''' between preferred and less-preferred responses for optimization.
* Avoids the need for a separate reward model.
'''How DPO Works'''
1. '''Collect Preference Data:''' Like RLHF, DPO starts with human preference rankings for model outputs.
2. '''Train Directly on Preferences:''' Instead of training a separate reward model and running PPO, DPO adjusts the model's logits directly to prefer responses that humans ranked higher.
3. '''Implicitly Regularized:''' DPO ensures that the model doesn’t deviate too much from its original state without needing an explicit KL term.
'''Advantages of DPO over RLHF'''
✅ No Reinforcement Learning → Eliminates PPO instability and reward hacking
✅ More Stable and Predictable Outputs → Avoids mode collapse and nonsensical generations
✅ Simpler & Cheaper → Does not require a separate reward model or reinforcement learning
✅ Better Balance Between Diversity & Preference Matching → Produces more natural and useful responses
'''DPO Loss Function'''
The DPO loss function is defined as:
<math>
L_{DPO} = -\mathbb{E}_{(x,y_w,y_l) \sim D} \left[ \log \sigma \left( \beta \log \frac{\pi_{\theta}(y_w | x)}{\pi_{\text{ref}}(y_w | x)} - \beta \log \frac{\pi_{\theta}(y_l | x)}{\pi_{\text{ref}}(y_l | x)} \right) \right]
</math>
* '''<math>x</math> (prompt)''': e.g., ''What is Ice?''
* '''<math>y_w</math> (preferred response)''': e.g., ''It's the solid form of water.''
* '''<math>y_l</math> (less preferred response)''': e.g., ''Water that has turned solid due to low temperatures.''
* '''<math>\pi_{\theta}</math>''': Current model's output probabilities.
* '''<math>\pi_{\text{ref}}</math>''': Reference model's frozen probabilities.
* '''<math>\beta</math>''': Temperature scaling factor.
<math>
L_{DPO} = -\mathbb{E}_{(x,y_w,y_l) \sim D} \left[ \log \sigma \left( \beta \log \frac{\pi_{\theta}(y_w | x)}{\pi_{\text{ref}}(y_w | x)} - \beta \log \frac{\pi_{\theta}(y_l | x)}{\pi_{\text{ref}}(y_l | x)} \right) \right]
</math>
<math>
L_{DPO} = -\mathbb{E}_{(x,y_w,y_l) \sim D} \left[ \log \sigma \left( \beta \log \frac{\frac{\pi_{\theta}(y_w | x)}{\pi_{\text{ref}}(y_w | x)}}{\frac{\pi_{\theta}(y_l | x)}{\pi_{\text{ref}}(y_l | x)}} \right) \right]
</math>


==== ELBO Decomposition ====
==== ELBO Decomposition ====

Latest revision as of 13:14, 28 February 2025


Notes on Exercises

Exercises are numbered using a two-part system, where the first number represents the lecture number and the second number represents the exercise number. For example:

  • 1.1 refers to the first exercise in Lecture 1.
  • 2.3 refers to the third exercise in Lecture 2.

Students are encouraged to complete these exercises as they follow the lecture content to deepen their understanding.

Exercise 1.1

Level: ** (Moderate)

Exercise Types: Novel

Each exercise you contribute should fall into one of the following categories:

  • Novel: Preferred – An original exercise created by you.
  • Modified: Valued – An exercise adapted or significantly altered from an existing source.
  • Copied: Permissible – An exercise reproduced exactly as it appears in the source.


References: Source: (e.g., book or other resources, if a webpage has its URL), Chapter,Page Number.

Question

Prove that the Perceptron Learning Algorithm converges in a finite number of steps if the dataset is linearly separable.

Hint:Note: exc Assume that the dataset {(xi,yi)}i=1N is linearly separable, where xiRd are the input vectors, and yi{1,1} are their corresponding labels. Show that there exists a weight vector w and a bias b such that yi(wxi+b)>0 for all i, and use this assumption to bound the number of updates made by the algorithm.

Solution

Step 1: Linear Separability Assumption If the dataset is linearly separable, there exists a weight vector w and a bias b such that: yi(wxi+b)>0i=1,2,,N. Without loss of generality, let w=1 (normalize w).

Step 2: Perceptron Update Rule The Perceptron algorithm updates the weight vector w and bias b as follows:

  • Initialize w0=0 and b0=0.
  • For each misclassified point (xi,yi), update:

ww+yixi,bb+yi.

Define the margin γ of the dataset as: γ=miniyi(wxi+b)xi. Since the dataset is linearly separable, γ>0.

Step 3: Bounding the Number of Updates

Let wt be the weight vector after t-th update. Define: M=maxixi2, the maximum squared norm of any input vector.

Growth of wt2 After t updates, the norm of wt satisfies: wt+12=wt+yixi2=wt2+2yi(wtxi)+xi2. Since the point is misclassified, yi(wtxi)<0. Thus: wt+12wt2+xi2wt2+M. By induction, after t updates: wt2tM.

Lower Bound on wtw Let wt be the weight vector after t-th update. Each update increases wtw by at least γ: wt+1w=(wt+yixi)w=wtw+yi(xiw). Since yi(xiw)γ, we have: wt+1wwtw+γ. By induction: wtwtγ.

Combining the Results The Cauchy-Schwarz inequality gives: wtwwtw=wt. Thus: tγwttM. Squaring both sides: t2γ2tM. Dividing through by t (assuming t>0): tMγ2.

Step 4: Conclusion

The Perceptron Learning Algorithm converges after at most Mγ2 updates, which is finite. This proves that the algorithm terminates when the dataset is linearly separable.

Exercise 1.2

Level: * (Easy)

Exercise Types: Modified

References: Simon J.D. Prince. Understanding Deep learning. 2024

This problem generalized Problem 4.10 in this textbook to N inputs and M outputs.

Question

(a) Consider a deep neural network with a single input, a single output, and K hidden layers, each containing D hidden units. How many parameters does this network have in total?

(b) Now, generalize the problem: if the number of inputs is N and the number of outputs is M, how many parameters does this network have in total?

Solution

(a) Total number of parameters when there is a single input and output:

For the first layer, the input size is 1 and the output size is D. Therefore, the number of weights is 1D, and the number of biases is D.

Number of parameters: D+D=2D

For hidden layers ii+1,i1,...,K1: Each hidden layer connects D units to another D units. Therefore, for each layer, the number of weights is D2, and the number of biases is D.

Number of parameters for all K1 hidden layers: (K1)(D2+D)

For the output layer, the number of weights is D, and the number of biases is 1.

Number of parameters: D+1

Therefore, the total number of parameters is 2D+(K1)(D2+D)+D+1.

(b) Total number of parameters for N inputs and M outputs:

In this case, the number of parameters for the first layer becomes ND+D, while the number of parameters for the output layer becomes DM+M.

Therefore, in total, the number of parameters is ND+D+(K1)(D2+D)+MD+M

Exercise 1.3

Level: * (Easy)

Exercise Types: Modified

References: Simon J.D. Prince. Understanding Deep learning. MIT Press, 2023

This problem modified from the background mathematics problem chap01 Question1.

Question

A single linear equation with three inputs associates a value y with each point in a 3D space (x1,x2,x3). Is it possible to visualize this? What value is at position (0,0,0)?

We add an inverse problem: If y,ω1,ω2,ω3 and β are known, derive a system of equations to solve for the input values x1,x2,x3 that produce a specific output value of y. Under what conditions is this problem solvable?

Solution

A single linear equation with three inputs is of the form:

y=β+ω1x1+ω2x2+ω3x3

where β is the offset, and ω1,ω2,ω3 are weights for the inputs x1,x2,x3.

We can define the code as follows:

def linear_function_3D(x1, x2, x3, beta, omega1, omega2, omega3):
    y = beta + omega1 * x1 + omega2 * x2 + omega3 * x3
    return y

Given β=0.5,ω1=1.0,ω2=0.4 and ω3=0.3,

y=β+ω10+ω20+ω30

Thus, y(0,0,0)=0.5.

To visualize, we can fix x3=0 and let x1,x2 vary, and generate the y-values using the equation.

Here is the code:

import numpy as np
import matplotlib.pyplot as plt

# Generate grid for x1 and x2, fix x3 = 0
x1 = np.linspace(-10, 10, 100)
x2 = np.linspace(-10, 10, 100)
x1, x2 = np.meshgrid(x1, x2)
x3 = 0  

# Define coefficients
beta = 0.5
omega1 = -1.0
omega2 = 0.4
omega3 = -0.3

# Compute y-values
y = linear_function_3D(x1, x2, x3, beta, omega1, omega2, omega3)

# Visualization
fig = plt.figure(figsize=(8, 6))
ax = fig.add_subplot(111, projection='3d')
ax.plot_surface(x1, x2, y, cmap='viridis')
ax.set_xlabel('x1')
ax.set_ylabel('x2')
ax.set_zlabel('y')
plt.title('3D Linear Function with Fixed x3=0')
plt.show()

The plot is shown below:

Visualize a single linear equation with three inputs associates a value y with each point in a 3D space.


For the inverse problem, given y,β,ω1,ω2,ω3, we can solve x1,x2,x3as follows:

[ω1ω2ω3][x1x2x3]=yβ

The problem is solvable if ω is not a zero vector, ensuring at least one weight contributes to the equation.

y = 10.0  
beta = 1.0
omega = [2, -1, 0.5]
rhs = y - beta

# Solve using least squares
x_vec = np.linalg.lstsq(np.array([omega]), [rhs], rcond=None)[0]
print(f"Solution for x: {x_vec}")


Exercise 1.4

Level: * (Easy)

Exercise Types: Novel

Question

Thinking about feedforward model with sigmoid activation, compute the output of a single-layer neural network with 3 inputs and 1 output.

Assuming:

- Input vector: x=(0.1,0.4,0.6)

- weights: w=(0.2,0.3,0.5)

- Bias: b=0.1

- a). Sigmoid activation function: f(z)=11+ez

- b). ReLU activation function: f(z)=max(0,z)

- c). Tanh activation function: f(z)=tanh(z)=ezezez+ez

Solution

1. Compute the weighted sum: z=wx+b=(0.2)(0.1)+(0.3)(0.4)+(0.5)(0.6)+0.1

Breaking this down step-by-step: z=0.02+0.12+0.3+0.1=0.54

2. a). Apply the sigmoid activation function: f(z)=11+ez

Substituting z=0.54: f(z)=11+e0.5411+0.5820.632

Thus, the final output is 0.632.


b). Similarly, apply the ReLU activation function: f(z)=max(0,z)

Substituting z=0.54: f(z)=max(0,0.54)=0.54

c). Finally, apply the Tanh activation function: f(z)=ezezez+ez

Substituting z=0.54: f(z)=e0.54e0.54e0.54+e0.541.7160.5831.716+0.5831.1332.2990.493

Exercise 1.5

Level: * (Easy)

Exercise Types: Novel

Question

1.2012: ________'s ImageNet victory brings mainstream attention to deep learning.

2.2016: Google's ________ uses deep reinforcement learning to defeat a Go world champion.

3.2017: The ________ architecture revolutionizes Natural Language Processing.

Solution

1. AlexNet

2. AlphaGo

3. Transformer

Key Milestones in Deep Learning

•2006: Deep Belief Networks – The modern era of deep learning begins.

•2012: AlexNet's ImageNet victory brings mainstream attention.

•2014-2015: Introduction of Generative Adversarial Networks (GANs).

•2016: Google's AlphaGo uses deep learning to defeat a Go world champion.

•2017: Transformer architecture revolutionizes Natural Language Processing.

•2018-2019: BERT and GPT-2 set new benchmarks in NLP.

•2020: GPT-3 demonstrates advanced language understanding and generation.

•2021: AlphaFold 2 achieves breakthroughs in protein structure prediction.

•2021-2022: Diffusion Models (e.g., DALL-E 2, Stable Diffusion) achieve state-of-the-art in image and video generation.

•2022: ChatGPT popularizes conversational AI and large language models (LLMs).

Exercise 1.6

Level: * (Easy)

Exercise Type: Novel

Question

a) What are some common examples of first-order search strategies in neural network optimization, and why are first-order methods generally preferred over second-order methods?

b) What is the difference between a deep neural network and a shallow neural network, and how many hidden layers does each typically have?

c) Prove that a perceptron cannot converge for the XOR problem.

Solution

a)

Common examples of first-order search strategies in neural network optimization include Gradient Descent (GD), Stochastic Gradient Descent (SGD), Momentum, and Adam. These methods rely on gradients (first derivatives) of the loss function to update model parameters, making them computationally efficient and scalable. First-order methods are preferred due to their efficiency, scalability to large datasets, and lower memory requirements compared to second-order methods. While second-order methods can converge faster, first-order methods like Adam balance performance and resource usage well, especially in large-scale networks.

b)

A deep neural network typically has more than 2 hidden layers, allowing it to learn complex, abstract features at each layer. A shallow neural network usually has 1 or 2 hidden layers. Therefore, networks with more than 2 hidden layers are considered deep, while those with fewer layers are considered shallow.

c)

Step 1: XOR Dataset

The XOR problem has the following data points and labels:

XOR Data
x₁ x₂ y
0 0 0
0 1 1
1 0 1
1 1 0
Step 2: Perceptron Decision Boundary

The perceptron decision boundary is defined as:

z=wx+wx+b

A point is classified as:

  • y = 1 if z > 0
  • y = 0 if z < 0

For the XOR dataset, we derive inequalities for each data point.

Step 3: Derive Inequalities

1. For (x₁, x₂) = (0, 0), y = 0:

  b < 0

2. For (x₁, x₂) = (0, 1), y = 1:

  w₂ + b > 0

3. For (x₁, x₂) = (1, 0), y = 1:

  w₁ + b > 0

4. For (x₁, x₂) = (1, 1), y = 0:

  w₁ + w₂ + b < 0
Step 4: Attempt to Solve

From the inequalities:

1. b<0

2. w+b>0w>b

3. w+b>0w>b

4. w+w+b<0w+w<b

Now, add inequalities (2) and (3):

w+w>2b

But compare this with inequality (4):

w+w<b

This leads to a contradiction because 2b<b cannot be true if b<0.

Therefore, the XOR dataset is not linearly separable, and the perceptron cannot converge for the XOR problem.

Exercise 1.7

Level: * (Easy)

Exercise Type: Novel

Question

The sigmoid activation function is defined as: σ(x)=11+ex.

(a) Derive the derivative of σ(x) with respect to x, and show that: σ(x)=σ(x)(1σ(x)).

(b) Use this property to explain why sigmoid activation is suitable for modeling probabilities in binary classification tasks.

Solution

(a) Derivative: Starting with σ(x)=11+ex, we compute: σ(x)=ddx(11+ex)=ex(1+ex)2.

By noting that σ(x)=11+ex and 1σ(x)=ex1+ex, we simplify to: σ(x)=σ(x)(1σ(x)).

(b) Why sigmoid for probabilities: The sigmoid function maps any real x into (0,1), which aligns with the range of valid probabilities in binary classification. Moreover, its derivative σ(x)=σ(x)(1σ(x)) makes gradient-based optimization naturally scale updates based on “confidence.” When σ(x) is near 0 or 1, the gradient becomes small, preventing large adjustments once the model is fairly certain in its prediction.

A closely related function is the softmax, which generalizes the same probabilistic interpretation to multi-class settings. For two classes, softmax is essentially the same as the sigmoid function, so it can also be suitable for binary classification problems.

Exercise 1.8

Level: * (Easy)

Exercise Types: Novel

Question

In classification, it is possible to minimize the number of misclassifications directly by using:

i=1n1(sign(βTxi+β0)yi)

where 1() is the indicator function, β is the weight vector, and β0 is the bias term. So, the loss function gives 1 for each incorrect response and 0 for each correct one.

    (a) Why is this approach not commonly used in practice?

    (b) Name and give formulas for two differentiable loss functions commonly employed in practice for binary classification tasks, explaining why they are more popular.

Solution

(a): The expression 1(sign(βTxi+β0)yi) gives only 0 or 1. Small changes in β or β0 can suddenly change the loss function for a sample from 0 to 1 (or vice versa). Because the loss function is discrete, the gradient with respect to β or β0 does not exist. Standard optimization techniques like gradient descent rely on differentiable, continuous loss function where partial derivatives can use to update the parameters.

(b): Two alternative loss functions:

Hinge Loss: i=1nmax(0,1yi(βTxi+β0))

The hinge loss is often used in Support Vector Machines (SVMs) and works well when the data is linearly separable.

Logistic (Cross-Entropy) Loss: i=1nlog(1+exp(yi(βTxi+β0)))

The logistic loss (or cross-entropy loss) is commonly used in logistic regression and neural networks. It is differentiable so it works well for gradient-based optimization methods.

Exercise 1.9

Level: * (Easy)

Exercise Types: Novel

Question

How are neural networks modeled? Using an example to explain it clearly.

Solution

Neural networks are modeled from biological neurons. A neural network consists of layers of interconnected neurons where each connection has associated weights. The input layer receives the data features, and each neuron corresponds to one feature from the dataset. The hidden layer consists of multiple neurons that transform the input data into intermediate representations, using a combination of weights, biases, and activation functions which allows the network to learn complex patterns, like the Sigmoid function S(x)=11+ex. The output layer generates the final prediction, such as probabilities for classification or continuous values for regression. Neural networks learn to map inputs to outputs by adjusting weights during training to minimize the error between predicted and actual outputs.

For example, in the lecture note, inputs x1=0.5,x2=0.9,x3=0.3 are passed through a hidden layer with specific weights:

H1 weight=(1.0,2.0,2.0),

H2 weight=(2.0,1.04.0),

H3 weight=(1.0,1.0,0.0).

The computations yield hidden neuron values of

H1=0.5×1.0+0.9×2.0+0.3×2.0=0.13,

H2=0.5×2.0+0.9×1.0+0.3×4.0=0.96,

H3=0.5×1.0+0.9×1.0+0.3×0.0=0.40,

which are then processed by the output layer to produce the final predictions.

This process demonstrates how neural networks learn and transform input data step by step.

Exercise 1.10

Level: ** (Moderate)

Exercise Types: Novel

Question

Biological neurons in the human brain have the following characteristics:

1. A neuron fires an electrical signal only when its membrane potential exceeds a certain threshold. Otherwise, it remains inactive.

2. Neurons are connected to one another through dendrites (input) and axons (outputs), forming a highly interconnected network.

3. The intensity of the signal passed between neurons depends on the strength of the connection, which can change over time due to learning and adaptation.

Considering the above points, answer the following questions:

Explain how these biological properties of neurons might inspire the design and functionality of nodes in artificial neural networks.

Solution

1. Threshold Behavior: The concept of a neuron firing only when its membrane potential exceeds a threshold is mirrored in neural networks through activation functions. These functions decide whether a node "fires" by producing a significant output.

2. Connectivity: The connections between biological neurons via dendrites and axons inspire the weighted connections in artificial neural networks. Each node receives inputs, processes them, and sends weighted outputs to subsequent node, similar how to signals propagate in the brain.

3. Learning and Adaptation: Biological neurons strengthen or weaken their connections based on experience (neuroplasticity). This is similar to how artificial networks adjust weights during training using backpropagation and optimization algorithms. The dynamic modification of weights allows artificial networks to learn from data.

Extra 4. Sparsity of Activation: Biologically, only a small fraction of neurons in the brain are active at specific time, which is energy-efficient and reduces redundancy. RELU attempts to micmic this sparsity so that reducing computational cost and improving generalization becomes feasible.

Exercise 1.11

Level: * (Easy)

Exercise Type: Novel

Question

If the pre-activation is 20, what are the outputs of the following activation functions: ReLU, Leaky ReLU, logistic, and hyperbolic?

Choose the correct answer:
a) 20, 20, 1, 1
b) 20, 0, 1, 1
c) 20, -20, 1, 1
d) 20, 20, -1, 1
e) 20, -20, 1, -1

Solution

The correct answer is a): 20, 20, 1, 1.

Calculation

ReLU(20)=max(0,20)=20

LeakyReLU(20)={20if 200α20if 20<0=20 where α is a small constant (typically 0.01).

σ(20)=11+e201

tanh(20)=e20e20e20+e20=1



Exercise 1.12

Level: * (Easy)

Exercise Type: Novel

Question

Imagine a simple feedforward neural network with a single hidden layer. The network structure is as follows: - linear activation function - The input layer has 2 neurons. - The hidden layer has 2 neurons. - The output layer has 1 neuron. - There are no biases in the network.

If the weights from the input layer to the hidden layer are given by: W(1)=[0.50.60.10.8] and the weights from the hidden layer to the output layer are given by: W(2)=[0.30.2]

Calculate the output of the network for the input vector x=[10] using a linear activation function for all neurons.

Hint

- The output of each layer is calculated by multiplying the input of that layer by the layer's weight matrix. - Use matrix multiplication to compute the outputs step-by-step.

Solution

    • Step 1: Calculate Hidden Layer Output**

The input to the hidden layer is the initial input x: h(1)=W(1)×x=[0.50.60.10.8][10]=[0.50.1]

    • Step 2: Calculate Output Layer Output**

The input to the output layer is the output from the hidden layer: y=W(2)×h(1)=[0.30.2]×[0.50.1]=0.3×0.5+(0.2)×0.1=0.150.02=0.13

Thus, the output of the network for the input vector x=[10] is 0.13.


Exercise 1.13

Level: * (Easy)

Exercise Types: Novel

Question

Explain whether this is a classification, regression, or clustering task each time. If the task is either classification or regression, also comment on whether the focus is prediction or explanation.

1. Stock Market Trends:

  A financial analyst wants to predict the future stock prices of a company based on historical trends, economic indicators, and company performance metrics.

2. Customer Segmentation:

  A retail company wants to group its customers based on their purchasing behaviour, including transaction frequency, product categories, and total spending, to design targeted marketing campaigns.

3. Medical Diagnosis:

  A hospital wants to develop a model to determine whether a patient has a specific disease based on symptoms, medical history, and lab test results.

4. Predicting Car Fuel Efficiency:

  An automotive researcher wants to understand how engine size, weight, and aerodynamics affect a car's fuel efficiency (miles per gallon).

Solution

1. Stock Market Trends

    • Task Type: Regression
    • Focus: Prediction
    • Reasoning: Stock prices are continuous numerical values, making this a regression task. The goal is to predict future prices rather than explain past fluctuations.

2. Customer Segmentation

    • Task Type: Clustering
    • Focus: —
    • Reasoning: Customers are grouped based on their purchasing behaviour without predefined labels, making this a clustering task.

3. Medical Diagnosis

    • Task Type: Classification
    • Focus: Prediction
    • Reasoning: The disease status is a categorical outcome (Has disease: Yes/No), making this a classification problem. The goal is to predict a diagnosis for future patients.

4. Predicting Car Fuel Efficiency

    • Task Type: Regression
    • Focus: Explanation
    • Reasoning: Fuel efficiency (miles per gallon) is a continuous variable. The researcher is interested in understanding how different factors influence efficiency, so the focus is on explanation.

Summary

Task Type Focus Reasoning
Stock Market Trends Regression Prediction Predict future stock prices (continuous variable).
Customer Segmentation Clustering Group customers based on purchasing behaviour.
Medical Diagnosis Classification Prediction Determine if a patient has a disease (Yes/No).
Predicting Car Fuel Efficiency Regression Explanation Understand how factors affect fuel efficiency.


Exercise 1.14

Level: * (Easy)

Exercise Types: Novel

Question

You are given a set of real-world scenarios. Your task is to identify the most suitable fundamental machine learning approach for each scenario and justify your choice.

    • Scenarios:

1. Loan Default Prediction:

  A bank wants to predict whether a loan applicant will default on their loan based on their credit history, income, and employment status.

2. House Price Estimation:

  A real estate company wants to estimate the price of a house based on features such as location, size, and number of bedrooms.

3. User Grouping for Advertising:

  A social media platform wants to group users with similar interests and online behavior for targeted advertising.

4. Dimensionality Reduction in Medical Data:**

  A medical researcher wants to reduce the number of variables in a dataset containing hundreds of patient health indicators while retaining the most important information.
    • Tasks:

- For each scenario, classify the problem into one of the four fundamental categories: Classification, Regression, Clustering, or Dimensionality Reduction. - Explain why you selected that category for each scenario. - Suggest a possible algorithm that could be used to solve each problem.

Solution

1. Loan Default Prediction

    • Task Type: Classification
    • Reasoning: The target variable (loan default) is categorical (Yes/No), making this a classification problem. The goal is to predict whether an applicant will default based on their financial history.
    • Possible Algorithm: Logistic Regression, Random Forest, or Gradient Boosting.

2. House Price Estimation

    • Task Type: Regression
    • Reasoning: House prices are continuous numerical values, making this a regression task. The goal is to estimate a house's price based on features like location and size.
    • Possible Algorithm:** Linear Regression, Decision Trees, or XGBoost.

3. User Grouping for Advertising

    • Task Type: Clustering
    • Reasoning: The goal is to group users based on their behavior without predefined labels, making this a clustering task.
    • Possible Algorithm: K-Means, DBSCAN, or Hierarchical Clustering.

4. Dimensionality Reduction in Medical Data

    • Task Type: Dimensionality Reduction
    • Reasoning: The goal is to reduce the number of variables while preserving essential information, making this a dimensionality reduction task.
    • Possible Algorithm: Principal Component Analysis (PCA), t-SNE, or Autoencoders.


Exercise 1.15

Level: * (Easy)

Exercise Types: Novel

Question

Define what machine learning is and how it is different from classical statistics. Provide the three learning methods used in machine learning, briefly define each and give an example of where each of them can be used. Include some common algorithms for each of the learning methods.

Solution

    • Machine learning Definition

– Machine Learning is the ability to teach a computer without explicitly programming it
– Examples are used to train computers to perform tasks that would be difficult to program

The difference between classical statistics and machine learning is the size of the data that they infer information from.
In classical statistics, this is usually done from a small dataset(not enough data) while in machine learning it is done from a large dataset(Too many data).

    • Supervised learning

Supervised learning is a type of machine learning where the model is trained on a labeled dataset, meaning each training example has input features and a corresponding correct output. The algorithm learns the relationship between inputs and outputs to make predictions on new, unseen data.

Examples:
Predicting house prices based on location, size, and other features (Regression).
Identifying whether an email is spam or not (Classification).

Common Algorithms:
Linear Regression, Logistic Regression, Decision Trees, Random Forest, Support Vector Machines (SVM), Neural Networks.

    • Unsupervised Learning

Unsupervised learning involves training a model on data without labeled outputs. The algorithm attempts to discover patterns, structures, or relationships within the data.

Examples:
Grouping customers with similar purchasing behaviors for targeted marketing (Clustering).
Identifying important features in a high-dimensional dataset (Dimensionality Reduction).

Common Algorithms:
K-Means, Hierarchical Clustering, DBSCAN (Clustering).
Principal Component Analysis (PCA), t-SNE, Autoencoders (Dimensionality Reduction).

    • Reinforcement Learning

Reinforcement learning (RL) is a type of machine learning where an agent learns to make decisions by performing actions in an environment to maximize cumulative rewards. The agent interacts with the environment, receives feedback in the form of rewards or penalties, and improves its strategy over time.

Examples:
Training a robot to walk by rewarding successful movements.
Teaching an AI to play chess or video games by rewarding wins and penalizing losses.

Common Algorithms:
Q-Learning, Deep Q Networks (DQN), Policy Gradient Methods, Proximal Policy Optimization (PPO).

Summary

Aspect Supervised Learning Unsupervised Learning Reinforcement Learning
Definition Learning from labeled data where inputs are paired with outputs. Learning patterns or structures from unlabeled data. Learning by interacting with an environment to maximize cumulative rewards.
Key Characteristics Trains on known inputs and outputs to predict outcomes for unseen data. No predefined labels; discovers hidden structures in the data. Agent learns through trial and error by receiving rewards or penalties for its actions.
Examples - Predicting house prices (Regression).
- Classifying emails as spam or not (Classification).
- Grouping customers by behavior (Clustering).
- Reducing variables in large datasets (Dimensionality Reduction).
- Training robots to walk.
- Teaching AI to play chess or video games.
Common Algorithms - Linear Regression
- Logistic Regression
- Decision Trees
- Random Forest
- SVM
- Neural Networks
- K-Means
- Hierarchical Clustering
- PCA
- t-SNE
- Autoencoders
- Q-Learning
- Deep Q Networks (DQN)
- Policy Gradient Methods
- Proximal Policy Optimization (PPO)


Exercise 1.16

Level: * (Easy)

Exercise Types: Novel

Question

Categorize each of these machine learning scenarios into supervised learning, unsupervised learning, or reinforcement learning. Justify your reasoning for each case.

(a) A neural network is trained to classify handwritten digits using the MNIST dataset, which contains 60 000 images of handwritten digits, along with the correct answer for each image.

(b) A robot is programmed to learn how to play a video game. It does not have access to the game’s rules, but it can observe its current score after each action. Over time, it learns to play better by maximizing its score.

(c) A deep learning model is designed to segment medical images into different sections corresponding to specific organs. The training data consists of medical scans that have been annotated by experts to mark the boundaries of the organs.

(d) A machine learning model is given 100 000 astronomical images of unknown stars and galaxies. Using dimensionality reduction techniques, it groups similar-looking objects based on their features, such as size and shape.

Solution

(a) Supervised learning: The model is trained with labeled data, where each image has a corresponding digit label.

(b) Reinforcement learning: The model learns by interacting with an environment and receiving feedback in the form of rewards or penalties. It explores different actions to maximize cumulative rewards over time.

(c) Supervised learning: The model uses labeled data where professionals annotated each region of the image.

(d) Unsupervised learning: The model works with unlabeled data to find patterns and group similar objects.


Exercise 1.17

Level: * (Easy)

Exercise Types: Novel

Question

How does the introduction of ReLU as an activation function address the vanishing gradient problem observed in early deep learning models using sigmoid or tanh functions?

Solution

The vanishing gradient problem occurs when activation functions like sigmoid or tanh compress their inputs into small ranges, resulting in gradients that become very small during backpropagation. This hinders learning, particularly in deeper networks.

The ReLU (Rectified Linear Unit), defined as f(x)=max(0,x), addresses this issue effectively:

(a) Non-Saturating Gradients: For positive input values, ReLU's gradient remains constant (equal to 1), preventing gradients from vanishing.

(b) Efficient Computation: The simplicity of the ReLU function makes it computationally faster than the sigmoid or tanh functions, which involve more complex exponential calculations.

(c) Sparse Activations: ReLU outputs zero for negative inputs, leading to sparse activations, which can improve computational efficiency and reduce overfitting.

However, ReLU can experience the "dying ReLU" problem, where neurons output zero for all inputs and effectively become inactive. Variants like Leaky ReLU and Parametric ReLU address this by allowing small, non-zero gradients for negative inputs, ensuring neurons remain active.

Exercise 1.18

Level: * (Easy)

Exercise Types: Novel

Question

What is the general concept of text generation in deep learning, and how does it work?

Solution

Text generation in deep learning refers to the process of automatically creating coherent and contextually relevant text based on input data or a learned language model. The goal is to produce text that mimics human-written content, maintaining grammatical structure, logical flow, and contextual relevance.

There are five steps.

1. Training on a Language Corpus: A deep learning model, such as a Recurrent Neural Network (RNN), Long Short-Term Memory (LSTM), or Transformer, is trained on a large dataset of text. During training, the model learns patterns, relationships between words, and context within sentences and across paragraphs.

2. Tokenization and Embeddings: Input text is broken into smaller units, such as words or subwords (tokens). These tokens are converted into numerical vectors (embeddings) that capture semantic and syntactic relationships.

3. The model predicts the probability of the next word or token in a sequence based on the context provided by the preceding words. It uses conditional probability, such as: P(wtw1,w2,...,wt1) to determine the likelihood of the next token.

4. Once the model generates probabilities for the next token, decoding strategies are used to construct text.

5. Generated text is evaluated for coherence, fluency, and relevance. Techniques such as fine-tuning on specific domains or datasets improve the model's performance for targeted applications.

Exercise 1.19

Level: * (Easy)

Exercise Types: Novel

Question

Supervised learning and unsupervised learning are two of the main types of machine learning, and they differ mainly in how the models are trained and the type of data used. Briefly state their differences.

Solution

Supervised Learning:

Data: Requires labeled data.

Goal: The model learns a mapping from inputs to the correct output.

Example Tasks: Classification and regression.

Training Process: The model is provided with both input data and corresponding labels during training, allowing it to learn from these examples to make predictions on new, unseen data.

Common Algorithms: Linear regression, decision trees, random forests, support vector machines, and neural networks.

Unsupervised Learning:

Data: Does not require labeled data.

Goal: The model tries to find hidden patterns or structure in the data.

Example Tasks: Clustering and dimensionality reduction.

Training Process: The model analyzes the input data without being told the correct answer, and it organizes or structures the data in meaningful ways.

Common Algorithms: K-means clustering, hierarchical clustering, principal component analysis (PCA), and autoencoders.

Exercise 1.20

Level: * (Easy)

Exercise Types: Novel

Question

It was mentioned in lecture that the step function had previously been used as an activation function, but we now commonly use the sigmoid function as an activation function. Highlight the key differences between these functions.

Solution

- The step function takes a single real numbered value and outputs 0 if the number is negative and 1 if the number is 0 or positive

- The sigmoid activation function is an s shaped curve with the output spanning between 0 and 1 (not inclusive)

- The equation for the sigmoid function is f(x)=11+ex

- The step activation function only produces two values as the output, 0 or 1, whereas the sigmoid activation function produces a continuous range of values between 0 and 1

- The smoothness of the sigmoid activation function makes it more suitable for gradient based learning in neural networks, allowing for more efficient back propagation

Exercise 1.21

Level: * (Easy)

Exercise Types: Novel

Question

Consider a linear regression model where we aim to estimate the weight vector w by minimizing the Residual Sum of Squares (RSS), defined as:

RSS(w)=12n=1N(ynwTxn)2=12Xwy22=12(Xwy)T(Xwy).

  1. Compute the gradient: Derive the gradient of RSS(w) with respect to w.
  2. Find the optimal w: Solve for w by setting the gradient to zero.
  3. Interpretation: What is the significance of the solution you obtained in terms of ordinary least squares (OLS)?

Provide your answers with clear derivations and explanations.

Solution

To find the optimal weight vector w, we first compute the gradient of the Residual Sum of Squares (RSS):

wRSS(w)=XTXwXTy.

Setting the gradient to zero and solving for w gives:

XTXw=XTy.

These are known as the normal equations, since at the optimal solution, yXw is orthogonal to the range of X.

The corresponding solution w^ is the ordinary least squares (OLS) solution, given by:

w^=(XTX)1XTy.

The matrix (XTX)1XT is known as the (left) pseudo-inverse of X, which generalizes matrix inversion for non-square matrices.

To ensure the solution is unique, we examine the Hessian matrix:

H(w)=2w2RSS(w)=XTX.

If X has full column rank (i.e., its columns are linearly independent), then H is positive definite, as shown by:

vT(XTX)v=(Xv)T(Xv)=Xv2>0,for any nonzero vector v.

Since the Hessian is positive definite in this case, the least squares objective has a unique global minimum.

Exercise 1.22

Level: * (Easy)

Exercise Types: Novel

Question

Which of the following best highlights the key difference between Machine Learning and Deep Learning?

A. Machine Learning is only suitable for small datasets, while Deep Learning can handle datasets of any size.

B. Machine Learning is restricted to regression and classification, whereas Deep Learning is used for image and text processing.

C. Deep Learning can model without any data, while Machine Learning requires large datasets.

D. Machine Learning relies on manually extracted features, while Deep Learning can automatically learn feature representations.

Solution

Answer: D;

Explanation: Machine Learning algorithms often require manual feature engineering, whereas Deep Learning can automatically extract features from data through multi-layered neural networks. This is a significant distinction between the two.

Machine Learning techniques include decision trees, svms, xgboosting, etc. These techniques typically work better on smaller datasets due to simpler structure. They often struggle to match the flexibility and scalability of deep neural networks as the data becomes more complex.

Deep neural networks work well on large datasets consisting of data with a more complex structure, such as images or sentences (LLM). Often times, more data is needed for deep neural networks in order for them to learn effectively and avoid overfitting. Their complex architecture of deep neural networks allow them to learn feature representations from raw data, without the need for manual feature engineering.

In summary,

Machine Learning: Simpler models, better suited for structured/tabular data.

Deep Learning: Automatically extracts features, and excels in unstructured data like images, audio, and text.

Exercise 1.23

Level: * (Easy)

Exercise Types: Novel

Question

Pros and Cons of supervised learning and unsupervised learning?

Solution

Supervised learning is to learn from labelled data. The benefits of supervised learning include its clear objective and direct evaluation through performance metrics such as MSE to compare model predictions with clear labels. The consequences of supervised learning encompass the time-consuming nature to obtain large labelled dataset and the risk of overfitting. Unsupervised learning needs pattern or data structure detection. The benefits of unsupervised learning include opportunities for data preprocessing. Thus, dimension reduction techniques can be used to simplify the data structure. Nevertheless, we can't directly control or interpret the results as good as the supervised learning does.

Exercise 1.24

Level: * (Easy)

Exercise Types: Novel

Question

Consider the dataset: {(x1,y1),(x2,y2),(x3,y3)}={([1,2],1),([2,3],1),([4,5],1)}, and a linear decision boundary defined as: w1x1+w2x2+b=0, where the classifier predicts y=1 if f(x)>0, and y=1 if f(x)0.

Given the weights and bias: w1=1,w2=1,b=0, determine whether all points in the dataset are correctly classified.

Solution

The decision function is: f(x)=w1x1+w2x2+b. Substituting w1=1, w2=1, and b=0, we evaluate f(x) for each point in the dataset.

For x1=[1,2]: f(x1)=(1)(1)+(1)(2)+0=1y=1(incorrect, since y1=1).

For x2=[2,3]: f(x2)=(1)(2)+(1)(3)+0=1y=1(incorrect, since y2=1).

For x3=[4,5]: f(x3)=(1)(4)+(1)(5)+0=1y=1(correct, since y3=1).


Exercise 1.25

Level: * (Easy)

Exercise Types: Novel

Question

Given a dataset with three samples: (x1,y1)=(1,2),(x2,y2)=(2,3),(x3,y3)=(3,5).

Assume a hypothesis class F consisting of functions f(x)=wx+b, where w and b are parameters. Use the MSE as the loss function: L(y,f(x))=(yf(x))2.

-a). For the score critereon, compute the sample score: S(f)=1ni=1nL(yi,f(xi)).

-b). For the search strategy, find the optimal parameters w and b that minimizes S(f).

Solution

-a). The loss for three samples:

L(y1,f(x1))=(2(w1+b))2

L(y2,f(x2))=(3(w2+b))2

L(y3,f(x3))=(5(w3+b))2

The sample score:

S(f)=13[(2(w1+b))2+(3(w2+b))2+(5(w3+b))2]

Simplify the sample score formula:

S(f)=13[(2wb)2+(32wb)2+(53wb)2]


-b). In order to minimize S(f), first differentiate S(f) with respect to w and b:

S(f)w=23[(2wb)+2(32wb)+3(53wb)]

S(f)b=23[(2wb)+(32wb)+(53wb)]

Set S(f)w and S(f)b equal to 0, we can get:

w=1, b=1.

Therefore, S(f) is minimized at these parameters.


Exercise 1.26

Level: * (Easy)

Exercise Types: Novel

Question

Given the weights and bias of a single neuron, classify several input points using a step function as the activation method.

Details: - Weights: \( w_1 = 0.6, w_2 = -0.8 \) - Bias: \( b = 0.1 \) - Activation: Step function where output is 1 if input is non-negative, and 0 otherwise.

Input Points: 1. \( (1, 1) \) 2. \( (-1, 1) \) 3. \( (0.5, -0.5) \) 4. \( (0, 0) \)

Solution

Calculating the Outputs For each input point \( (x_1, x_2) \), calculate the linear combination using the formula \( y = w_1 \times x_1 + w_2 \times x_2 + b \), then apply the step function.

- **Point 1 \((1, 1)\):** \[ y = 0.6 \times 1 - 0.8 \times 1 + 0.1 = -0.1 \rightarrow \text{step}(-0.1) = 0 \] (Class 0)

- **Point 2 \((-1, 1)\):** \[ y = 0.6 \times -1 - 0.8 \times 1 + 0.1 = -1.3 \rightarrow \text{step}(-1.3) = 0 \] (Class 0)

- **Point 3 \((0.5, -0.5)\):** \[ y = 0.6 \times 0.5 - 0.8 \times -0.5 + 0.1 = 0.8 \rightarrow \text{step}(0.8) = 1 \] (Class 1)

- **Point 4 \((0, 0)\):** \[ y = 0.6 \times 0 - 0.8 \times 0 + 0.1 = 0.1 \rightarrow \text{step}(0.1) = 1 \] (Class 1)

Conclusion This exercise demonstrates how a neuron uses its weights and bias to compute outputs for given inputs and classify them using a step function based on a threshold.

Exercise 1.27

Level: * (Easy)

Exercise Types: Novel

Question

Consider the following 2D and 3D datasets and determine whether a perceptron solution exists for each. If a solution exists, visually prove it by plotting the data points and a possible decision boundary. Use Python to accomplish this task.

Part 1: Given the dataset:

x1x2y35138+177+165+1

Show visually whether there exists a perceptron solution that correctly classifies all points.

Part 2: Given the dataset:

x1x2y35138+177165+1

Show visually whether there exists a perceptron solution that correctly classifies all points.

Part 3: Given the 3D dataset:

x1x2x3y3521386+17751654+1


Show visually whether there exists a perceptron solution that correctly classifies all points.

Solution

Part 1:

import numpy as np
import matplotlib.pyplot as plt


part1_data = np.array([
    [3, 5, -1],
    [3, 8, 1],
    [7, 7, 1],
    [6, 5, 1]
])

part1_X = part1_data[:, :2]  # First two columns for features
part1_y = part1_data[:, 2]   # Last column for classes

# Define colors based on classes, Im chooosing green and red
colors = ['red' if label == -1 else 'green' for label in part1_y]


plt.scatter(part1_X[:, 0], part1_X[:, 1], c=colors, edgecolors='black', s=100)

part1_x1_vals = np.linspace(2, 7, 100)
part1_x2_vals =  -part1_x1_vals + 9
plt.plot(part1_x1_vals, part1_x2_vals, 'b--')

plt.xlabel('x1')
plt.ylabel('x2')
plt.title('Part 1: 2D Classification Data')

plt.grid(True)
plt.show()

There exists a perceptron solution that correctly classifies all points.

x1+x29=0

where the perceptron parameters are:

w1=1

w2=1

b=9

Part 2:

part2_data = np.array([
    [3, 5, -1],
    [3, 8, 1],
    [7, 7, -1],
    [6, 5, 1]
])

part2_X = part2_data[:, :2]  # First two columns for data points
part2_y = part2_data[:, 2]   # Last column for classes

# Define colors based on class classes, Im chooosing green and red
colors = ['red' if label == -1 else 'green' for label in part2_y]

plt.scatter(part2_X[:, 0], part2_X[:, 1], c=colors, edgecolors='black', s=100)

plt.xlabel('x1')
plt.ylabel('x2')
plt.title('Part 2: 2D Classification Data')

plt.legend()
plt.grid(True)

plt.show()

There does not exist perceptron solution that correctly classifies all points.

Part 3:

from mpl_toolkits import mplot3d
#library needed to plot 3d data

part3_data = np.array([
    [2, 3, 1, -1],   
    [5, 6, 2, -1],   
    [8, 9, 3, +1],   
    [9, 10, 6, +1], 
])

part3_X = part3_data[:, :3]  # First three columns for data points
part3_y = part3_data[:, 3]   # Last column for classes

# Define colors based on classes, Im chooosing green and red
colors = ['red' if label == -1 else 'green' for label in part3_y]

# Use projection="3d" to create 3D scatter plot
ax = plt.axes(projection='3d')

# Plot 3d data points
ax.scatter(part3_X[:, 0], part3_X[:, 1], part3_X[:, 2], c=colors, edgecolors='black', s=100)

# Create a horizontal hyperplane at x2 = 7
part3_x1, part3_x3 = np.meshgrid(np.linspace(0, 10, 10), np.linspace(0, 10, 10))
part3_x2 = 7

ax.plot_surface(part3_x1, part3_x2, part3_x3, color='blue', alpha=0.5)

ax.set_xlabel('x1')
ax.set_ylabel('x2')
ax.set_zlabel('x3')
ax.set_title('3D Perceptron Solution Visualization')

plt.show()

There exists a perceptron solution that correctly classifies all points.

x2=7

where the perceptron parameters are:

w1=0

w2=1

w3=0

b=7



Exercise 1.28

Level: * (Easy)

Exercise Types: Novel

References: A. Ghodsi, STAT 940 Deep Learning: Lecture 1, University of Waterloo, Winter 2025.

Question

Artificial Intelligence can be applied to a wide variety of fields. Give an example where AI has been used as a tool for scientific discovery.

Solution

Artificial intelligence has been applied in climate science, where deep learning models are used to predict climate patterns, simulate climate models, and forecast extreme weather events. These AI models have demonstrated high accuracy, enabling better disaster preparedness efforts.

Additionally, AI has accelerated scientific research by facilitating faster and more efficient simulations of complex physical systems. It has been used to study black holes and particle physics, advancing our understanding of fundamental sciences.


Exercise 2.1

Level: * (Easy)

Exercise Types: Novel

References: Calin, Ovidiu. Deep learning architectures: A mathematical approach. Springer, 2020

This problem is coincidentally similar to Exercise 5.10.1 (page 163) in this textbook, although that exercise was not used as the basis for this question.

Question

This problem is about using perceptrons to implement logic functions. Assume a dataset of the form x1,x2{0,1}, and a perceptron defined as: y=H(β0+β1x1+β2x2), where H is the Heaviside step function, defined as: H(z)={1,if z0,0,if z<0.

(a)* Find weights β1,β2 and bias β0 for a single perceptron that implements the AND function.

(b)* Find the weights β1,β2 and bias β0 for a single perceptron that implements the OR function.

(c)** Given the truth table for the XOR function:

x1x2x1x2000011101110

Show that it cannot be learned by a single perceptron. Find a small neural network of multiple perceptrons that can implement the XOR function. (Hint: a hidden layer with 2 perceptrons).

Solution

(a) A perceptron that implements the AND function:

y=H(1.5+x1+x2).

Here:

β0=1.5,β1=1,β2=1.. This works because the AND function returns 1 only when both inputs are 1. For a perceptron, the condition for activation is: β0+β1x1+β2x20. This must hold for (1, 1) but fail for all other combinations. Substituting values leads to the choice of β0=1.5 and β1=β2=1.

(b) A perceptron that implements the OR function:

y=H(0.5+x1+x2).

Here:

β0=0.5,β1=1,β2=1. This works because the OR function returns 1 if either or both inputs are 1. Using similar logic to the AND case, the decision boundary conditions lead to these parameters.

Perceptrons that implement the AND and OR functions respectively.


(c) XOR is not linearly separable, so it cannot be implemented by a single perceptron.

The XOR function returns 1 when the following are true:

  • Either x1 or x2 are 1. In other words, the expression x1 OR x2 returns 1.
  • x1 and x2 are not both 1. In other words, the expression x1 NAND x2 returns 1.

To implement this, the outputs of an OR and a NAND perceptron can be taken as inputs to an AND perceptron. (The NAND perceptron was derived by multiplying the weights and bias of the AND perceptron by -1.)

Neural network that implements the XOR function.


Why can't the perceptron converge in the case of linear non-separability?

In linearly separable data, there exists a weight vector w and bias b such that:

yi(wxi+b)>0i

But in the case of linear non-separability, w and b satisfying this condition do not exist, so the perceptron cannot satisfy the convergence condition.

Exercise 2.2

Level: * (Easy)

Exercise Types: Novel

Question

1.How do feedforward neural networks utilize backpropagation to adjust weights and improve the accuracy of predictions during training?

2. How would the training process be affected if the learning rate in optimization algorithm were too high or too low?

Solution

1. After a forward pass where inputs are processes to generate an output, the error between the prediction and actual values is calculated. This error is then propagated backward through the network, and the gradients of the loss function with respect to the weights are computed. Using these gradients, the weights are updated with an optimization algorithm like stochastic gradient descent, gradually minimizing the error and improving the networks' performance.

2. If the learning rate is too high, the weights might overshoot the optimal values, leading to oscillations or divergence. If it's too low, the training process might become very slow and stuck in local minimum.

Calculations

Step 1: Forward Propagation

Each neuron computes:

z=Wx+b

a=f(z)

where:

  • W = weights, b = bias
  • f(z) = activation function (e.g., sigmoid, ReLU)
  • a = neuron’s output
Step 2: Compute Loss

The error between predicted y^ and actual y is calculated using a loss function, such as **Mean Squared Error (MSE)**:

L=1n(yy^)2

For classification, **Cross-Entropy Loss** is commonly used.

Step 3: Backward Propagation

Using the **chain rule**, gradients are computed:

LW=LaazzW

These gradients guide weight updates to minimize loss.

Step 4: Weight Update using Gradient Descent

Weights are updated using:

W=WαLW

where α is the **learning rate**.


Exercise 2.3

Level: * (Easy)

Exercise Types: Modified

References: Simon J.D. Prince. Understanding Deep learning. 2024

This problem comes from Problem 3.5 in this textbook. In addition to the proof, I explained why this property is important to learning neural networks.

Question

Prove that the following property holds for αR+:

ReLU[αz]=αReLU[z]

Explain why this property is important in neural networks.

Solution

This is known as the non-negative homogeneity property of the ReLU function.

Recall the definition of the ReLU function:

ReLU(z)={zif z0,0if z<0.

We prove the property by considering the two possible cases for z.

Case 1: z0

If z0, then by the definition of the ReLU function:

ReLU(z)=z

Therefore:

ReLU(αz)=αz

and:

αReLU(z)=αz

Hence, in this case:

ReLU(αz)=αReLU(z)

Case 2: z<0

If z<0, then αz<0.

Therefore:

ReLU(αz)=ReLU(z)=0

and:

αReLU(z)=α0=0

Hence, in this case:

ReLU(αz)=αReLU(z)

Since the property holds in both cases, this completes the proof.

Why is this property important in neural networks?

In a neural network, the input to a neuron is often a linear combination of the weights and inputs.

When training neural networks, scaling the inputs or weights can affect the activations of neurons. However, because ReLU satisfies the homogeneity property, the output of the ReLU function scales proportionally with the input. This means that scaling the inputs by a positive constant (like a learning rate or normalization factor) does not change the overall pattern of activations — it only scales them. This stability in scaling is important during optimization because it makes the network's output more predictable and ensures that scaling transformations don't break the network's functionality.

Additionally, because of the non-negative homogeneity property, the gradients also scale proportionally, the scale of the gradient changes proportionally with the input scale, which ensures that the optimization process remains stable. It helps prevent exploding gradients when the inputs are scaled by large positive values.

The homogeneity property of ReLU also helps the network to perform well on different types of data. By keeping the scaling of activations consistent, it helps maintain the connection between inputs and outputs during training, even when the data is adjusted or scaled. This makes ReLU useful when input values vary a lot, and it simplifies the network's response to changes in input distributions, which is especially valuable when transferring a trained model to new data or domains.

While great in most cases, there have been some slight modifications to this property to yeild better results in specific cases. Known as the "dying ReLU" problem, in which neurons output zero for all inputs when their weights are updated to negative values, this effectively makes them inactive which can hinder learning and reduce model capacity. Similarly, ReLU can also suffer from exploding gradients for large inputs. Therefore, alternative propossed modifications include Leaky ReLU, which allows a small, non-zero gradient for negative inputs to mitigate neuron death; ELU (Exponential Linear Unit), which smooths gradients and improves convergence; and GELU (Gaussian Error Linear Unit), which combines smoothness and non-linearity for improved performance in certain cases.

Exercise 2.4

Level: * (Easy)

Exercise Types: Novel

Question

Train a perceptron on the given dataset using the following initial settings, and ensure it classifies all data points correctly.

  • Initial weights: w0=0,w1=0,w2=0
  • Learning rate: η=0.1
  • Training dataset:
  (x₁ = 1, x₂ = 2, y = 1)
  (x₁ = -1, x₂ = -1, y = -1)
  (x₁ = 2, x₂ = 1, y = 1)

y=1 if the output z=w1x1+w2x2+w00, otherwise y=1.

Solution

Iteration 1

1. First data point (x₁ = 1, x₂ = 2) with label 1:

  • Weighted sum: y^=w0+w1x1+w2x2=0+0(1)+0(2)=0
  • Predicted label: y^=1
  • Actual label: 1 → No misclassification

2. Second data point (x₁ = -1, x₂ = -1) with label -1:

  • Weighted sum: y^=w0+w1x1+w2x2=0+0(1)+0(1)=0
  • Predicted label: y^=1
  • Actual label: -1 → Misclassified

3. Third data point (x₁ = 2, x₂ = 1) with label 1:

  • Weighted sum: y^=w0+w1x1+w2x2=0+0(2)+0(1)=0
  • Predicted label: y^=1
  • Actual label: 1 → No misclassification

Update Weights (using the Perceptron rule with the cost as the distance of all misclassified points)

For the misclassified point (x₁ = -1, x₂ = -1):

  • Updated weights:
  • w0=w0+ηy=0+0.1(1)=0.1
  • w1=w1+ηyx1=0+0.1(1)(1)=0.1
  • w2=w2+ηyx2=0+0.1(1)(1)=0.1

Updated weights after first iteration: w0=0.1,w1=0.1,w2=0.1

Iteration 2

1. First data point (x₁ = 1, x₂ = 2) with label 1:

  • Weighted sum: y^=0.1+0.1(1)+0.1(2)=0.1+0.1+0.2=0.2
  • Predicted label: y^=1
  • Actual label: 1 → No misclassification

2. Second data point (x₁ = -1, x₂ = -1) with label -1:

  • Weighted sum: y^=0.1+0.1(1)+0.1(1)=0.10.10.1=0.3
  • Predicted label: y^=1
  • Actual label: -1 → No misclassification

3. Third data point (x₁ = 2, x₂ = 1) with label 1:

  • Weighted sum: y^=0.1+0.1(2)+0.1(1)=0.1+0.2+0.1=0.2
  • Predicted label: y^=1
  • Actual label: 1 → No misclassification

Since there are no misclassifications in the second iteration, the perceptron has converged!

Final Result

  • Weights after convergence: w0=0.1,w1=0.1,w2=0.1
  • Total cost after convergence: Cost=0, since no misclassified points.


Exercise 2.5

Level: * (Moderate)

Exercise Types: Novel

Question

Consider a Feed-Forward Neural Network (FFN) with one or more hidden layers. Answer the following questions:

    (a) Describe how does the Feed-Forward Neural Network (FFN) work in general. Describe the component of the Network.

    (b) How does the forward pass work ? Provide the relevant formulas for each step.

    (c) How does the backward pass (backpropagation) ? Explain and provide the formulas for each step.

Solution

(a): A Feed-Forward Neural Network (FFN) consists of an input layer, one or more hidden layers, and one output layer. Each layer transforms the input data, with each neuron's output being fed to the next layer as input. Each neuron in a layer is a perceptron, which is a basic computational unit that contains weights, bias and an activation function. The perceptron computes a weighted sum of its inputs, adds a bias term, and passes the result through an activation function. In this structure, each layer transforms the data as it passes through, with each neuron's output being fed to the next layer. The final output is the network’s prediction, then the loss function use the prediction and the true label of the data to calculate the loss. The backward pass computes the gradients of the loss with respect to each weight and bias in the network, and then update the weights and biases to minimize the loss. This process is repeated for each sample (or mini-batch) of data until the loss converges and the weights are optimized.

(b): The forward pass involves computing the output for each layer in the network. For each layer, the algorithm performs the following steps:

1. Compute the weighted sum of inputs to the layer:

z(l)=W(l)a(l1)+b(l)

2. Use the activation function to calculate the output of the layer:

y^=a(L)=σ(z(L))

3. Repeat these steps for each layer, until getting to the output layer

(c): The backward pass (backpropagation) updates the gradients of the loss function with respect to each weight and bias, and then use the gradient descents to update the weights.

1. Calculate the errors for each layer:

Error at the output layer: The error term at the output layer has this formula:

δ(L)=La(L)σ(z(L))

Error for the hidden layers: The error for each hidden layer is:

δ(l)=(W(l+1))Tδ(l+1)σ(z(l))

3. Gradient of the loss with respect to weights and biases. Compute the gradients for the weights and biases:

The gradient for weights is:

LW(l)=a(l1)(δ(l))T

The gradient is for biases is:

Lb(l)=δ(l)

4. Update the weights and biases using gradient descent:

W(l)W(l)ρLW(l)

Where ρ is the learning rate.

b(l)b(l)ρLb(l)

Repeat these steps for each layers from output layer to input layers to update all the weights and biases


Exercise 2.6

Level: * (Easy)

Exercise Types: Novel

Question

A single neuron takes an input vector x=[2,3], with weights w=[0.4,0.6]. The target output is ytrue=1.

1. Calculate the weighted sum z=wx.

2. Compute the squared error loss: L=0.5(zytrue)2

3. Find the gradient of the loss with respect to the weights w and perform one step of gradient descent with a learning rate η=0.01.

4.Provide the updated weights and the error after the update.

5. Compare the result of the previous step with the case of a learning rate of η=0.1

Solution

1. z=wx=(0.42)+(0.63)=0.8+1.8=2.6

2. L=0.5(zytrue)2=0.5(2.61)2=0.5(1.6)2=0.52.56=1.28

3. The gradient of the loss with respect to wi is: Lwi=(zytrue)xi

For w1 (associated with x1=2): Lw1=(2.61)2=1.62=3.2

For w2 (associated with x2=3): Lw2=(2.61)(3)=1.63=4.8 The updated weights are: wi=wiηLwi

For w1: w1=0.40.013.2=0.40.032=0.368

For w2: w2=0.60.01(4.8)=0.6+0.048=0.552

4. Recalculate z with updated weights: z=(0.3682)+(0.5523)=0.736+1.656=2.392

Recalculate the error: L=0.5(zytrue)2=0.5(2.3921)2=0.5(1.392)2=0.51.937=0.968

5. Compare the result of the previous step with the case of a learning rate of η=0.1:

For w1: w1=0.40.13.2=0.40.032=0.08

For w2: w2=0.60.1(4.8)=0.6+0.048=0.12

Recalculate z with the updated weights: z=(0.082)+(0.123)=0.16+0.36=0.52

Recalculate the error: L=0.5(zytrue)2=0.5(0.521)2=0.5(0.48)2=0.50.2304=0.1152

Comparison:

- With a learning rate of η=0.01, the error after one update is L=0.968.

- With η=0.1, the error after one update is L=0.1152.

The error is much lower when using a larger learning rate η=0.1 compared to a smaller learning rate η=0.01. However, large learning rates can sometimes cause overshooting of the optimal solution, so care must be taken when selecting a learning rate.

Exercise 2.7

Level: * (Easy)

Exercise Types: Copied

References: https://www.uni-weimar.de/fileadmin/user/fak/medien/professuren/Webis/teaching/ws13/ml/exercises-en-neural-networks.pdf

This problem comes from Exercise 2 : Perceptron Learning.

Question

Given two single perceptrons a and b, each defined by the inequality w0+w1x1+w2x20:

- Perceptron a: w0=1, w1=2, w2=1 - Perceptron b: w0=0, w1=2, w2=1

Is perceptron a more general than perceptron b?

Solution

To decide if perceptron a is more general than perceptron b, we compare their respective decision boundaries and positive regions:

- Perceptron a: The positive region satisfies 1+2x1+x20. The decision boundary is x2=2x11.

- Perceptron b: The positive region satisfies 2x1+x20. The decision boundary is x2=2x1.

A perceptron a is called “more general” than perceptron b if: 1. Every point that b classifies as positive is also classified as positive by a. 2. There exist points that a classifies as positive which b does not.

Observe that for any x1: 2x112x1. Hence, the set of points {(x1,x2):x22x1} (perceptron b’s positive region) is contained in the set {(x1,x2):x22x11} (perceptron a’s positive region). Therefore: 1. If b classifies a point as positive, a also does. 2. There are additional points (namely those where 2x11x2<2x1) that a classifies as positive but b does not.

Hence, perceptron a is indeed more general than perceptron b.

Additional Subquestion

For a random sample of points, verify empirically that any point classified as positive by perceptron b is also classified as positive by perceptron a.

Additional Solution (Sample Code)

Below is a short Python snippet that generates random points and checks their classification according to each perceptron. (No visual output is included.)

import numpy as np

def perceptron_output(x1, x2, w0, w1, w2):
    return (w0 + w1*x1 + w2*x2) >= 0

# Weights for a and b:
w_a = (1, 2, 1)  # w0=1, w1=2, w2=1
w_b = (0, 2, 1)  # w0=0, w1=2, w2=1

n_points = 1000
x1_vals = np.random.uniform(-10, 10, n_points)
x2_vals = np.random.uniform(-10, 10, n_points)

count_b_positive_also_positive_in_a = 0
count_b_positive = 0

for x1, x2 in zip(x1_vals, x2_vals):
    output_b = perceptron_output(x1, x2, *w_b)
    output_a = perceptron_output(x1, x2, *w_a)
    if output_b:
        count_b_positive += 1
        if output_a:
            count_b_positive_also_positive_in_a += 1

print("Out of", count_b_positive, "points that B classified as positive,")
print(count_b_positive_also_positive_in_a, "were also positive for A.")
print("Hence, all (or nearly all) B-positive points lie in A's positive region.")

Exercise 2.10

Level: * (Easy)

Exercise Type: Novel

Question

In a simple linear regression

a). Derive the vectorized form of the SSE (loss function) in terms of Y, X and θ.

b). Find the optimal value of θ that minimizes the SSE (Recall that this is the weights of the linear regression).

Solution

a).

SSE=YY^2=(YY^)T(YY^)=YTYYTXθ(Xθ)TY+(Xθ)T(Xθ)=YTY2YTXθ+(Xθ)T(Xθ)

b).

0=SSEθ0=θ[YTY2YTXθ+(Xθ)T(Xθ)]0=02YXT+2XTXθ2XTXθ=2YXTθ=(YXT)(XTX)1

Note that XTX0, so 2θ2SSE=2XTX0. Hence, the stationary point derived above yields a local minimum.

Exercise 2.11

Level: **(Moderate)

Exercise Types: Novel

Question

Deep learning models often face challenges during training due to the vanishing gradient problem, especially when using sigmoid or tanh activation functions.

(a) Describe the vanishing gradient problem and its impact on the training of deep networks.

(b) Explain how the introduction of ReLU (Rectified Linear Unit) activation function mitigates this problem.

(c) Discuss one potential downside of using ReLU and propose an alternative activation function that addresses this limitation.

Solution

(a) Vanishing Gradient Problem: The vanishing gradient problem occurs when the gradients of the loss function become extremely small as they are propagated back through the layers of a deep network. This leads to:

(i)Slow or stagnant weight updates in early layers;

(ii)Difficulty in effectively training deep models. This issue is particularly pronounced with activation functions like sigmoid and tanh, where gradients approach zero as inputs saturate.

(b) Role of ReLU in Mitigation: ReLU, defined as f(x)=max(0,x), mitigates the vanishing gradient problem by:

(i)Producing non-zero gradients for positive inputs, maintaining effective weight updates;

(ii)Introducing sparsity, as neurons deactivate (output zero) for negative inputs, which improves model efficiency.

(c) Downside of ReLU and Alternatives: One downside of ReLU is the "dying ReLU" problem, where neurons output zero for all inputs, effectively becoming inactive. This can happen when weights are poorly initialized or during training. In other words, the weighted sum of inputs falls below zero, and the gradient of the ReLU function becomes zero. High learning rate may push neurons into this inactive states.

Alternative: Leaky ReLU allows a small gradient for negative inputs, defined as f(x)=x for x>0 and f(x)=αx for x0, where α is a small positive constant. This prevents neurons from dying, ensuring all neurons contribute to learning.

Exercise 2.12

Level: * (Easy)

Exercise Type: Novel

Question

Consider the following data:

x=[112233],y=[122323]

This data is fitted by a linear regression model with no bias term. What is the loss for the first four data points? Use the L2 loss defined as:

L=12(yy^)2.

Solution

The correct losses for the first four data points are 0, 0.5, 0, and 0.5.

Calculation

Step 1: Fit the linear regression model.
Since there is no bias term, the model is y^=βx, where β=xiyixi2.

Compute β: β=11+12+22+23+32+3312+12+22+22+32+32=2828=1.

Step 2: Calculate y^ for each x.
For the first four data points:
y^1=11=1
y^2=11=1
y^3=12=2
y^4=12=2

Step 3: Compute the L2 loss for each point.
- For (x1,y1): L1=12(11)2=0.
- For (x2,y2): L2=12(21)2=0.5.
- For (x3,y3): L3=12(22)2=0.
- For (x4,y4): L4=12(32)2=0.5.

Thus, the losses are: 0, 0.5, 0, 0.5.


Exercise 2.13

Level: ** (Moderate)

Exercise Types: Novel

References: A. Ghodsi, STAT 940 Deep Learning: Lecture 2, University of Waterloo, Winter 2025.

Question

In Lecture 2, we derived a formula for a simple perceptron to determine a hyperplane which splits a set of linearly independant data.

In class, we defined the error as

err=iMyi(βTxi+β0)

Where M is the set of points which have been misclassified

The function for the simple perceptron was defined as

yi=βTx+β0

Where a point belongs to Set 1 if it is above the line, and Set 2 if it is below the line.

In lecture 2, we found the partial derivatives as

errf=iMyi(βTxi+βi)

and

errβ=iMyi

And defined the formula for gradient descent as

[ββ0]=[ββ0]+η[iMyixiiMyi]

Generate a random set of points and a line in 2D using python, and sort the set of points into 2 sets above and below the line. Then use gradient descent and the formulas above to find a hyperplane which also sorts the set with no prior knowledge of the line used for sorting.

Solution

The code below is a sample of implementing the 2D gradient descent algorithm derived in Lecture 2 to a random dataset

import numpy as np
import matplotlib.pyplot as plt
import functools

#Generate a random array of points
random_array = np.random.random((40,2)) 

#Linearlly seperate the points by a random hyperplane (in this case, a 2D line)
#y = ax + b
a = np.random.random()
b = np.random.random()*0.25

#Create the ground truth, classify points into Set 1 or Set 2
set_1_indicies = random_array[:,1] >= (a*random_array[:,0] + b) #Boolean indicies where y is greater to or equal to the line y = ax + b
set_2_indicies = random_array[:,1] < (a*random_array[:,0] + b)

#Get the (x,y) coordinates of set 1 and set 2 by selecting the indicies of the random array which are either above or below the hyperplane
set_1= random_array[set_1_indicies]
set_2= random_array[set_2_indicies]


plt.figure(1,figsize=(6,6))
plt.scatter(set_1[:,0],set_1[:,1],c='r')
plt.scatter(set_2[:,0],set_2[:,1],c='b')
plt.xlabel('x')
plt.ylabel('y')
x = np.linspace(0,1,2)
y = x*a + b
plt.plot(x,y,'g')
plt.legend(['Set 1','Set 2','Initial Hyperplane Used to Split Sets'])
plt.title("Generated Dataset")
plt.show()

#Now use a simple perceptron and the algorithm developed in class during lecture 2 to have an agent with no prior knowledge of the hyperplane determine what it is, or find a hyperplane that can seperate the two sets.

#Randomly initialize beta and beta_0

beta = np.random.random()

beta_0 = np.random.random()*0.25

def update_weights(beta,beta_0,random_array,set_1_indicies,set_2_indicies,learning_rate):
    #Find perceptron set 1 and set 2
    perceptron_set_1_indicies = random_array[:,1] >= (beta*random_array[:,0] + beta_0)
    perceptron_set_2_indicies = random_array[:,1] < (beta*random_array[:,0] + beta_0)
    
    #Find set M, the misclassified points
    #A point x,y classified by the agent as class 1 is misclassified if it is actually in set 2 or if it is classified as class 2 and is actually in set 1
    M_indicies= np.logical_or(np.logical_and(perceptron_set_1_indicies,set_2_indicies),np.logical_and(perceptron_set_2_indicies,set_1_indicies))
    
    #Get an array of the x,y coordinates of the misclassified points
    M=random_array[M_indicies]
    
    #Define variables for the sums on the right side of the gradient descent linear equation
    sum_yixi = 0
    sum_yi = 0
    
    #Compute the sums needed to do gradient descent
    for i in range(0,len(M)):
        sum_yixi = sum_yixi + M[i,0]*M[i,1]
        sum_yi = sum_yi + M[i,1]
    
    #Update beta and beta_0
    beta = beta + learning_rate*sum_yixi
    beta_0 = beta_0 + learning_rate*sum_yi
    
    return beta,beta_0


#Run for 1000 epochs

for i in range(0,1000):
    beta,beta_0 = update_weights(beta,beta_0,random_array,set_1_indicies,set_2_indicies,0.01)
    

plt.figure(1,figsize=(6,6))
plt.scatter(set_1[:,0],set_1[:,1],c='r')
plt.scatter(set_2[:,0],set_2[:,1],c='b')
plt.xlabel('x')
plt.ylabel('y')
x = np.linspace(0,1,2)
y = beta*x + beta_0
plt.plot(x,y,c='g')
plt.legend(['Set 1','Set 2','Gradient Descent Hyperplane'])
plt.title("Gradient Descent Generated Hyperplane")
plt.show()

The figure below shows a sample of the randomly generated linearly separated sets, and the lines used to separate the sets.

Randomy generated sets of data linearly separated

The figure below shows the predicted hyperplane found using gradient descent

Hyperplane found through gradient descent algorithm derived in STAT 240 lecture 2

Exercise 2.14

Level: *(Easy)

Exercise Types: Novel

Question

Consider a simple neural network model with a single hidden layer to classify input data into two categories based on their features. Address the following points:

  1. Describe the process of input data transformation through a single hidden layer.
  2. Identify the role of activation functions in neural networks.
  3. Explain the importance of the learning rate in the neural network training process.

Solution

  1. Input Processing:

    The network receives input features and feeds them through a hidden layer, where each input is subject to a weighted sum, addition of a bias, and application of an activation function. This series of operations transforms the input data into a representation that captures complex relationships within the data.

    Mathematically, the output h of the hidden layer for an input vector x is given by: h=f(W(1)x+b(1)), where W(1) represents the weights, b(1) the biases, and f the activation function.

  2. Role of Activation Functions:

    Activation functions such as sigmoid, ReLU, or tanh introduce necessary non-linearities into the model, enabling it to learn more complex patterns and relationships in the data. These functions are applied to each neuron's output and help regulate the neural network's overall output, ensuring predictability and differentiation between different types of outputs.

  3. Importance of Learning Rate:

    The learning rate η is a critical parameter that determines the extent to which the weights in the network are updated during training. An optimal learning rate ensures efficient convergence to a minimum, whereas an excessively high rate can lead to overshooting and an excessively low rate to slow convergence or getting stuck in local minima.



Exercise 2.15

Level: ** (Moderate)

Exercise Types: Novel

Question

Consider a simple feedforward neural network with one input layer, one hidden layer, and one output layer. The network structure is as follows:

  • Input layer: 2 neurons (features x1 and x2).
  • Hidden layer: 3 neurons with ReLU activation ((a=max(0,z))).
  • Output layer: 1 neuron with no activation (linear output).

The weights (W) and biases (b) for the layers are:

Hidden layer:

Whidden=[0.50.20.80.30.50.7],bhidden=[0.10.40.2]

Output layer:

Whidden=Woutput=[0.60.10.3],boutput=0.5


For input values x1=1.5 and x2=0.5:

  1. Calculate the output of the hidden layer (ahidden).
  2. Calculate the final output of the network (youtput).

Solution

Step 1: Calculate zhidden=Whiddenx+bhidden

The input vector is: x=[x1x2]=[1.50.5]

zhidden=[0.50.20.80.30.50.7][1.50.5]+[0.10.40.2]


zhidden=[(0.51.5)+(0.20.5)(0.81.5)+(0.30.5)(0.51.5)+(0.70.5)]+[0.10.40.2]

zhidden=[0.75+0.11.20.150.750.35]+[0.10.40.2]=[0.850.650.9]

Step 2: Apply ReLU activation

The ReLU activation is defined as:

ahidden=max(0,zhidden)


ahidden=[max(0,0.85)max(0,0.65)max(0,0.9)]=[0.850.650]


Step 3: Calculate zoutput=Woutputahidden+boutput

zoutput=[0.60.10.3][0.850.650]+0.5

zoutput=(0.60.85)+(0.10.65)+(0.30)+0.5

zoutput=0.510.065+0+0.5=0.945

Step 4: Final Output

The final output of the network is: youtput=zoutput=0.945


Exercise 2.16

Level: * (Easy)

Exercise Types: Novel

Question

Consider the following binary classification task, where the goal is to classify points into two categories: +1 or -1.

Training Data: x1x2y231121311451 Where x1 and x2 are the input features, y is the target label (+1 or -1).

Task: Train a perceptron model using gradient descent, and update the weights using the perceptron update rule using the first data point(2,3,1). Initialize the weights as β0=0, β1=0, and β2=0. Choose a learning rate of η=0.1.

Solution

Step 1: Compute the Prediction

The perceptron model predicts the label using the following equation:

y^=sign(β0+β1x1+β2x2)

Substituting the initial weights and the input values:

y^=sign(0+02+03)=sign(0)=0

Since the predicted label y^=0 is not equal to the true label y=1, we need to update the weights.

Step 2: Update the Weights

β0=β0+ηy=0+0.11=0.1

β1=β1+ηyx1=0+0.112=0.2

β2=β2+ηyx2=0+0.113=0.3

Exercise 2.17

Level: * (Easy)

Exercise Types: Novel

Question

Consider a binary classification problem where a perceptron is used to separate two linearly separable classes in R2. The perceptron updates its weight vector w using the following update rule:

w(t+1)=w(t)+ηy(t)x(t)

where:

  • w(t) is the weight vector at iteration t,
  • x(t)R2 is the feature vector of the misclassified sample at iteration t,
  • y(t){+1,1} is the corresponding label,
  • η>0 is the learning rate.

Prove that if the data is **linearly separable**, the perceptron algorithm **converges in a finite number of steps

Solution

Define the angle between w and the optimal weight vector w, which perfectly separates the data. The perceptron algorithm updates the weight vector in the direction of each misclassified sample, gradually aligning it with w.

By repeatedly applying the update rule and using the Cauchy-Schwarz inequality, we can show that:

w(t)wtγR

which grows linearly with t. Meanwhile, the norm of w(t) is bounded as:

w(t)2tR2

Combining these inequalities leads to the bound on the number of updates:

TR2γ2

Exercise 2.18

Level: * (Easy)

Exercise Types: Novel

Question

In a binary classification problem, assume the input data is a 2-dimensional vector x = [x1,x2].The Perceptron model is defined with the following parameters:

Weights: w = [2,-1] Bias: b = -0.5

The Perceptron output is given by: y = sign(wx + b), where sign(z) is the sign function that outputs +1 if z > 0, and -1 otherwise.

1. Compute the Perceptron output y for the input sample x = [1,2];

2. Assume the target label is t = +1. Determine if the Perceptron classifies the sample correctly. If it misclassifies, provide the update rule for the weights w and biases b, and compute their updated values after one step.

Solution

1. Compute the predicted output y and determine if classification is correct:

z=w*x+b=(21)+(12)+(0.5)=220.5=0.5<0

since z<0, the Perceptron output is

y=sign(0.5)=1

2. The target label t = +1, but the Perceptron output y = -1. Hence, the classification is incorrect.

Update rule for weights and bias:

Gradient:

w=ρ(ty)x=0.1(1(1))[1,2]=[0.2,0.4]

b=ρ(ty)=0.1(1(1))=0.2

Update:

Assume the learning rate here is 0.1,

wnew=wold+w=[2,1]+[0.2,0.4]=[2.2,0.6]

bnew=bold+b=0.5+0.2=0.3

Exercise 2.19

Level: ** (Moderate)

Exercise Types: Novel

Question

Given a simple feedforward neural network with one hidden layer and a softmax output, the network has the following structure:

  • Input layer: xRn,
  • Hidden layer: Linear transformation h=Wx+b, followed by a ReLU activation, i.e., h=max(0,h),
  • Output layer: Softmax output youtput=Softmax(Wh+b).

Let the true label be yRk, where k is the number of output classes and y is a one-hot vector.

1.Derive the gradient of the loss function (cross-entropy loss) with respect to the output logit W2h++b2 in terms of the softmax output and the true label y. Write the expression for Lyoutput. Here we assume the loss function is the entropy loss, i.e. L=iyilog(youtput,i) where yi is the true label and youtput,i

2. Using the chain rule, derive the gradient of the loss function with respect to the hidden layer h+. How does the ReLU activation affect the gradient computation?

Solution

1. Let the output logits be represented as: z=Wh+b where h=max(0,Wx+b) is the output of the hidden layer after the ReLU activation.

The softmax output youtput=Softmax(z) is given by: youtput,i=ezijezj

The cross-entropy loss L=iyilog(youtput,i) where yi is the true label and youtput,i is the predicted probability from the softmax.

The gradient of the loss with respect to the output logits zi is: Lzi=youtput,iyi

The gradient with respect to the output youtput is: Lyoutput=youtputy

2. Now, we compute the gradient of the loss with respect to the hidden layer h+.

Using the chain rule, we have: Lh+=Lzzh+

From part 1, we already computed the derivative of the loss with respect to the output logits: Lz=youtputy

The derivative of the logits with respect to the hidden layer is: zh+=W

Therefore, the gradient with respect to the hidden layer is: Lh+=WT(youtputy)

The ReLU activation introduces a nonlinearity in the gradient computation. Specifically, ReLU is defined as: ReLU(x)=max(0,x)

The gradient of the ReLU function is: ReLU(x)=1 if x>0 else 0

Therefore, the gradient with respect to the hidden layer becomes: Lh+=(WT(youtputy))ReLU(h+)

This means that if an element of h+ is zero (due to the ReLU activation), the corresponding gradient is also zero, which effectively prevents updates to that particular element during backpropagation.

Exercise 2.20

Level: * (Easy) Exercise Types: Novel

Question

Compute the distance of the following misclassified points to the hyperplane L: x1=[2,3], y1=1, x2=[4,1], y2=1.

The hyperplane parameters are: β=[1,2]T,β0=3.

Solution

The hyperplane equation is: βTx+β0=x12x2+3.


For x1=[2,3], y1=1: βTx1+β0=(1)(2)+(2)(3)+3=26+3=1. The distance is: d1=y1(βTx1+β0)=(1)(1)=1.

For x2=[4,1], y2=1: βTx2+β0=(1)(4)+(2)(1)+3=4+2+3=9. The distance is: d2=y2(βTx2+β0)=(1)(9)=9.

Exercise 2.21

Level: * (Easy)

Exercise Types: Novel

Question

Train a perceptron using gradient descent for the following settings:

  • Input Data: xi=[xi1,xi2]T.
  • Labels: yi{1,+1}.
  • Initial Weights: w=[w1,w2]T=[0,0]T, b=0.
  • Learning Rate: η=0.1.

The perceptron update rules are:
ww+ηyixi
bb+ηyi

Dataset:
x1=[2,1]T, y1=1
x2=[1,1]T, y2=1
Tasks:

  1. Perform one iteration of gradient descent (update weights and bias).
  2. Determine whether both points are correctly classified after the update.

Solution

Initialization: w=[0,0]T, b=0, η=0.1.

Step 1: Update for Point x1=[2,1]T, y1=1
Compute perceptron output: Output=wTx1+b=0.
Misclassification occurs (Outputy10).
Update weights and bias:
w[0,0]T+0.11[2,1]T=[0.2,0.1]T
b0+0.11=0.1

Step 2: Update for Point x2=[1,1]T, y2=1
Compute perceptron output: Output=wTx2+b=0.2.
Misclassification occurs (Outputy2>0).
Update weights and bias:
w[0.2,0.1]T+0.1(1)[1,1]T=[0.1,0.2]T
b0.1+0.1(1)=0

Results:
Final weights: w=[0.1,0.2]T
Final bias: b=0

Classification Check:
For x1: wTx1+b=0.4 (correctly classified).
For x2: wTx2+b=0.1 (correctly classified).

Conclusion:
After one iteration of gradient descent, both points are correctly classified.

Exercise 2.22

Level: * (Moderate)

Exercise Types: Novel

Question

For the following neural network, do one forward pass through the network using the point (x1, x2, x3) = (1, 2, -1). The hidden layer uses the ReLu activation function and the output layer uses the sigmoid activation function. Calculate pfinal.

Diagram of the neural network

Solution

1) Hidden layer calculations: The equations for the hidden layer are z1=x1w1+x2w2+x3w3+w4 and z2=x1w5+x2w6+x3w7+w8. Plugging in the values x and the weights we obtain z1=(1)(0.5)+(2)(0.3)+(1)(0.4)1=0.3 and z2=(1)(0.2)+(2)(1)+(1)(0.7)+0.9=2. The equations to activate the hidden layers are za=max(0,z1) and zb=max(0,z2). Plugging in z1 and z2 we obtain za=max(0,0.3)=0 and zb=max(0,2)=2.

2) Output layers calculations: The equations for the output layer is zfinal=zaw9+zbw10+w11. Plugging in za, zb and the weights we obtain zfinal=00.6+20.50.4=0.6. To calculate pfinal we need to use the sigmoid activation function so the equation is pfinal=11+ezfinal. Plugging in the value for zfinal we obtain pfinal=11+e0.6=0.646.

Exercise 2.23

Level: * (Easy)

Exercise Types: Novel

Question

You are given a perceptron with weights w=[2,3] and bias b=5. The perceptron uses the activation function: f(x)=sign(wx+b) where x=[x1,x2] is the input and sign(z) outputs 1 if z>0 and −1 otherwise. 1) Write the equation of the hyperplane that separates the two classes defined by this perceptron. 2) Determine whether the following points are classified as 1 or -1 by the perceptron. x1=[1,1] x2=[2,1] x3=[0,2]

Solution

1) The hyperplane is defined by the equation where wx+b=0. Substituting the given weights and bias gives 2x13x2+5=0. This is the equation of the hyperplane that separates the two classes. 2) For x1=[1,1], wx1+b=2(1)3(1)+5=4. Thus, x1=1 by the perceptron. For x2=[2,1], wx2+b=2(2)3(1)+5=12. Thus, x2=1 by the perceptron. For x3=[0,2], wx3+b=2(0)3(2)+5=1. Thus, x3=1 by the perceptron.

Exercise 2.24

Level: * (Easy)

Exercise Types: Novel

Question

Given a dataset D={(x1,y1)=([1,2],1),(x2,y2)=([2,1],1),(x3,y3)=([3,1],1),(x4,y4)=([1,2],1)}

a). Show that the dataset D is linearly separable by finding the weight vector β=[w1,w2] and bias b such that: yi(βTxi+b)>0,(xi,yi)D

b). Train the perceptron starting with w1=0,w2=0,b=0. Use the update rule for misclassification points: ββ+yixi,bb+yi Show the full process and update β and b.

c). Write the final values of β and b.

Solution

a). When y=1, [1,2] and [3,1].

When y=1, [2,1] and [1,2].

Assume a line w!x1+w2x2+b=0, where β=[1,1],b=2.

For [1,2]:11+122=1>0 (correctly separated).

For [3,1]:13+112=2>0 (correctly separated).

For [2,1]:12+1(1)2=1<0 (correctly separated).

For [1,2]:11+1(2)2=3<0 (correctly separated).

b). As w1=0,w2=0,b=0,

For (x1,y1)=([1,2],1), f(x1)=sign(01+02+0)=0

This is incorrect, thus update into: w10+11=1,w20+12=2,b0+1=1

For (x2,y2)=([2,1],1), f(x2)=sign(12+2(1)+1)=1

This is incorrect, thus update into: w11+(1)2=1,w22+(1)(1)=3,b1+(1)=0

For (x3,y3)=([3,1],1), f(x3)=sign(13+31+0)=0

This is incorrect, thus update into: w11+13=2,w23+11=4,b0+1=1

For (x4,y4)=([1,2],1), f(x4)=sign(21+4(2)+1)=1

This is correct, thus no update.

c). Therefore, final weight is w1=2,w2=4,b=1

Exercise 2.25

Level: * (Easy)

Exercise Types: Novel

Question

Explain the mechanism of self-attention used in transformers, focusing on the computation of attention scores. Use a small example with the input vectors corresponding to three words of your choice to demonstrate how self-attention weights are calculated and used to produce the output vectors.

Solution

Self-Attention Mechanism: Self-attention allows a model to dynamically weigh the importance of each word in a sequence relative to others, which is crucial for understanding the context and relationships in sentences.

Example Setup: - Assume we have three words in our input: "Star Wars," "Star Trek," and "Star Gate". - Each word is initially represented by a simple 2-dimensional embedding for simplicity.

Step 1: Compute Q, K, V vectors For each word, compute the Query (Q), Key (K), and Value (V) vectors using learned weight matrices (assume identity matrices for simplicity): - Q, K, V for "Star Wars" = [1, 0] - Q, K, V for "Star Trek" = [0, 1] - Q, K, V for "Star Gate" = [1, 1]

Step 2: Compute Attention Scores Calculate the dot product of the query vector of each word with the key vector of every other word: - Score for "Star Wars" with "Star Trek": [1, 0] • [0, 1] = 0 - Score for "Star Wars" with "Star Gate": [1, 0] • [1, 1] = 1 - Score for "Star Trek" with "Star Wars": [0, 1] • [1, 0] = 0 - Score for "Star Trek" with "Star Gate": [0, 1] • [1, 1] = 1 - Score for "Star Gate" with "Star Wars": [1, 1] • [1, 0] = 1 - Score for "Star Gate" with "Star Trek": [1, 1] • [0, 1] = 1

Step 3: Normalize Scores using Softmax Apply the softmax function to ensure scores sum to one and represent probabilities: - Normalized scores between "Star Wars," "Star Trek," and "Star Gate": [0.333, 0.333, 0.333] (this type of simplicity would be like using a naive bayes model to predict)

Step 4: Compute Output Vectors Multiply each value vector by the corresponding normalized score and sum them to produce the output vector for each word: - Output for "Star Wars": 0.333*[1, 0] + 0.333*[0, 1] + 0.333*[1, 1] = [0.666, 0.666] - Output for "Star Trek": Similar calculation - Output for "Star Gate": Similar calculation


Exercise 3.1

Level: ** (Moderate)

Exercise Type: Novel

Implement the perceptron learning algorithm with momentum for the AND function. Plot the decision boundary after 10 epochs of training with a learning rate of 0.1 and a momentum of 0.9.

Solution

import numpy as np
import matplotlib.pyplot as plt

# Dataset
data = np.array([
    [0, 0, -1],
    [0, 1, -1],
    [1, 0, -1],
    [1, 1, 1]
])

# Initialize weights, learning rate, and momentum
weights = np.random.rand(3)
learning_rate = 0.1
momentum = 0.9
epochs = 10
previous_update = np.zeros(3)

# Add bias term to data
X = np.hstack((np.ones((data.shape[0], 1)), data[:, :2]))
y = data[:, 2]

# Training loop
for epoch in range(epochs):
    for i in range(len(X)):
        prediction = np.sign(np.dot(weights, X[i]))
        if prediction != y[i]:
            update = learning_rate * y[i] * X[i] + momentum * previous_update
            weights += update
            previous_update = update

# Plot final decision boundary
x_vals = np.linspace(-0.5, 1.5, 100)
y_vals = -(weights[1] * x_vals + weights[0]) / weights[2]
plt.plot(x_vals, y_vals, label='Final Decision Boundary')

# Plot dataset
for point in data:
    color = 'blue' if point[2] == 1 else 'red'
    plt.scatter(point[0], point[1], color=color)

plt.title('Perceptron with Momentum')
plt.legend()
plt.show()


Final decision boundary.


Exercise 3.2

Level: ** (Moderate)

Exercise Types: Novel

Question

Write a python program showing how the back propagation algorithm work with a 2 inputs 2 hidden layer and 1 output layer neural network. Train the network on the XOR problem:

  • Input[0,0] -> Output 0
  • Input [0,1] -> Output 1
  • Input [1,0] -> Output 1
  • Input [1,1] -> Output 0

Use the sigmoid activation function. Use Mean Square Error as the loss function.

Solution

import numpy as np

# -------------------------
# 1. Define Activation Functions
# -------------------------

def sigmoid(x):
    """
    Sigmoid activation function.

    :param x: A decimal value
    :return: The sigmoid activation of given value
    """
    return 1 / (1 + np.exp(-x))

def sigmoid_derivative(x):
    """
    Derivative of the sigmoid function.
    Here, 'x' is assumed to be sigmoid(x), 
    meaning x is already the output of the sigmoid.

    :param x: A decimal value
    :return: The derivative of sigmoid activation of given value
    """
    return x * (1 - x)


# -------------------------
# 2. Prepare the Training Data (XOR)
# -------------------------
# Input data (4 samples, each with 2 features)
X = np.array([
    [0, 0],
    [0, 1],
    [1, 0],
    [1, 1]
])

# Target labels (4 samples, each is a single output)
y = np.array([
    [0],
    [1],
    [1],
    [0]
])

# -------------------------
# 3. Initialize Network Parameters
# -------------------------
# Weights for input -> hidden (shape: 2x2)
W1 = np.random.randn(2, 2)
# Bias for hidden layer (shape: 1x2)
b1 = np.random.randn(1, 2)

# Weights for hidden -> output (shape: 2x1)
W2 = np.random.randn(2, 1)
# Bias for output layer (shape: 1x1)
b2 = np.random.randn(1, 1)

# Hyperparameters
learning_rate = 0.1
num_epochs = 10000

# -------------------------
# 4. Training Loop
# -------------------------
for epoch in range(num_epochs):
    # 4.1. Forward Pass
    #   - Compute hidden layer output
    hidden_input = np.dot(X, W1) + b1  # shape: (4, 2)
    hidden_output = sigmoid(hidden_input)
    
    #   - Compute final output
    final_input = np.dot(hidden_output, W2) + b2  # shape: (4, 1)
    final_output = sigmoid(final_input)
    
    # 4.2. Compute Loss (Mean Squared Error)
    error = y - final_output  # shape: (4, 1)
    loss = np.mean(error**2)
    
    # 4.3. Backpropagation
    #   - Gradient of loss w.r.t. final_output
    d_final_output = error * sigmoid_derivative(final_output)  # shape: (4, 1)
    
    #   - Propagate error back to hidden layer
    error_hidden_layer = np.dot(d_final_output, W2.T)  # shape: (4, 2)
    d_hidden_output = error_hidden_layer * sigmoid_derivative(hidden_output)  # shape: (4, 2)
    
    # 4.4. Gradient Descent Updates
    #   - Update W2, b2
    W2 += learning_rate * np.dot(hidden_output.T, d_final_output)  # shape: (2, 1)
    b2 += learning_rate * np.sum(d_final_output, axis=0, keepdims=True)  # shape: (1, 1)
    
    #   - Update W1, b1
    W1 += learning_rate * np.dot(X.T, d_hidden_output)  # shape: (2, 2)
    b1 += learning_rate * np.sum(d_hidden_output, axis=0, keepdims=True)  # shape: (1, 2)
    
    # Print loss every 1000 epochs
    if epoch % 1000 == 0:
        print(f"Epoch {epoch}, Loss: {loss:.6f}")

# -------------------------
# 5. Testing / Final Outputs
# -------------------------
print("\nTraining complete.")
print("Final loss:", loss)

# Feedforward one last time to see predictions
hidden_output = sigmoid(np.dot(X, W1) + b1)
final_output = sigmoid(np.dot(hidden_output, W2) + b2)

print("\nOutput after training:")
for i, inp in enumerate(X):
    print(f"Input: {inp} -> Predicted: {final_output[i][0]:.4f} (Target: {y[i][0]})")

Output:

Epoch 0, Loss: 0.257193
Epoch 1000, Loss: 0.247720
Epoch 2000, Loss: 0.226962
Epoch 3000, Loss: 0.191367
Epoch 4000, Loss: 0.162169
Epoch 5000, Loss: 0.034894
Epoch 6000, Loss: 0.012459
Epoch 7000, Loss: 0.007127
Epoch 8000, Loss: 0.004890
Epoch 9000, Loss: 0.003687

Training complete.
Final loss: 0.0029435579049382756

Output after training:
Input: [0 0] -> Predicted: 0.0598 (Target: 0)
Input: [0 1] -> Predicted: 0.9461 (Target: 1)
Input: [1 0] -> Predicted: 0.9506 (Target: 1)
Input: [1 1] -> Predicted: 0.0534 (Target: 0)

Exercise 3.3

Level: * (Easy)

Exercise Types: Novel

Question

Implement 4 iterations of gradient descent with and without momentum for the function f(x)=x2+2 with learning rate η=0.1, momentum γ=0.9, starting value of x0=2, starting velocity of v0=0. Comment on the differences.

Solution

Note that f(x)=2x

Without momentum:

Iteration 1: x1=x0ηf(x0)=20.122=1.6

Iteration 2: x2=x1ηf(x1)=1.60.121.6=1.28

Iteration 3: x3=x2ηf(x2)=1.280.121.28=1.024

Iteration 4: x4=x3ηf(x3)=1.0240.121.024=0.8192

With momentum:

Iteration 1: v1=γv0+ηf(x0)=0.90+0.122=0.4,x1=x0v1=20.4=1.6

Iteration 2: v2=γv1+ηf(x1)=0.90.4+0.121.6=0.68,x2=x1v2=1.60.68=0.92

Iteration 3: v3=γv2+ηf(x2)=0.90.68+0.120.92=0.796,x3=x2v3=0.920.796=0.124

Iteration 4: v4=γv3+ηf(x3)=0.90.796+0.120.124=0.7412,x4=x3v4=0.1240.7412=0.6172

By observation, we know that the minimum of f(x)=x2+2 occurs at x=0. We can see that with momentum, the algorithm moves towards the minimum much faster than without momentum as past gradients are accumulated, leading to larger steps. However, we also can see that momentum can cause the algorithm to overshoot the minimum since we are taking larger steps.

Benefits for momentum: Momentum is a technique used in optimization to accelerate convergence. Inspired by physical momentum, it helps in navigating the optimization landscape.

By remembering the direction of previous gradients, which are accumulated into a running average (the velocity), momentum helps guide the updates more smoothly, leading to faster progress. This running average allows the optimizer to maintain a consistent direction even if individual gradients fluctuate. Additionally, momentum can help the algorithm escape from shallow local minima by carrying the updates through flat regions. This prevents the optimizer from getting stuck in small, unimportant minima and helps it continue moving toward a better local minimum.

Additional Comment: It is important to note that the use of running average is only there to help with intuition. At time t, while the velocity is a linear sum of previous gradients, the weight of the gradient decreases as time get further away. That is, the Q(w0) term will have a coefficient of (1γ)t.

Exercise 3.4

Level: ** (Moderate)

Exercise Types: Novel

Question

Perform one iteration of forward pass and backward propagation for the following network:

  • Input layer: 2 neurons (x₁, x₂)
  • Hidden layer: 2 neurons (h₁, h₂)
  • Output layer: 1 neuron (ŷ)
  • Input-to-Hidden Layer:
 w₁₁¹ = 0.15, w₂₁¹ = 0.20, w₁₂¹ = 0.25, w₂₂¹ = 0.30
 Bias: b¹ = 0.35
 Activation function: sigmoid
  • Hidden-to-Output Layer:
 w₁₁² = 0.40, w₂₁² = 0.45
 Bias: b² = 0.60
 Activation function: sigmoid

Input:

  • x₁ = 0.05, x₂ = 0.10
  • Target output: y = 0.01
  • Learning rate: η = 0.5

Solution

Step 1: Forward Pass

1. Hidden Layer Outputs

For neuron h₁:

  • z¹=w¹x+w¹x+b¹=0.15(0.05)+0.20(0.10)+0.35=0.3775
  • h=σ(z¹)=11+e0.37750.5933

For neuron h₂:

  • z¹=w¹x+w¹x+b¹=0.25(0.05)+0.30(0.10)+0.35=0.3925
  • h=σ(z¹)=11+e0.39250.5968
2. Output Layer
  • z²=w²h+w²h+b²=0.40(0.5933)+0.45(0.5968)+0.60=1.1051
  • y^=σ(z²)=11+e1.10510.7511

Step 2: Compute Error

  • E=12(y^y)2=12(0.75110.01)20.2738

Step 3: Backpropagation

3.1: Gradients for Output Layer

1. Gradient w.r.t. output neuron:

  • δ²=(y^y)y^(1y^)
  • δ²=(0.75110.01)0.7511(10.7511)=0.1381

2. Update weights and bias for hidden-to-output layer:

  • w²=w²ηδ²h=0.400.50.13810.5933=0.359
  • w²=w²ηδ²h=0.450.50.13810.5968=0.409
  • b²=b²ηδ²=0.600.50.1381=0.53095
3.2: Gradients for Hidden Layer

1. Gradients for hidden layer neurons:

For h₁:

  • δ=δ²w²h(1h)
  • δ=0.13810.400.5933(10.5933)=0.0138

For h₂:

  • δ=δ²w²h(1h)
  • δ=0.13810.450.5968(10.5968)=0.0148

2. Update weights and bias for input-to-hidden layer:

For w₁₁¹:

  • w¹=w¹ηδx=0.150.50.01380.05=0.14965

For w₂₁¹:

  • w¹=w¹ηδx=0.200.50.01380.10=0.19931

For b¹:

  • b¹=b¹η(δ+δ)=0.350.5(0.0138+0.0148)=0.3347


This completes one iteration of forward and backward propagation.

Exercise 3.5

Level: * (Easy)

Exercise Types: Novel

Question

Consider the loss function Q(w)=w2+2w+1. Compute the gradient of Q(w). Starting from w0=2, perform two iterations of stochastic gradient descent using a learning rate ρ=0.1.

Solution

Compute the gradient at w0:Q(w0)=ddw0(w02+2w0+1)=2w0+2=2(2)+2=4+2=6

Update the weight using SGD: w1=w0ρQ(w0)=20.16=20.6=1.4

Compute the gradient at w1: Q(w1)=ddw1(w12+2w1+1)=2w1+2=2(1.4)+2=2.8+2=4.8

Update the weight again: w2=w1ρQ(w1)=1.40.14.8=1.40.48=0.92


Gradient Path Figure:

Gradient Descent Path on Loss Function


Exercise 3.6

Level: * (Easy)

Exercise Types: Novel

Question

What is the prediction of the following MLP for x=[221]?

Diagram of the MLP

Both layers are using sigmoid activation. The weight matrices connecting the input and hidden layer, and the hidden layer and output are respectively: V=[101110],W=[01].

Choose the correct answer:
a) σ(0)
b) σ(σ(0))
c) σ(1)
d) σ(σ(0))

Solution

The correct answer is b): σ(σ(0)).

Calculation

Step 1: Compute the hidden layer output h.
h=σ(Vx)=[σ(3)σ(0)]

Step 2: Compute the output layer prediction y.
y=σ(Wh)=σ(σ(0))

Thus, the prediction of the MLP is σ(σ(0)).


Exercise 3.7

Level: * (Easy)

Exercise Types: Novel

Question

Feedforward Neural Networks (FNNs) are one of the commonly used model in deep learning. In the context of training such networks, there are several important design components and techniques to consider.

(a) Give three commonly used activation functions. For each function, provide the formula and comment on its usage.

(b) Write down a widely used loss function for classification and explain why it is popular. Provide an example.

(c) Explain what adaptive learning methods are and how they help optimize and speed up neural network training.

Solution

(a)

  1. Sigmoid Activation Function

    f(z)=11+ez

    The output of the sigmoid function ranges from 0 to 1, making it suitable for estimating probabilities. For example, it can be used in the final layer of a binary classification task.

  2. ReLU (Rectified Linear Unit) Activation Function

    f(z)=max(0,z)={z,if z>0,0,if z0.

    ReLU outputs zero or a positive number, enabling some weights to be set to 0, promoting sparse representation. Since it only requires a comparison, and possibly setting a number to zero, it is more computationally efficient than other activation functions. An activation function similar to ReLU is the Gaussian error linear unit (GELU), which has a very similar shape except it is smooth at z=0.

  3. Tanh (Hyperbolic Tangent)

    f(z)=ezezez+ez

    Advantages: It can have zero-centered output, which helps during optimization by leading to balanced gradient updates; It's also a smooth gradient that works well in many cases. It also squashes extreme values into the range [-1,1], reducing the bias introduced from outlying datapoints.

    Disadvantages: It outputs close to -1 or 1 can have near-zero gradients, leading to slower learning (vanishing gradient issue).

(b)

Cross-Entropy Loss
LCE=i=1n[yilog(ypred,i) + (1yi)log(1ypred,i)]

It provides a smooth and continuous gradient, and it penalizes the incorrect predictions more when the predictions are made with confidence. It is well suited for multi-class classification, especially when used with softmax function together.

Consider a binary classification problem where yi=[1,0,1],ypred,i=[0.9,0.2,0.7]. Using the LCE, we could calculate:
LCE=13[1log(0.9) +0log(0.1)+0log(0.2)+1log(0.7)]0.154

The gradient of the loss with respect to ypred,i is:
LCEypred,i=1n[yiypred,i1yi1ypred,i]

Calculate the gradients, LCEypred,10.370,LCEypred,20.417,LCEypred,30.476, which is a relatively smooth gradient.

The loss should be between 0 and 1 for a binary classification. A value of 0.154 shows that the model performs well.

When ypred,i is close to 1 but the true label yi=0, the term  (1yi)log(1ypred,i) would approach infinity. This is because log(1ypred,i) when ypred,i1. This large gradient would force the model to correct overconfidence.

(c)

Some variants of SGD adjust the learning rate during the training process based on the gradients' magnitudes, helping accelerate convergence and manage gradients more effectively.


Exercise 3.8

Level: * (Easy)

Exercise Types: Novel

Question

Consider a Feedforward Neural Network (FNN) with a single neuron, where the loss function is given by: L(w)=(w3)2. Compute the gradient of L(w). Starting from w0=0 perform two iterations of Stochastic Gradient Descent (SGD) using a learning rate η=0.5

Solution

Gradient of L(w):
dLdw=2(w3)
w0=0
w1=w0ηdLdw=3
w2=w1ηdLdw=3
So, after 2 iterations, w2=3.


Additional Expanded Question

What if the loss function were L(w)=(w3)4? Compute its gradient and perform two iterations of SGD starting from w0=0 using the same learning rate η=0.5. Do we still reach w=3 in two steps?

Additional Solution

For L(w)=(w3)4, the gradient is: dLdw=4(w3)3.

1. **Iteration 1** (k=0): dLdw|w=0=4(03)3=4×(27)=108. w1=00.5×(108)=54.

2. **Iteration 2** (k=1): dLdw|w=54=4(543)3=4×513=4×132651=530604. w2=540.5×530604=54265302=265248.

Clearly, w does not converge to 3 in just two steps. Because w is far from 3 initially, the gradient is extremely large and causes a massive overshoot. In practice, you would reduce η or use more sophisticated optimization methods to handle the higher-order curvature of this loss function.

Exercise 3.9

Level: ** (Moderate)

Exercise Types: Modified

References: Source: Schonlau, M., Applied Statistical Learning. With Case Studies in Stata, Springer. ISBN 978-3-031-33389-7 (Chapter 14, page 318).

Question

Consider the feedforward neural network with initial weights shown in Figure 3.9 (For simplicity, there are no biases). Use sigmoid activation functions (σ(x)=11+ex) for both the hidden and the output layers. Use a learning rate of ρ=0.5.

Figure 3.9


(a): Compute a forward pass through the network for the observation (y,x1,x2,x3) = (1,3,-2,5). That is, compute the predicted probability p1.

(b): Using the result from (a), make a backward pass to compute the revised w7 and w1. Use squared error loss: E=0.5(yp1)2, where y{0,1} is the true value of the response and p1 is the predicted probability.

Solution

(a)

zA=x1w1+x2w2+x3w3=30.8+(2)(1)+50.1=4.9

zB=x1w4+x2w5+x3w6=30.3+(2)0.5+5(0.2)=1.1

outA=11+ezA=11+e4.9=0.9926

outB=11+ezB=11+e1.1=0.2497

z1=outAw7+outBw8=0.99261.3+0.24970.4=1.3903

p1=11+ez1=11+e1.3903=0.8006

(b)

Using winew=wioldρEwi

Ew7=Ep1p1z1z1w7=(p1y)p1(1p1)outA=0.0317

w7new=1.30.5(0.0317)=1.3159

Ew1=Ep1p1z1z1outAoutAzAzAw1=(p1y)p1(1p1)w7outA(1outA)x1=0.0091

w1new=0.80.5(0.0091)=0.8046

Exercise 3.10

Level: * (Easy)

Exercise Types: Novel

Question

What is vanishing gradient and how is it caused? What is the solution that fixes vanishing gradient?

Answer

The vanishing gradient problem occurs when the gradients used to update weights in a neural network become extremely small as they propagate backward through the layers. This happens because activation functions compress their inputs into a narrow output range. Consequently, their derivatives are very small, particularly for inputs far from zero, causing gradients to shrink exponentially in deeper layers. As a result, in modern computing, the gradient will be the result of multiplying multiple epsilon sized gradients where the resulting update is 0. To fix this, we use the relu activation function where the gradient is either 0 or 1. This ensures that the update value will not vanish due to small gradients. This is because ReLU does not squash its outputs into a narrow range. For positive inputs, the gradient of ReLU is constant and equal to 1, ensuring that gradients remain significant during backpropagation. Unlike other functions that lead to exponentially small gradients, ReLU’s piecewise linear nature avoids the compounding effect of small derivatives across layers. By maintaining larger gradient values, ReLU ensures that weight updates are not hindered, making it an effective solution to the vanishing gradient problem, especially in deep networks.

Exercise 3.11

Level: ** (Moderate)

Exercise Types: Novel

Question

Given a two-layer neural network with the following specifications:

Inputs: Represented as x=[x1,x2]T, a 2×1 column vector.

Weights: First layer weight matrix: W1, a 2×2 matrix; Second layer weight vector: W2, a 1×2 row vector.

Activations: The activation function for all layers is the sigmoid function, defined as: σ(z)=11+ez.

Loss Function: The cross-entropy loss, given by L=ylog(y^)(1y)log(1y^) where y is the true label (0 or 1) and y^ is the predicted output.

(a). Write out the forward propagation steps.

(b). Calculate the derivative of the loss with respect to weights in W1 and W2 using the chain rule.

Solution

(a). Forward Propagation Steps:

For the first layer pre-activation: z1=W1x where z1 is a 2×1 column vector.

For the first layer activation: a1=σ(z1) where the sigmoid function is applied element-wise, resulting in a1, a 2×1 column vector.

For the second layer pre-activation: z2=W2a1 where z2 is a scalar value.

For the second layer activation (output): y^=σ(z2) where y^ represents the predicted probability.

For the loss calculation: L=ylog(y^)(1y)log(1y^).


(b). Derivative of the Loss

Gradients for the Second Layer W2: using the chain rule: LW2=Ly^y^z2z2W2.

For the loss gradient w.r.t. output:Ly^=yy^+1y1y^.

For the gradient of sigmoid output w.r.t. pre-activation:y^z2=y^(1y^).

For the gradient of pre-activation w.r.t. weights:z2W2=a1.

For the combine terms:LW2=(y^y)a1.

Gradients for the First Layer W1: using the chain rule:LW1=La1a1z1z1W1.

For the gradient of loss w.r.t. first layer activation:La1=Lz2z2a1; from the second layer:Lz2=(y^y),z2a1=W2T. So:La1=(y^y)W2T.

For the gradient of activation w.r.t. pre-activation: a1z1=a1(1a1), where denotes element-wise multiplication.

For the gradient of pre-activation w.r.t. first layer weights: z1W1=xT.

For the combine terms: LW1=[(y^y)W2T][a1(1a1)]xT.


Exercise 3.12

Level: ** (Moderate)

Exercise Types: Novel

Question

Consider the **Bent Identity loss function**, a smooth approximation of the absolute loss, defined as:

l(y,y^)=1+(y^y)21

The following identities may be useful:

ddx1+x2=x1+x2,yx=yuux.

where y is the true response, and y^=wTx+b is the predicted response for a feature vector x given model parameters w and b.

Part (a): Compute the Gradient Find the gradient of the loss function with respect to w and b.

Part (b): Implement Gradient Descent Using your result from Part (a), write the update rules for **gradient descent** and implement the iterative optimization process.

Solution

Step 1: Computing the Gradient We differentiate the loss function:

l(y,y^)=1+(y^y)21.

Differentiating with respect to w and b, we obtain:

wl=(y^y)x1+(y^y)2

bl=y^y1+(y^y)2

Step 2: Gradient Descent Update Rules We update the parameters using gradient descent:

wt+1=wtηwl

bt+1=btηbl

where η is the learning rate.

Step 3: Algorithm Implementation

Initialize w, b randomly
Set learning_rate η
For t = 1 to max_iterations:
    Compute predicted value: y_hat = w^T * x + b
    Compute gradients:
        grad_w = ((y_hat - y) / sqrt(1 + (y_hat - y)^2)) * x
        grad_b = (y_hat - y) / sqrt(1 + (y_hat - y)^2)
    Update parameters:
        w = w - η * grad_w
        b = b - η * grad_b
    Check for convergence


Exercise 3.13

Level: ** (Difficult)

Exercise Types: Novel

Question

Consider training a deep neural network with momentum-based SGD on a quadratic approximation of the loss near a local minimum, L(θ)=12θH,θ, where H is the Hessian. Explain how the momentum term modifies the effective condition number of H, and why this can speed convergence in directions with small curvature while controlling overshoot in directions with large curvature. Provide a brief analysis of the discrete iteration dynamics that illustrates this effect.

Solution

Let θt be the parameters at iteration t, and vt be the velocity term. The momentum-based SGD updates for a quadratic loss can be written as:

vt+1=βvt+ηHθt,θt+1=θtvt+1,

where β is the momentum coefficient and η is the learning rate.

In the eigenbasis of H, let λi be an eigenvalue and ui the corresponding eigenvector.

Projecting the iteration onto the direction ui yields a scalar recurrence of the form:

θt+1(i)=θt(i)[βvt(i)+ηλiθt(i)].

Because vt(i) itself depends on past gradients, the combined effect of β and η,λi modifies the “effective” eigenvalue seen in that direction. Specifically:

Small λi (Flat Directions)

When λi is small, repeated gradient directions are reinforced by β, accelerating convergence compared to vanilla SGD. Effectively, momentum increases the update step in directions that change slowly.

Large λi (Steep Directions)

If λi is large, the term β,vt(i) moderates the sudden jumps, helping to avoid overshooting. The velocity “remembers” past updates, dampening abrupt swings caused by steep curvature.

Overall, momentum alters the eigenvalues of H into a more favorable spectrum, reducing the effective condition number. In practice, this translates into faster convergence along flat directions and controlled progress in steep directions, both of which are crucial in the highly non-convex landscapes typical of deep neural networks.

Exercise 3.14

Level: * (Easy)

Exercise Types: Novel

Question

Perform one step of backpropagation for the following network:

  • Input layer: 2 neurons
  • Hidden layer: 2 neurons
  • Output layer: 1 neuron
  • Activation function: sigmoid
  • Weight matrix between the input and hidden layer: W1=[0.40.20.60.3]
  • Weight matrix between the hidden layer and output layer: W2=[0.50.3]
  • Input:X=[0.50.1]
  • Target output: y = 0.8
  • Learning rate: η = 0.1

Solution

Step 1: Forward Pass

Hidden Layer Outputs

a1=0.40.5+(0.20)0.10=0.18

z1=σ(a1)=11+e0.180.545

a2=0.50.6+0.30.1=0.33

z2=σ(a2)=11+e0.330.582

Output Layer

a3=0.5(0.545)+(0.3)0.582=0.0979

y^=σ(a3)=11+e0.09790.5245

Step 2: Compute Error

L=(y^y)2=(0.52450.8)20.0759

Step 3: Backpropagation

Gradients for Output Layer

δ3=2(y^y)=0.2755

Update weights for hidden-to-output layer:

W2[1]=W2[1]ηδ3z1=0.50.1(0.2755)0.545=0.515 W2[2]=W2[2]ηδ3z2=0.30.1(0.2755)0.582=0.284

Gradients for Hidden Layer

δ1=σ(a1)δ3W2[1]=0.545(10.545)(0.2755)0.5=0.0342

δ2=σ(a2)δ3W2[2]=0.582(10.582)(0.2755)(0.3)=0.0201

Update weights and bias for input-to-hidden layer:

W1[11]=W1[11]ηδ1X[1]=0.40.1(0.0342)0.5=0.4017

W1[12]=W1[12]ηδ1X[2]=0.20.1(0.0342)0.1=0.1997

W1[21]=W1[21]ηδ2X[1]=0.60.10.02010.5=0.5990

W1[22]=W1[22]ηδ2X[2]=0.30.10.02010.1=0.2998


Exercise 3.15

Level: ** (Moderate)

Exercise Types: Modified (Based on ME 780 Assignment 2, University of Waterloo, Fall 2024 - in the assignment, backpropogation was programmed for a 2D vector field with a deeper network using MATLAB not Python. This was modified to use Python with a simpler network as an easier exercise to understand backpropogation. A sigmoid activation function is used rather than tanh)

References:

A. Ghodsi, STAT 940 Deep Learning: Lecture 3, University of Waterloo, Winter 2025.

W. Melek, ME 780 Computational Intelligence Chapter 6 Neural Network Parameter Learning Algorithms Course Notes, University of Waterloo, Fall 2024

Question

Define a function f(x)=x2 on the domain (0,1).

Develop a 3 layer feedforward neural network with 10 neurons in the second layer to predict the output of this function. Use a sigmoid activation function for the hidden layer, and a linear activation function for the output layer.

Manually code backpropogation to learn the weights for this network using Python.

Use stochastic gradient descent, as discussed in Lecture 3 of STAT 940.

Solution

import numpy as np
import matplotlib.pyplot as plt

x = np.linspace(0,1,50).reshape(50,1)
y = x**2

#number of neurons in hidden layer

#Define a matrix with the weights and biases for the hidden layer
w_1 = np.random.rand(10,1) #10 is the number of neurons in the hidden layer, 1 is the number of neurons in the input layer
b_1 = np.random.rand(10,1) 

#define a matrix with weights for the output layer
w_2 = np.random.rand(1,10) #1 is the number of neurons in the output layer, 10 is the number of neurons in the hidden layer
b_2 = np.random.rand(1,1)

#Sigmoid function in Python credit https://stackoverflow.com/questions/60746851/sigmoid-function-in-numpy
def sigmoid(z):
    return 1/(1 + np.exp(-z))

def nn_output(w_1,b_1,w_2,b_2,x):
    
    hidden_layer_output = sigmoid(np.matmul(w_1,np.transpose(x)) + b_1)
    
    return (np.matmul(w_2,hidden_layer_output) + b_2), hidden_layer_output

#Plot the desired function and initial neural network output before training
plt.figure(1,figsize=(7,6))
plt.plot(x,y)
plt.plot(x,nn_output(w_1,b_1,w_2,b_2,x)[0].flatten())
plt.title('Neural Network Output Before Training')
plt.legend(['Desired Function','Neural Network Output'])
plt.show()

learning_rate = 0.1

x2 = np.linspace(0,1,50)

#Do 1000 epochs
for i in range(1000):
    
    #shuffle x2 for each epoch
    np.random.shuffle(x2)    
    
    #For each epoch, do stochastic gradient descent, looping through each element in x
    for j in range(x2.shape[0]):

        #Evaluate the neural network output at x to get the error of the output
        y_nn = nn_output(w_1,b_1,w_2,b_2,x2[j].reshape(1,1))
        
        #Update the weights and bias in the output layer
        
        #Note - these equations for the output layer only work for a linear activation function, otherwise you'd have to use the chain rule
        #delta is the error in the output
        delta_output = (x2[j]**2 - y_nn[0])
        #Bias update is previous bias + learning rate * delta
        b_2 = b_2 + learning_rate*delta_output
        #Weight update is previous weight + learning rate * delta * input (input is the hidden layer neuron output)
        w_2 = w_2 + np.matmul(learning_rate*delta_output,np.transpose(y_nn[1]))
        
        #Update the weights and bias in the hidden layer
        #Note that the derivative of the sigmoid function is f'(x) = y(1-y)
        delta_hidden = (y_nn[1])*np.matmul(np.transpose(w_2),delta_output)
        #Bias update is same like above
        b_1 = b_1 + learning_rate*delta_hidden
        #Weight update is same like above
        w_1 = w_1 + learning_rate*np.matmul(delta_hidden,x2[j].reshape(1,1))
        
#Plot the desired function and initial neural network output after training
plt.figure(1,figsize=(7,6))
plt.plot(x,y)
plt.plot(x,nn_output(w_1,b_1,w_2,b_2,x)[0].flatten())
plt.title('Neural Network Output After Training')
plt.legend(['Desired Function','Neural Network Output'])
plt.show()


Neural Network Output Before Training


Neural Network Output after Using Backpropogation for Training



Exercise 3.16

Level: * (Moderate)

Exercise Types: Copied

Reference: Calin, Ovidiu. Deep learning architectures: A mathematical approach. Springer, 2020

This question is from exercise 6.6.9 on page 198.

Question

Consider a one-hidden layer neural network with sigmoid neurons in the hidden layer. Given that the input is normally distributed, XN(0,1), and the output is Y=i=1Nαiσ(wiX+bi). Show that Var(Y) is approximately iσ(bi)2αi2wi2.

Solution

The variance of Y is given by Var(Y)=Var(i=1Nαiσ(wiX+bi))

Since the σ(wiX+bi) terms are not independent, it can be hard to decompose. However, we can use a linear approximation as follows for small values wiX around bi:

σ(wiX+bi)σ(bi)+σ(bi)wiX

Therefore, we have Var(Y)Var(i=1Nαi(σ(bi)+σ(bi)wiX))=Var(i=1Nαiσ(bi)wiX)=(i=1Nαiσ(bi)wi)2 since XN(0,1)

This is approximately equal to iσ(bi)2αi2wi2 if we ignore the cross terms. Note that the squared terms dominate the cross terms since the squared terms are always positive, and we assume weights are small.



Exercise 3.17

Level: * (Moderate)

Exercise Types: Modified

Question

Consider the loss function Q(w)=w2+3w+5.

Compute the gradient of Q(w). Starting from w0=2, perform three iterations of stochastic gradient descent using a learning rate ρ=0.15. Explain how the choice of ρ influences the stability and speed of convergence for this loss function.

Solution

Compute the gradient of Q(w): Q(w)=ddw(w2+3w+5)=2w+3

At w0=2: Q(w0)=2(2)+3=4+3=1 Update w: w1=w0ρQ(w0)=20.15(1)=2+0.15=1.85

At w1=1.85: Q(w1)=2(1.85)+3=3.7+3=0.7 Update w: w2=w1ρQ(w1)=1.850.15(0.7)=1.85+0.105=1.745

At w2=1.745: Q(w2)=2(1.745)+3=3.49+3=0.49 Update w: w3=w2ρQ(w2)=1.7450.15(0.49)=1.745+0.0735=1.6715

Effect of ρ: With ρ=0.15, the convergence is stable, but it might require more iterations for steeper gradients. A smaller ρ (e.g., ρ=0.05) would slow down the updates, increasing the number of iterations required to reach the minimum. A larger ρ (e.g., ρ=0.5) could lead to overshooting or divergence, especially near sharp curvatures in the loss function.


Exercise 3.18

Level: * (Easy)

Exercise Types: Novel

Question

In a feedforward neural network, explain why introducing more hidden layers can potentially improve the network's capacity to model complex functions. However, why might adding too many hidden layers degrade the model's performance or make training difficult?

Solution

Adding more hidden layers increases the expressive power of the network, enabling it to approximate more complex functions. This stems from the Universal Approximation Theorem, which states that a sufficiently large feedforward neural network with non-linear activation functions can approximate any continuous function on a compact subset of n. Each additional layer allows the network to learn and represent features at different levels of abstraction, with earlier layers capturing simpler patterns and deeper layers identifying more complex relationships.

However, adding too many hidden layers introduces several challenges:

  • Vanishing/Exploding Gradients: During backpropagation, the gradients of the loss function with respect to weights in earlier layers can diminish (vanishing) or grow uncontrollably (exploding). This makes it difficult to update weights effectively and slows down or destabilizes training.
  • Overfitting: Excessively deep networks with many parameters are prone to overfitting, especially if the training data is insufficient or noisy. The network may memorize the training data instead of generalizing well to unseen data.
  • Computational Cost: Deeper networks require more computation, leading to longer training times and higher resource demands, which might be inefficient for certain applications.
  • Optimization Challenges: Deep networks create highly non-convex loss landscapes, increasing the risk of getting stuck in poor local minima or saddle points, making convergence to a good solution more challenging.
  • Diminishing Returns: Beyond a certain depth, additional layers may no longer contribute significantly to the network's ability to learn, resulting in wasted computational resources.



Exercise 3.19

Level: * (Easy)

Exercise Types: Modified

References: Calin, Ovidiu. Deep learning architectures: A mathematical approach. Springer, 2020, Exercise 4.17.2, Page 130.

Question

Consider the quadratic function Q(x)=12xTAxbx, with A nonsingular square matrix of order n.

(1) Find the gradient.

(2) Write down the update equation using standard gradient descent and momentum

Solution

(1) Q(x)=Axb

(2) Update equation given by gradent descent

xt+1=xtρQ(xt)=xtρ(Axtb)=(IρA)xt+ρb

Update equation given by momentum vt+1=βvt+(1β)Q(x)=βvt+(1β)(Axtb)

xt+1=xtρvt+1=(Iρ(1β)A)xtρβvt+ρ(1β)b

Exercise 3.20

Level: * (Easy)

Exercise Types: Novel

Question

Consider a simple feedforward neural network with one hidden layer. The network takes an input vector x=[x1,x2,...,xn], passes it through a hidden layer with activation function σ, and produces an output ypred via a linear output layer.

The architecture of the network is as follows:

  • Input Layer: x=[x1,x2,...,xn]
  • Hidden Layer: h=σ(W1x+b1), where W1Rm×n and b1Rm are the weights and bias of the hidden layer,
  • Output Layer: ypred=W2h+b2, where W2R1×m and b2R are the weights and bias of the output layer.

Given the mean squared error (MSE) loss function: L=12(ytrueypred)2 where ytrue is the true target value.

Derive the backpropagation equations for updating the weights W1,W2 and biases b1,b2 using gradient descent.

Solution

Step 1: Gradients with respect to W2 and b2

The predicted output ypred is given by: ypred=W2h+b2

The derivative of the loss function with respect to ypred is: Lypred=(ytrueypred)

Now, compute the gradient of the loss with respect to W2 and b2:

For W2: LW2=LypredypredW2=(ytrueypred)h

For b2: Lb2=Lypredypredb2=(ytrueypred)

Step 2: Gradients with respect to W1 and b1

Next, we compute the gradients with respect to the hidden layer parameters.

The hidden layer activation is: h=σ(W1x+b1)

Using the chain rule, we first compute Lh: Lh=Lypredypredh=(ytrueypred)W2

Then, we compute the gradient with respect to W1 and b1:

For W1: LW1=LhhW1=(ytrueypred)W2σ(W1x+b1)xT

For b1: Lb1=Lhhb1=(ytrueypred)W2σ(W1x+b1)

Step 3: Update Equations

Using the gradients derived above, the updates for the weights and biases using gradient descent are:

For W2: W2(t+1)=W2(t)ηLW2

For b2: b2(t+1)=b2(t)ηLb2

For W1: W1(t+1)=W1(t)ηLW1

For b1: b1(t+1)=b1(t)ηLb1

Where η is the learning rate.


Exercise 3.21

Level: ** (Moderate)

Exercise Types: Novel

Question

There are many choices of activation functions in Feedforward Neural Networks, such as the sigmoid functions and hyperbolic tangent. This question considers other possibilities.

(a) Suppose a and b are constants. Is atanh(bx) a good candidate? (b) Is sin(x) a good activation function?

Solution

(a) It could be a good candidate, but the main effect would be similar to tanh(x). The addition of constants can scale the intermediate values within the networks and therefore can affect the convergence rate, akin to the effect of batch normalization.

(b) It may not be a good choice of activation function. Although it introduces nonlinearities in the training, the periodicity also introduces many local minimum, exacerbating the issue of escaping local minima.

Smaller mini-batch size outperforms larger mini-batch size when we need to deal with highly non-convex optimization problems where escaping local minima is prioritized. Nevertheless, it may cause the model not to converge effectively as one of the drawbacks.

Exercise 3.22

Level: * (Easy)

Exercise Types: Novel

Question

Assume you are training a nerual network model with gradient decent. There is a dataset with 1000 samples.

1. If you choose a mini-batch size of 100, how many times will the weights be updated during training?

2. If the mini-batch size is 50, how will the number of updates change? Why?

Solution

1. The dataset has 1000 samples, and each mini-batch has 100 samples. Thus, the number of weight updates will be:

1000100=10 updates.

2. If the mini-batch size is 50, the number of weight updates will be:

100050=20 updates.

Therefore, the number of updates increases, and asmaller mini-batch results in more frequent updates, but each update involves fewer sample.

Exercise 3.23

Level: ** (Moderate)

Exercise Types: Novel

Question

Given a simple linear regression model y = w x + b and a single training example (x=2,y=4), show how to perform one Stochastic Gradient Descent update step for w and b. Suppose: w=1,b=0,L=12(ypredy)2,η=0.1.

Solution

ypred=wx+b=12+0=2,error=ypredy=24=2,Lw=(ypredy)x=(2)2=4,Lb=(ypredy)=2,wnew=wηLw=10.1(4)=1.4,bnew=bηLb=00.1(2)=0.2.

Exercise 3.24

Level: ** (Moderate)

Exercise Types: Modified

References: Deep Learning - Foundations and Concepts, by Christopher M. Bishop and Hugh Bishop, Exercise 7.1, Page 212.

Question

Prove that the Stochastic Gradient Descent (SGD) algorithm reduces the value of the objective function Q(w), where Q(w) is differentiable, and its gradient satisfies Q(w). The goal of the proof is to show that for a sufficiently small learning rate η, the weight update rule: wt+1=wtηQ(wt) ensures that the objective function Q(w) decreases monotonically.

Solution

1. Change in the Objective Function:

The change in the objective function value can be expressed as:

Q(wt+1)Q(wt)

Using the first-order Taylor expansion of Q(w), we can approximate it as:

Q(wt+1)Q(wt)+Q(wt)T(wt+1wt)

2. Substitude the update rule: Substituting the weight update rule wt+1=wtηQ(wt), we get:

Q(wt+1)Q(wt)ηQ(wt)TQ(wt)

3. Gradient Property:

The quadratic term involving the gradient can be written as:

Q(wt)TQ(wt)=Q(wt)2

Therefore, Q(wt+1)Q(wt)ηQ(wt)2

4. Conclusion:

Since the learning rate η>0andQ(wt)20,

we have: Q(wt+1)Q(wt)0.

As long as the learning rate η is sufficiently small, the objective function Q(w) will decrease monotonically, and SGD will converge to a local minimum of Q(w).

This proof shows that with an appropriately chosen learning rate, SGD guarantees a reduction in the objective function at each step, making it a reliable optimization method for machine learning tasks.

Exercise 3.25

Level: ** (Moderate)

Exercise Types: Modified (Reference: Probabilistic Machine Learning: An Introduction, 13.2.3 Activation Functions)

Question

Consider a single-layer neural network with the ReLU activation function defined as: ReLU(x)=max(0,x).

Given a weight matrix W, an input vector x, and a bias b, the output of the layer is: h=ReLU(Wx+b).

Let: W=[1230], x=[21], b=[13].

1. Compute the output h of the layer.
2. Derive the gradient of the ReLU activation for the given x and explain how it behaves for positive and negative values of the input.

Solution

1. The output is computed as: h=ReLU(Wx+b), where: Wx=[1230][21]=[1(2)+(2)(1)3(2)+0(1)]=[2+26+0]=[46].

Adding the bias: Wx+b=[46]+[13]=[53].

Applying ReLU: h=ReLU([53])=[max(0,5)max(0,3)]=[53].

2. Gradient of ReLU:

The derivative of ReLU is defined as: ReLU(x)={1if x>0,0if x0.

For example take x=[21]: Then 2>0, the gradient is 1. 10, the gradient is 0.

Hence, the gradient of ReLU activation behaves as a binary switch, passing gradients only for positive values of the input and blocking gradients for non-positive values.


Exercise 3.26

Level: ** (Moderate)

Exercise Types: Novel

Question

Given a single-layer neural network with a sigmoid activation function used for binary classification, the network is trained using stochastic gradient descent (SGD) with the cross-entropy loss function:

L=[ylog(y^)+(1y)log(1y^)],

where y is the binary label (0 or 1) and y^ is the predicted probability.

Assuming the input vector x=[0.5,1.2,0.3], label y=1, and learning rate η=0.01, derive and apply the SGD update rules for a single training instance. Include calculations for the weights and bias from initial random values.

Solution

1. **Forward Pass Calculation:** Calculate the output before activation, z, by z=wx+b where initial weights w=[0.2,0.1,0.1] and bias b=0.01. Then apply the sigmoid function to obtain the predicted probability y^=11+ez.

2. **Loss and Gradient Calculation:** Calculate the loss using the cross-entropy formula. Derive the gradients with respect to y^ as Ly^=[y1y^(1y)11y^] and chain it to get Lz=y^y.

3. **Update Weights and Bias:** Use the gradient and learning rate to update each weight wi and the bias b: wi=wiηLzxi, b=bηLz.

For example, the weight update for w1 would be: w1=0.20.01(y^1)0.5, and similarly for other weights and bias.

Exercise 3.27

Level: * (Easy)

Exercise Types: Novel

Question

Consider the following two optimization update rules:

Standard Gradient Descent (GD): wt+1=wtρQ(wt)

Momentum-Based Update: vt+1=βvt+(1β)Q(wt), wt+1=wtρvt+1

Explain the key differences between standard gradient descent and the momentum-based update in terms of:

1) How the gradient information is used.

2) The behaviour of the optimization process, particularly in flat regions and regions with high curvature.

3) The convergence speed to the minimum.

Solution

Gradient Information Usage:

Standard Gradient Descent: Each update is based solely on the current gradient Q(wt). It does not account for the gradients from previous steps.

Momentum: Uses a running average of past gradients, vt, to smooth out updates. This accumulates past gradient information, making the optimization less sensitive to short-term noise in the gradient.

Behaviour in Flat and High-Curvature Regions:

Standard Gradient Descent: Progress in flat regions (e.g., plateaus or saddle points) is slow since updates rely only on the small gradients at each step. In high-curvature regions, it may oscillate across the curvature due to abrupt changes in gradient direction.

Momentum: Momentum accelerates progress in flat regions by building up velocity from consistent gradients, preventing you from getting stuck in a flat region. It also reduces oscillations in high-curvature regions by smoothing out the updates, leading to more stable convergence.

Convergence Speed:

Standard Gradient Descent: Typically slower, especially in scenarios where gradients are small or noisy, as it lacks the mechanism to "remember" past gradients.

Momentum: Often converges faster, especially when β is tuned appropriately. The accumulated velocity helps overcome small local minima and speeds up optimization in flat regions.

Exercise 3.28

Level: ** (Moderate)

Exercise Types: Novel

References: Adapted from Hastie, T., Tibshirani, R., & Friedman, J. (2021). The Elements of Statistical Learning, pages 174-180.

Question

(a) Starting with the given smoothing matrix formulation for the Reinsch form: \[ S_\lambda = N(N^T N + \lambda \Omega_N)^{-1}N^T, \] derive the simplified Reinsch form under the assumption that \( N \) is invertible. Show step-by-step how this leads to: \[ S_\lambda = (N^{-T}(N^T N + \lambda \Omega_N)N^{-1})^{-1} = (I + \lambda N^{-T} \Omega_N N^{-1})^{-1}. \]

(b) Discuss how wavelet smoothing can be applied to feedforward neural networks to help manage overfitting, especially in scenarios where the data is highly noisy. How does introducing the smoothing parameter \( \lambda \) and the penalty matrix \( \Omega_N \) affect the generalization ability of the neural network model?

Solution

Part (a) Derivation

Given the matrix \( S_\lambda \) as defined above, start with the inner product and factor in the invertibility of \( N \): \[ S_\lambda = N(N^T N + \lambda \Omega_N)^{-1}N^T. \] Assuming \( N \) is invertible, we have: \[ S_\lambda = N^{-T}(N^T N + \lambda \Omega_N)N^{-1}. \] This can be further simplified to: \[ S_\lambda = (I + \lambda N^{-T} \Omega_N N^{-1})^{-1}, \] where \( I \) denotes the identity matrix.

Part (b) Application to Neural Networks

In feedforward neural networks, overfitting is a significant challenge when dealing with complex models and noisy data. Wavelet smoothing, applied through the Reinsch form, offers a method to control model complexity by smoothing the learned functions.

The matrix \( N \) typically represents the network's weight matrix, and \( \Omega_N \) acts as a regularization term that penalizes the weight configurations based on their complexity. The smoothing parameter \( \lambda \) adjusts the trade-off between the training data's fidelity and the solution's smoothness.

By incorporating the Reinsch form into the network's training process, the effective degrees of freedom are reduced, leading to smoother function estimates. This reduction helps prevent the network from capturing noise as signal, enhancing its ability to generalize from the training data to unseen data.

The mathematical formulation provided in the exercise guides the understanding of how different components of the regularization term and smoothing parameter interact to influence the network’s learning process, potentially improving prediction accuracy on new, unseen data.

Exercise 3.29

Level: * (Easy)

Exercise Types: Modified - Problem 3.16, Prince, Simon JD. Understanding Deep Learning. MIT Press, 2023

Question

Draw a fully-connected neural network with 2 inputs, 3 hidden units in the first hidden layer, 2 hidden units in the second hidden layer, and 2 outputs. Then, write out the general equations for each layer (i.e. h(1),h(2), and y), where σ is the activation function used for each layer.

Solution

Below is the drawing of the neural network:

Fully-Connected Neural Network Drawing for Exercise 3.29

Equations:

h(1)=σ(W(1)x+b(1))

h(2)=σ(W(2)h(1)+b(2))

y=σ(W(3)h(2)+b(3))

Exercise 3.30

Level: ** (Moderate)

Exercise Types: Novel


Question

Suppose f:RnR is differentiable, convex, and L-smooth. Suppose we are given a starting point x0. Assume that there exists an r such that {xRn:f(x)f(x0)}B(0,r).

(a) Show that f has a minimizer x.

Proof. Let f:RnR be differentiable, convex, and L-smooth. Differentiability implies f is continuous and convexity of f implies that any local minima is a global minima for f. Thus it is enough to show that there exist local minima. By hypothesis, there exists r such that S={xRn:xf(x0)}B(0,r).

S is bounded: By definition of a bounded set, a set AX is bounded if there exist aX and r>0 such that AB(a,r). Thus, by hypothesis S is bounded.

S is closed:} A function g:XY is said to be continuous if for every closed set VY, the inverse image g1(V)={xX:g(x)V} is also a closed subset of X. Since f is continuous, the pre-image of a closed set is closed. We set c=f(x0), then S=Sf(x0) is closed in Rn.

Now that we have S is bounded and closed, it follows from the \textit{Heine-Borel Theorem} that S is compact, and then by the \textit{Extreme-value Theorem} there exists xS such that f(x)f(x) for all xS. By convexity of f, we have that f(x)f(x) for all xRn, as needed.

(b) Show the following inequality: For any x such that f(x)f(x0), f(x)f(x)2rf(x).

Proof. Suppose f has a minimizer x and let f(x)f(x0). Since xS by definition, we use the sub-gradient inequality for convex functions: f(x)f(x)+f(x)T(xx) which implies: f(x)f(x)f(x)T(xx). Multiplying both sides by 1 gives: f(x)f(x)f(x)T(xx). Since f(x)f(x), we obtain: |f(x)T(xx)|0. Using the Cauchy-Schwarz inequality: f(x)f(x0)f(x)T(xx)f(x)xx. Applying the triangle inequality: xxx+x.

Since x,xSB(0,r), we have xr and xr. Thus,

f(x)f(x)f(x)(r+r)=2rf(x). This completes the proof.


Exercise 4.1

Level: * (Easy)

Exercise Types: Novel

Question

Explain why SURE is rarely used in large-scale deep learning in practice.

Solution

Note that to compute the model complexity part of the SURE estimator, we have to compute the divergence term:

2σ2i=1nDi

where

Di=f^i(y)yi

For modern deep learning frameworks, both the number of parameters (weights) and the number of data dimensions are huge (in million or billions). This makes the computation of the divergence term extremely expensive. Note that using stochastic gradient descent the estimation of the weights is the result of an iterative process. If we include an inner loop to compute all the divergence, the computation complexity is growing exponentially.

Additionally, the high-dimensional nature of deep learning models means that computing the divergence requires handling large matrices or tensors, making the task even more resource-intensive. Even though parallel computation techniques like GPU acceleration can reduce the time for individual gradient calculations, the divergence computation still adds significant overhead when applied across all data points and iterations. Moreover, the computational complexity becomes even more challenging when dealing with large-scale datasets and real-time training, where the time needed to calculate divergence can slow down the training process substantially. This makes methods like SURE impractical for real-time or large-scale applications compared to simpler and more efficient alternatives like cross-validation, which does not require computing high-dimensional divergence and is easy to implement, making it a more suitable approach in practice.

However, SURE gives very good insight about the behaviour of the true error, and the divergence term is considered a regularization term. For simpler models such as linear regression, the divergence term can be easy to compute, and perturbing a trained data point would not change the estimated function by much. However in more complex models such as deep learning frameworks, perturbing a trained data point can result in large changes in our estimated function, meaning that the divergence term will be larger. Often times, we add a regularization term to our loss function that mimics the behaviour of the divergence term, such that the loss function increases the more complex our model is. Techniques such as adding weight decay or penalties on gradient magnitudes are often used to improve generalization.

Additional Subquestion

Could we use SURE in a simplified or approximate way for deep learning models, perhaps by estimating only a subset of partial derivatives or using a smaller batch of data? What would be the potential trade-offs?

Solution for Additional Question

One possible approach to making SURE more tractable is to approximate the divergence term using a small subset of data points or partial derivatives. For instance: - **Subsampled Divergence**: Compute Di for only a small mini-batch of the dataset and use this to extrapolate the full divergence. - **Block-Diagonal or Low-Rank Approximation**: Instead of computing the full Jacobian, approximate it by a block-diagonal or low-rank structure, significantly reducing the computational cost.

However, these approximations introduce additional variance or bias into the divergence estimate. If the mini-batch is not representative, the divergence (and thus the SURE estimate) might be inaccurate. Although such tricks can offer partial relief, they still tend to be more computationally demanding than alternatives like cross-validation. As a result, most large-scale deep learning pipelines avoid SURE in favor of simpler, widely supported methods.

Exercise 4.2

Level: * (Easy)

Exercise Types: Novel

Question

Use SURE to analyze how the bias-variance tradeoff is reflected in the risk of an estimator. Consider two scenarios:

  • A high-bias, low-variance estimator (e.g., a constant estimate f^(y)=c for all y).
  • A high-variance, low-bias estimator (e.g., f^(y)=y).
  • For the estimator defined by the equation:

f^(y)=cy+d,

where c and d are constants:

a. Derive the divergence D(f^).,

b. Use the derived divergence to compute the SURE formula for the risk.

Show how the SURE formula quantifies the risk in both cases.

Solution

High-bias, low-variance estimator:

  • Since f^(y)=c, the divergence D(f^)=0 (no dependence on y).
  • The SURE risk simplifies to Risk=(cy)2+2σ20=(cy)2
  • The expected risk is influenced entirely by the choice of c relative to f (bias).

High-variance, low-bias estimator:

  • For f^(y)=y, the divergence D(f^)=1 (derivative of y w.r.t. itself is 1).
  • The SURE risk becomes Risk=|yy|2+2σ21=2σ2.
  • The risk reflects only the variance, as bias is negligible.

Divergence and SURE formula: a. The divergence is D(f^)=c because the derivative of cy+d with respect to y is c.

b. The SURE formula for the risk becomes:

Risk=E[(cy+dy)2]+2σ2c=E[(c1)2y2+2(c1)dy+d2]+2σ2c.


Exercise 4.3

Level: ** (Moderate)

Exercise Types: Novel

Question

How does SURE explain why cross-validation and regularization are effective for estimating true error?
Hint: Consider the cases when a data point is not in the training set and when it is included in the training set.

Solution

Let’s first recall the SURE (Stein's Unbiased Risk Estimate) formula:

E[(y0^y0)2]=E[(f0^f0)2]+E[ϵ02]2E[ϵ0(f0^f0)]

Case 1: Data Point Not in the Training Set

When the data point is not in the training set, the covariance term E[ϵ0(f0f0)] becomes zero, since the model does not have access to that particular point during training. This simplifies the formula to:

E[(y0^y0)2]=E[(f0^f0)2]+E[ϵ02]

Now, when summing over all m points, we obtain:

i=1m(yi^yi)2=i=1m(fi^fi)2+mσ2

Where σ2 is noise. The total error (Err) can be written as:

Err=errmσ2

Here, mσ2 is a constant, which means the true error differs from the empirical error by a constant value only. Therefore, the empirical error (err) provides a good estimate of the true error (Err) when the point is not in the training set.

This explains why cross-validation is effective. Cross-validation essentially evaluates the model on data points that were not part of the training set, and since the empirical error is only offset by a constant, it provides a reliable estimate of the true error.

Case 2: Data Point in the Training Set

When the data point is part of the training set, the covariance term E[ϵ0(f0f0)] is no longer zero. We have:

i=1m(yi^yi)2=i=1n(fi^fi)2+nσ22σ2i=1nDi

Where Di represents the bias introduced by the model. This equation can be further simplified to:

Err=errnσ2+2σi=1nDi

In this case, the additional term i=1nDi reflects the model’s complexity. The complexity term increases with the capacity of the model and is often difficult to calculate directly. To handle this, instead of directly calculating the complexity term, we can use a function that increases with respect to model capacity, and treat it as the regularization term. The regularization term penalizes model complexity to avoid overfitting, thus helping to prevent the model from fitting noise in the training set.

This explains the need for regularization techniques. Regularization helps to control model complexity and ensures that the model generalizes better to unseen data, improving the estimation of the true error.

Thus, both cross-validation and regularization are grounded in the same principle of improving the estimation of true error by adjusting for complexity and noise.

(Note: the formulas are all from Lecture 4 content, STAT 940)

Exercise 4.4

Level: ** (Moderate)

Exercise Types: Novel

Question

Assume there is a point set (xi,yi) satisfying yi=2xi+3sin(xi)+ni, where niN(0,4), for i = 1, 2, ...

Now we fit the relationship between y and x, using polynomial linear models with order from 1 to 10. Show the MSE of models of different complexity.

Solution

library(ggplot2)
x <- seq(0, 10, length.out = 100)
y <- 2 * x + 3 * sin(x) + rnorm(100, mean = 0, sd = 2)
data <- data.frame(x = x, y = y)

degrees <- 1:10
mse_values <- numeric(length(degrees))

for (i in seq_along(degrees)) {
  degree <- degrees[i]
  
  model <- lm(y ~ poly(x, degree), data = data)

  predicted <- predict(model, data)
  
  mse_values[i] <- mean((data$y - predicted)^2)
}

mse_results <- data.frame(Degree = degrees, MSE = mse_values)
print(mse_results)

ggplot(mse_results, aes(x = Degree, y = MSE)) +
  geom_line(color = "blue") +
  geom_point(size = 3, color = "red") +
  labs(title = "MSE vs. Model Complexity",
       x = "Polynomial Degree",
       y = "Mean Squared Error (MSE)") +
  theme_minimal()

ggplot(data, aes(x = x, y = y)) +
  geom_point(color = "black", alpha = 0.6) +
  geom_smooth(method = "lm", formula = y ~ poly(x, 1), color = "red", se = FALSE) +
  geom_smooth(method = "lm", formula = y ~ poly(x, 3), color = "blue", se = FALSE) +
  geom_smooth(method = "lm", formula = y ~ poly(x, 10), color = "green", se = FALSE) +
  labs(title = "Polynomial Regression Fits",
       x = "x",
       y = "y") +
  theme_minimal()

Output:


Additional Comment: This graph clearly shows the importance in choosing a good space for your model candidates. When allowing your model to have too much complexity, we see that there is not a lot of reduction in the MSE after 4 polynomial degrees. But there is a big difference from 3 to 4, so based on the graph, it would be best to pick the polynomial of degree 4 as the model as it performed good on the testing dataset while being more robust than models of higher polynomial order.

Exercise 4.5

Level: * (Easy)

Exercise Types: Novel

Question

Use the SURE equation to explain the difference of using data in the training dataset vs outside of the training dataset in estimating the true error using emperical error (of same size of dataset).

Answer

The Key is in the term 2σ2i=1nDi. There are overall 2 main terms that contributes to this value ---the model complexity and the variance of the error. If the variance is sufficiently small and the model complexity is not too large (i.e p<3), the difference between using training datapoints and using testing datapoints would not be as significant. Thus, if the complexity of the model is not very high (low Di) with low sample size, using the training dataset to estimate true error will not be extremely different from using a separate dataset.

When the model complexity increases (p become larger), the model becomes more sensitive to small changes in the training data. The sensitivity could be written as y^iyi. This derivative would be larger as it follows the training data, exaggerating the penalty term 2σ2i=1nDi in SURE.

Exercise 4.6

Level: * (Easy)

Exercise Types: Novel

Question

For a momentum factor β, explain the impact of increasing or decreasing β (e.g., β=0.9 vs. β=0.5) on the learning process.

Solution

The momentum factor β determines how much of the velocity contributes to the current step during gradient descent.

When β is high (e.g., β=0.9), momentum retains most of the previous velocity, resulting in smoother and more consistent updates. In situations where gradients do not change direction significantly, high β accelerates convergence as momentum accumulates in the correct direction. However, on highly non-convex surfaces or steep gradients, high β may cause oscillations or overshooting as the momentum term dominates gradient changes.

When β is low (e.g., β=0.5), the updates rely more heavily on the current gradient rather than accumulated momentum, which can introduce more noise into the updates. In flat regions or long valleys, low β leads to slower progress as previous updates fade quickly. However, a lower β adapts better to situations where the loss landscape changes direction frequently, reducing the risk of overshooting.

Exercise 4.7

Level: ** (Moderate)

Exercise Types: Novel

Question

Suppose we have a linear regression model y=Xβ+ε with εN(0,σ2I). We use a ridge estimator with penalty λ:

β^λ=(XX+λI)1Xy,y^λ=Xβ^λ. Write down the form of Stein’s Unbiased Risk Estimator (SURE) for this ridge estimator in terms of y^λ and the hat matrix. Briefly explain why the term involving the trace of the hat matrix Hλ adjusts for overfitting, and how that adjustment depends on λ. Describe how you would use SURE to select an optimal value of λ.

Solution

1. SURE for the Ridge Estimator Define the hat matrix for ridge regression as:

Hλ=X(XX+λI)1X,y^λ=Hλy. Stein’s Unbiased Risk Estimator (SURE) for this setting is:

SURE(λ)=yy^λ2+2σ2trace(Hλ). Here, |yy^λ|2 represents the (in-sample) residual sum of squares, and trace(Hλ) measures the effective degrees of freedom used by the ridge estimator.

2. Role of the Hat Matrix Trace

The matrix Hλ maps the observed data y to the fitted values y^λ. Its trace, trace(Hλ), indicates how sensitive the fitted values are to the observed data. Larger trace(Hλ) means the model is using more degrees of freedom and risks overfitting, causing the naive residual sum of squares |yy^λ|2 to underestimate true prediction error. As λ increases, the estimator shrinks coefficients more aggressively and trace(Hλ) typically decreases, reflecting a simpler (less flexible) model. 3. Using SURE to Select λ To choose an optimal λ from the perspective of unbiased risk estimation, one can:

Compute SURE(λ) over a grid of possible λ values. Select the λ that minimizes SURE(λ). Because SURE includes the penalty 2,σ2,trace(Hλ), it corrects for the bias introduced by fitting the same data used in the residual calculation. This makes SURE a more reliable guide to out-of-sample error than just looking at |yy^λ|2.

Exercise 4.8

Level: * (Easy)

Exercise Type: Novel

Question

You are tasked with understanding the Mean Squared Error (MSE) and its components: bias and variance, using the provided diagram as a reference.

Diagram for MSE calculation

Setup:
1. You have a true underlying function: f(x)=2x+3

2. A model is used to estimate f(x), given as: f^(x)=ax+b, where a and b are estimated from data.

3. Your model has the following properties:
- Expected estimate: E[f^(x)]=1.8x+2.5
- Variance: Var[f^(x)]=0.1 (constant for all x).

(a) Calculate the bias at x=2.

(b) Given that Var[f^(x)]=0.1, compute the Mean Squared Error (MSE) at x=2.

Solution

1. Bias Calculation:
The bias is defined as: Bias=E[f^(x)]f(x).

Substitute the values for f(x) and E[f^(x)] at x=2:

- f(2)=2(2)+3=7
- E[f^(2)]=1.8(2)+2.5=3.6+2.5=6.1.

Thus, Bias=E[f^(2)]f(2)=6.17=0.9.

2. Variance Contribution:
The variance is directly given as: Var[f^(x)]=0.1.

3. MSE Decomposition:
The Mean Squared Error (MSE) is defined as: MSE=Bias2+Var.

Substitute the values:
- Bias2=(0.9)2=0.81,
- MSE=0.81+0.1=0.91.

Final Answer:
- Bias: 0.9.
- Variance: 0.1.
- MSE: 0.91.

Exercise 4.9

Level: * (Easy)

Exercise Types: Novel

Question

Suppose you are developing a predictive model for house prices using a dataset with features like square footage, number of bedrooms, and location. You decide to compare three models with increasing complexity:

1. A simple linear regression model.

2. A polynomial regression model with degree 3.

3. A neural network with multiple layers.

Using Stein's Unbiased Risk Estimator (SURE), explain how you would determine which model is expected to generalize best to unseen data. Any practical challenges you might encounter?

Solution

Approach

1. For each model, compute the empirical error on the training data. For instance, compute the Mean Squared Error: err=1ni=1n(yiy^i)2.

2. Estimate σ2, analyze the variance of residuals from a simple baseline model like linear regression, which provides a good approximation of the noise in the data.

3. For each model, calculate the complexity term 2σ2i=1nDi, where Di=fi^yi

4. Compute the Stein's Unbiased Risk Estimator for each model by Err=errnσ2+2σ2i=1nDi

5. Compare the SURE values for the three models. The model with the lowest SURE is expected to generalize best to unseen data.

Practical Challenges

1. Using a simple model like linear regression might provide a biased estimate if the data is highly nonlinear. This will suggest an inaccurate variance σ2.

2. While SURE penalizes complexity, it may favor simpler models if the noise variance is high. However, overly simplistic models might underfit.

3. If the best model is neural networks, then it will be less interpretable in this case and calculating Di becomes computationally expensive.

4. For neural networks, estimating Di is challenging due to the model's intricate structure, lack of interpretability and prone to numerical instability.

Exercise 4.10

Level: ** (Moderate)

Exercise Types: Novel

Question

Derive Stein’s Unbiased Risk Estimator (SURE) for the training set and the testing set.

Solution

Notation

We have observations yi=f(xi)+εi where εiN(0,σ2) and f^(xi) is the model’s prediction at xi. We write y^i=f^(xi).

Test Data

For a test point (x0,y0) not used in fitting f^:

y^0y0=f^(x0)(f(x0)+ε0).

(y^0y0)2=(f^(x0)f(x0))2+ε022ε0(f^(x0)f(x0)).

f^(x0) is independent of ε0, E[ε0(f^(x0)f(x0))]=0

E[(y^0y0)2]=E[(f^(x0)f(x0))2]+σ2.

Summing over M test points:

i=1M(y^iyi)2=i=1M(f^(xi)f(xi))2+Mσ2.

Training Data

For a point (x0,y0) used in training, f^(x0) depends on y0. We have:

(y^0y0)2=(f^(x0)(f(x0)+ε0))2.

Define D0:=f^(x0)y0.

By Stein’s lemma,

E[ε0(f^(x0)f(x0))]=σ2E[f^(x0)ε0].

But f^(x0)ε0=f^(x0)y0, so E[ε0(f^(x0)f(x0))]=σ2E[D0].

E[(y^0y0)2]=E[(f^(x0)f(x0))2]+σ22σ2E[D0].

Summing over n training points:

i=1n(y^iyi)2=i=1n(f^ifi)2+nσ22σ2i=1nDi.

Exercise 4.11

Level: * (Easy)

Exercise Types: Novel

Question

How does the choice of momentum factor β influence the ability of gradient descent to escape saddle points or local minima during optimization?

Solution

The momentum factor β plays a significant role in determining how gradient descent navigates complex loss landscapes.

For reference, the formula for momentum-based SGD is as follows:

vt+1=βvt+ηΔWt,

where β is the momentum coefficient and η is the learning rate.

When β is high (e.g., β = 0.9), the optimizer builds up velocity over time, which helps push it through flat regions like saddle points more effectively. This accumulated momentum can prevent the algorithm from getting stuck in shallow local minima by carrying the updates forward despite weak gradients. However, in very sharp local minima, high β may cause overshooting, making it harder to settle at the true minima. When β is low (e.g., β = 0.5), the optimizer relies more on the current gradient, which reduces the accumulated velocity. While this makes the updates more adaptive to the local landscape, it also increases the likelihood of getting trapped in saddle points or small local minima, as the velocity is insufficient to escape flat or weak gradient regions.

Exercise 4.12

Level: * (Moderate)

Exercise Types: Novel

Question

Explain the key idea behind Stein's Unbiased Risk Estimator (SURE) and how it can be applied to choose an optimal parameter or model in high-dimensional estimation problems. Why is it preferred over traditional risk estimation methods in some scenarios?

Solution

Stein's Unbiased Risk Estimator (SURE) provides an unbiased estimate of the risk (expected squared error) of an estimator using only the observed data, without requiring knowledge of the true parameter. It is particularly useful in high-dimensional problems, where it balances bias and variance effectively, aiding in tasks like model selection and hyperparameter tuning for methods such as LASSO or ridge regression. SURE is computationally efficient, often providing closed-form expressions, and is preferred over traditional methods like cross-validation in scenarios with Gaussian noise and differentiable estimators. However, its applicability depends on specific assumptions (e.g., noise distribution and estimator smoothness), and it may not always perform well in small sample sizes or under non-standard conditions. In practice, SURE is widely used in signal processing, image denoising, and compressive sensing, where risk estimation plays a crucial role in optimizing model performance.

Exercise 4.13

Level: * (Easy)

Exercise Types: Novel

Question

In order for Stein's unbiased risk estimator to be useful, we need to figure out how to compute Di, which can be challenging. Then what is the advantage of SURE despite the challenge?

Solution

1. SURE is useful because it provides an unbiased estimate of the risk of an estimator without needing the true parameter. Typically, to evaluate the MSE of an estimator, you would need to know the true parameter value but SURE allows you to assess the performance of an estimator without this information.

2. Even if computing the sum of the partial derivatives directly is complex, SURE can be applied to compare different estimators. The goal is often to choose an estimator that minimizes the risk, so SURE helps identify more efficient estimators, especially in high-dimensional settings.

3. In many practical applications, it's not necessary to compute the exact sum of partial derivatives. Instead, we can approximate or use simplified models for the estimator and the data.

Exercise 4.14

Level: * (Easy)

Exercise Types: Novel

Question

Prove that MSE = Bias2+Var

Solution

Let f denote the true function, f^ denote the estimated function , x denote the data

MSE=E[(f(x)f^(x))2]=E[(f(x)E[f^(x)]+E[f^(x)]f^(x))2]=(f(x)E[f^(x)])2+(E[f^(x)]f^(x))2=Bias2+Var

where the second last equality comes from E[(f(x)E[f^(x)])(E[f^(X)]f^(x))]=E[f(x)E[f^(x)]f(x)f^(x)E[f^(X)]2+f^(x)E[f^(X)])]=f(x)E[f^(X)]f(x)E[f^(X)]E[f^(X)]2+E[f^(X)]2=0

Alternatively,

E[(f(x)E[f^(x)])(E[f^(x)]f^(x))]=(f(x)E[f^(x)])E[E[f^(x)]f^(x)]=(f(x)E[f^(x)])(E[E[f^(x)]]E[f^(x)])=(f(x)E[f^(x)])(E[f^(x)]E[f^(x)])=0,

since the bias (f(x)E[f^(x)]) is a constant.

Exercise 4.15

Level: ** (Moderate)

Exercise Types: Novel

Question

When applying numerical methods, it is essential to constantly remind ourselves of the assumptions behind the model. What are the assumptions of SURE required for SURE to provide an unbiased estimate of the true risk? How does it compare to cross-validation as a model selection technique?

Solution

Assumptions:

1. The noise follows a normal distribution with constant variance.

2. The response must be linearly related to the predictors.

3. The effective degrees of freedom must be correctly computed.

Comparisons with Cross-validation:

1. While the assumptions of SURE could be unrealistic to hold, cross validation may suffer from higher variance due to the random splitting.

2. SURE is computationally cheaper than cross validation.

3. Cross validation does not impose normality on the noise, giving a more general account.

Exercise 4.16

Level: * (Easy)

Exercise Types: Modified (Reference: Lecture 04)

Question

Suppose yN(θ,σ2I), where θRn is the true parameter, y is the observed data, and σ2 is the variance of the noise. Consider the following estimator for θ: θ^=ay, where aR is a scalar constant.

Derive the Stein's Unbiased Risk Estimator (SURE) for the estimator θ^.

Solution

The true risk is given by: R=E[θ^θ2]. Substituting θ^=ay and yN(θ,σ2I), we expand the risk: R=E[ayθ2]=E[a(yθ)+(a1)θ2].

Using E[yθ]=0 and E[yθ2]=nσ2, we get: R=a2E[yθ2]+(a1)2θ2=a2nσ2+(a1)2θ2.

To derive SURE, we estimate the true risk using: SURE=θ^y2+2σ2div(f), where f(y)=ay and div(f)=an because: fi(y)yi=afor all i.

First term: θ^y2=ayy2=(a1)2y2.

Therefore: SURE=(a1)2y2+2σ2na.

Exercise 4.17

Level: * (Easy)

Exercise Types: Novel

Question

Stein's Unbiased Risk Estimator (SURE) is often discussed in the context of its effectiveness in model selection. Explain how SURE can be used to select the best model from a set of candidates, specifically focusing on its capacity to balance model complexity against prediction error.

Solution

SURE is particularly valuable in model selection because it provides an unbiased estimate of the risk (expected prediction error) for different models, even without knowing the true underlying function. It does this by combining the empirical error (residuals) with a penalty proportional to the model's complexity.

For instance, if we have multiple regression models of varying complexity, SURE helps identify the model that optimally balances low empirical errors with manageable complexity. This is crucial because overly complex models might fit the training data very well (low empirical error) but perform poorly on new data due to overfitting. Conversely, overly simple models might not capture the necessary patterns in the data, leading to high empirical errors.

The SURE formula includes a term that adjusts the observed empirical error by adding a complexity penalty. This penalty is usually proportional to the trace of the hat matrix (a measure of leverage or influence of each observation in linear models), which scales with the flexibility or number of parameters in the model. By evaluating SURE for each model, we can choose the model that minimizes this unbiased estimate of the risk, thereby selecting the model with the best generalization performance expected on new, unseen data.

Exercise 4.18

Level: * (Easy)

Exercise Types: Novel

Question

Why Stein's Unbiased Risk Estimator (SURE) serves as a good regularization method?

Solution

SURE directly estimates the risk (mean squared error) of an estimator θ^. Thus, we can compare different estimators or penalization strategies by explicitly minimizing the estimated risk. By selecting the model or parameters that minimize the SURE criterion, we can effectively regularize the problem to achieve better generalization result. Moreover, it can handle high-dimensional problems because it takes Di into consideration.

Exercise 4.19

Level: ** (Moderate)

Exercise Types: Novel

References: Adapted from [Unsupervised Learning with Stein’s Unbiased Risk Estimator](https://arxiv.org/pdf/1805.10531).

Question

Critically evaluate the application of Stein's Unbiased Risk Estimator (SURE) for image denoising in scenarios where ground truth data is unavailable. Discuss the implementation of SURE within convolutional neural networks (CNNs) for image recovery, focusing on the use of the divergence term: \[ \text{div} \, \mathbf{J} = \operatorname{trace}(\nabla \mathbf{f}(\mathbf{x})) \] from the trace of the Jacobian matrix of the estimator with respect to observed data. Explain how this approach, as explored in the referenced paper, assists in parameter optimization and mitigates the challenges posed by the absence of clean reference images.

Solution

The paper implements Stein's Unbiased Risk Estimator (SURE) for unsupervised image denoising, demonstrating its practical use in settings devoid of ground truth data. SURE estimates the risk associated with a denoising estimator by leveraging the formula: \[ \text{SURE} = \sigma^2 \left( n - 2\operatorname{trace}(\nabla \mathbf{f}(\mathbf{x})) \right) + \| \mathbf{y} - \mathbf{f}(\mathbf{x}) \|^2 \] where \( \mathbf{y} \) is the observed noisy image, \( \mathbf{f}(\mathbf{x}) \) is the denoised output, and \( \sigma^2 \) is the noise variance. This approach allows for the optimization of CNN parameters so that the model self-evaluates its performance based on the observed data alone, enhancing its ability to generalize better from noisy observations to cleaner reconstructions.

Exercise 4.20

Level: * (Easy)

Exercise Types: Novel

References:

A. Ghodsi, STAT 940 Deep Learning: Lecture 4, University of Waterloo, Winter 2025.

Question

In STAT 940 Lecture 4, it was shown that the expectation E[(N(0,σ2))2]=σ2

Using Python and NumPy, randomly sample a large number of randomly generated gaussian samples with a mean of 0 and a randomly generated variance to numerically demonstrate that this expectation is indeed true

Solution

import numpy as np
import matplotlib.pyplot as plt

#Generate a random variance
std = np.random.rand()

#Generate 1000 random number with a mean of 0 and a standard deviation of std
sampled_gaussian_numbers = np.random.normal(0, std, 1000)

#Plot a histogram of the sampled numbers
plt.figure(1, figsize=(8, 6))
plt.hist(sampled_gaussian_numbers, bins=30)
plt.title("Histogram of gaussian samples, mean = 0, std = " + str(np.round(std, 3)))
plt.show()

#Calculate the expectation value of the sampled numbers squared
expectation = np.mean(sampled_gaussian_numbers**2)

print("The randomly generated variance is: ", std**2)
print("The expectation of the randomly generated gaussian samples squared is: ", expectation)


Sample Histogram of Randomly Sampled Gaussians in Python


Sample output of gaussian variance and computed expectation of randomly generated gaussian samples squared


Exercise 4.21

Level: * (Easy)

Exercise Types: Novel

Definition: Given a matrix M and vector v we often define a feature map F:RnRm as one of the following:

  • F(x)=Mx+v
  • F(x)=Mx (Here is convolution)
  • F(x)=M,v (M can be replaced by a vector.)

Definition: Let f be a real valued function defined on E, then f is is Lipschitz if exists L0 such that f(x)f(y)Lxy for all x,yE.

Question

Show that each feature map is Lipschitz.

Proof

There are three cases:

Case 1: Using linearity of multiplication and the Cauchy-Schwartz Inequality, we obtain: F(x)F(y)=Mx+v(My+v)=M(xy)Mxy

Case 2: Using linearity of convolution operator (proof is trivial we leave it as an exercise for the reader) then we obtain: F(x)F(y)=MxMy=M(xy)Mxy

Case 3: Using linearity of the inner product and the Cauchy-Schwartz Inequality for norms, we obtain: F(x)F(y)=M,xM,y=M,xyMxy

Exercise 5.1

Level: * (Easy)

Exercise Type: Novel

Question

1) Which of the following options can be used to regularize an MLP (choose all that apply)?

a) Add noise to data
b) Use full batch gradient descent
c) Add dropout
d) Use early stopping

2) Using Stochastic Gradient Descent with a small minibatch when training an MLP helps with generalization:

a) True
b) False

3) Explain why adding noise to the input data helps improve generalization in a neural network.

Solution

1) The correct answers are a), c), and d).
- a) Adding noise to data is a regularization technique that can improve generalization by forcing the model to learn robust patterns. Types of noise used in MLPs include: input noise, weight noise, activation noise and dropouts.
- c) Dropout randomly deactivates neurons during training, reducing overfitting.
- d) Early stopping prevents overfitting by halting training once the validation error stops improving.

b) is incorrect because using full batch gradient descent does not help regularize the model.

2) The correct answer is a) True.
Using Stochastic Gradient Descent with a small minibatch size introduces noise into the optimization process, which can act as a form of regularization and improve generalization.

3) Explanation: Adding noise to the input data acts as a form of data augmentation. It forces the model to learn features that are robust to variations in the input, reducing reliance on specific details of the training data. This helps the network generalize better to unseen data, as it becomes more adaptable to small changes and less prone to overfitting.

Additional Note: One form of adding noise is through data smoothing. This ensures that the function is not overconfident on the objects that it was trained on.

Exercise 5.2

Level: * (Easy)

Exercise Type: Novel

Question

Derive the gradient of the loss function with respect to the weights w for the following regularized quadratic loss:

L(w)=12ni=1n(yiwTxi)2+λ2w2

where λ>0 is the regularization parameter.

Solution

The gradient of the loss function L(w) with respect to w can be computed as follows:

wL(w)=w(12ni=1n(yiwTxi)2)+w(λ2w2)

For the first term: w(12ni=1n(yiwTxi)2)=1ni=1n(yiwTxi)xi

For the second term: w(λ2w2)=λw

Combining both terms: wL(w)=1ni=1n(yiwTxi)xi+λw

Exercise 5.3

Level: ** (Moderate)

Exercise Types: Novel

Question

What are the mathematical formulas for Ridge Regression and Lasso Regression, including their respective penalty terms? Additionally, write a Python script that visualizes the effect of these regularization techniques on a selected loss function (e.g., Mean Squared Error) for a simple linear regression model. Once you have the graph, interpret the graph by explaining how the shapes show the differences between Lasso and ridge regression.

Solution

Ridge Regression and Lasso Regression are both forms of linear regression with regularization to prevent overfitting.

Ridge regression minimizes the following objective function:

β^=argminβi=1n(yiXiβ)2+λj=1pβj2


where:

  • yi are the target values,
  • Xi represents the input features,
  • β are the regression coefficients,
  • λ is the regularization parameter controlling the strength of the penalty.


The penalty term λj=1pβj2 ensures that coefficients are shrunk towards zero, reducing overfitting but not setting any coefficients exactly to zero. For small λ, model behaves closer to an unregularized model (like ordinary least squares); for larger λ, strong regularization can push model coefficients towards zero. Lasso may set some to exactly zero, while Ridge reduces the size but does not zero-out coefficients.


Lasso regression introduces an L1 penalty term:

β^=argminβi=1n(yiXiβ)2+λj=1p|βj|

where the L1 penalty term λj=1p|βj| encourages sparsity in the coefficients. Some coefficients will be set exactly to zero, making Lasso useful for feature selection.

Visualization
The following Python script visualizes the impact of Ridge and Lasso regularization by plotting the contours of the Mean Squared Error (MSE) loss function along with the constraint regions imposed by Ridge (L2 ball) and Lasso (L1 diamond):

import numpy as np
import matplotlib.pyplot as plt

# Define the loss function
def mse_loss(beta1, beta2):
    return beta1**2 + beta2**2  # Simplified MSE (for visualization)

# Generate grid for visualization
beta1_vals = np.linspace(-2, 2, 100)
beta2_vals = np.linspace(-2, 2, 100)
B1, B2 = np.meshgrid(beta1_vals, beta2_vals)
Loss = mse_loss(B1, B2)

# Plot contours of the loss function
plt.figure(figsize=(10, 6))
contour = plt.contour(B1, B2, Loss, levels=20, cmap='viridis')
plt.colorbar(contour)

# Plot Ridge constraint (L2 ball)
ridge_circle = plt.Circle((0, 0), radius=1.2, color='red', fill=False, linestyle='dashed', label="Ridge Constraint (L2)")

# Plot Lasso constraint (L1 diamond)
lasso_diamond = np.array([[1, 0], [0, 1], [-1, 0], [0, -1], [1, 0]]) * 1.2
plt.plot(lasso_diamond[:, 0], lasso_diamond[:, 1], 'b--', label="Lasso Constraint (L1)")

# Add constraints to the plot
ax = plt.gca()
ax.add_patch(ridge_circle)
plt.xlim(-2, 2)
plt.ylim(-2, 2)
plt.axhline(0, color='black', linewidth=0.5)
plt.axvline(0, color='black', linewidth=0.5)

# Labels and legend
plt.xlabel(r'$\beta_1$')
plt.ylabel(r'$\beta_2$')
plt.title("Effect of Ridge and Lasso Regularization on Loss Function")
plt.legend()
plt.grid(True)
plt.show()

Output:

1. Ridge Regression (L2) – Red Circle

   Ridge regression enforces a circular constraint on the coefficients (β1,β2β1​,β2​).
   The solution is found where the contours of the loss function (MSE) first touch this L2 constraint region.
   Since the constraint is smooth (no sharp corners), the coefficients are shrunk gradually towards zero but rarely exactly zero.
   This means Ridge keeps all features in the model but reduces their impact by shrinking their values.

2. Lasso Regression (L1) – Blue Diamond

   Lasso regression imposes a diamond-shaped constraint on the coefficients.
   The sharp corners of the L1 constraint (at the axes) make it more likely that the optimal solution lies exactly on one of these axes.
   This means Lasso sets some coefficients to exactly zero, effectively performing feature selection by eliminating less important variables.
   The reason for this behavior is that the contours of the loss function often first touch the constraint at the corners, leading to sparsity in the solution. 

Conclusion Ridge Regression (L2) shrinks coefficients continuously but keeps all variables. Lasso Regression (L1) forces some coefficients to exactly zero, performing automatic feature selection.

Exercise 5.4

Level: ** (Moderate)

Exercise Types: Novel

Question

Label smoothing modifies the standard one-hot ground truth labels in multi-class classification by assigning a small amount of probability mass to incorrect classes. Suppose we replace each one-hot label y with a “smoothed” label y~ that assigns 1α to the true class and α/(C1) to each of the other C1 classes, where C is the total number of classes and α is a small constant.

Write the modified cross-entropy loss using y~ and a predicted probability vector p. Explain how this modification helps reduce model overconfidence and potentially improves calibration. Give an example scenario (e.g., large-scale image classification) where label smoothing has been shown to be particularly beneficial.

Solution

Modified Cross-Entropy Loss Standard cross-entropy for one-hot labels y and predicted probabilities p is c=1Cyclogpc. With label smoothing, each target label becomes y~c. Hence, the loss is:

smooth=c=1Cy~clogpc,wherey~c={1α,for the correct class,αC1,for other classes. Reduction of Overconfidence and Improved Calibration

In a one-hot scheme, the model is strongly penalized if it does not put near-total probability mass on the correct class. Label smoothing distributes a fraction α of the probability across incorrect classes, preventing the model from becoming overly confident. By avoiding extreme outputs (probabilities close to 0 or 1), the model tends to produce more calibrated predictions, often generalizing better to unseen data. Example Scenario In large-scale image classification (e.g., ImageNet), label smoothing has demonstrated notable gains:

Models converge more smoothly, especially when data is abundant but still noisy in certain classes. Overconfidence is reduced, leading to improved validation accuracy and calibration metrics.

Exercise 5.5

Level: * (Easy)

Exercise Types: Modified

References: https://www.cs.toronto.edu/~lczhang/321/files/midterm_b.pdf

Question

Which of the following about weight decay is true?


(A) Including weight decay generally reduces the training cost.

(B) Weight decay directly penalizes large activations.

(C) Weight decay can help revive a “dead” or “saturated” neuron.

(D) Weight decay helps get out of saddle points.

Solution

C) Weight decay increases the training cost because there is an extra (positive) term in the training cost.Weight decay penalizes large weights and not activations. The choice of adding weight decay is independent of the choice of the optimizer. Weight decay can revive a “dead” neuron, but it does not help us get out of saddle points. Weight decay primarily regularizes weights and does not directly address saddle points. Techniques like momentum or adaptive gradients are more relevant for escaping saddle points.

Additional note: Dead/saturated neurons have activations that are always in the plateau area of the activation function (e.g. ReLU or sigmoid or tanh), caused by large (positive or negative) weights/biases. Weight decay reduces those parameters, so that the activations will not be consistently large. It might be useful to note that weight decay can be used in combination with various optimizers like SGD (Stochastic Gradient Descent), Adam, and RMSprop. While SGD can benefit from weight decay, optimizers like Adam and RMSprop with adaptive learning rates might help mitigate issues like saddle points and local minima, where weight decay alone might be insufficient.

Exercise 5.6

Level: ** (Moderate)

Exercise Types: Novel

Question

Train a neural network with both L2 regularization and early stopping on UCI dataset. Vary the regularization strength and patience, and observe how they interact to affect model generalization.

Solution

import torch
import torch.nn as nn
import torch.optim as optim
from sklearn.model_selection import train_test_split
from sklearn.datasets import load_diabetes
from sklearn.preprocessing import StandardScaler
from torch.utils.data import DataLoader, TensorDataset
import matplotlib.pyplot as plt

# Set device
device = torch.device("cuda" if torch.cuda.is_available() else "cpu")

# Load UCI dataset (using the diabetes dataset as an example)
data = load_diabetes()
X, y = data.data, data.target

# Standardize features
scaler = StandardScaler()
X = scaler.fit_transform(X)

# Split into training, validation, and test sets
X_train, X_temp, y_train, y_temp = train_test_split(X, y, test_size=0.3, random_state=42)
X_val, X_test, y_val, y_test = train_test_split(X_temp, y_temp, test_size=0.5, random_state=42)

# Convert data to PyTorch tensors
X_train_tensor = torch.tensor(X_train, dtype=torch.float32).to(device)
y_train_tensor = torch.tensor(y_train, dtype=torch.float32).view(-1, 1).to(device)
X_val_tensor = torch.tensor(X_val, dtype=torch.float32).to(device)
y_val_tensor = torch.tensor(y_val, dtype=torch.float32).view(-1, 1).to(device)
X_test_tensor = torch.tensor(X_test, dtype=torch.float32).to(device)
y_test_tensor = torch.tensor(y_test, dtype=torch.float32).view(-1, 1).to(device)

# Prepare DataLoader
train_loader = DataLoader(TensorDataset(X_train_tensor, y_train_tensor), batch_size=32, shuffle=True)
val_loader = DataLoader(TensorDataset(X_val_tensor, y_val_tensor), batch_size=32)
test_loader = DataLoader(TensorDataset(X_test_tensor, y_test_tensor), batch_size=32)

# Define neural network model
class SimpleNN(nn.Module):
    def __init__(self, input_dim):
        super(SimpleNN, self).__init__()
        self.fc1 = nn.Linear(input_dim, 64)
        self.fc2 = nn.Linear(64, 32)
        self.fc3 = nn.Linear(32, 1)
        self.relu = nn.ReLU()
    
    def forward(self, x):
        x = self.relu(self.fc1(x))
        x = self.relu(self.fc2(x))
        x = self.fc3(x)
        return x

# Training function with early stopping
def train_model(model, train_loader, val_loader, criterion, optimizer, num_epochs, patience):
    train_loss_history = []
    val_loss_history = []

    best_val_loss = float('inf')
    best_model_state = None
    patience_counter = 0

    for epoch in range(num_epochs):
        # Training phase
        model.train()
        train_loss = 0.0
        for X_batch, y_batch in train_loader:
            optimizer.zero_grad()
            y_pred = model(X_batch)
            loss = criterion(y_pred, y_batch)
            loss.backward()
            optimizer.step()
            train_loss += loss.item()
        train_loss /= len(train_loader)
        train_loss_history.append(train_loss)

        # Validation phase
        model.eval()
        val_loss = 0.0
        with torch.no_grad():
            for X_batch, y_batch in val_loader:
                y_pred = model(X_batch)
                loss = criterion(y_pred, y_batch)
                val_loss += loss.item()
        val_loss /= len(val_loader)
        val_loss_history.append(val_loss)

        # Early stopping
        if val_loss < best_val_loss:
            best_val_loss = val_loss
            best_model_state = model.state_dict()
            patience_counter = 0
        else:
            patience_counter += 1
            if patience_counter >= patience:
                print(f"Early stopping triggered at epoch {epoch+1}.")
                break

        print(f"Epoch {epoch+1}/{num_epochs}, Train Loss: {train_loss:.4f}, Val Loss: {val_loss:.4f}")

    # Load the best model state
    model.load_state_dict(best_model_state)
    return train_loss_history, val_loss_history

# Define L2 regularization strengths and patience values
l2_strengths = [0.0, 0.01, 0.1]
patience_values = [3, 5]
results = {}

# Train models with different regularization and early stopping settings
for l2_strength in l2_strengths:
    for patience in patience_values:
        print(f"\nTraining with L2 regularization = {l2_strength}, Patience = {patience}")
        model = SimpleNN(input_dim=X.shape[1]).to(device)
        optimizer = optim.Adam(model.parameters(), lr=0.001, weight_decay=l2_strength)
        criterion = nn.MSELoss()

        train_loss, val_loss = train_model(
            model, train_loader, val_loader, criterion, optimizer, num_epochs=100, patience=patience
        )

        # Evaluate the model on the test set
        model.eval()
        test_loss = 0.0
        with torch.no_grad():
            for X_batch, y_batch in test_loader:
                y_pred = model(X_batch)
                loss = criterion(y_pred, y_batch)
                test_loss += loss.item()
        test_loss /= len(test_loader)

        results[(l2_strength, patience)] = {
            "train_loss": train_loss,
            "val_loss": val_loss,
            "test_loss": test_loss
        }

# Plot results
plt.figure(figsize=(12, 8))
for (l2_strength, patience), result in results.items():
    plt.plot(result["val_loss"], label=f"L2={l2_strength}, Patience={patience}")

plt.title("Validation Loss with Different L2 Regularization and Patience")
plt.xlabel("Epochs")
plt.ylabel("Validation Loss")
plt.legend()
plt.grid(True)
plt.savefig('validation_loss.jpg')

# Display summary results
print("\nSummary of Results:")
for (l2_strength, patience), result in results.items():
    print(f"L2 Regularization: {l2_strength}, Patience: {patience}")
    print(f"Final Train Loss: {result['train_loss'][-1]:.4f}")
    print(f"Final Validation Loss: {result['val_loss'][-1]:.4f}")
    print(f"Test Loss: {result['test_loss']:.4f}\n")

Output:


1. Effect of L2 Regularization:

With regularization, the validation loss decreases more smoothly. A stronger penalty (L2=0.1) slows down the training initially, as it regularizes the weights more strictly. This can prevent overfitting but may lead to underfitting if the regularization is too strong.

2. Effect of Patience (Early Stopping):

Compared with patience=3, the model with patience=5 may lead to slight improvements if the loss decreases further after plateauing. Longer patience typically benefits models with regularization (L2=0.1) because it gives the model more time to converge despite slower initial progress.

3. Interaction Between L2 and Patience:

L2=0.1 with Patience=3 stops relatively early and might underfit slightly compared to Patience=5; Moderate L2 (L2=0.01) and higher patience (5) provide a better trade-off, as the validation loss decreases smoothly without abrupt stops.

Exercise 5.7

Level: * (Easy)

Exercise Types: Novel

Question

Describe the main idea of the Manifold Tangent Classifier and its application in regularization. Provide an example.

Solution

The Manifold Tangent Classifier (MTC) is a method that improves generalization by leveraging the low-dimensional structure of data. Many datasets lie on a lower-dimensional manifold embedded in high-dimensional space, meaning small changes along certain directions should not affect classification.

MTC ensures that the classifier f(x) is invariant to these small changes by enforcing that its gradient is orthogonal to the tangent vectors of the manifold at x. These tangent vectors represent directions where the data naturally varies, and the classifier should be insensitive to changes in these directions.

Mathematically, this is achieved through regularization:

λi(f(x)xvi)2 where:

λ controls the strength of regularization. vi are the tangent vectors of the manifold. The expression penalizes large directional derivatives of f(x) along these vectors. By adding this regularization term to the loss function, the model becomes more invariant to small perturbations along the data manifold, leading to:

  1. Reduced overfitting, as the model does not capture irrelevant noise.
  2. Better generalization, since the decision boundary aligns with meaningful variations in the data.
  3. Robustness to adversarial noise, as the classifier focuses on actual structure rather than high-dimensional artifacts.

This approach is particularly useful in semi-supervised learning and unsupervised feature learning, where understanding data geometry helps in learning meaningful representations.


Consider a dataset of handwritten digits, such as the MNIST dataset, where each digit is represented as a high-dimensional image with 28×28 pixels, resulting in a 784-dimensional space. Despite this high-dimensional representation, the variations in handwritten digits do not span the entire space. Instead, they form a much lower-dimensional manifold within it. These variations include differences in slant, stroke thickness, and minor rotations, which do not alter the identity of the digit itself. However, traditional classifiers may be sensitive to these variations, potentially leading to misclassification.

The Manifold Tangent Classifier (MTC) helps mitigate this issue by enforcing invariance to small perturbations along the data manifold. It does this by identifying tangent vectors, which represent natural variations in the data. The classifier is then trained to ensure that its gradient is orthogonal to these tangent directions. This means that small changes in writing style—such as a slightly tilted or stretched digit—will not affect the classification outcome. By incorporating this regularization, the model aligns its decision boundary with meaningful variations rather than being influenced by irrelevant fluctuations in high-dimensional space.

For example, in a typical classification scenario, a standard neural network might misclassify a digit "3" as an "8" due to a slight distortion. However, with MTC, the classifier understands that such a variation is natural and maintains the correct classification. This regularization approach ensures that the model learns representations that are not just accurate but also more robust and interpretable.




Exercise 5.8

Level: *** (Hard)

Exercise Types: Novel

Question

You are provided with a noisy dataset sampled from a simple harmonic oscillator, with mass m=1kg and spring constant k=100N/m. The task in this problem is to write a regression neural network that predicts the oscillator's position y as a function of time t.

The dataset can be generated using the following script:

import numpy as np
import torch

np.random.seed(1234)

t = np.random.uniform(0, 1, 30)
noise = np.random.normal(0, 0.2, t.shape)
y = np.sin(10*t) + noise

t = torch.tensor(t, dtype=torch.float32).view(-1, 1)
y = torch.tensor(y, dtype=torch.float32).view(-1, 1)

(a) Neural network

In PyTorch, write a fully connected neural network with 4 hidden layers, each with 200 neurons. Use a tanh activation function after each hidden layer. Use a learning rate of 0.001. Generate a test dataset of times between t=0 and t=1 second(s). Create a plot and comment on the result.

(b) L2 regularization

Repeat the process above, but implement L2 regularization (the weight_decay parameter) in the optimizer. Comment on the result.

(c) Physics-informed neural network

If a dataset follows a known physical law (i.e., a differential equation), this differential equation can be added as a term to the loss function. This penalizes the neural network for solutions that do not obey this law and acts as a form of regularization. The equation of motion for the simple harmonic oscillator is:

d2ydt2+kmy=0

Using PyTorch's automatic differentiation function(s), compute the first and second derivatives of y with respect to t, and create a new loss function that is the sum of the mean squared error (MSE) and a new "physics loss" term. Introduce a hyperparameter that controls what fraction of the physics loss gets added to the total loss. Note that getting a good solution requires a careful selection of this parameter as well as the weight decay factor.

Solution

import torch
import torch.nn as nn
import torch.optim as optim
import numpy as np
import matplotlib.pyplot as plt

torch.manual_seed(1234)

class SimpleNN(nn.Module):
    def __init__(self):
        super(SimpleNN, self).__init__()
        self.fc1 = nn.Linear(1, 200)
        self.fc2 = nn.Linear(200, 200)
        self.fc3 = nn.Linear(200, 200)
        self.fc4 = nn.Linear(200, 200)
        self.fc5 = nn.Linear(200, 1)

    def forward(self, t):
        t = torch.tanh(self.fc1(t))
        t = torch.tanh(self.fc2(t))
        t = torch.tanh(self.fc3(t))
        t = torch.tanh(self.fc4(t))
        t = self.fc5(t)
        return t

def train(t, y, WEIGHT_DECAY=0, PHYSICS=0):
    model = SimpleNN()
    criterion = nn.MSELoss()
    optimizer = optim.Adam(model.parameters(), lr=0.001, weight_decay=WEIGHT_DECAY)

    epochs = 2000
    for epoch in range(epochs):
        perm = torch.randperm(len(t))
        t = t[perm]
        y = y[perm]

        t.requires_grad = True
        y_pred = model(t) # forward pass

        ### derivatives for the physics loss ###
        dy_dt = torch.autograd.grad(outputs=y_pred, inputs=t, grad_outputs=torch.ones_like(y_pred), create_graph=True)[0]
        d2y_dt2 = torch.autograd.grad(outputs=dy_dt, inputs=t, grad_outputs=torch.ones_like(dy_dt), create_graph=True)[0]
        physics_loss = torch.mean((d2y_dt2 + 100 * y_pred) ** 2)

        loss = criterion(y_pred, y)
        total_loss = loss + PHYSICS * physics_loss

        optimizer.zero_grad()
        total_loss.backward() # backwards pass
        optimizer.step()  # update weights

        t.requires_grad = False

        if (epoch + 1) % 100 == 0:
            print(f"Epoch [{epoch + 1}/{epochs}], Loss: {loss.item():.4f}, "
                  f"Physics Loss: {physics_loss.item():.4f}, Total Loss: {total_loss.item():.4f}")

    t_test = torch.linspace(0, 1, 100).view(-1, 1)
    with torch.no_grad():
        predictions = model(t_test)

    return t_test.numpy(), predictions.numpy()

t_test, pred = train(t, y)
_, pred_L2 = train(t, y, WEIGHT_DECAY=1e-3)
_, pred_phys = train(t, y, WEIGHT_DECAY=1e-3, PHYSICS=1e-5)

plt.figure(figsize=(8, 4))
plt.plot(t_test, pred, label="No regularization")
plt.plot(t_test, pred_L2, label="L2 regularization")
plt.plot(t_test, pred_phys, label="L2 + physics")
plt.scatter(t.numpy(), y.numpy(), color="k", label="Training data")
plt.xlabel("$t$")
plt.ylabel("$y$")
plt.legend()
plt.show()
A plot of the training data, along with the test predictions for a neural network with (a) no regularization, (b) L2 regularization, and (c) L2 regularization + physics informed loss.


Exercise 5.9

Level: ** (Moderate)

Exercise Types: Novel

Question

You will train a linear regression model to predict y values. Assume you have a high-dimensional dataset with noise, where the input features are xR100×50 (100 samples and 50 features), and the target outputs are yR100.

1. Write a Python function to implement a linear regression model with L2 regularization using gradient descent.

2. Train the model in:

   a. Without regularization lambda = 0
   b. With regularization lambda = 0.1

Solution

import numpy as np

np.random.seed(42)
x = np.random.randn(100, 50)
true_w = np.random.randn(50) * 0.5
y = x @ true_w + np.random.randn(100) * 0.1

# linear regression with L2 regularization
def linear_reg(x, y, lr = 0.01, lambda = 0.0, epochs = 1000):
    n, d = x.shape
    w = np.zeros(d)
    for _ in range(epochs):
        gradient = -2/n * x.T @ (y - x @ w) + lambda_ * w
        w = w - lr * gradient

no_reg = linear_reg(x, y, lambda = 0.0)
with_reg = linear_reg(x, y, lambda = 0.1)


Exercise 5.10

Level: ** (Moderate)

Exercise Types: Novel

Question

Consider a deep learning model that suffers from high variance, indicating it might be overfitting to the training data. Explore regularization techniques that could potentially reduce overfitting. Describe the following methods and explain how they contribute to reducing overfitting:

1. Weight Decay

2. Noise Injection

3. Early Stopping

4. Bagging

Provide a simple example or formula (where applicable) to demonstrate each method's effect.

Solution

1. Weight Decay: This regularization technique involves adding a penalty term to the loss function based on the sum of the squared values of the parameters (L2 regularization). This discourages large weights and helps to prevent the model from fitting the noise in the training data.

Example Formula: Lnew=Loriginal+λiwi2, where λ is the regularization strength and wi are the model weights.

Example: This form of regularization is often used with gradient descent based optimization methods, such as when training a neural network.

A very similar form of regularization is an L1 penalty, which uses |wi| instead of wi2. One notable difference is that L1 can cause some weights to be set exactly to 0, while this is highly unlikely with L2.

2. Noise Injection: By adding noise to the inputs or outputs during training, the model learns to ignore small variations, enhancing its generalization capabilities. Noise injection can be applied in different forms, such as adding noise to the weights (weight noise), outputs (output noise), or inputs (input noise).

Example: Injecting Gaussian noise ϵN(0,σ2) to inputs during training to make the model robust to slight variations in input data.

3. Early Stopping: This involves stopping the training process before the model has fully converged to the minimum of the loss function on the training set. By monitoring the performance on a validation set and stopping when performance degrades (implying the start of overfitting), this method effectively limits the capacity of the model.

Example: Stop training when validation loss begins to increase, even if training loss continues to decrease.

4. Bagging: Bagging, or bootstrap aggregating, involves training multiple models on different random subsets of the training data (that were sampled with replacement) and then averaging their predictions. This technique reduces variance and avoids overfitting by smoothing out predictions.

Example: Train multiple neural networks independently on different subsets of data and average their outputs to make final predictions.

Example: Use bagging for models that inherently have a high variance, such as decision tree models (e.g., random forest).

Exercise 5.11

Level: * (Easy)

Exercise Types: Novel

Question

Suppose the loss of a machine learning problem follows the function f(x)=cos(x). Find the tangent of f(x) at x=0.

Solution

f(0)=sin(0)=0

cos(0)=1

Therefore, the tangent function is g(x)=1

Exercise 5.12

Level: ** (Moderate)

Exercise Types: Novel

Question

Consider the manifold to be the unit sphere in R3

(1) What is the dimension of the sphere?

(2) Find the tangent plane to any point on the sphere

Solution

(1) A sphere in R3 can be expressed as S2:={(x1,x2,x3)R3:x12+x22+x32=1}, so it's dimension is 2

(2) Note that S2 can also be expressed as the zero set of the function F:R3R,(x1,x2,x3)x12+x22+x321, and it's Jacobian DF:=(2x1,2x2,2x3) is maximal rank 1 on S2. Therefore, for any point p=(x1,x2,x3)S2 the tangent plane is given by kerDF(p)={vR3:(2x1,2x2,2x3)v=0}


Exercise 5.13

Level: ** (Moderate)

Exercise Types: Modified

Reference: Prince, Simon J.D. Understanding Deep Learning. The MIT Press, 2023, p. 160, udlbook.com. Accessed 25 Jan. 2025.

Question

Show that the weight decay parameter update with decay rate 2αλ: w=(12αλ)wαL(w) on the original loss function L(w)) is equivalent to a standard gradient update using L2 regularization so that the modified loss function is L~(w)=L(w)+λ||w||2.

Solution

Given L~(w)=L(w)+λ||w||2, L~(w)=L(w)+2λw.

Given w=(12αλ)wαL(w), w=wα(2λw+L(w)), which is the standard gradient update on L~(w).


Exercise 5.14

Level: * (Easy)

Exercise Types: Novel

Question

Except for the examples listed in class, provide another example of noise injection as part of the regularization strategy.

Solution

Here we look at the dropout noise which randomly sets some features to 0 during training, this strategy prevents co-adaption of neurons.

The dropout function is defined as:

x=xM,MBernoulli(p)

where M is a binary mask with probability p of keeping each unit.

A Python Example (PyTorch):

import torch

dropout = torch.nn.Dropout(p=0.5)  # 50% dropout
x = torch.tensor([0.5, 0.3, 0.8])
x_noisy = dropout(x)
print(x_noisy)

Exercise 5.15

Level: * (Easy)

Exercise Types: Modified

Reference: Calin, Ovidiu. Deep learning architectures: A mathematical approach. Springer, 2020, page 463

Question

A one-hidden layer feedforward neural net, with dimensions 784-N-10, is used to classify the MNIST data. Find the range of the number of hidden neurons, N, for which the network overfits the training data. Note the MNIST dataset consists of 28x28 images, each identified with 10 classes. Assume the dataset contains 10,000 images.

Solution

We assume the MNIST dataset has 10,000 training points (xi,zi) where xi is a 784 dimensional vector (28x28 flattened image) and zi is a 10 dimensional one hot vector (indicating which class the image belongs to). Since there are 10,000 images, this yields a space with dimension 10,000*10 =100,000.

The dimension of the output manifold for the one-hidden layer feedforward NN is r=784N+N10+N since we have 784N weights, from the input to hidden layer, N biases, and N10 weights from the hidden layer to the output layer.

Therefore for the network to overfit, we require r>100,000784N+N10+N>100,000N>100,000/795=125.786. That is, we require the dimension of the output manifold of the neural network to be greater than 100,000. Therefore, we require over 126 hidden neurons for which the network overfits the training data, assuming the training set consists of 10,000 images.

Exercise 5.16

Level: ** (Moderate)

Exercise Types: Novel

Question

a). Given the loss function of a ridge regression, isolate the weights, θ and compare the ridge regression weights against that of an OLS regression.

f(θ)=i(yiy^i)2+λ||θ||22

b). Show how the weights of the ridge regression are updated using the Newton-Raphson method.

c). Discuss one benefits of ridge regression.

Solution

a).

f(θ)=i(yiy^i)2+λjθj2=(yxθ)T(yxθ)+λθTθθf(θ)=2xT(yxθ)+2λθ

By letting θf(θ)=0,

0=2xT(yxθ)+2λθ=xTy+xTxθ+λθxTy=xTxθ+λθxTy=(xTx+λI)θθ=(xTx+λI)1xTy

Comparing both weighting schemes:


θridge=(xTx+λI)1xTyθOLS=(xTx)1xTy


b).

Using the Newton-Raphson method:


θNew=θold+ρf(θOld)f(θOld)=θ+ρ(xT(yxθ)+λθ)1((yxθ)T(yxθ)+λθTθ)

c).

One advantage of Ridge Regression, apart from the general penalization effect on the coefficients, is that it allows highly correlated x data to be included in the model. When the x data is highly correlated, the xTx term in the denominator of an OLS regression tends to 0, leaving us with an undefined weight. The added +λI in the denominator of the Ridge Regression reconciles this and therefore allows for highly correlated x features to be included. This can be particularly useful in certain situations, where keeping highly correlated variables increases model accuracy while maintaining stability.

Exercise 5.17

Level: ** (Moderate)

Exercise Types: Novel

Question

How Bagging's regularization effect differs from Dropout or L2 regularization?

Solution

Bagging reduces variance by training multiple models to integrate. It is best used when computing resources are sufficient because multiple models need to be trained for integration.

L2 regularization reduces the overfitting of a model to a particular sample by constraining the weight of a single model. To train individual models when the computational cost is low.

Dropout randomly drops neurons during training of individual models, thereby reducing overdependence between neurons, thereby enhancing the robustness of the neural network to reduce overfitting.

Exercise 5.18

Level: * (Easy)

Exercise Types: Novel

Question

Data augmentation is commonly used to improve the generalization ability of deep learning models. Consider a scenario where a convolutional neural network (CNN) is trained on a dataset of handwritten digits.

1) Explain how applying random rotations and Gaussian noise injection as data augmentation techniques could impact the model's performance.

2) What potential drawbacks can arise from excessive data augmentation, and how can these be mitigated?

3) Mathematically, how does injecting noise at the input act as a form of regularization? Explain using the concept of the Manifold Tangent Classifier.

Solution

1) Impact of random rotations and Gaussian Noise Injection:

• Random rotations: Rotating the images randomly within a small range helps the model learn rotational invariance, making it more robust to variations in real-world data. However, excessive rotation may distort digits, making classification harder.

• Gaussian Noise Injection: Adding Gaussian noise to the input images forces the network to learn robust features rather than memorizing the dataset. It acts similarly to dropout by introducing randomness, which helps prevent overfitting.

2) Drawbacks of Excessive Data Augmentation:

• If the augmentation introduces unrealistic transformations, such as excessive rotations that make digits unrecognizable, it may degrade model performance.

• Augmenting too much can increase training time significantly without proportional improvement.

• Mitigation: Using hyperparameter tuning, validation monitoring and adversarial training can help balance augmentation intensity.

3) Mathematical Explanation of Noise Injection as Regularization:

• Injecting noise at the input level can be interpreted as adding a regularization term to the loss function.

• If x is the input and noise ϵ is added, the perturbed input becomes x=x+ϵ.

• Expanding the loss function using a Taylor series, we see that the noise injection penalizes large weight changes, enforcing smooth decision boundaries.

• The Manifold Tangent Classifier (MTC) leverages this by learning the local manifold structure of the data, ensuring that small perturbations (such as injected noise) do not drastically change the classification outcome.

Exercise 5.19

Level: ** (Moderate)

Exercise Types: Novel

Question

L2 regularization (also known as weight decay) is widely used to prevent overfitting in neural networks. The regularized loss function for a neural network is given by:

Lreg(θ) = Ltrain(θ) + λ ||θ||22

where Ltrain(θ) is the training loss (e.g., cross-entropy loss), ||θ||22 = ∑i=1N θi2 is the squared L2 norm of the weights, and λ is the regularization hyperparameter.

  1. Derive the gradient of the regularized loss function with respect to the weights θj. Show the update rule for the weight θj during gradient descent.
  2. Prove that the L2 regularization term leads to a shrinkage effect on the weights. Specifically, show that for each weight θj, the regularization term effectively penalizes large values of θj, making them smaller over time.
  3. Explain how L2 regularization helps control overfitting in terms of the bias-variance decomposition. Use the bias-variance decomposition of the generalization error to argue how L2 regularization reduces model variance.

Solution

1. Gradient of the Regularized Loss Function

The regularized loss function is:

Lreg(θ) = Ltrain(θ) + λ ||θ||22

To compute the gradient of Lreg(θ) with respect to the weight θj, we first compute the gradient of each term:

  • Gradient of the training loss term Ltrain(θ): θj Ltrain(θ)
  • Gradient of the regularization term λ ||θ||22: The gradient of the L2 penalty term is: θj (λ ∑i=1N θi2) = 2λθj

The total gradient with respect to θj is:

θj Lreg(θ) = ∇θj Ltrain(θ) + 2λθj

Update Rule for the Weight θj

Using gradient descent, the update rule for θj is:

θj ← θj - η (∇θj Ltrain(θ) + 2λθj)

Thus, the weight update rule with L2 regularization is:

θj ← θj - η∇θj Ltrain(θ) - 2ηλθj

2. Shrinkage Effect of L2 Regularization

To understand how L2 regularization shrinks the weights, we look at the weight update rule:

θj ← θj - η (∇θj Ltrain(θ) + 2λθj)

The second term - 2ηλθj represents the shrinkage of the weight θj. This term reduces the magnitude of θj over time, which is the shrinkage effect. Specifically, the term:

- 2ηλθj

forces the weight to decrease in magnitude during each update, thus reducing the complexity of the model and helping prevent overfitting by avoiding large values for the weights. The strength of the shrinkage effect is directly controlled by the regularization parameter λ, the learning rate η, and the magnitude of the weight θj.

3. L2 Regularization and Bias-Variance Decomposition

The generalization error can be decomposed into three components: bias, variance, and irreducible error:

ℰ = Bias² + Variance + Irreducible Error

L2 regularization helps to control overfitting by influencing the variance component. Here’s how:

  • Bias: L2 regularization slightly increases bias by forcing the model to simplify (via shrinking the weights). A more complex model with no regularization can fit the training data perfectly, but at the cost of increased variance.
  • Variance: L2 regularization reduces variance by preventing the weights from becoming too large, which would lead to an overfitting model with high variance. By penalizing large weights, the model generalizes better and has reduced sensitivity to fluctuations in the training data.

Thus, L2 regularization reduces the overall generalization error by decreasing variance (the model is less sensitive to noise) while introducing a slight increase in bias (the model is less complex). This tradeoff helps the model generalize better to unseen data.

Exercise 5.20

Level: * (Easy)

Exercise Types: Novel

Question

True/False:

1.Regularization is a technique that reduces model complexity by adding an extra penalty term (such as L1 or L2 regularization) to the loss function, helping to prevent overfitting.

2.Regularization can improve a model's performance on training data by increasing its complexity, allowing it to capture more intricate patterns in the data.

Solution

1. True.

Regularization works by adding a penalty term to the loss function that discourages the model from becoming too complex. This helps prevent overfitting, where the model performs well on training data but poorly on new, unseen data. Common regularization methods include L1 regularization (Lasso), which penalizes the absolute values of the model weights and can lead to sparse models, and L2 regularization (Ridge), which penalizes the squared values of the weights, encouraging smaller weight magnitudes. By using regularization, the model generalizes better and avoids fitting noise or irrelevant details in the training data.

2. False.

Regularization actually works by reducing a model's complexity, not increasing it. It adds a penalty to the loss function for large weights, which encourages the model to focus on the most important features and prevents it from fitting to noise or irrelevant patterns in the training data. By controlling complexity, regularization helps the model generalize better to unseen data, rather than overfitting to the training set.

Exercise 6.1

Level: ** (Moderate)

Exercise Types: Modified

Reference: Source: Schonlau, M., Applied Statistical Learning. With Case Studies in Stata, Springer. ISBN 978-3-031-33389-7 (Chapter 14, page 319).

Question

In binary logistic regression, we model the log odds of one class as a linear function of predictor variables. In multinomial logistic regression, where there are K possible classes, we model the log odds of K1 classes relative to a reference class K:

log(pkpK)=αk+x1βk1++xpβkp,

for k=1,2,,K1.

Suppose we use a neural network model to implement multinomial logistic regression. Design a neural network architecture for a case with four input variables (p=4) and five possible outcome classes ( K=5 ).

(a) Explain how the output layer should be structured and which activation function should be used.

(b) Introduce a **dropout** mechanism in the model. Explain where dropout can be applied and how it affects training and generalization.

Solution

To design a neural network that performs multinomial logistic regression with p=4 input variables and K=5 classes, we follow these steps:

1. Neural Network Architecture

- Input Layer:** 4 neurons (one for each predictor variable).

- Hidden Layer (Optional):** To introduce non-linearity, we can add a hidden layer with dropout.

- Output Layer:** 5 neurons (one for each class).

Each output neuron represents the log-odds of class k relative to the reference class K, following the equation:

log(pkpK)=αk+x1βk1++xpβkp,for k=1,2,,4.

The probability of class K is obtained as:

pK=1k=1K1pk.

2. Activation Function

Since this is a **classification problem**, the **softmax activation function** is used in the output layer:

pk=ezkj=1Kezj,where zk=αk+x1βk1++xpβkp.

This ensures that: - Each pk is between 0 and 1. - The sum of all pk values is 1.

3. Incorporating Dropout Dropout is a regularization technique that randomly deactivates neurons during training to prevent overfitting. It is commonly applied to hidden layers.

- Where to Apply Dropout:

 - If a hidden layer is included, apply dropout (e.g., with probability [math]\displaystyle{  p = 0.5  }[/math]) to prevent co-adaptation of neurons.  
 - Dropout **should not** be applied to the input or output layers.  

- Impact on Training and Generalization:

 - During training, dropout randomly removes a fraction of neurons in each iteration, forcing the network to learn more robust features.  
 - During inference (testing), dropout is disabled, and all neurons contribute, with weights scaled accordingly.  
 - This reduces overfitting and improves generalization to unseen data.  

4. Loss Function To train the network, the **categorical cross-entropy loss** is used:

L=i=1Nk=1Kyiklogpik

where: - N is the number of samples.

- yik is 1 if sample i belongs to class k, otherwise 0.

- pik is the predicted probability for class k.


5. Summary of Neural Network Design with Dropout

- Input layer: 4 neurons (one per input feature).

- Hidden layer (optional): Can include 8 neurons with ReLU activation and dropout (p=0.5).

- Output layer: 5 neurons (one per class) with softmax activation.

- Activation function: Softmax in the output layer.

- Loss function: Categorical cross-entropy.

- Regularization: Dropout applied to hidden layer to reduce overfitting.

By including dropout, the model becomes more robust to noise and prevents reliance on specific neurons, leading to better generalization performance.

Exercise 6.2

Level: * (Easy)

Exercise Types: Novel

Question

Consider a neural network with a single hidden layer. The hidden layer has 4 neurons, and the ReLU activation function is applied. During training, dropout is applied with a probability of 0.5. If the input to the hidden layer is x=[1,2,3,4] and the weights are W=[0.50.20.30.80.10.50.70.20.40.60.10.30.30.40.20.1], compute the output of the hidden layer after applying dropout.

Assume the following dropout mask is sampled: m=[1,0,1,0].

Solution

1. Compute the pre-activation values: z=Wx=[0.50.20.30.80.10.50.70.20.40.60.10.30.30.40.20.1][1234]=[3.50.31.40.9]

2. Apply the ReLU activation function: ReLU(z)=max(0,z)=[3.50.31.40.9]

3. Apply the dropout mask and scale by 110.5=2: h=mReLU(z)2=[1010][3.50.31.40.9]2=[7.002.80]

The final output of the hidden layer after applying dropout is: h=[7.0,0,2.8,0].

Exercise 6.3

Level: ** (Moderate)

Exercise Types: Novel

Question

Train a simple deep neural network with and without dropout regularization on the MNIST dataset. Experiment with different dropout rates (0.1, 0.3, 0.5). Analyze the model's performance in terms of accuracy and generalization.

Solution

import torch
import torch.nn as nn
import torch.optim as optim
from torchvision import datasets, transforms
from torch.utils.data import DataLoader
import matplotlib.pyplot as plt

# Set device
device = torch.device("cuda" if torch.cuda.is_available() else "cpu")

# Define data preprocessing and load the MNIST dataset
transform = transforms.Compose([
    transforms.ToTensor(),
    transforms.Normalize((0.5,), (0.5,))  # Normalize to [-1, 1]
])

train_dataset = datasets.MNIST(root='./data', train=True, transform=transform, download=True)
test_dataset = datasets.MNIST(root='./data', train=False, transform=transform, download=True)

train_loader = DataLoader(train_dataset, batch_size=64, shuffle=True)
test_loader = DataLoader(test_dataset, batch_size=64, shuffle=False)

# Define a simple neural network
class SimpleNN(nn.Module):
    def __init__(self, dropout_rate=0.0):
        super(SimpleNN, self).__init__()
        self.fc1 = nn.Linear(28 * 28, 256)
        self.dropout = nn.Dropout(dropout_rate)
        self.fc2 = nn.Linear(256, 128)
        self.fc3 = nn.Linear(128, 10)
        self.relu = nn.ReLU()
    
    def forward(self, x):
        x = x.view(x.size(0), -1)  # Flatten the input
        x = self.relu(self.fc1(x))
        x = self.dropout(x)  # Apply dropout
        x = self.relu(self.fc2(x))
        x = self.fc3(x)  # Output layer
        return x

# Define training and evaluation functions
def train_model(model, train_loader, optimizer, criterion, num_epochs=10):
    model.train()
    train_loss = []
    for epoch in range(num_epochs):
        epoch_loss = 0.0
        for images, labels in train_loader:
            images, labels = images.to(device), labels.to(device)
            
            optimizer.zero_grad()
            outputs = model(images)
            loss = criterion(outputs, labels)
            loss.backward()
            optimizer.step()
            
            epoch_loss += loss.item()
        train_loss.append(epoch_loss / len(train_loader))
    return train_loss

def evaluate_model(model, test_loader, criterion):
    model.eval()
    correct = 0
    total = 0
    test_loss = 0.0
    with torch.no_grad():
        for images, labels in test_loader:
            images, labels = images.to(device), labels.to(device)
            outputs = model(images)
            loss = criterion(outputs, labels)
            test_loss += loss.item()
            
            _, predicted = torch.max(outputs.data, 1)
            total += labels.size(0)
            correct += (predicted == labels).sum().item()
    accuracy = 100 * correct / total
    return test_loss / len(test_loader), accuracy

# Experiment with different dropout rates
dropout_rates = [0.0, 0.1, 0.3, 0.5]
results = {}

for rate in dropout_rates:
    model = SimpleNN(dropout_rate=rate).to(device)
    criterion = nn.CrossEntropyLoss()
    optimizer = optim.Adam(model.parameters(), lr=0.001)
    
    # Train the model
    print(f"Training with dropout rate: {rate}")
    train_loss = train_model(model, train_loader, optimizer, criterion, num_epochs=10)
    
    # Evaluate the model
    test_loss, test_accuracy = evaluate_model(model, test_loader, criterion)
    results[rate] = (train_loss, test_loss, test_accuracy)

# Plot the training loss for different dropout rates
plt.figure(figsize=(10, 6))
for rate, (train_loss, _, _) in results.items():
    plt.plot(train_loss, label=f"Dropout {rate}")

plt.title("Training Loss for Different Dropout Rates")
plt.xlabel("Epochs")
plt.ylabel("Loss")
plt.legend()
plt.grid(True)
plt.savefig('training_loss.jpg')


# Display test accuracy for different dropout rates
print("\nResults Summary:")
for rate, (_, test_loss, test_accuracy) in results.items():
    print(f"Dropout Rate {rate}: Test Loss = {test_loss:.4f}, Test Accuracy = {test_accuracy:.2f}%")


Output:


Results Summary:

Dropout Rate 0.0: Test Loss = 0.0778, Test Accuracy = 97.80%

Dropout Rate 0.1: Test Loss = 0.0826, Test Accuracy = 97.48%

Dropout Rate 0.3: Test Loss = 0.0873, Test Accuracy = 97.49%

Dropout Rate 0.5: Test Loss = 0.0930, Test Accuracy = 97.11%

From the summary results and the plot above, it is clear that the model tends to overfit without dropout. With a moderate dropout rate, the model achieves a good balance between generalization and regularization, leading to improved test accuracy. However, with a high dropout rate, excessive regularization can hinder the model's ability to learn effectively, resulting in reduced test accuracy. Hence, we always select moderate dropout rate in the practical problem.

Exercise 6.4

Level: * (Easy)

Exercise Type: Novel

Question

True/False Questions on Dropout

1. Dropout helps prevent overfitting by randomly deactivating a subset of neurons during training.

2. Dropout is used both during training and during testing to ensure consistent performance.

3. Using a high dropout rate (e.g., 90%) can lead to underfitting the model.

4. Dropout introduces noise in the network, which makes it more robust and forces the network to learn redundant representations.

5. Dropout is not compatible with batch normalization because they both normalize activations.

6. Dropout improves model performance by reducing training time significantly.

Solution

1. Dropout helps prevent overfitting by randomly deactivating a subset of neurons during training.
Answer: True
Explanation: Dropout prevents overfitting by deactivating a random subset of neurons during each forward pass in training. This forces the network to learn more generalizable features rather than relying on specific neurons or overfitting to the training data. Dropout acts as a regularizer by preventing the model from overfitting. Regularization techniques like dropout introduce some form of 'noise' or uncertainty in training, which prevents the model from memorizing the training data and forces it to focus on the most important patterns in the data

2. Dropout is used both during training and during testing to ensure consistent performance.
Answer: False
Explanation: Dropout is only applied during training. During inference, dropout is turned off, and all neurons are active. The weights are scaled to account for the absence of dropout, ensuring consistent output without randomly deactivating neurons.

3. Using a high dropout rate (e.g., 90%) can lead to underfitting the model.
Answer: True
Explanation: Underfitting occurs when the model is too simple to capture the underlying patterns in the data. A very high dropout rate deactivates most of the neurons, which reduces the network’s capacity to learn complex patterns. This can result in underfitting, where the model performs poorly on both the training and validation sets. Studies typically recommend a dropout rate between 20% and 50% for most problems. Extremely high rates, such as 90%, often make the network underfit and perform worse than simpler models.

4. Dropout introduces noise in the network, which makes it more robust and forces the network to learn redundant representations.
Answer: True
Explanation: By deactivating random neurons during training, dropout adds noise, making the model more robust to variations in the data. This encourages the network to learn redundant and distributed representations, as no single neuron can dominate the decision-making process.

5. Dropout is not compatible with batch normalization because they both normalize activations.
Answer: False
Explanation: Dropout and batch normalization are compatible, although they operate differently. Batch normalization normalizes activations, while dropout randomly deactivates neurons. The goal of Batch Normalization is to stabilize and speed up training. The goal of dropout is to prevent overfitting. Batch normalization is typically applied earlier in the network, often before nonlinearities like ReLU, while dropout is typically used later in the network, after the activation layers. Combining both allows you to stabilize training (via batch normalization) while reducing overfitting (via dropout)

Additional notes: Dropout prevents overfitting by giving other nodes to be trained on a chance. It avoids the pitfall of having 1 node dominating other nodes for training, and allow the option for other weights to be explored. A commonly used starting point is a dropout rate of 0.5, which means 50% of neurons are dropped during training. This can be fine-tuned depending on the model's performance on the validation set. Larger dropout rates might be used for smaller networks, while lower rates are preferred for larger models.

6. Dropout improves model performance by reducing training time significantly.
Answer: False
Explanation: Dropout helps in preventing overfitting by randomly deactivating a subset of neurons during training, forcing the model to learn more robust features. However, dropout does not necessarily reduce training time. In fact, it can increase training time since fewer active neurons participate in each forward and backward pass, which can slow down convergence. Additionally, since dropout is only applied during training (not inference), the computational savings do not extend to the final model when making predictions.

Exercise 6.5

Level: ** (Moderate)

Exercise Types: Novel

References: Adapted from concepts introduced by Srivastava et al., 2014.

Question

Consider the application of dropout to a linear regression model with a response variable y and a single predictor x. The linear model can be expressed as:

y=β0+β1x+ϵ, where ϵ represents normally distributed error.

(a) If dropout is applied at a rate of 0.2 during the training phase, how does this affect the estimation of β0 and β1? Discuss the potential benefits and drawbacks.

(b) Extend this to a multiple regression scenario where there are three predictors x1,x2,x3. Explain how dropout could be implemented during training and its expected impact on model variance and bias.

Solution

1.Dropout Implementation and Effects in Simple Linear Regression:

- Applying dropout to the predictor x during training involves temporarily removing it from the model with a probability of 0.2. This effectively introduces missingness in the predictor data, which can make the model more robust by preventing it from relying too heavily on x for predicting y.

- Potential Benefits: - Reduces the risk of overfitting by making the model less sensitive to noise in the predictor x. - Forces the model to not rely on any single input feature, thus potentially discovering more general patterns in the data.

- Potential Drawbacks: - Can increase model bias if important predictor information is consistently dropped. - Might lead to higher variance in the estimated parameters due to reduced effective sample size during each training iteration.

2. Extension to Multiple Regression

- In a model with multiple predictors, dropout can be applied to each predictor independently. Each predictor xi is dropped with a probability of 0.2 during each training epoch.

- Impact on Model Variance and Bias: - Model Variance: Dropout generally increases model variance during training but can lead to a reduction in variance of predictions by averaging over multiple "thinned" models. It can be seen as an ensemble method: As if we have many different tiny networks, and we take the weighted average of all of them. - Model Bias: Similar to the simple linear regression case, the bias might increase due to the systematic exclusion of potentially important predictors during training epochs. - The application of dropout in this setting acts as a form of regularization, helping to mitigate overfitting especially when the number of predictors is large relative to the sample size.

Exercise 6.6

Level: * (Easy)

Exercise Types: Novel

Question

Let f(x)=4sin(x). Apply gradient clipping with a limit of 3. What is the resulting gradient?

Solution

The gradient is f(x)=4cos(x).

After clipping, any gradient that exceeds 3 gets limited to 3, and any gradient that goes below -3 gets limited to -3. This is visualized in the plot below.


Exercise 6.7

Level: * (Easy)

Exercise Types: Modified

Sources Calin, Ovidiu. Deep learning architectures: A mathematical approach. Springer, 2020, Exercise 12.13.9

Question

How does the capacity of a network change when:

(a) An extra fully-connected layer is added to the network

(b) Some perceptrons are dropped out of the network

(c) The weights are constrained to be kept small

Solution

(a) Increases. Adding an extra fully-connected layer increases the number of parameters and allows the network to learn more complex functions. The added depth enables the network to capture higher-order interactions in the data, potentially increasing its representational power. However, deeper networks may also be harder to train due to issues like vanishing gradients.

(b) Can decrease effective capacity (but not parameter count). Dropout randomly deactivates neurons during training, which prevents co-adaptation and encourages robustness. While the total number of parameters remains unchanged, the effective capacity of the network is reduced because fewer units participate in each forward pass. However, at test time, all neurons are active with scaled weights, meaning the full network is used.

(c) Decreases. Constraining weights (e.g., via L2 regularization) limits how much each neuron can contribute to the output. This reduces the flexibility of the model, making it less prone to overfitting but also potentially limiting its ability to learn complex patterns.

Exercise 6.8

Level: ** (Moderate)

Exercise Type: Novel

Question

Dropout in Linear Regression

1. How does applying dropout during training differ from its use during testing in linear regression models?

2. Consider a linear regression model: y=w1x1+w2x2+w3x3+b If dropout is applied to the inputs x1,x2,x3 with a dropout rate of p=0.2, describe the expected effect on the effective input during training.

3. Explain how dropout can affect the model’s capacity and generalization in regression tasks.

4. How would applying dropout to the weights of a linear regression model (instead of the inputs) impact the learned parameters and model performance?

Solution

1. Dropout during training vs. testing: During training, dropout randomly deactivates a fraction of the neurons (or inputs, in the case of linear regression) at each forward pass. This simulates training on different "thinned" versions of the network, helping to prevent co-adaptation of features. During testing, dropout is not applied; instead, all neurons are active, and the weights are scaled down by the dropout probability to approximate the effect of averaging over the thinned networks.

2. Effect on inputs with p=0.2: If a dropout rate of 0.2 is applied, 20% of the inputs x1,x2,x3 will be set to zero randomly during training. On average, each input contributes only 80% of its value to the output during training. Therefore, the effective input becomes scaled by a factor of 1p=0.8. The modified equation during training becomes: y^=0.8w1x1+0.8w2x2+0.8w3x3+b This ensures the model does not overly rely on any single input feature.

3. Effect on capacity and generalization: Dropout reduces the effective capacity of the model during training by deactivating some inputs or neurons, forcing the model to distribute learning across all features. This prevents overfitting to the training data and improves generalization to unseen data. However, in some cases, dropout can slightly increase training time as the model requires more epochs to converge due to the reduced capacity during training.

4. Regularization: By preventing any single weight from dominating the learning process, it encourages a more balanced contribution of all features.

Weight Averaging: At test time, the model would use the full weight set, but with scaled values, approximating an ensemble of multiple different sub-models.

Training Stability: Unlike input dropout, weight dropout directly impacts how much each feature contributes to the prediction at every step, potentially leading to a noisier optimization process.

Reduced Overfitting: By forcing the model to rely on different subsets of weights at each training step, it reduces dependency on specific features and helps improve generalization.

Exercise 6.9

Level: * (Easy)

Exercise Type: Novel

Question

This is a quick exercise for demonstrating the effect of batch normalization. Suppose you are given the following mini-batch of inputs:

X=[10,8,2,10]

(a) Apply the sigmoid activation function directly to X.

(b) Now, normalize the inputs X using batch normalization, assuming that the layer has learned parameters γ=2 and β=0.5. Then, apply the sigmoid activation to the normalized inputs.

(c) Why can batch normalization be helpful in models that use activations such as the sigmoid function?

Solution

Note that all of the numerical answers here are rounded to 2 decimal places for conciseness.

(a) The sigmoid function is given by

σ(x)=11+ex

Applying this to all of the elements of X results in the following.

σ(X)=[4.54×105,3.35×104,8.81×101,1.00×101]

(b) The mean and variance of X are given below.

μB=2 σB2=54

These are used to calculate the normalized form of X.

X^=XμBσB2+ϵ=[0.25,0.31,0.63,0.80]

Then, the learned parameters are used for scaling and shifting.

Y=γX^+β=[0.16,0.24,0.83,0.96]

(c) The batch given in the problem statement had values that were either very large or very small, and therefore were in the saturation regions of the sigmoid function. Without batch normalization, the output contained values that were either extremely close to zero or extremely close to 1. In those regions, the gradient of the sigmoid function is very small, which makes it harder for the model to learn. Batch normalization can be used to keep the inputs in the centre, close to zero, where the gradient is non-negligible. In other words, the distribution of the inputs to a layer may change during training (i.e., internal covariate shift); batch normalization is meant to mitigate this.

Exercise 6.10

Level: ** (Moderate)

Exercise Type: Novel

Question

1. Answer the following True or False questions, and explain why:

(a). Batch normalization reduces internal covariance shift, improving model performance.

(b). Beta-smoothness describes how much the output difference |f(x1)f(x2)| changes when the input difference |x1x2| is perturbed.

(c). A smaller L in L-Lipschitz continuity generally leads to better optimization.

(d). If the gradient changes significantly between nearby points, using a large learning rate is a good choice.

(e). Weight normalization is a viable alternative to batch normalization.

2. A neural network layer has 5 neurons, each receiving the same input x. The activations before dropout are:

a=[2.0,1.5,3.0,0.5,2.5]

Apply dropout with a dropout rate of 0.4 (i.e., 40% of neurons are randomly set to 0 during training). The remaining activations are scaled to maintain expected values. What are the output activations after applying dropout and scaling?

Solution

1.

(a). False. Initially, batch normalization was believed to mitigate internal covariance shift. However, later research (2019) found that adding noise to data performed just as well as using BatchNorm. Since noise increases the variance of each iteration, it actually amplifies internal covariance shift rather than reducing it. This suggests that batch normalization does not work by fixing covariance shift but instead improves training through other mechanisms, such as smoothing the optimization landscape.

(b). False. Beta-smoothness refers to a bound on how much the gradient of a function can change, meaning it limits how fast the slope of the function varies. The concept described in the statement actually corresponds to L-Lipschitz continuity, which bounds the maximum rate at which the function values can change with respect to input perturbations.

(c). True. A smaller L means the function has a lower maximum gradient, making it smoother. Smooth functions are easier to optimize because they reduce the risk of abrupt gradient changes (sharp cliffs) that can destabilize training. This leads to more stable updates and better convergence behavior.

(d). False. Large variations in the gradient indicate a highly non-smooth loss landscape. In such cases, a large learning rate can cause the optimizer to overshoot the minimum or oscillate chaotically, much like a ball bouncing between steep slopes. Instead, a more stable learning rate should be used in these situations to ensure smooth convergence.

(e). True. While batch normalization is widely used, it is not the only normalization technique. Weight normalization, which normalizes weight vectors instead of activations, can serve as an effective alternative, especially in cases where batch statistics are unreliable (e.g., small batch sizes or online learning).

2. With a dropout rate of 0.4, 40% of neurons (2 out of 5) are dropped (set to 0). Suppose the second (1.5) and fourth (0.5) neurons are dropped. The remaining activations are:

a=[2.0,0,3.0,0,2.5]

During training, we scale the remaining neurons by (110.4=10.6=1.67) to maintain the expected activation. Applying this scaling to the nonzero activations:

a=[2.0×1.67,0,3.0×1.67,0,2.5×1.67]

After applying dropout and scaling, the output activations are:

[3.33,0,5.00,0,4.17]

Exercise 6.11

Level: ** (Moderate)

Exercise Types: Novel

Question

This Exercise has the goal of getting a better understanding of what is a Lipschitz function, an L-Smooth function and its implications.

We say that a function is Lipschitz if xR, L such that:

|f(x)f(y)|L|xy|

We say that a function is L-Smooth if xR, L such that:

|f(x)f(y)|L|xy|

Give an example of a function that is not Lipschitz and not L-Smooth. Explain the ramifications of these conditions.

Solution

Let us begin by finding a function that is not Lipschitz. Suppose we have f(x)=x. By Lipschitz property:

|f(x1)f(x2)|L|x1x2||x1x2||x1x2|L

Now, suppose that |x1x2|0+. Now as the gap between both x1 and x1 narrows, while still remaining greater than 0, the function gets increasingly steeper. Take for instance 0.00010.000010.0068. Now divide this by 9105, we see that this is roughly equal to 75.9746926.

As the gap narrows, this number increases until we are left with:

L

which is absurd. Therefore, f(x)=x is not Lipschitz.

When taking the gradient, we see that f(x)=12x. Once again, as x0, the gradient approaches infinity. Therefore, we can also conclude that the function is not L-Smooth.

When considering a loss function, and the necessity of a local minimum, having a function who's gradient increases dramatically and quickly can lead to poor convergence and inability to attain the local minimum, or in this case, the infimum. Therefore, this would not be an ideal loss function.

Exercise 6.12

Level: * (Easy)

Exercise Types: Novel

Question

Batch Normalization and Internal Covariate Shift

What is internal covariate shift, and why is it considered a problem in deep learning?

Given a mini-batch of input activations x=x1,x2,...,xm, batch normalization normalizes each activation using the batch mean and variance. Write the mathematical formulation of batch normalization for a single activation xi.

How does batch normalization help in improving optimization and generalization in deep learning models?

Solution

Internal Covariate Shift: Internal covariate shift refers to the change in the distribution of network activations during training as the parameters of previous layers update. This shift forces each layer to continuously adapt to new distributions, slowing down convergence and making optimization more difficult.

Mathematical Formulation: Given a mini-batch x=x1,x2,...,xm, batch normalization is computed as follows:

Compute the batch mean: μ=1mi=1mxi Compute the batch variance: σ2=1mi=1m(xiμ)2 Normalize each activation: x^i=xiμσ2+ϵ Scale and shift using learnable parameters γ and β: yi=γx^i+β Effect on Optimization and Generalization:

Optimization: Batch normalization smooths the loss landscape by normalizing activations, making gradients more predictable and allowing for larger learning rates. This speeds up convergence and stabilizes training. Generalization: By reducing the sensitivity of the model to small variations in input distributions, batch normalization acts as a form of regularization, reducing the risk of overfitting.

Exercise 6.13

Level: * (Easy)

Exercise Types: Novel

Question

  1. Which of the following is not a commonly used from of regularization in deep neural networks??

    • A) Weight Decay
    • B) Dropout
    • C) Label smoothing
    • D) Training the net until it hits 100% accuracy on the training data
  2. Label smoothing is mostly directted at preventing which of these??

    • A) Large model bias
    • B) Overconfidence in the predictions
    • C) Too many data augmentations
    • D) Slower training speed

Solution

  1. Correct Answer: D

    Short Reason: Weight Decay, Dropout, and Label Smoothing are all frequent used ways to reduce overfitting. Training a network until it absolutely nails 100% of the training data is usually not considered a good method and can cause severe overfitting.

    Detailed Explanation: Weight decay, dropout, and label smoothing are regularization techniques that help deep neural networks generalize better and avoid overfitting. Weight decay prevents the model from relying too much on large weights by encouraging smaller but more evenly distributed values, making the network more stable. Dropout randomly disables a fraction of neurons during training, forcing the network to learn redundant and distributed representations, which improves robustness and reduces reliance on specific features. Label smoothing prevents the model from becoming overconfident in its predictions by slightly softening the target labels, which helps in handling noisy data and improves generalization, especially in classification tasks. These techniques are widely used because they enhance model performance on unseen data while reducing the risk of memorization.

  2. Correct Answer: B

    Short Reason: Label smoothing basically lowers the chance of being fully certain about any class. This helps reduce the model's overconfidence in it’s own predictions, so it generalizes better.

Exercise 6.14

Level: * (Easy)

Exercise Types: Novel

Question

  1. What is the role of using Dropout when training neural networks?

    • A) Speed up computation (reduce the number of neurons)
    • B) Improve the generalization ability of the model (introduce noise to reduce the coadaptability of neurons)
    • C) Reduce the number of parameters (force neurons to share weights)
    • D) Increasing the complexity of the model (randomly adjusting the activation function of neurons)
  2. What mechanism does Batch Normalization use to accelerate the training of neural networks?

    • A) Reduce the problem of gradient disappearance and gradient explosion
    • B) Randomly discard neurons
    • C) Add the number of network layers
    • D) Reduce the number of weights

Solution

  1. Correct Answer: B

    Short Reason: Dropout reduces coadaptation by randomly dropping neurons, thereby enhancing the model's generalization ability and reducing overfitting.

  2. Correct Answer: A

    Short Reason: Batch Normalization alleviates the problem of gradient explosion by reducing internal covariate shifts to increase gradient stability and accelerate convergence.

Exercise 6.15

Level: ** (Moderate)

Exercise Types: Novel

Question

1. What is the working principle of dropout?

2. How does dropout affect the training process of a neural network?

3. What is the role of dropout and why does the model performance decrease if not using dropout?

Solution

1. Dropout is a common regularization method which aims at preventing overfitting in deep learning. The principle is to randomly drop a portion of the neurons in the network during training, such as setting their outputs to zero. This "drop" operation is done proportionally, typically using a hyperparameter called the dropout rate. The dropout rate indicates the probability of a neuron being dropped in each iteration. For example, if the dropout rate is 0.5, each neuron has a 50% chance of being dropped during each forward pass.

2. Dropping neurons randomly can prevent the neural network model relying on the output of individual neurons during learning. This can enhances the model's ability to generalize. Dropout can also prevent overfitting, especially when the training data is small or the model is complex.

3. The reasons are:

- Dropout prevents overfitting by randomly dropping neurons during training. When Dropout is not used during model training, all neurons participate in the computation. This will lack the randomness and lead to biased unbalanced model weight compared to the training phase.

- If the output is not properly scaled, such as multiplying specific rate like 1-p, the model may become sensitive to the inputs, and result in inaccurate predictions.

Exercise 6.16

Level: * (Easy)

Exercise Type: Novel

Question

Dropout and Batch Normalization are two widely used techniques in deep learning for improving generalization and optimization.

1) Dropout: Explain how dropout prevents overfitting in deep neural networks. How does it relate to training multiple "thinned" networks?

2) Batch Normalization: What is the primary motivation behind Batch Normalization, and how does it address internal covariate shift?

Consider a scenario where you train a deep neural network with both Dropout and Batch Normalization.

• How do these techniques interact during training, and why can their combined use sometimes lead to suboptimal performance?

• What adjustments can be made to effectively combine these techniques?

Solution

1) Dropout and Overfitting Prevention:

• Dropout randomly deactivates neurons during training, preventing co-adaptation among neurons.

• It forces the network to learn redundant, independent features, acting as an ensemble of multiple "thinned" networks.

• At test time, dropout is turned off, and the weights are scaled accordingly to approximate the effect of averaging multiple models.

2) Batch Normalization and Internal Covariate Shift:

• Internal covariate shift refers to the change in distribution of activations across layers during training, slowing down convergence.

• Batch Normalization normalizes activations within each mini-batch, ensuring a stable distribution of inputs for each layer.

• It introduces learnable parameters (scale and shift) to preserve model expressiveness.

3) Interaction of Dropout and Batch Normalization:

• Issue: Dropout introduces noise by randomly deactivating neurons, while Batch Normalization relies on stable statistics of mini-batches.

• Conflict: The randomness of Dropout disrupts the mean and variance estimates of Batch Normalization, leading to unstable training.

Adjustments for Compatibility:

• Using Dropout after Batch Normalization (rather than before) to avoid interference in mean/variance computation.

• Reducing Dropout rate when using Batch Normalization, as BatchNorm itself provides regularization.

• Alternatively, using Spatial Dropout in convolutional networks, which drops entire feature maps rather than individual neurons.

Exercise 6.17

Level: ** (Moderate)

Exercise Types: Novel

Question

This Exercise aims to explore the relationship between L-Smoothness and Lipschitz continuity of a function. We say that a function is Lipschitz if xR, L such that:

|f(x)f(y)|L|xy|

We say that a function is L-Smooth if xR, L such that:

|f(x)f(y)|L|xy|

Consider the following question:

    • Can an L-Smooth function be non-Lipschitz?** Provide an example and explain the reasoning behind your answer. Discuss the implications of this scenario and the effects it could have when considering optimization or convergence in machine learning.

Solution

Yes, an L-Smooth function can be non-Lipschitz.

Consider the function f(x)=x3/2 for x0.

First, let’s check if it is L-Smooth:

The gradient of f(x) is: f(x)=32x1/2.

For any x1,x20, we compute the difference in the gradients: |f(x1)f(x2)|=|32(x11/2x21/2)|32|x1x2|1/2.

Thus, the function is L-Smooth with a constant L=32.

Now, let’s check if it is Lipschitz:

For Lipschitz continuity, we want to show that there exists a constant L such that: |f(x1)f(x2)|L|x1x2|.

However, we compute the difference between f(x1) and f(x2): |f(x1)f(x2)|=|x13/2x23/2|32|x1x2|1/2 for small |x1x2|.

As (|x1x2|0, we see that the ratio |f(x1)f(x2)||x1x2|. Therefore, the function is not Lipschitz.

Exercise 6.18

Level: * (Easy)

Exercise Types: Novel

Question

True or False: Dropout helps improve a model's ability to generalize by making it more likely to memorize the training data.

Solution

False. Dropout actually helps reduce memorization of the training data by preventing the model from becoming overly reliant on specific neurons. By randomly turning off neurons during training, it forces the model to learn more robust and generalized features instead of memorizing specific patterns in the data. This helps the model perform better on unseen data.

Exercise 7.1

Level: ** (Moderate)

Exercise Types: Novel

References: Hesaraki, S. (2023). Feature Map. Medium. www.medium.com/@saba99/feature-map-35ba7e6c689e

This article describes more details about convolutional layers and feature maps.

Question

In this problem, we are interested in how convolutional neural networks learn information during training. For this, we will be plotting the "feature maps" of a CNN, which show the output of a convolutional layer after the learned filters have been applied to a sample image.

For this example, you can use the MNIST (handwritten digits) or the FashionMNIST (clothes) dataset. Each dataset has 60 000 greyscale (1 channel) training images that are each 28x28 pixels in size. The following script can be used to download the MNIST dataset, and a very similar one can be used for FashionMNIST:

transform = transforms.Compose([transforms.ToTensor(), transforms.Normalize((0.5,), (0.5,))])
train_dataset = torchvision.datasets.MNIST(root="./data", train=True, download=True, transform=transform)
train_loader = torch.utils.data.DataLoader(train_dataset, batch_size=64, shuffle=True)

Write a CNN that consists of 3 convolutional layers each with a kernel size of 3 and a padding of 1 pixel in thickness. Each one will learn 6 filters. After each convolutional layer, apply a ReLU activation and a pooling layer with a kernel size of 2 and a stride of 2. After that, use a fully connected hidden layer followed by the output layer (the 2 datasets mentioned above each have 10 classes).

Train the neural network for ~3 epochs. Don't worry too much about the accuracy.

After training, select a random image from the training dataset and run it through the trained model. After each of the 3 convolutional layers, make a plot of the result for each of the 6 filters. Comment on your observations.

Solution

The convolutional neural network:

Note: to save space, the Python imports are not shown here.

class SimpleCNN(nn.Module):
    def __init__(self):
        super(SimpleCNN, self).__init__()
        self.conv1 = nn.Conv2d(1, 6, kernel_size=3, padding=1)
        self.conv2 = nn.Conv2d(6, 6, kernel_size=3, padding=1)
        self.conv3 = nn.Conv2d(6, 6, kernel_size=3, padding=1)
        self.pool = nn.MaxPool2d(kernel_size=2, stride=2)
        self.fc1 = nn.Linear(6 * 3 * 3, 64)
        self.fc2 = nn.Linear(64, 10)

    def forward(self, x):
        x = self.pool(F.relu(self.conv1(x)))
        x = self.pool(F.relu(self.conv2(x)))
        x = self.pool(F.relu(self.conv3(x)))
        x = x.view(-1, 6 * 3 * 3)
        x = F.relu(self.fc1(x))
        x = self.fc2(x)
        return x
    
model = SimpleCNN()
optimizer = optim.Adam(model.parameters(), lr=0.005)
criterion = nn.CrossEntropyLoss()

for epoch in range(3): # 3 epochs
    model.train()
    for images, labels in train_loader:
        optimizer.zero_grad()
        outputs = model(images)
        loss = criterion(outputs, labels)
        loss.backward()
        optimizer.step()

The feature maps:

random_idx = np.random.randint(len(train_dataset))
image, label = train_dataset[random_idx] # getting a sample image
image = image.unsqueeze(0)

with torch.no_grad(): ### getting the feature maps
    conv1_output = F.relu(model.conv1(image)) ### feature map 1
    conv1_output_pooled = model.pool(conv1_output)
    conv2_output = F.relu(model.conv2(conv1_output_pooled)) ### feature map 2
    conv2_output_pooled = model.pool(conv2_output)
    conv3_output = F.relu(model.conv3(conv2_output_pooled)) ### feature map 3
    conv3_output_pooled = model.pool(conv3_output)

fig, axes = plt.subplots(4, 6, figsize=(6, 5))

axes[0, 0].imshow(image.reshape(28, 28), cmap="gray") # plotting the sample image
axes[0, 0].set_title("Sample Image", fontsize=10)
axes[0, 0].axis("off")

for j in range(1, 6):
    axes[0, j].axis("off")

outputs = [conv1_output, conv2_output, conv3_output]
layer_names = ["conv1", "conv2", "conv3"]

for row, (layer_output, name) in enumerate(zip(outputs, layer_names), start=1):
    for col in range(6):
        axes[row, col].imshow(layer_output[0, col].cpu().numpy(), cmap="viridis")
        axes[row, col].axis("off")
    axes[row, 0].set_title(name.title(), fontsize=10)

plt.tight_layout()
plt.show()

According to these images, the first layer detects edges (i.e., after the first layer, the image looks like a high-pass filter was applied to it, outlining the edges), while the second layer detects the rough overall shape. After the third convolutional layer, the image is very abstracted.

The feature maps for a CNN trained on the MNIST dataset, for a sample image of the digit 8.
The feature maps for a CNN trained on the FashionMNIST dataset, for a sample image of a shirt/sweater.


Exercise 7.2

Level: * (Easy)

Exercise Type: Novel

Question

Compare max pooling, average pooling, and global pooling on CIFAR-10 dataset.

Solution

import tensorflow as tf
from tensorflow.keras.models import Sequential
from tensorflow.keras.layers import Conv2D, MaxPooling2D, AveragePooling2D, GlobalMaxPooling2D, GlobalAveragePooling2D, Flatten, Dense
from tensorflow.keras.datasets import cifar10
from tensorflow.keras.utils import to_categorical
import matplotlib.pyplot as plt

# Load CIFAR-10 dataset
(x_train, y_train), (x_test, y_test) = cifar10.load_data()

# Normalize the dataset
x_train = x_train.astype("float32") / 255.0
x_test = x_test.astype("float32") / 255.0

# One-hot encode the labels
y_train = to_categorical(y_train, 10)
y_test = to_categorical(y_test, 10)

# Function to create a model with different pooling strategies
def create_model(pooling_layer):
    model = Sequential([
        Conv2D(32, (3, 3), activation='relu', input_shape=(32, 32, 3)),
        pooling_layer,
        Flatten(),
        Dense(64, activation='relu'),
        Dense(10, activation='softmax')
    ])
    model.compile(optimizer='adam', loss='categorical_crossentropy', metrics=['accuracy'])
    return model

# Pooling layers to compare
pooling_strategies = {
    'MaxPooling': MaxPooling2D((2, 2)),
    'AveragePooling': AveragePooling2D((2, 2)),
    'GlobalMaxPooling': GlobalMaxPooling2D(),
    'GlobalAveragePooling': GlobalAveragePooling2D()
}

# Train and evaluate models
results = {}
for name, pooling_layer in pooling_strategies.items():
    print(f"Training with {name}")
    model = create_model(pooling_layer)
    history = model.fit(x_train, y_train, epochs=10, batch_size=64, validation_split=0.2, verbose=0)
    test_loss, test_acc = model.evaluate(x_test, y_test, verbose=0)
    results[name] = (history, test_loss, test_acc)

# Plot training and validation accuracy
plt.figure(figsize=(12, 8))
for name, (history, _, _) in results.items():
    plt.plot(history.history['val_accuracy'], label=f"{name} (val_acc)")
plt.title('Validation Accuracy for Different Pooling Strategies')
plt.xlabel('Epochs')
plt.ylabel('Accuracy')
plt.legend()
plt.grid(True)
plt.show()

# Print test accuracies
for name, (_, _, test_acc) in results.items():
    print(f"{name}: Test Accuracy = {test_acc:.4f}")

Validation accuracy for different pooling strategies on CIFAR-10 dataset.


We can conclude the following information from the plot:

1. MaxPooling achieves the highest validation accuracy overall. It implies that MaxPooling is the most effective pooling strategy for this dataset and architecture, likely because it preserves dominant features while reducing dimensionality.

2. AveragePooling performs slightly worse than MaxPooling but follows a similar trend. It provides a smoother feature extraction method but may lose some fine details.

3. GlobalMaxPooling and GlobalAveragePooling perform significantly worse, showing that they discard too much spatial information, leading to weaker model performance on CIFAR-10.


Exercise 7.3

Level: * (Easy)

Exercise Type: Novel

Question

Consider training a deep neural network where the gradients of the loss with respect to parameters sometimes explode to very large values. To mitigate this, gradient clipping is applied with a threshold τ=5.

Let g=(g1,g2) be a gradient vector with norm |g|=g12+g22. The clipped gradient is defined as:

gclipped=gmin(1,τg). Suppose at an iteration, we have g1=6 and g2=8.

(a) Compute the clipped gradient gclipped.

(b) Explain why gradient clipping is necessary in deep networks and its effect on training dynamics.

(c) Assume we are training an LSTM with gradient clipping and a learning rate of 0.01. The norm of the unmodified gradient at time step t is |gt|=20, and the updated gradient after clipping is |gclipped,t|=5.

Compute the weight update for a parameter w given that the gradient component in that direction is gtw=10. If gradient clipping was not applied, how would the update change, and what potential issue could occur?

(d) Consider the same scenario, but now the threshold for gradient clipping is increased from τ=5 to τ=10.

Recompute the clipped gradient gclipped using this new threshold and compare it to the previously computed result. How does increasing the threshold affect the gradient update?

Solution

(a) Computing the clipped gradient: The gradient norm is:

g=62+82=10. Since |g|>τ, we apply clipping:

gclipped=g510=(6,8)0.5=(3,4). Thus, the clipped gradient is (3,4).

(b) Effect of Gradient Clipping: Gradient clipping prevents exploding gradients by rescaling large updates, stabilizing training in deep networks and recurrent models (e.g., LSTMs). It helps avoid divergence and allows for larger learning rates while preventing numerical instability.

(c) Computing the Weight Update in an LSTM with Clipping:

The clipped gradient norm is 5, meaning that the updated gradient is scaled by (5 / 20) = 0.25 of its original value. The clipped gradient for the weight w is: gclipped,tw=gtw0.25=10×0.25=2.5. The weight update using learning rate η=0.01: Δw=ηgclipped,tw=0.01×2.5=0.025. If gradient clipping was not applied:

The original update would be: Δw=0.01×10=0.1. This significantly larger update could lead to instability or divergence in training, especially in deep networks like LSTMs, where gradient magnitudes can vary significantly over time.

(d) Computing the clipped gradient with τ=10:

The gradient norm remains: g=62+82=10.

Since |g|=τ, the clipping factor is: min(1,1010)=1.

Thus, the clipped gradient remains the same: gclipped=g1=(6,8).

Since the threshold now matches the gradient norm, no clipping is applied. The update is larger compared to the previous case (τ=5), where the gradient was scaled down. A higher threshold allows for larger updates, which can speed up convergence but also increases the risk of instability if gradients are too large. A lower threshold enforces stronger clipping, stabilizing training but possibly slowing down learning.


Exercise 7.4

Level: * (Easy)

Exercise Type: Novel

Question

In convolutional neural networks (CNNs), parameter sharing is a key property that is different from fully-connected neural networks (FCNNs).

1. Explain the concept of parameter sharing in CNNs. How does it differ from fully connected layers?

2. Consider a convolutional layer with an input of size 32×32×3 (height, width, channels) and a filter of size 5×5×3. How many parameters does this filter have, including bias(es)?

3. Discuss one advantage and one limitation of parameter sharing in CNNs.

Solution

1. Concept of Parameter Sharing:

In a fully connected layer, each neuron has its own set of unique weights for every input feature, leading to a large number of parameters. In CNNs, the same set of filter weights is applied across different spatial locations, meaning the parameters are shared across the input. This greatly reduces the total number of parameters and improves generalization.

Furthermore, the concept of parameter sharing (or lack thereof) makes CNNs and FCNNs suited for different tasks. Because the same filter in a CNN is applied everywhere, a feature (like an edge or corner) will be detected regardless of where it appears in the image. For example, if a filter learns to detect cats in the top-left corner, it will also detect cats in the bottom-right. This makes CNNs well-suited for spatially structured data, such as images and videos, and work well in tasks such as object detection, segmentation, motion analysis, etc. In contrast, FCNNs are better suited for tasks where each feature is independent of its position relative to other features, such as tabular datasets. Examples of this include customer data in a marketing problem (e.g., demographics, spending habits, etc.), healthcare records, business analytics, etc.

2. Computing Parameters:

Weight parameter(s): 5×5×3=75. The size of a filter includes all 3 of its dimensions.

Bias parameter(s): 1. Each filter has one bias, regardless of dimensions.

Total parameters per filter: 75+1=76

Therefore, a single convolutional filter of size 5×5×3 has 76 parameters in total.

3. Advantages and limitations:

Advantage: Parameter sharing reduces the number of parameters; this is more computationally efficient than having many parameters and also makes CNNs less prone to overfitting.

Additional note: Parameter sharing is particularly useful for lower-layer filters, like edge detectors, which are applied across the entire image.Since CNNs are naturally equivalent to translation, meaning that when the image shifts, the feature map shifts similarly, this allows CNNs to detect features like edges and corners anywhere in the image, which improves generalization and helps to capture spatial hierarchies. By sharing filters/parameters, CNNs use fewer parameters, making them more efficient and less likely to overfit.


Limitation: Parameter sharing assumes that the learned features are equally useful across the entire input, which may not be ideal for tasks where spatial location is important (e.g., detecting objects in fixed positions).

Additional note: Since parameter sharing assumes that the same features (like edges, textures, etc.) are equally important throughout the entire image, this works well for detecting general patterns that can appear anywhere. However, for tasks where the specific location of features matters, a feature might be crucial in one part of the image (like the top-left corner) but irrelevant in another part (like the bottom-right corner), applying the same filter everywhere cannot capture location-specific features effectively. Solutions include including deformable convolutions to allow adaptive receptive fields and self-attention mechanisms to capture long-range dependencies.

Exercise 7.5

Level: * (Easy)

Exercise Type: Novel

Question

Given an image matrix and a filter matrix, compute both the cross-correlation and convolution outputs without padding and using a stride of 1.

Image Matrix: I=[123456789]

Filter Matrix: K=[0110]

1. Compute the cross-correlation output.

2. Compute the convolution output.

3. Explain why cross-correlation is used in deep learning instead of convolution.

4. Give intuitive examples of cross-correlation and convolution.

Solution

1. Cross-correlation:

Cross-correlation applies the filter as is, without flipping it.

O(i,j)=mnI(i+m,j+n)K(m,n)

For each position:

(1,1): (1×0)+(2×1)+(4×1)+(5×0)=2

(1,2): (2×0)+(3×1)+(5×1)+(6×0)=2

(2,1): (4×0)+(5×1)+(7×1)+(8×0)=2

(2,2): (5×0)+(6×1)+(8×1)+(9×0)=2

O=[2222]

Sample python code to solve this is shown below

import numpy as np

I = np.array([[1,2,3],[4,5,6],[7,8,9]])
K = np.array([[0,1],[-1,0]])

output = np.empty((2,2))

for i in range(2):
    for j in range(2):
        output[i,j] = np.sum(I[i:i+2,j:j+2]*K)


2. Convolution:

Convolution first flips the filter horizontally and vertically before applying it.

O(i,j)=mnI(im,jn)K(m,n)=mnI(i+m,j+n)K(m,n)


Flipped Filter: Kflipped=[0110]

Applying the flipped filter:

(1,1): (1×0)+(2×1)+(4×1)+(5×0)=2

(1,2): (2×0)+(3×1)+(5×1)+(6×0)=2

(2,1): (4×0)+(5×1)+(7×1)+(8×0)=2

(2,2): (5×0)+(6×1)+(8×1)+(9×0)=2


O=[2222]


3. In deep learning, we use cross-correlation instead of convolution because flipping the filter (as done in convolution) is not needed. In CNNs, filters are learned automatically, so the model adjusts their weights without requiring a flip. Skipping this step makes computations simpler and faster while still detecting the same features. Since CNNs learn patterns during training, using cross-correlation instead of convolution does not change the results, making it the preferred choice in deep learning.


4. Imagine you are using a blur filter (like an averaging filter) on an image. You take a small patch of the image and overlay the filter as it is, computing the weighted sum at each step. This process is effectively cross-correlation because we apply the filter without flipping. Now, instead of directly applying the filter, imagine you flip it both horizontally and vertically before using it. In practical applications, this doesn’t change much for symmetric filters (like a Gaussian blur), but for asymmetric filters, flipping alters the output.

Exercise 7.6

Level: * (Easy)

Exercise Types: Novel

Question

1. What architecture makes Convolutional Neural Networks (CNNs) different than a standard feedforward neural networks?

2. What type of domain benefits most due to these differences?

Solution

1)

  • Local Connectivity: In CNNs, each neuron is only connected to a localized region of the input rather than to all input units as in fully connected layers. This local connectivity make sure the model can be sparse if necessary,making it more efficient and reducing overfitting.
  • Weight Sharing: A filter with fixed weights is applied across different locations of the input. This reduces the total number of parameters compared to fully connected networks, significantly lowering computational complexity and enhancing generalization.
  • Translation Equivariance: Because the same filter slides over the input, the model can easily recognize features with different locations.
  • Pooling Operations: Pooling reduces the dimensions of layers, making the model more robust to small changes. This also helps reduce dimensionality and computation.
  • Hierarchical Feature Learning: CNNs learn a hierarchy of features, from low-level in the earlier layers to high-level features in the deeper layers. This hierarchical structure makes CNNs highly effective for complex tasks like image recognition and object detection.

2) Due to the above unique properties, CNNs are best suited for data that store information or meaning in a spatial format. The classical example is images, which encode meaning due to the specific spatial arraingments of the pixels. In other words, reordering the pixel data in an image would destroy its information, and hence CNNs perform the best for these types of data.

Exercise 7.7

Level: * (Easy)

Exercise Types: Novel

Question

Sobel filter is a popular edge-detection filter. Sobel filter can be seen as combining:

A 1D derivative filter, [1 0 1], in one direction and a 1D “blur” filter, [121], in the other direction


1. Horizontal Sobel Filter

It is often written as [101202101].

See how this comes from multiplying [121] by [1 0 1]

2. Vertical Sobel Filter

Construct the 3×3 matrix for the vertical Sobel filter by swapping the roles of “blur” and “derivative,” and write it out explicitly.

3. Application

Given the 3×3 image patch [222257169], apply your vertical Sobel filter to the center pixel (i.e., do a 3×3 convolution) and calculate the filter’s response.

Hint: For the vertical Sobel, think of smoothing left-to-right, then taking the derivative top-to-bottom.

Solution

Step 1. Horizontal Sobel Filter (Review)

We can write a vertical blur filter as Bv=[121] and a horizontal derivative filter as Dh=[101]. Their outer product gives Shorizontal=Bv×Dh=[101202101].

Step 2. Vertical Sobel Filter

For vertical edge detection, we blur horizontally and differentiate vertically. Thus, let Bh=[1 2 1] (horizontal blur) and Dv=[101] (vertical derivative). The vertical Sobel kernel is their outer product: Svertical=Dv×Bh=[121000121].

Step 3. Applying the Vertical Sobel Filter

Consider the image patch I=[222257169],

The filter response at the center pixel is given by the sum of element‐wise products: Response=i=13j=13(Svertical(i,j)I(i,j)).

Computing row by row:

    • Top row: (1×2)+(2×2)+(1×2)=2+4+2=8
    • Middle row: (0×2)+(0×5)+(0×7)=0
    • Bottom row: ((1)×1)+((2)×6)+((1)×9)=1129=22

Summing these:

8+022=14.

Hence, the vertical Sobel filter response at the center pixel is 14, indicating a strong downward-to-upward intensity change in that region.

Exercise 7.8

Level: * (Easy)

Exercise Types: Novel

Question

Answer whether the following statements about Convolutional Neural Networks (CNNs) are True or False.

1.CNNs are designed to work only with grayscale images.

2.Pooling layers in CNNs help reduce the spatial dimensions of the input while preserving important features.

3.Fully connected layers in a CNN help maintain spatial relationships between pixels.

Solution

1.False – CNNs can process images with multiple channels, such as RGB images (three channels) or even hyperspectral images with many channels.

2.True – Pooling operations, such as max pooling, downsample the feature maps, reducing computational complexity and helping prevent overfitting while retaining essential features.

3.False – Fully connected layers discard spatial relationships since they treat the input as a single vector, unlike convolutional layers that preserve spatial structure. Fully connected layers flatten the feature maps into a one-dimensional vector, discarding spatial relationships. Unlike convolutional layers, which preserve spatial structure, fully connected layers focus on high-level feature abstraction.



Exercise 7.9

Level: * (Easy)

Exercise Types: Novel

Question

In the context of Convolutional Neural Networks (CNNs), explain the following concepts and their significance in image-based deep learning tasks:

(a) How do convolutional layers reduce the number of parameters compared to fully connected layers, and why is this advantageous?

(b) What role do pooling layers (e.g., max-pooling) play in achieving translation invariance?

(c) How does the hierarchical structure of CNNs (e.g., stacking convolutional and pooling layers) enable the learning of complex features from raw pixel data?

Solution

(a) Convolutional layers apply small filters (kernels) that slide across the input image, computing dot products locally. These filters are shared across all spatial positions (e.g., a 3×3 kernel uses the same weights for every patch of the image). It can reduce memory requirements, train models faster, and reduce overfitting.

(b)Pooling downsamples feature maps by aggregating local regions (e.g., 2×2 windows). Max-pooling selects the maximum activation in each window. It reduces overfitting by compressing spatial dimensions and prioritizes the presence of features over their exact location.

(c) Early Layers: Detect low-level features (edges, corners, colors).

Example: A 3×3 filter might activate for horizontal edges.

Middle Layers: Combine edges into textures or shapes (e.g., circles, stripes).

Example: A filter might respond to "eye-like" patterns.

Deep Layers: Assemble shapes into high-level semantic features (e.g., faces, objects).

Exercise 7.10

Level: * (Easy)

Exercise Types: Novel

References: A. Ghodsi, STAT 940 Deep Learning: Lecture 7, University of Waterloo, Winter 2025.

Question

In Lecture 07a Convolutional Networks, images of the output of a convolution with a 3x3 kernel with the first column being -1, the middle column being 0, and the right column being 1

K=[101101101]

was shown as a demonstration of how convolutions when applied on images can be used to find vertical edges. (The images of elephants from the MATLAB script shown in the lecture video)

Manually implement a script which does this in Python. Import a random sample image from anywhere, take the mean of the RGB channels (just apply the convolution on a single channel for demonstration purposes), define the 3x3 convolution kernel, then use for loops to traverse the image and apply how the convolution works when implemented on an image

Solution

from skimage import data
import numpy as np
import matplotlib.pyplot as plt

#Sample image from skimage library
image = data.astronaut() 

#Convert to greyscale
image_greyscale = np.mean(image, axis=2) 

#3x3 kernel, the same as was implimented in the lecture
kernel = np.array([[-1, 0, 1], [-1, 0, 1], [-1, 0, 1]]) 

#Normalize the image
image_greyscale = image_greyscale / 255.0

#Define an empty np array to store the image, note it will be 2 less pixels as we are not doing any padding
convolution_output = np.empty([image_greyscale.shape[0]-2, image_greyscale.shape[1]-2])

#Loop across the x y pixels of the image
for i in range(image_greyscale.shape[0]-2):
    for j in range(image_greyscale.shape[1]-2):
        #Loop across the x y pixels of the kernel
        for k in range(3):
            for l in range(3):
                #Take the sum of the kernel times the pixels at the given window in the image
                convolution_output[i, j] += image_greyscale[i+k, j+l] * kernel[k, l]   

#Plot figures                
fig, axs = plt.subplots(1, 3, figsize=(10, 5))
axs[0].imshow(image_greyscale, cmap='gray')
axs[0].set_title('OriginalImage')
axs[0].axis('off')
axs[1].imshow(kernel, cmap='gray')
axs[1].set_title('Kernel')
axs[1].set_ylim(-0.5,2.5)
axs[2].imshow(convolution_output, cmap='gray')
axs[2].set_title('Convolution Output')
axs[2].axis('off')
plt.show()


Output of the script above



Exercise 7.11

Level: * (Easy)

Exercise Types: Novel

Question

Padding and stride affect the behavior of a convolutional layer.

1. Suppose a CNN applies a 3×3 filter to an input of size 32×32 with zero-padding P and stride S. Compute the minimum and maximum values of P and S such that the output feature map remains at least 16×16.

2. Show how "same" padding and "valid" padding affect the output size differently.

3. Given the following scenarios, compute the output size:

· 3×3 filter, P=1,S=1 on 64×64 input.

· 5×5 filter, P=2,S=2 on 64×64 input.

Solution

Convolution Formula: O=(WK+2P)/S+1, where W is the input size, K is the filter size, P is the padding, and S is the stride.

1. Condition for a 32×32 input, 3×3 filter, and output at least 16×16

For W=32 and K=3, O=(323+2P)/S+1=(29+2P)/S+1.

Requiring O16 gives: (29+2P)/S1529+2P15S.

Thus, for a given S, we must have: P(15S29)/2, and for a given P, the stride must satisfy: S(29+2P)/15.

2. Same Padding and Valid Padding

· Same Padding: Choose P=(K1)/2. For a 3×3 filter, P=1, so when S=1, O=(323+2×1)/1+1=32.

· Valid Padding: No padding, i.e., P=0. In this case, O=(323+0)/1+1=30.

3. Output size for specific cases

· 3×3 filter, P=1,S=1, input 64×64: O=(643+2×1)/1+1=64.

· 5×5 filter, P=2,S=2, input 64×64: O=(645+2×2)/2+1=(645+4)/2+1=(63/2)+1=31+1=32


Exercise 7.12

Level: * (Easy)

Exercise Types: Novel

Question

1. Given an input of size 32×32, a 2×2 max-pooling layer with stride 2 is applied. Compute the output size.

2. Compare the effects of max pooling, average pooling, and global average pooling in terms of information retention.

3. If a CNN has 4 pooling layers (each using 2×2 pooling with stride 2), how does this affect the final feature map size when the original input is 256×256?

Solution

1.

Given an input of size 32×32, applying a 2×2 max-pooling layer with stride 2 reduces each spatial dimension by a factor of 2. This is because the pooling window "slides" 2 pixels at a time and computes the maximum value within each non-overlapping 2×2 region.

Thus, the output dimensions will be:

32/2×32/2=16×16

2.

·Max Pooling:

Operation: For each pooling region, the maximum value is selected.

Information Retention:

Advantages:

Retains the most dominant (i.e., strongest) feature within each region. Helps the network become invariant to small translations.

Disadvantages:

Discards other information in the region. May lose details that could be useful for fine-grained distinctions.

·Average Pooling:

Operation: For each pooling region, the average (mean) of the values is computed.

Information Retention:

Advantages:

Retains a summary of the entire region by capturing the overall average activation. Can provide a smoother representation of the features.

Disadvantages:

Can dilute strong signals since it blends them with lower values. May not emphasize the presence of a distinctive feature as strongly as max pooling.

·Global Average Pooling (GAP):

Operation: The average is computed over the entire spatial dimensions of each feature map, reducing each feature map to a single scalar value.

Information Retention:

Advantages:

Reduces the feature map to a vector (one value per channel), which can drastically reduce the number of parameters. Forces the network to identify the overall presence of a feature rather than its precise location, often acting as a strong regularizer. Commonly used in the final layer for classification tasks.

Disadvantages:

Completely removes spatial information, which might be necessary for tasks requiring localization. Provides a very coarse summary of the feature map.

3.

After 1st Pooling: 256÷2=128⇒128×128

After 2nd Pooling: 128÷2=64⇒64×64

After 3rd Pooling: 64÷2=32⇒32×32

After 4th Pooling: 32÷2=16⇒16×16

Thus, the final feature map size will be 16×16.

Exercise 7.13

Level: * (Easy)

Exercise Types: Novel


Question

Given the input image

I=[1230145612789231325424135]

and single filter K=[101101101]

The Convolutional layer employs a single filter K of size 3*3, and the filter weights are defined by the matrix K, with no padding, no bias, no activation, and stride=1.


1. Calculate the output feature map size.

2. Compute the output feature map.

Solution

1.

Since the input size is (5×5) and the filter is (3×3), the output feature map size is given by the formula:

O=(IK+2P)S+1

where: O=Outputsize

I=5(Inputsize)

K=3(Kernelsize)

P=0(Padding)

S=1(Stride)


Substituting the values: O=(53+2(0))1+1

O=(53)1+1=21+1=3

Thus, the output feature map will be 3×3.

2.

Since the input size is (5×5) and the filter is (3×3), we perform convolution with a stride of 1 and no padding.

InputImage(5×5)[1230145612789231325424135]

Filter(3×3)[101101101]


The convolution is performed by sliding the filter over the input and computing the dot product.

FirstPosition(Topleftcorner)[123456789]

Applying element-wise multiplication with the filter: (1×1)+(2×0)+(3×1)+(4×1)+(5×0)+(6×1)+(7×1)+(8×0)+(9×1)

=1+03+4+06+7+09=6

NextPosition(MoveRight)[230561892]

Applying element-wise multiplication: (2×1)+(3×0)+(0×1)+(5×1)+(6×0)+(1×1)+(8×1)+(9×0)+(2×1)

=2+0+0+5+01+8+02=12

NextPosition(MoveRight)[301612923]

Applying element-wise multiplication: (3×1)+(0×0)+(1×1)+(6×1)+(1×0)+(2×1)+(9×1)+(2×0)+(3×1)

=3+01+6+02+9+03=12

Similarly for the 2nd and 3rd rows......

FinalOutputFeatureMap(3×3)[61212588250]


Exercise 7.14

Level: * (Moderate)

Exercise Types: Copied

Reference: Calin, Ovidiu. Deep learning architectures: A mathematical approach. Springer, 2020, page 541

Question

Explain why between two networks with the same input and the same depth and width, a CNN is less prone to overfitting than a fully-connected neural network.

Solution

1. CNN's use less weights due to weight sharing, weights are shared across the inputs resulting in less parameters. CNN's can be viewed as a fully connected layer with a sparse weight matrix. For example, a 2x1 1d convolutional kernel [w1,w2] performed on a input vector x=[x1,...,x6]T resulting in an output vector y=[y1,...,y5]T, can be written as a fully connected layer y=σ(Wx), where

W=(w1w200000w1w200000w1w200000w1w200000w1w2)

2. CNN's use local connections, meaning each neuron only connects to a small patch of the input. This enforces a prior that nearby pixels in images contain more relevant features, reducing the model's flexibility and making it less likely to memorize random noise. In contrast, fully connected layers assume all input features are equally important by connecting all neurons, leading to more variance in learned patterns and a higher risk of overfitting.

3. Convolutional layers are translation-invariant, meaning data augmentation techniques such as rotating, flipping, and cropping images will help CNN's generalize more. In contrast, fully connected layers rely on exact pixel locations.

4. CNNs detect edges and other features through convolutions and pooling layers and is spatial invariant, meaning that they can be detected no matter where they appear in the image. In contrast, fully connected layers struggle to detect such features

Others are encouraged to add on/modify reasoning to why CNN's are less prone to overfitting.

Exercise 7.15

Level: ** (Moderate)

Exercise Types: Modified

Reference: Mooney, P. T. (2018). Chest X-Ray Images (Pneumonia) [Dataset]. Kaggle. Retrieved from Kaggle. For finding the dataset search the keywords in Google.

Question

Train a Convolutional Neural Network (CNN) to classify chest X-ray images as either normal or showing pneumonia. Use data augmentation to improve generalization. Visualize CNN feature maps to understand what the model learns. Find the dataset in the reference.

Solution

First step is the Data Preprocessing:

import tensorflow as tf
from tensorflow.keras.preprocessing.image import ImageDataGenerator
import matplotlib.pyplot as plt

# Define dataset paths
dataset_path = "chest_xray/"

# Data preprocessing
datagen = ImageDataGenerator(rescale=1./255)

train_data = datagen.flow_from_directory(
    dataset_path + "train",
    target_size=(150, 150),
    batch_size=32,
    class_mode='binary'
)

val_data = datagen.flow_from_directory(
    dataset_path + "val",
    target_size=(150, 150),
    batch_size=32,
    class_mode='binary'
)

test_data = datagen.flow_from_directory(
    dataset_path + "test",
    target_size=(150, 150),
    batch_size=32,
    class_mode='binary',
    shuffle=False
)

Next, build the model by utilizing multiple convolutional layers to detect pattern in chest X-rays:

from tensorflow.keras import layers, models

# Build CNN model
model = models.Sequential([
    layers.Conv2D(32, (3, 3), activation='relu', input_shape=(150, 150, 3)),
    layers.MaxPooling2D(2, 2),
    layers.Conv2D(64, (3, 3), activation='relu'),
    layers.MaxPooling2D(2, 2),
    layers.Conv2D(128, (3, 3), activation='relu'),
    layers.MaxPooling2D(2, 2),
    layers.Flatten(),
    layers.Dense(128, activation='relu'),
    layers.Dropout(0.5),
    layers.Dense(1, activation='sigmoid')
])

# Compile the model
model.compile(optimizer='adam', loss='binary_crossentropy', metrics=['accuracy'])

# Train the model
history = model.fit(train_data, validation_data=val_data, epochs=10)

# Evaluate the model
test_loss, test_acc = model.evaluate(test_data)
print(f"Test Accuracy: {test_acc:.2f}")

Now, by visualizing the feature maps of different layers, we are able to understand how the CNN makes decisions:

import numpy as np
import matplotlib.pyplot as plt

# Select a test image
img_path = test_data.filepaths[0]
img = tf.keras.preprocessing.image.load_img(img_path, target_size=(150, 150))
img_array = tf.keras.preprocessing.image.img_to_array(img) / 255.0
img_array = np.expand_dims(img_array, axis=0)

# Extract feature maps
layer_outputs = [layer.output for layer in model.layers if 'conv' in layer.name]
activation_model = tf.keras.models.Model(inputs=model.input, outputs=layer_outputs)
activations = activation_model.predict(img_array)

# Plot feature maps
fig, axes = plt.subplots(nrows=1, ncols=len(activations), figsize=(20, 5))
for i, activation in enumerate(activations):
    axes[i].imshow(activation[0, :, :, 0], cmap='viridis')
    axes[i].axis('off')
plt.show()


Exercise 7.16

Level: ** (easy)

Exercise Types: Novel

References: Ghodsi, A. (2025). Convolutional Neural Networks. Deep Learning.

Question

Design a simple CNN architecture to understand the structure and parameter efficiency of convolutional layers. Assume you are processing a grayscale image of size 28x28 pixels:

1. Create a CNN with:

  - One convolutional layer with 8 filters of size 3x3, stride 1, padding 'valid'.
  - ReLU activation function for the convolutional layer.
  - A max pooling layer after the convolutional layer with pool size 2x2 and stride 2.

2. Calculate the total number of parameters that need to be learned in this CNN. 3. Discuss the benefits of using small filter sizes and pooling layers in CNNs.

Solution

1. **CNN Architecture Specifications:**

  - Convolutional layer with 8 filters, each filter of size 3x3, applied to the grayscale input image of size 28x28.
  - Each convolutional filter has 9 weights (3x3) and 1 bias, applied without padding ('valid').
  - ReLU activation function is used to introduce non-linearity.
  - Max pooling layer with a pool size of 2x2 reduces spatial dimensions by half, due to stride 2.

2. **Parameter Calculation:**

  - **Convolutional Layer Parameters:**
    - Number of filters = 8
    - Weights per filter = 3x3 = 9
    - Biases per filter = 1
    - Total parameters = 8 filters x (9 weights + 1 bias) = 8 x 10 = 80 parameters

3. **Discussion on Benefits of Small Filter Sizes and Pooling Layers:**

  - **Small Filter Sizes:**
    - Small filters such as 3x3 allow the network to capture basic visual features such as edges and textures with fewer parameters, enhancing generalization capabilities.
    - Using multiple small filters can effectively capture various aspects of the input data while keeping the network compact and efficient.
  - **Pooling Layers:**
    - Pooling layers reduce the spatial dimensions of the feature maps, which decreases the computational load for subsequent layers.
    - By downsampling the feature maps, pooling layers also help to make the detection of features invariant to small shifts and distortions in the input image, enhancing the model's robustness to variations in input data.

Exercise 7.17

Level: * (easy)

Exercise Types: Novel

Question

Input Matrix:

[13245687910121113141516]

Perform the max pooling operation on the input matrix with a 2x2 filter and a stride of 2.

Solution

Question

Input Matrix:

[13245687910121113141516]

Perform the max pooling operation on the input matrix with a \(2 \times 2\) filter and a stride of 2.

Solution

Step 1: Divide the input matrix into non-overlapping \(2 \times 2\) regions based on the given stride.

- Region 1 (Top-left):

 [math]\displaystyle{   
  \begin{bmatrix}  
  1 & 3 \\  
  5 & 6  
  \end{bmatrix}  
  \Rightarrow \max(1, 3, 5, 6) = 6  
   }[/math]  

- Region 2 (Top-right):

 [math]\displaystyle{   
  \begin{bmatrix}  
  2 & 4 \\  
  8 & 7  
  \end{bmatrix}  
  \Rightarrow \max(2, 4, 8, 7) = 8  
   }[/math]  

- Region 3 (Bottom-left):

 [math]\displaystyle{   
  \begin{bmatrix}  
  9 & 10 \\  
  13 & 14  
  \end{bmatrix}  
  \Rightarrow \max(9, 10, 13, 14) = 14  
   }[/math]  

- Region 4 (Bottom-right):

 [math]\displaystyle{   
  \begin{bmatrix}  
  12 & 11 \\  
  15 & 16  
  \end{bmatrix}  
  \Rightarrow \max(12, 11, 15, 16) = 16  
   }[/math]  

Step 2: Construct the output matrix from the maximum values of each region.

Output Matrix:

[681416]


Exercise 7.18

Level: * (Easy)

Exercise Type: Novel

References: A. Ghodsi, STAT 940 Deep Learning: Lecture 7, University of Waterloo, Winter 2025.

Question

When a Convolutional Neural Network (CNN) is being trained, normalization is a helpful technique to stabilize that process.

1. What is one benefit of Filter Response Normalization (FRN) when training a Convolutional Neural Network (CNN)?

2. Additionally, some networks are designed to be normalizer-free. Name one normalizer-free technique and a benefit it provides.

Solution

1. One benefit of using Filter Response Normalization when training a CNN is that it prevents batch elements from influencing each other by normalizing channels independently, which helps improve the performance of the model. It also supports stable training across various batch sizes and network architectures. Note that, unlike Batch Normalization (BN), FRN does not depend on batch statistics (mean and variance across a batch), making it more robust for small batch sizes and applicable to batch-independent inference. It ensures positive activations and controls feature scale, which leads to better gradient flow and reducing internal covariate shift.

2. One normalizer-free technique is Adaptive Gradient Clipping. This technique ensures that the norm of the gradient never exceeds a certain value by dynamically adjusting the clipping strength during training. It helps prevent CNNs from facing exploding gradients, which makes it useful when training large-scale CNNs.

Exercise 7.19

Level: ** (Moderate)

Exercise Type: Modified

References: Calin, Ovidiu. Deep learning architectures: A mathematical approach. Springer, 2020. Exerciese 16.9.3

Question

Consider a 3×3 kernel K=[121000121]

a) What is the effect of this convolution kernel?

b) What is the effect of the transpose kernel KT?

Solution

a) Suppose we want to perform the convolution to a 3×3 matrix [a11a12a13a21a22a23a31a32a33][121000121]=a11a31+2(a12a32)+(a13a33), the effect is to subtracting the third row from the first row, showing differences in vertical pixel intensity. If there is a sharp intensity change from one row to another, the kernel will produce a large response, highlighting the presence of a horizontal edge. If the intensity remains constant across rows, the convolution will output near zero, meaning no edge is detected.

(b) It is similar to part (a), the only difference is that KT filters the vertical edges.

Exercise 7.20

Level: * (Easy)

Exercise Type: Novel

Question

Consider a convolutional neural network (CNN) used for image classification. The network consists of a convolutional layer followed by a max-pooling layer. The convolutional layer uses a 3x3 kernel with a stride of 1, and the max-pooling layer uses a 2x2 kernel with a stride of 2. Given an input image of size 32x32 with 3 color channels (RGB), calculate the dimensions of the output feature map after passing through both the convolutional and max-pooling layers.

Solution

1. Convolutional Layer:

- Input size: 32×32×3 (height × width × channels)
- Kernel size: 3×3
- Stride: 1
- Padding: Assuming no padding (i.e., valid convolution)

The formula to calculate the output size after convolution is:

Output size=Input sizeKernel sizeStride+1

Applying this to the height and width: Output height=3231+1=30

Output width=3231+1=30

Therefore, the output feature map after the convolutional layer is 30×30×N, where N is the number of filters in the convolutional layer.

2. Max-Pooling Layer:

- Input size: 30×30×N
- Kernel size: 2×2
- Stride: 2

The formula to calculate the output size after max-pooling is: Output size=Input sizeKernel sizeStride+1


Applying this to the height and width: Output height=3022+1=15


Output width=3022+1=15

Therefore, the final output feature map after the max-pooling layer is 15×15×N.


Exercise 7.21

Level: * (Moderate)

Exercise Type: Novel

Question

X=[1230145610789213210456789]. Do convolution operation by kernel feature K=[101101101] with a stride of 1. Later, apply RELU activation function ReLU(x)=max(0,x). Next, apply 2*2 maxpooling with stride 1. Finally, flattening then pass vector to a fully connected layer with weights W=[0.5,0.5,1,1] and bias b=2.

Solution

After sliding kernel feature K, we obtain C=[666666999]. After applying RELU to C, we obtain C=[660660990]. Applying maxpooling, we obtain P=[6699]. Flattening converts P into V=[6,6,9,9]. Passing V to a fully connected layer Z=VWT+b, we obtain Z = (3 - 3 + 9 - 9 + 2) = 2.


Exercise 7.22

Level: * (Moderate)

Exercise Type: Novel

Question

Given two 1D signals:

x=[3 1 2 1]

h=[2 0 1]

1. Compute the convolution of x and h.

2. Compute the cross-correlation of x and h

Solution

Step 1: Compute the Convolution

The convolution of x and h is given by:

y[n]=(xh)[n]=kx[k]h[nk]

This means we flip h and slide it across x, computing the dot product at each position.

Flip h: hflip=[1 0 2]

y=[32 30+12 31+10+22 11+20+(1)2 21+(1)0 (1)1].

y=[6 2 7 1 2 1].

Thus, the convolution result is y=[6 2 7 1 2 1].

Step 2: Compute the Cross-Correlation

The cross-correlation is rx,h[n]=kx[k]h[k+n]

This time, we do not flip h:

r=[31 30+11 32+10+21 12+20+(1)1 22+(1)0 (1)2]

r=[3 1 8 1 4 2]

The cross-correlation result is r=[3 1 8 1 4 2].


Exercise 7.23

Level: ** (Moderate)

Exercise Type: Novel

Question

Let f:RH×W×CRH×W×C represent a convolutional layer in a CNN with kernel size k×k, stride s and zero padding p. Assume the layer has C output channels and uses a standard linear convolution operation without depthwise separability or dilation. Then, increasing k while keeping s, p and C fixed always results in a strictly larger receptive field and an increase in the number of learnable parameters.

Is this true?

Solution

False.

While increasing 𝑘 typically expands the receptive field, the change is not necessarily strictly larger in all cases, especially if the stride or padding is also adjusted to maintain spatial dimensions. Furthermore, the number of parameters increases only if standard convolution is used. If a factorized convolution (e.g., depthwise separable convolution or low-rank approximation) is applied, increasing k does not necessarily lead to a parameter increase. Additionally, in architectures like dilated CNNs, effective receptive field growth is not solely dependent on 𝑘.

Exercise 7.24

Level: ** (Moderate)

Exercise Types: Novel

Question

In Convolutional Neural Networks (CNNs), convolution operations exhibit equivariance to input transformations, while pooling operations enhance invariance to such transformations.

1. Prove that the convolution operation is equivariant to translation. That is, given an input x(i) and a convolutional kernel w(i), if the input is translated by k, the output feature map is also translated accordingly:

(xw)(i)=jx(j)w(ij)

Show that:

(Tkxw)(i)=Tk(xw)(i)

Where Tk denotes a translation by k units.

2. Explain how pooling operations disrupt equivariance and enhance model invariance.

Solution

1. Proof of Equivariance in Convolution:

The convolution operation is defined as:

(xw)(i)=jx(j)w(ij)

Let Tkx(i) denote a translation by k units:

(Tkx)(i)=x(ik)

Computing convolution after translation:

(Tkxw)(i)=jx(jk)w(ij)

Computing translation after convolution:

Tk(xw)(i)=(xw)(ik)=jx(j)w(ikj)

Using a variable substitution j=jk, we get:

Tk(xw)(i)=jx(j)w(ij)

Since both expressions are identical, we conclude that: (Tkxw)(i)=Tk(xw)(i)


2. How Pooling Enhances Invariance

- Pooling (such as max pooling or average pooling) operates on local windows (e.g., 2×2 or 3×3) and selects a representative value.

- For example, in max pooling, as long as the maximum value in the window stays the same despite small translations, the output remains unchanged.

- Small shifts in input may not change the pooling result because the max or average value in the window may remain unchanged.

- This makes CNNs more robust to minor translations, improving generalization to real-world variations.


Exercise 8.1

Level: * (Easy)

Exercise Types: Novel

Question

In relation to Gated Recurrent Units (GRUs), write a Python script to:

  1. Simulate a sequence of 20 time steps where the input xt is a sinusoidal wave.
  2. Use a simple GRU cell with randomly initialized weights.
  3. Visualize the evolution of the hidden state ht over time.

Solution

import numpy as np
import matplotlib.pyplot as plt

# Sigmoid and tanh activation functions
sigmoid = lambda x: 1 / (1 + np.exp(-x))
tanh = lambda x: np.tanh(x)

# Initialize weights randomly
np.random.seed(42)
W_z, U_z, b_z = np.random.randn(3) * 0.5
W_r, U_r, b_r = np.random.randn(3) * 0.5
W_h, U_h, b_h = np.random.randn(3) * 0.5

# Generate sinusoidal input sequence
timesteps = 20
x_seq = np.sin(np.linspace(0, 4 * np.pi, timesteps))

# Initialize hidden state
h_t = 0
hidden_states = []

# GRU forward pass
for x_t in x_seq:
    z_t = sigmoid(W_z * x_t + U_z * h_t + b_z)
    r_t = sigmoid(W_r * x_t + U_r * h_t + b_r)
    h_tilde_t = tanh(W_h * x_t + U_h * (r_t * h_t) + b_h)
    h_t = (1 - z_t) * h_t + z_t * h_tilde_t
    hidden_states.append(h_t)

# Plot hidden state evolution
plt.plot(hidden_states, label="Hidden State h_t")
plt.xlabel("Time step")
plt.ylabel("Hidden State Value")
plt.title("GRU Hidden State Evolution")
plt.legend()
plt.show()

The plot shows how the hidden state ht evolves over time as it processes the sinusoidal input.


Exercise 8.2

Level: * (Easy)

Exercise Types: Novel

Question

In Lecture 8, about BPTT algorithm, write the expression of LU. Explain why the vanishing and exploding gradient problem occurs in BPTT and how it affects training.


Solution

LU=tLtU=tLtStStU=t(something computable)xt

The vanishing and exploding gradient problem occurs in BPTT because gradients are backpropagated through many time steps. If weights are small, gradients shrink exponentially, making learning slow (vanishing gradients). If weights are large, gradients grow exponentially and leads to instability (exploding gradients). Gradient Clipping can be implemented to limit gradient magnitudes and prevent instability.

The vanishing and exploding gradient problem in BPTT occurs due to repeated multiplication of Jacobian matrices over many time steps.

Why It Occurs

1. Gradient Propagation During BPTT, the gradient of the hidden state s_t with respect to the initial state \( s_0 \) is calculated as: sts0=k=1tsksk1.

Each Jacobian matrix sksk1  is defined as: sksk1=diag(1tanh2(ak))W , where W is the recurrent weight matrix.

2. Eigenvalues of W The eigenvalues of \( W \) determine the behavior of gradients:

  • If (|λ|<1), the product shrinks exponentially, causing vanishing gradients.
  • If (|λ|>1), the product grows exponentially, causing exploding gradients.

How It Affects Training

1. Vanishing Gradient

  • Gradients become too small, slowing learning and preventing the network from capturing long-term dependencies.
  • The model focuses only on short-term relationships.

2. Exploding Gradient

  • Gradients become excessively large, leading to numerical instability.
  • The optimization process may diverge, making training unreliable.


Exercise 8.3

Level: *** (Difficult)

Exercise Type: Novel

Question

Recurrent Neural Networks (RNNs) suffer from the vanishing and exploding gradient problem due to the repeated multiplication of Jacobians through time steps.

Consider a simple RNN with a hidden state update equation:

ht=tanh(Wht1+Uxt+b)

where W is the recurrent weight matrix, U is the input weight matrix, and xt is the input at time step t. Explain why the gradient of the loss with respect to W can either explode or vanish over long time steps.

Assume the eigenvalues of W are given by λ1,λ2,...,λn. What condition on λi would lead to the vanishing gradient problem, and what condition would cause the exploding gradient problem?

To mitigate these issues, gradient clipping is often applied during backpropagation through time (BPTT). Suppose we apply gradient clipping with a threshold τ=1 to a gradient g=(g1,g2,g3) with norm |g|=5. Compute the clipped gradient vector.

Solution

Why Gradients Vanish or Explode:

The gradient of the loss with respect to W involves the product of multiple Jacobians through time:

LWt=1TWTht

If W has eigenvalues less than 1, repeated multiplication causes the gradient to shrink exponentially, leading to vanishing gradients. This prevents earlier time steps from having a significant influence on training.

If W has eigenvalues greater than 1, repeated multiplication causes the gradient to grow exponentially, leading to exploding gradients, causing unstable updates.

Eigenvalue Condition for Vanishing and Exploding Gradients:

Vanishing Gradient: If |λi|<1, the gradients diminish exponentially over time. Exploding Gradient: If |λi|>1, the gradients grow exponentially, causing instability. Applying Gradient Clipping:

Given g=(g1,g2,g3) with norm |g|=5 and clipping threshold τ=1: gclipped=g15=(g1,g2,g3)×0.2. The clipped gradient vector is: gclipped=(0.2g1,0.2g2,0.2g3).


Additional note: The matrix W can be decomposed into eigenvectors and eigenvalues. During backpropagation, the gradient is multiplied by W at each layer (or time step in RNNs). This multiplication scales the gradient along the eigenvectors of W, with the scaling factor determined by the corresponding eigenvalues. If W has large eigenvalues (greater than 1), the gradient is stretched exponentially along those eigenvectors, causing the gradient to grow quickly across layers, leading to exploding gradients. Conversely, if W has small eigenvalues (less than 1), the gradient is shrunk exponentially, causing it to vanish as it propagates back through many layers or time steps, leading to vanishing gradients.


Exercise 8.4

Level: * (Easy)

Exercise Types: Novel

Question

Train an LSTM-based model to classify movie reviews as positive/negative using the IMDB dataset and compare LSTM with a simple Dense network.

Solution

import numpy as np
import tensorflow as tf
import matplotlib.pyplot as plt
from tensorflow.keras.datasets import imdb
from tensorflow.keras.preprocessing.sequence import pad_sequences
from tensorflow.keras.models import Sequential
from tensorflow.keras.layers import Embedding, LSTM, Dense, Flatten
from tensorflow.keras.optimizers import Adam

# Load IMDB dataset with the top 10,000 words
vocab_size = 10000
max_length = 200
(x_train, y_train), (x_test, y_test) = imdb.load_data(num_words=vocab_size)

# Pad sequences to ensure uniform length
x_train = pad_sequences(x_train, maxlen=max_length)
x_test = pad_sequences(x_test, maxlen=max_length)

lstm_model = Sequential([
    Embedding(input_dim=vocab_size, output_dim=128, input_length=max_length),
    LSTM(64, return_sequences=False),
    Dense(1, activation='sigmoid')
])

lstm_model.compile(optimizer=Adam(learning_rate=0.001), loss='binary_crossentropy', metrics=['accuracy'])

# Train the LSTM model
history_lstm = lstm_model.fit(x_train, y_train, validation_data=(x_test, y_test), epochs=5, batch_size=64)

dense_model = Sequential([
    Embedding(input_dim=vocab_size, output_dim=128, input_length=max_length),
    Flatten(),
    Dense(128, activation='relu'),
    Dense(1, activation='sigmoid')
])

dense_model.compile(optimizer=Adam(learning_rate=0.001), loss='binary_crossentropy', metrics=['accuracy'])

# Train the Dense model
history_dense = dense_model.fit(x_train, y_train, validation_data=(x_test, y_test), epochs=5, batch_size=64)

import matplotlib.pyplot as plt

# Plot accuracy comparison
plt.figure(figsize=(12, 6))
plt.plot(history_lstm.history['accuracy'], label='LSTM Train Acc')
plt.plot(history_lstm.history['val_accuracy'], label='LSTM Val Acc')
plt.plot(history_dense.history['accuracy'], label='Dense Train Acc')
plt.plot(history_dense.history['val_accuracy'], label='Dense Val Acc')
plt.xlabel('Epochs')
plt.ylabel('Accuracy')
plt.legend()
plt.title('LSTM vs. Dense Model Accuracy')
plt.show()

The plot shows the accuracy of the lstm model and the dense model.


It's clear that the training accuracy and validation accuracy of the LSTM model are both better than the dense model. LSTM performs better since it captures sequential dependencies in text by maintaining long-term effects. Dense networks struggle with long-term context and fail to learn any meaningful correspondences, hence the flat accuracy curve which suggests the architecture is not suitable for this problem.

Exercise 8.5

Level: * (Easy)

Exercise Types: Novel

Question

1. Match the following properties to Leaky Units, RNNs, or Gated RNNs.
(a). Uses explicit gating to control memory flow → ________________
(b). Memory retention is controlled by a simple decay factor → ________________
(c). Can suffer from vanishing gradient problems → ________________
(d). Can learn patterns but has difficulty with long-term dependencies → ________________
(e). Has a separate cell state to regulate information storage → ________________
(f). Computationally simplest among all three models → ________________
(g). Uses reset and update gates to modify memory retention → ________________


2. Here are the formulas for Leaky Units and Gated RNNs (GRU) from Lecture 8.

Leaky Units:

st,i=(11τi)st1+1τiσ(Wst1+Uxt)

where: - τi controls the memory decay for each component i of the state vector. - st is the state at time t, and σ is a nonlinear activation function (e.g., sigmoid).

Gated Recurrent Networks (GRU):

rt=σ(Wrst1+Urxt)(reset gate)zt=σ(Wzst1+Uzxt)(update gate)s~t=tanh(W(rtst1)+Uxt)(temporary state)st=ztst1+(1zt)s~t(final state)

where: - rt is the reset gate. - zt is the update gate. - s~t is the temporary state. - st is the final state at time t.

Now make a comparison between Leaky Units and Gated RNNs, their similarities and differences.

Solution

1.

(a). Gated RNNs
(b). Leaky Units
(c). RNNs
(d). Leaky Units and RNNs
(e). Gated RNNs
(f). Leaky Units
(g). Gated RNNs


2.

Similarities: Both Leaky Units and Gated RNNs are recurrent models that update their states using information from the previous state and current input. They are both designed to handle sequential data and capture long-term dependencies, though they do so in different ways. Additionally, both models use nonlinear activation functions like sigmoid or tanh in their computations.

Differences: Leaky Units use a fixed decay rate τi to mix past and current states, making them easier and faster to compute, but less effective for handling long-term memory. They can have problems with vanishing gradients when the decay rate is too small and are easier to train, but not as good for complex tasks. On the other hand, Gated RNNs use learnable gates (such as forget, input, and update) to control how much of the previous memory is kept and how much of the new input is used. These gates are learned through training, which makes Gated RNNs more flexible and better at handling long-term dependencies, but also more complex and slower to train.

Exercise 8.6

Level: * (Medium)

Exercise Types: Novel

Question

Dataset: https://data.cityofnewyork.us/Environment/Air-Quality/c3uy-2p5r/about_data Build a Recurrent Neural Network (RNN) to predict the next hour's PM2.5 concentration using the New York City Air Quality Dataset. Use PyTorch to implement the model, and train it on sequences of 24 hours of historical data (including features like temperature, wind speed, and ozone levels).

Solution

import pandas as pd
import numpy as np
from sklearn.preprocessing import RobustScaler
from sklearn.metrics import r2_score, mean_absolute_error
import torch
import torch.nn as nn
from torch.utils.data import Dataset, DataLoader

# --------------------------------------------------
# 1. Enhanced Data Preparation with Metrics
# --------------------------------------------------
def load_data(filepath):
    df = pd.read_csv(filepath)
    
    # Filter relevant data
    pm_ozone = df[
        (df['Name'].isin(['Fine particles (PM 2.5)', 'Ozone (O3)'])) &
        (df['Data Value'].notna())
    ].copy()
    
    # Convert to annual data
    pm_ozone['year'] = pm_ozone['Time Period'].str.extract(r'(\d{4})').astype(float)
    pm_ozone = pm_ozone.dropna(subset=['year'])
    pm_ozone['year'] = pm_ozone['year'].astype(int)
    
    # Pivot table with error handling
    try:
        pivot_df = pm_ozone.pivot_table(
            index=['Geo Place Name', 'year'],
            columns='Name',
            values='Data Value',
            aggfunc='mean'
        ).reset_index()
    except ValueError:
        raise RuntimeError("Pivot failed - check for duplicate entries")
    
    # Handle missing values
    pivot_df = pivot_df.groupby('Geo Place Name').apply(
        lambda x: x.ffill().bfill()
    ).reset_index(drop=True)
    
    return pivot_df.dropna()

# --------------------------------------------------
# 2. Data Scaling with Validation
# --------------------------------------------------
def scale_data(df):
    scaler = RobustScaler()
    features = scaler.fit_transform(df[['Fine particles (PM 2.5)', 'Ozone (O3)']])
    
    # Ensure no NaNs after scaling
    if np.isnan(features).any():
        raise ValueError("NaN values detected after scaling")
    
    return features, scaler

# --------------------------------------------------
# 3. Sequence Creation with Quality Control
# --------------------------------------------------
def create_sequences(features, years, seq_length=3):
    X, y = [], []
    
    # Group by neighborhood
    unique_neighborhoods = years['Geo Place Name'].unique()
    
    for neighborhood in unique_neighborhoods:
        mask = years['Geo Place Name'] == neighborhood
        neighborhood_features = features[mask]
        neighborhood_years = years[mask]['year'].values
        
        # Check for consecutive years
        year_diffs = np.diff(neighborhood_years)
        if len(neighborhood_years) < seq_length + 1 or not np.all(year_diffs == 1):
            continue
            
        # Create sequences
        for i in range(len(neighborhood_features) - seq_length):
            seq = neighborhood_features[i:i+seq_length]
            target = neighborhood_features[i+seq_length][0]  # PM2.5 is first feature
            
            X.append(seq)
            y.append(target)
    
    return np.array(X), np.array(y)

# --------------------------------------------------
# 4. Model with Metrics Tracking
# --------------------------------------------------
class AirQualityRNN(nn.Module):
    def __init__(self, input_size=2, hidden_size=16):
        super().__init__()
        self.gru = nn.GRU(input_size, hidden_size, batch_first=True)
        self.fc = nn.Linear(hidden_size, 1)
        
    def forward(self, x):
        out, _ = self.gru(x)
        return self.fc(out[:, -1, :]).squeeze()


def train_and_validate(model, train_loader, test_loader, epochs=30):
    optimizer = torch.optim.AdamW(model.parameters(), lr=1e-4)
    criterion = nn.MSELoss()
    
    best_r2 = -np.inf
    metrics = {'train_loss': [], 'test_mae': [], 'test_r2': []}
    
    for epoch in range(epochs):
        # Training
        model.train()
        train_loss = 0
        for X_batch, y_batch in train_loader:
            optimizer.zero_grad()
            outputs = model(X_batch)
            loss = criterion(outputs, y_batch)
            loss.backward()
            torch.nn.utils.clip_grad_norm_(model.parameters(), 1.0)
            optimizer.step()
            train_loss += loss.item()
        
        # Validation
        model.eval()
        y_true, y_pred = [], []
        with torch.no_grad():
            for X_batch, y_batch in test_loader:
                preds = model(X_batch)
                y_true.extend(y_batch.numpy())
                y_pred.extend(preds.numpy())
        
        # Calculate metrics
        mae = mean_absolute_error(y_true, y_pred)
        r2 = r2_score(y_true, y_pred)
        metrics['train_loss'].append(train_loss/len(train_loader))
        metrics['test_mae'].append(mae)
        metrics['test_r2'].append(r2)
        
        print(f"Epoch {epoch+1}/{epochs}")
        print(f"Train Loss: {metrics['train_loss'][-1]:.4f}")
        print(f"Test MAE: {mae:.4f} | R²: {r2:.4f}\n")
        
    return metrics

# --------------------------------------------------
# 5. Main Execution with Metrics Reporting
# --------------------------------------------------
if __name__ == "__main__":
    # Load and prepare data
    df = load_data("Air_Quality_20250202.csv")
    features, scaler = scale_data(df)
    
    # Create sequences
    X, y = create_sequences(features, df[['Geo Place Name', 'year']])
    
    # Split data
    split = int(0.8 * len(X))
    X_train, X_test = X[:split], X[split:]
    y_train, y_test = y[:split], y[split:]
    
    # Create datasets
    class AirDataset(Dataset):
        def __init__(self, X, y):
            self.X = torch.tensor(X, dtype=torch.float32)
            self.y = torch.tensor(y, dtype=torch.float32)
            
        def __len__(self): return len(self.X)
        def __getitem__(self, idx): return self.X[idx], self.y[idx]
    
    train_loader = DataLoader(AirDataset(X_train, y_train), batch_size=32, shuffle=True)
    test_loader = DataLoader(AirDataset(X_test, y_test), batch_size=32, shuffle=False)
    
    # Initialize and train model
    model = AirQualityRNN()
    metrics = train_and_validate(model, train_loader, test_loader)
    
    # Final evaluation
    print("\nFinal Performance:")
    print(f"Best R² Score: {max(metrics['test_r2']):.4f}")
    print(f"Best MAE: {min(metrics['test_mae']):.4f}")

Exercise 8.7

Level: *** (Difficult)

Exercise Type: Novel

References: Neumann, E. (2016). Double pendulum. web.mit.edu/jorloff/www/chaosTalk/double-pendulum/double-pendulum-en.html

This is where the equations of motion came from.

Question

This exercise is about using recurrent neural networks (RNNs) to predict the behaviour of chaotic, time-dependent systems. Consider a double pendulum, a well-known problem in physics that consists of one pendulum attached to the end of another. The state of the double pendulum can be fully described using the following variables:

θ1: The angle of the first pendulum from the vertical.

θ2: The angle of the second pendulum from the vertical.

ω1: The angular velocity of the first pendulum.

ω1: The angular velocity of the second pendulum.

The system is governed by the following system of equations, which do not have closed-form solutions:

ω1=g(2m1+m2)sinθ1m2gsin(θ12θ2)2sin(θ1θ2)m2(ω22L2+ω12L1cos(θ1θ2))L1(2m1+m2m2cos(2θ12θ2)

ω2=2sin(θ1θ2)(ω12L1(m1+m2)+g(m1+m2)cosθ1+ω22L2m2cos(θ1θ2))L2(2m1+m2m2cos(2θ12θ2)

Assume the following parameters:

m1=m2=1kg (the masses of the pendulums)

L1=L2=1m (the lengths of the pendulums)

g=9.81m/s2 (acceleration due to gravity)

Initial conditions:

θ1(0)=θ2(0)=π/2 ω1(0)=ω2(0)=0

The task is to predict the next time step of this system given a sequence of previous states.

(a) Numerically solve the given system of equations using scipy.integrate.solve_ivp (or similar) for times between 0 and 10 seconds. Generate a dataset by sampling overlapping sequences from the solution. Split the dataset into testing and training sets, using the first half for training and the second half for testing.

(b) Write a simple RNN that takes as input a sequence states of the form [θ1,ω1,θ2,ω2], and outputs the next state in the sequence.

(c) For the test dataset, plot the model's predictions for each of the 4 variables, [θ1,ω1,θ2,ω2], alongside the true values from the numerical solution.

Solution

g = 9.81 # m/s^2

def double_pendulum(t, y):

    """Defines the system of differential equations for the double pendulum."""

    theta1, w1, theta2, w2 = y

    delta_theta = theta1 - theta2 
    den = 3 - np.cos(2*delta_theta)

    # 1st equation of motion:
    dw1_dt = (-g * (3 * np.sin(theta1) + np.sin(theta1 - 2 * theta2))
        - 2 * np.sin(delta_theta) * (w2**2 + w1**2 * np.cos(delta_theta))) / den
    # 2nd equation of motion:
    dw2_dt = (2 * np.sin(delta_theta) * (
            2 * w1**2 + 2 * g * np.cos(theta1) + w2**2 * np.cos(delta_theta))) / den

    return [w1, dw1_dt, w2, dw2_dt]

def create_sequences(data, seq_length=10):
    """Prepares time series data."""
    x = []
    y = []
    for i in range(len(data) - seq_length):
        x.append(data[i:i+seq_length])
        y.append(data[i+seq_length])
    return np.array(x), np.array(y)

class SimpleRNN(nn.Module):
    def __init__(self, input_size=4, hidden_size=32, num_layers=1, output_size=4):
        super(SimpleRNN, self).__init__()
        self.rnn = nn.RNN(input_size, hidden_size, num_layers, batch_first=True)
        self.fc = nn.Linear(hidden_size, output_size)

    def forward(self, x):
        x, _ = self.rnn(x)
        x = self.fc(x[:, -1, :])
        return x

theta1_0, w1_0, theta2_0, w2_0 = np.pi / 2, 0, np.pi / 2, 0
y0 = [theta1_0, w1_0, theta2_0, w2_0] # initial conditions

t_eval = np.linspace(0, 10, 1000)
data = solve_ivp(double_pendulum, (0, 10), y0, t_eval=t_eval).y.T

x, y = create_sequences(data)
x, y = torch.tensor(x, dtype=torch.float32), torch.tensor(y, dtype=torch.float32)

train_size = int(0.5 * len(x))
x_train, y_train = x[:train_size], y[:train_size]
x_test, y_test = x[train_size:], y[train_size:]

model = SimpleRNN()
criterion = nn.MSELoss()
optimizer = optim.Adam(model.parameters(), weight_decay=0.01)

num_epochs = 200
for epoch in range(num_epochs):
    model.train()
    optimizer.zero_grad()
    outputs = model(x_train)
    loss = criterion(outputs, y_train)
    loss.backward()
    optimizer.step()

    if (epoch+1) % 5 == 0:
        print(f'Epoch [{epoch+1}/{num_epochs}], Loss: {loss.item():.4f}')

model.eval()
predictions_test = model(x_test).detach().numpy()


Exercise 8.8

Level: ** (Moderate)

Exercise Types: Copied

Reference: Calin, Ovidiu. Deep learning architectures: A mathematical approach. Springer, 2020

This question is from exercise 17.10.2 on page 558.

Question

(a) Consider the matrix:

W=(110210310410). Show that limnWn=O2, where O2 denotes the 2×2 zero matrix.

(b) Let A be a k×k symmetric matrix and denote by ρ(A)=max1ik|λi| its spectral radius, where λi denotes the eigenvalues of A. Consider the matrix W=11+ρ(A)A. Prove that limnWn=Ok.

(c) Let W be a 2×2 matrix as defined in part (a). Define the sequence:

Sn=k=1nWk

Show that as n, the sum converges to a finite limit and compute that limit.

Solution

Part (a)

1.Spectral Radius of W: The spectral radius ρ(W) is defined as the maximum absolute value of the eigenvalues of W: ρ(W)=max|λ|.

2. Eigenvalue Calculation: To compute the eigenvalues, solve the characteristic equation: det(WλI)=0, where: WλI=(110λ210310410λ). The determinant is: det(WλI)=(110λ)(410λ)6100. Solving this quadratic equation gives the eigenvalues λ1 and λ2, both satisfying |λi|<1.

3. Convergence of Wn: Since ρ(W)<1, the powers Wn decay to zero as n: limnWn=O2.

Part (b)

1. Spectral Radius of W: The matrix W=11+ρ(A)A scales A such that: ρ(W)=ρ(A)1+ρ(A). Since ρ(A)>0, we have ρ(W)<1.

2. Convergence of Wn: For any eigenvalue λi of A, the eigenvalue of W is: μi=λi1+ρ(A). Because |μi|<1, the powers Wn decay to the zero matrix as n: limnWn=Ok.

Part (c)

1. Geometric Series of W: Since ρ(W)<1, the sum of the matrix powers forms a geometric series: Sn=k=1nWk=W(IWn)(IW)1

2. Limit of the Sum: As n, we know from part (a) that WnO2. Therefore, taking the limit in the sum formula: S=k=1Wk=W(IO2)(IW)1

Simplifying:

S=W(IW)1

This shows that the sum converges to a finite limit, given by W(IW)1. Since ρ(W)<1, the matrix (IW) is invertible, ensuring that the sum remains finite.

Exercise 8.9

Level: ** (Moderate)

Exercise Type: Novel

References:

[1] K. P. Murphy, Probabilistic Machine Learning: An introduction. MIT Press, 2022. [Online]. Available: http://probml.github.io/book1

[2] A. Ghodsi, STAT 940 Deep Learning: Lecture 7, University of Waterloo, Winter 2025.

Question

Explain how gated RNN's help prevent the exploding or vanishing gradient problem experienced by vanilla RNN networks.

Solution

In a standard RNN, the hidden state is updated multiplicatively, givne by the equation [2]

st=σ(Wst1+Uxt)

Since we multiply the hidden state st by the weight matrix W at each time step, we face gradient explosion if the eigenvalues λ are greater than one, and decay if λ are less than 1.

Gated RNNs update the hidden state in an additive rather than a multiplicative way, and therefore, since the weight updated to the hidden states are no longer multiplicative, the issue with gradient descent from vanilla RNNs is avoided.

The equations to update a Gated RNN are given as

zt=σ(U(z)xt+W(z)st1)

rt=σ(U(r)xt+W(r)st1)

s~t=tanh(Uxt+rtWst1)

st=ztst1+(1zt)s~t

The gated RNN puts additional controls on which help prevent vanishing gradient or gradient explosion. while s~ still contains a Wst1 term, the reset gate <r_t> helps to prevent an exploding gradient by forgetting some previous terms of the state, and limiting infinite multiplication. Meanwhile, the update gate zt is capable of maintaining gradient from the previous state therefore preventing the gradient from vanishing entirely in the case of W having eigenvalues less than 1.

Therefore, rather than being purely multiplicative like a vanilla RNN, by using the reset and update gates and updating the state in an additive manner, gated RNNs are able to help reduce the risk of vanishing gradients or gradient explosion in recurrent neural networks [1]

Exercise 8.10

Level: * (Easy)

Exercise Types: Novel

Question

Answer whether the following statements about Recurrent Neural Networks (RNNs) are True or False.

1. RNNs are designed to handle sequential data by maintaining a hidden state that gets updated at each time step.

2. RNNs are unable to handle long-term dependencies in data due to the vanishing gradient problem.

3. RNNs are generally faster to train than feedforward neural networks because they process sequences in parallel.

4. How do Long Short-Term Memory (LSTM) networks and Gated Recurrent Units (GRUs) address the vanishing gradient problem in RNNs? Explain their key mechanisms.

Solution

1. True – RNNs are specifically designed to process sequential data, where the hidden state is updated at each time step to capture information from previous steps. The hidden state acts as a memory of past information, enabling RNNs to capture dependencies in the data over time.

2. True – RNNs can struggle with long-term dependencies because of the vanishing gradient problem, where gradients become too small to effectively update weights over long sequences (updates for very early layers will be very small).

3. False – RNNs are generally slower to train than feedforward networks because they process sequences step by step, making parallelization more difficult (This is one of the advantages of transformer over RNN). RNNs must process sequences sequentially since each time step's computation depends on the hidden state from the previous step, this dependency prevents efficient parallelization, . While CNNs or Transformers can process entire sequences simultaneously.

4. LSTMs and GRUs are advanced types of RNNs designed to mitigate the vanishing gradient problem by introducing mechanisms that help retain long-term dependencies.

LSTM (Long Short-Term Memory) Mechanisms:
Forget Gate: Decides how much past information should be discarded.
Input Gate: Determines how much new information should be stored.
Cell State: Acts as a long-term memory, allowing gradients to flow over long sequences.
Output Gate: Controls the final output based on the cell state.

By using gates and a cell state, LSTMs allow important information to persist over long sequences, preventing gradients from becoming too small.

GRU (Gated Recurrent Unit) Mechanisms:
Reset Gate: Helps forget irrelevant past information.
Update Gate: Controls how much of the past information should be passed forward.

Exercise 8.11

Level: ** (Moderate)

Exercise Types: Novel

Question

Write a Python code to demonstrate the vanishing gradient problem using a simple RNN model. The code should include the following:

- Define a simple RNN model.

- Generate a random sequence as input data.

- Implement a training loop where you calculate and store the gradient norm at each epoch.

- Plot the gradient norm over the epochs to visualize the vanishing gradient problem.

Solution

import torch
import torch.nn as nn
import torch.optim as optim
import matplotlib.pyplot as plt

# Define a simple RNN model
class SimpleRNN(nn.Module):
    def __init__(self, input_size, hidden_size, output_size):
        super(SimpleRNN, self).__init__()
        self.rnn = nn.RNN(input_size, hidden_size, batch_first=True)
        self.fc = nn.Linear(hidden_size, output_size)

    def forward(self, x):
        out, _ = self.rnn(x)
        out = self.fc(out[:, -1, :])  # Get the output from the last time step
        return out

# Generate some dummy data (sequence length = 10)
sequence_length = 10
input_size = 1  # Just one feature
hidden_size = 5  # Small hidden size to observe vanishing gradients
output_size = 1  # Single output for simplicity
batch_size = 1

# Random input sequence
x = torch.randn(batch_size, sequence_length, input_size)
y = torch.randn(batch_size, output_size)  # Random target for demonstration

# Initialize the model, loss function, and optimizer
model = SimpleRNN(input_size, hidden_size, output_size)
criterion = nn.MSELoss()
optimizer = optim.SGD(model.parameters(), lr=0.01)

# To store the gradients over time
gradients = []

# Training loop
for epoch in range(500):
    optimizer.zero_grad()  # Zero gradients
    output = model(x)  # Forward pass
    loss = criterion(output, y)  # Compute loss
    loss.backward()  # Backpropagation

    # Store the gradient of the first RNN layer (hidden state)
    if epoch % 100 == 0:
        grad_norm = torch.norm(model.rnn.all_weights[0][0].grad).item()
        gradients.append(grad_norm)

    optimizer.step()  # Update weights

# Plot the gradients over time
plt.plot(range(0, 500, 100), gradients, marker='o')
plt.xlabel('Epoch')
plt.ylabel('Gradient Norm')
plt.title('Vanishing Gradient in RNN')
plt.show()


Exercise 8.12

Level: * (easy)

Exercise Types: Novel

Question

Consider a simple dynamic system where the state of the system at any time t is defined by st=0.9st1+0.1xt, where xt is the input at time t and the initial state s0 is zero. Simulate the response of the system over 50 time steps assuming xt is a random signal with values uniformly distributed between 0 and 1. Plot the state st over time to visualize the system's response to the random inputs.

Solution

import numpy as np
import matplotlib.pyplot as plt

# Define the length of the simulation
num_steps = 50

# Generate random input
x_t = np.random.uniform(0, 1, num_steps)

# Initialize the state
s_t = np.zeros(num_steps)

# Simulate the system's response over time
for t in range(1, num_steps):
    s_t[t] = 0.9 * s_t[t-1] + 0.1 * x_t[t]

# Plot the state over time
plt.figure(figsize=(10, 5))
plt.plot(s_t, label='State $s_t$')
plt.plot(x_t, label='Input $x_t$', linestyle='--')
plt.xlabel('Time step')
plt.ylabel('Value')
plt.title('System Response to Random Input')
plt.legend()
plt.grid(True)
plt.show()



Exercise 8.13

Level: * (Easy)

Exercise Types: Novel

Question

We have a simple RNN with the following parameters:

Input:x=(x1x2)=(0.50.3)

Weight matrices:

W=(0.50.20.30.7)(for previous hidden state to current hidden state)

U=(0.10.4) (for input to hidden)

V=(0.60.5) (for hidden to output)

Hidden state s is passed through the tanh activation tanh(x).

Output at each timestep is o.

Target output for time step 1 is 0.8. Target output for time step 2 is 0.6.

Initial hidden state s= 0.

Compute gradient of the loss with respect to V for the first timestep.

Solution

Refenence: Source: GeeksforGeeks. (n.d.). Implementing Recurrent Neural Networks in PyTorch.

Forward Pass

s1=tanh(Ws0+Ux1)=tanh([0.50.20.30.7][0.50.3]+[0.10.4]0)=[0.1880.345]

o1=Vs1=[0.60.5][0.1880.345]=0.2853

Gradient calculation

δ1=Losso1=o1target1=0.5147

LossV=δ1s1=0.5147[0.1880.345]=[0.09680.1776]

Exercise 8.14

Level: ** (Moderate)

Exercise Types: Modified

Reference: GeeksforGeeks. (n.d.). Implementing Recurrent Neural Networks in PyTorch.

Question

Analyze the implementation of a simple RNN in PyTorch for sine wave prediction. The model uses nn.RNN with 20 hidden units and a fully connected layer, trained with MSE loss and the Adam optimizer. The input is a sequence of 50 time steps, and the target is the next 50 steps. After training, the model's predictions are compared to the true sine wave values in a plot.

Solution

import torch
import torch.nn as nn
import torch.optim as optim
import numpy as np
import matplotlib.pyplot as plt

# Generate sine wave data
def generate_data(seq_length, num_samples):
    X = []
    y = []
    for i in range(num_samples):
        x = np.linspace(i * 2 * np.pi, (i + 1) * 2 * np.pi, seq_length + 1)
        sine_wave = np.sin(x)
        X.append(sine_wave[:-1])  # input sequence
        y.append(sine_wave[1:])   # target sequence
    return np.array(X), np.array(y)

seq_length = 50
num_samples = 1000
X, y = generate_data(seq_length, num_samples)

# Convert to PyTorch tensors
X = torch.tensor(X, dtype=torch.float32)
y = torch.tensor(y, dtype=torch.float32)

print(X.shape, y.shape)  # Output: (1000, 50), (1000, 50)

class SimpleRNN(nn.Module):
    def __init__(self, input_size, hidden_size, output_size):
        super(SimpleRNN, self).__init__()
        self.rnn = nn.RNN(input_size, hidden_size, batch_first=True)
        self.fc = nn.Linear(hidden_size, output_size)
    
    def forward(self, x):
        h0 = torch.zeros(1, x.size(0), hidden_size).to(x.device)
        out, _ = self.rnn(x, h0)
        out = self.fc(out)
        return out

input_size = 1
hidden_size = 20
output_size = 1
model = SimpleRNN(input_size, hidden_size, output_size)

criterion = nn.MSELoss()
optimizer = optim.Adam(model.parameters(), lr=0.001)

# Training loop
num_epochs = 100
for epoch in range(num_epochs):
    model.train()
    outputs = model(X.unsqueeze(2))  # Add a dimension for input size
    loss = criterion(outputs, y.unsqueeze(2))
    
    optimizer.zero_grad()
    loss.backward()
    optimizer.step()
    
    if (epoch + 1) % 10 == 0:
        print(f'Epoch [{epoch+1}/{num_epochs}], Loss: {loss.item():.4f}')

# Make predictions
model.eval()
with torch.no_grad():
    predictions = model(X.unsqueeze(2)).squeeze(2).numpy()

# Plot results
plt.figure(figsize=(10, 6))
plt.plot(y[0].numpy(), label='True')
plt.plot(predictions[0], label='Predicted')
plt.legend()
plt.show()

Output:

torch.Size([1000, 50]) torch.Size([1000, 50])
Epoch [10/100], Loss: 0.3295
Epoch [20/100], Loss: 0.2356
Epoch [30/100], Loss: 0.1260
Epoch [40/100], Loss: 0.0716
Epoch [50/100], Loss: 0.0468
Epoch [60/100], Loss: 0.0317
Epoch [70/100], Loss: 0.0187
Epoch [80/100], Loss: 0.0102
Epoch [90/100], Loss: 0.0061
Epoch [100/100], Loss: 0.0050


Figure 8.14


Exercise 8.15

Level: ** (Moderate)

Exercise Types: Modified

Reference: Calin, Ovidiu. Deep learning architectures: A mathematical approach. Springer, 2020. Exercise 17.10.5

Question

Consider a state update hn=f(hn1;θ),n1, where the transition function is f(x;θ)=tanh(θx),|θ|<1. Find limnhn the hidden state of the system in the long run

Solution

The transition function f(x;θ)=tanh(θx) satisfies the contraction mapping property. Specifically, a function f is a contraction if there exists a constant 0k<1 such that for any x,y in its domain, we have:

|f(x)f(y)|k|xy|.

For f(x;θ)=tanh(θx), we compute its derivative:

f(x;θ)=θsech2(θx).

Since |θ|<1 and 0sech2(θx)1 for all x, we obtain:

|f(x;θ)||θ|<1.

Thus, f is a contraction mapping. By Banach’s Fixed Point Theorem, the sequence hn converges to the unique fixed point of f, which satisfies:

tanh(θa)=a.

The function g(a)=tanh(θa)a has a unique solution at a=0 because tanh(θa) is strictly increasing and satisfies tanh(0)=0.

Therefore,

limnhn=0.

Extended Question

Consider a modified state update hn=f(hn1;θ,c), where the transition function is given by

f(x;θ,c)=tanh(θx+c),|θ|<1,cR.

Find limnhn, the hidden state of the system in the long run.

Extended Solution

We analyze the convergence of the sequence hn by finding the fixed points of f(x;θ,c)=tanh(θx+c).

A fixed point satisfies:

a=tanh(θa+c).

Define g(a)=tanh(θa+c)a. The function g(a) is continuous and strictly increasing. Since |θ|<1, the function f(x;θ,c) remains a contraction mapping. By Banach’s Fixed Point Theorem, there exists a unique fixed point a satisfying the equation above.

To approximate the fixed point, note that for small c, we expand tanh(x)x for small x, leading to:

ac1θ.

Thus, in the long run, the hidden state stabilizes at:

limnhn=a,

where a is the unique solution to a=tanh(θa+c).



Exercise 8.16

Level: ** (Moderate)

Exercise Types: Modified

Question

Let J be the Jacobian matrix of an Echo State Network (ESN) at a given time step, describing the local linearization of the system’s state transition dynamics. That is, given a small change Δs in the state vector, the evolution of this perturbation is given by:

Δst+1=JΔst

where st represents the perturbation at time t. Prove that if all eigenvalues of J satisfy |λi|<1 for all i then the mapping is a contraction.

Proof.

To prove that the transformation is contractive when all eigenvalues of J satisfy |λi|<1, we analyze the evolution of perturbations using the spectral decomposition of J. Assuming J is diagonalizable, it can be written as:

J=VΛV1

where V is the matrix of eigenvectors and Λ is the diagonal matrix of eigenvalues λ1,λ2,,λn. Any initial perturbation can be expressed in terms of the eigenvectors as

Δs0=c1v1+c2v2++cnvn. . Applying the recurrence relation iteratively,

Δst=JtΔs0=(VΛtV1)Δs0.

Since J acts linearly on the eigenvectors, this simplifies to

Δst=c1λ1tv1+c2λ2tv2++cnλntvn.

Now, taking the norm on both sides and applying the triangle inequality,

Δsti=1n|ci||λi|tvi.

Since we assumed that |λi|<1 for all i, it follows that |λi|t0 as t. Consequently, each term in the summation approaches zero, implying that

Δst0ast.

Thus, the mapping Δst+1=JΔst is a contraction, meaning that any small perturbation in the state space is gradually forgotten over time. This ensures the stability of the Echo State Network.

Exercise 8.17

Level: * (Easy)

Exercise Types: Novel

Question

Consider this recurrent neural net with input at time t: xt=0.5, previous hidden state: ht1=0.2, weights for hidden state: Wh=0.7, weights for input: Wx=0.3, bias: b=0.1, and Activation function: tanh. Compute new hidden state and output yt using an output weight Wy=0.6.

Solution

The hidden state is updated using the formula: ht=tanh(Wxxt+Whht1+b) ht=tanh((0.30.5)+(0.70.2)+0.1) = tanh(0.39) = 0.37

The output is computed as: yt=Wyht = 0.6*0.37 = 0.222.

Exercise 8.18

Level: *** (Difficult)

Exercise Types: Novel

Question

Consider a recurrent neural network (RNN) with the hidden state update equation:

ht=σ(Whht1+Wxxt+b)

where WhRn×n and WxRn×d are weight matrices, bRn is a bias vector, and σ  is an activation function (e.g., tanh).

The output at each time step is given by:

yt=Wyht+c

where WyRm×n is an output weight matrix and cRm is a bias vector.

The network is trained using Backpropagation Through Time (BPTT) with a loss function:

L=t=1T(yt,y^t)

where () is a differentiable loss function.

1. Gradient Behavior Analysis:

(a) Show that the gradient of the loss with respect to Wh can be expressed as:

LWh=t=1Tk=tTLhkhkhthtWh where hkht  depends on repeated multiplications of Wh.

(b) Derive the conditions under which this term leads to the **vanishing gradient problem**.

(c) Derive the conditions under which this term leads to the **exploding gradient problem**.

2. Spectral Radius Condition:

(a) Prove that if the spectral radius ρ(Wh)<1, then the gradient vanishes exponentially.

(b) Prove that if ρ(Wh)>1, then the gradient explodes exponentially.


3. Mitigation Strategies:

(a) Explain how gradient clipping prevents unstable updates.

(b) Consider an LSTM cell with the update equation for the cell state ct:

ct=ftct1+itc~t where ft and it are gate activations. Explain why this structure mitigates vanishing gradients.

(c) Discuss the impact of **orthogonal weight initialization** (where WhWhT=I) on gradient propagation.

Solution

1. Gradient Behavior Analysis

(a) Gradient of the Loss w.r.t W_h

The loss function is:

L=t=1T(yt,y^t)

Using Backpropagation Through Time (BPTT), the gradient of the loss with respect to Wh is:

LWh=t=1Tk=tTLhkhkhthtWh

where:

hkht=j=tk1Whσ(Whhj+Wxxj+b)

This term involves repeated multiplications of Wh, which affects gradient stability.

(b) Vanishing Gradient Condition If Wh has eigenvalues λi such that |λi|<1, then:

WhnλmaxnI,as n

where λmax is the largest eigenvalue in magnitude. Since λmaxn0 as n, the gradients shrink exponentially, leading to the **vanishing gradient problem**.

(c) Exploding Gradient Condition If Wh has eigenvalues λi such that |λi|>1, then:

WhnλmaxnI,as n

Since λmaxn, the gradients grow exponentially, causing the **exploding gradient problem**.

2. Spectral Radius Condition

(a) Vanishing Gradients The spectral radius ρ(Wh) is the largest absolute eigenvalue of Wh. If ρ(Wh)<1, then:

WhnCρ(Wh)n,for some constant C

which implies that the gradient norms decay exponentially.

(b) Exploding Gradients

If ρ(Wh)>1, then:

WhnCρ(Wh)n

which causes exponential growth in gradients, leading to unstable weight updates.

3. Mitigation Strategies

(a) Gradient Clipping Instead of using raw gradients g, we clip them if they exceed a threshold τ:

g=ggτ,if g>τ

This prevents excessively large updates and stabilizes training.

(b) LSTM Mitigation of Vanishing Gradients LSTMs introduce a **cell state** ct that is updated as:

ct=ftct1+itc~t

where ft (forget gate) allows information to persist over time. Since:

ctct1=ft

and ft can be close to 1, the gradient can remain close to 1, preventing vanishing gradients.

(c) Orthogonal Weight Initialization If Wh is initialized as an **orthogonal matrix**, then:

WhWhT=I

which ensures that:

Whn=1 for all n

This stabilizes gradient propagation and prevents vanishing/exploding gradients.



Exercise 8.19

Level: * (Easy)

Exercise Types: Novel

Question

Suppose you have a neural network layer with an input vector x = [3, -2, 5, -1] and you are using the Leaky ReLU activation function with α = 0.1. (i.e. For negative inputs, the output is 0.1x). Please compute the output vector after applying the activation function.

Solution

The Leaky ReLU activation function is defined as:

f(x)={xif x>0αxif x0

Given the input vector x = [3, -2, 5, -1], and α = 0.1, we can compute the output for each element in the vector:

1. For value is 3:

f(3)=3(since 3>0)

2. For value is -2:

f(2)=0.1×(2)=0.2(since 20)

3. For value is 5:

f(5)=5(since 5>0)

4. For value is -1:

f(1)=0.1×(1)=0.1(since 10)

Thus, the output vector after applying the Leaky ReLU activation function is:

y=[3,0.2,5,0.1]

Exercise 8.20

Level: ** (Easy)

Exercise Types: Novel

Question

(a) Explain gradient clipping and how it is applied during RNN training.

(b) Explain how LSTMs and GRUs reduce the vanishing gradient problem using gating mechanisms. Provide key mathematical equations to support your explanation.

Solution

(a) Gradient Clipping:

Gradient clipping is a technique used to prevent the exploding gradient problem, which occurs when gradients grow exponentially during backpropagation through time (BPTT) in recurrent neural networks (RNNs). If the gradients become too large, weight updates can become unstable, leading to poor convergence or numerical issues.

- When gradients become too large, normalize them:

g~=gg×τ,if g>τ

- where g~ is the clipped gradient, and τ is a predefined threshold to prevent gradient explosion

(b) How LSTMs and GRUs Mitigate Vanishing Gradients:

(1) LSTM

- How LSTM Mitigates Vanishing Gradients:

LSTMs introduce memory cells and gating mechanisms to control the flow of information, preventing gradients from vanishing.

Key LSTM Equations:

LSTMs maintain a cell state ct that accumulates information over time:

ct=ftct1+itc~t

where:

ft=σ(Wfht1+Ufxt+bf) (Forget Gate) it=σ(Wiht1+Uixt+bi) (Input Gate) ot=σ(Woht1+Uoxt+bo) (Output Gate) c~t=tanh(Wcht1+Ucxt+bc) (Candidate Cell State)

The hidden state is then computed as:

ht=ottanh(ct)

- Why LSTMs Reduce Vanishing Gradients:

1. Cell state ct enables long-term memory storage.

If the forget gate Ft ≈1, past information remains for many time steps.

This prevents information from vanishing as gradients remain close to 1.

2. Gates regulate information flow

The forget gate decides how much past information to keep.

The input gate determines how much new information to store.

This ensures a balance between old and new information.

(2) GRU

- How GRUs Reduce Vanishing Gradients

GRUs are a simplified version of LSTMs with fewer parameters but similar effectiveness.

Key GRU Equations

GRUs combine the forget and input gates into a single update gate zt:

zt=σ(Wzht1+Uzxt+bz)

The reset gate rt controls how much past information to discard:

rt=σ(Wrht1+Urxt+br)

The new candidate hidden state:

h~t=tanh(Wh(rtht1)+Uhxt+bh)

Final hidden state update:

ht=(1zt)ht1+zth~t

- Why GRUs Reduce Vanishing Gradients

1.The update gate zt determines how much past information to retain. If zt ≈1, the model keeps previous information for longer.

2.The reset gate rt allows selective forgetting which his improves adaptability while still mitigating vanishing gradients.


Exercise 8.21

Level: ** (Moderate)

Exercise Types: Novel

Question

Recurrent Neural Networks (RNNs) suffer from the *vanishing gradient problem* due to repeated multiplications of the Jacobian matrix over long sequences. Consider an RNN with the hidden state update:

ht=σ(Whht1+Wxxt+b)

where: - WhRn×n is the recurrent weight matrix. - WxRn×d is the input weight matrix. - bRn is the bias vector. - σ() is an activation function (e.g., tanh or ReLU).

The loss function is:

L=t=1T(yt,y^t)

where () is a differentiable loss function.

(a) Gradient Propagation Analysis

1. Show that the gradient of the loss with respect to Wh is:

  [math]\displaystyle{  \frac{\partial \mathcal{L}}{\partial W_h} = \sum_{t=1}^{T} \sum_{k=t}^{T} \frac{\partial \mathcal{L}}{\partial h_k} \frac{\partial h_k}{\partial h_t} \frac{\partial h_t}{\partial W_h}  }[/math]
  where [math]\displaystyle{  \frac{\partial h_k}{\partial h_t}  }[/math] involves repeated multiplications of [math]\displaystyle{  W_h  }[/math].

2. Explain why this multiplication leads to the vanishing or exploding gradient problem based on the eigenvalues of Wh.

(b) Mitigation Strategies 1. Gradient Clipping: Explain how it prevents the exploding gradient problem. 2. Leaky Units: Discuss how leaky units mitigate vanishing gradients. 3. Gated RNNs: Compare the structures of GRUs and LSTMs, explaining why they help prevent vanishing gradients.

Solution Outline

1. Backpropagation shows gradients depend on (Wh)t. If λmax (largest eigenvalue of Wh) satisfies:

  - [math]\displaystyle{  |\lambda_{\max}| \lt  1  }[/math], gradients shrink exponentially → vanishing gradient.
  - [math]\displaystyle{  |\lambda_{\max}| \gt  1  }[/math], gradients grow exponentially → exploding gradient.

2. Mitigation Strategies:

  - Gradient Clipping: Caps gradients to prevent instability.
  - Leaky Units: Retain controlled past-state influence.
  - Gated RNNs (GRUs, LSTMs): Use gating mechanisms to maintain relevant long-term dependencies.

Exercise 9.1

Level: * (Easy)

Exercise Types: Copied

References: https://machinelearningmastery.com/the-attention-mechanism-from-scratch/

Question

Write a Python code to demonstrate the general attention mechanism using NumPy and SciPy libraries in Python. For simplicity, you will initially calculate the attention for the first word in a sequence of four. You will then generalize the code to calculate an attention output for all four words in matrix form.

Solution

Let’s start by first defining the word embeddings of the four different words to calculate the attention. In actual practice, these word embeddings would have been generated by an encoder; however, for this particular example, you will define them manually.

# encoder representations of four different words
word_1 = array([1, 0, 0])
word_2 = array([0, 1, 0])
word_3 = array([1, 1, 0])
word_4 = array([0, 0, 1])

Next step is generate the weight matrices randomly. However, in actual practice, these would have been learned during training.

...
# generating the weight matrices
random.seed(42) # to allow us to reproduce the same attention values
W_Q = random.randint(3, size=(3, 3))
W_K = random.randint(3, size=(3, 3))
W_V = random.randint(3, size=(3, 3))

...
# generating the queries, keys and values
query_1 = word_1 @ W_Q
key_1 = word_1 @ W_K
value_1 = word_1 @ W_V

query_2 = word_2 @ W_Q
key_2 = word_2 @ W_K
value_2 = word_2 @ W_V

query_3 = word_3 @ W_Q
key_3 = word_3 @ W_K
value_3 = word_3 @ W_V

query_4 = word_4 @ W_Q
key_4 = word_4 @ W_K
value_4 = word_4 @ W_V

Considering only the first word for the time being, the next step scores its query vector against all the key vectors using a dot product operation.

...
# scoring the first query vector against all key vectors
scores = array([dot(query_1, key_1), dot(query_1, key_2), dot(query_1, key_3), dot(query_1, key_4)])

The score values are subsequently passed through a softmax operation to generate the weights. Before doing so, it is common practice to divide the score values by the square root of the dimensionality of the key vectors (in this case, three) to keep the gradients stable.

...
# computing the weights by a softmax operation
weights = softmax(scores / key_1.shape[0] ** 0.5)

print("Attention Weights:", weights)
Attention Weights: [0.23608986 0.00738988 0.74913039 0.00738988]


We see that the attention weights are higher for word 3, implying that it has a stronger influence than the other words with word 1. Finally, the attention output is calculated by a weighted sum of all four value vectors.

...
# computing the attention by a weighted sum of the value vectors
attention = (weights[0] * value_1) + (weights[1] * value_2) + (weights[2] * value_3) + (weights[3] * value_4)

print(attention)
[0.98522025 1.74174051 0.75652026]

For faster processing, the same calculations can be implemented in matrix form to generate an attention output for all four words in one go:

from numpy import array
from numpy import random
from numpy import dot
from scipy.special import softmax

# encoder representations of four different words
word_1 = array([1, 0, 0])
word_2 = array([0, 1, 0])
word_3 = array([1, 1, 0])
word_4 = array([0, 0, 1])

# stacking the word embeddings into a single array
words = array([word_1, word_2, word_3, word_4])

# generating the weight matrices
random.seed(42)
W_Q = random.randint(3, size=(3, 3))
W_K = random.randint(3, size=(3, 3))
W_V = random.randint(3, size=(3, 3))

# generating the queries, keys and values
Q = words @ W_Q
K = words @ W_K
V = words @ W_V

# scoring the query vectors against all key vectors
scores = Q @ K.transpose()

# computing the weights by a softmax operation
weights = softmax(scores / K.shape[1] ** 0.5, axis=1)

# computing the attention by a weighted sum of the value vectors
attention = weights @ V

print(attention)
[[0.98522025 1.74174051 0.75652026]
 [0.90965265 1.40965265 0.5       ]
 [0.99851226 1.75849334 0.75998108]
 [0.99560386 1.90407309 0.90846923]]

Exercise 9.2

Level: * (Easy)

Exercise Types: Novel

Transformer Models and Sentence Similarity

Transformers are deep learning models designed for natural language processing (NLP) tasks. They use self-attention mechanisms to capture contextual relationships between words in a sequence, making them highly effective for tasks like machine translation, text classification, and sentence similarity analysis.

In this exercise, we use the all-MiniLM-L6-v2 model, a lightweight and efficient transformer designed for sentence embeddings. It is optimized for tasks like sentence similarity and clustering, providing high-quality embeddings with reduced computational cost.

Below is a Python script that uses this model to compute sentence embeddings and visualize their similarity.

import numpy as np
import matplotlib.pyplot as plt
from sentence_transformers import SentenceTransformer
from sklearn.metrics.pairwise import cosine_similarity

# Example sentences
sentences = [
    "The cat sits on the mat.",
    "A dog is running in the park.",
    "The feline is resting on a rug.",
    "An animal moves through the field.",
    "I love programming with Python.",
]

# Load a pre-trained transformer model
model = SentenceTransformer("all-MiniLM-L6-v2")

# Convert sentences to embeddings
embeddings = model.encode(sentences)

# Compute similarity matrix
similarity_matrix = cosine_similarity(embeddings)

# Plot the similarity matrix
plt.figure(figsize=(8, 6))
plt.imshow(similarity_matrix, cmap="coolwarm", interpolation="nearest")
plt.colorbar(label="Cosine Similarity")
plt.xticks(ticks=np.arange(len(sentences)), labels=range(len(sentences)))
plt.yticks(ticks=np.arange(len(sentences)), labels=range(len(sentences)))
plt.title("Sentence Similarity Matrix")
plt.show()
Sentence Similarity Matrix

Exercise 9.3

Level: * (Easy)

Exercise Types: Modified, STAT 940 Lecture Notes, Lecture 9 Slide 431, Ali Ghodsi, Winter 2025

Question

A box with a size of 500 cubic inches needs its weight estimated. The weights and sizes of two reference boxes are: - Box 1: Size = 480 cubic inches, Weight = 20 pounds - Box 2: Size = 520 cubic inches, Weight = 30 pounds

1. Calculate the similarity scores for sizes "480" and "520" with respect to size "500". 2. Compute the coefficients a1 and a2 for the two reference boxes. 3. Calculate the weighted average weight of the box with size "500". 4. Implement a Python function to compute the estimated weight of any box given two reference boxes and their weights.

Solution

Step 1: Calculate the Similarity Scores The **similarity scores** are calculated as: Similarity=1|Target SizeReference Size|.

- For size **480**: Similarity=1|500480|=120.

- For size **520**: Similarity=1|500520|=120.

Step 2: Compute the Coefficients The coefficients a1 and a2 are normalized similarity scores: a1=120120+120=12, a2=120120+120=12.

Step 3: Calculate the Weighted Average Weight The weighted average weight is computed as: Weighted Average Weight=(a1Weight of Box 1)+(a2Weight of Box 2).

Substituting values: Weighted Average Weight=(1220)+(1230)=10+15=25pounds.

Final Answer The estimated weight of the box with size 500 cubic inches is: 25pounds. Since the target size (500) is exactly between the two reference sizes (480 and 520), the estimated weight is the average of 20 and 30 pounds, which intuitively makes sense.


Exercise 9.4

Level: ** (Moderate)

Exercise Types: Novel

Question

RNN Architecture and Weight Calculation

Recurrent Neural Networks (RNNs) are essential for processing sequences in tasks such as language modelling and time series prediction. They are designed to maintain a 'memory' of previous inputs by using the output of a layer as input for the next step. In this exercise, you will manually compute the output of a simple RNN layer over a single time step.

Given a simple RNN with:

  • One input neuron xt
  • One recurrent neuron with a hidden state ht1
  • Weight from input to hidden wih=0.5
  • Recurrent weight whh=0.8
  • Initial hidden state h0=0

Calculate the hidden state h1 after processing the first input x1=1.0.

Solution

1. Calculate Activation:

The RNN uses the formula:

ht=tanh(xtwih+ht1whh)

where tanh is the hyperbolic tangent function, providing the activation for the hidden state.

2. Compute:

h1=tanh(1.00.5+0.00.8)=tanh(0.5)0.462

Thus, h10.462, which is the new hidden state after processing the first input.

This exercise demonstrates how the RNN updates its hidden state by combining the input and the previous state, allowing the network to "remember" past information through its recurrent connections.

Below is a Python function that computes the estimated weight of any target box given two reference boxes and their weights:

import numpy as np

def estimate_weight(target_size, ref_sizes, ref_weights):
    similarities = [1 / abs(target_size - size) for size in ref_sizes]
    coefficients = similarities / np.sum(similarities)
    estimated_weight = np.dot(coefficients, ref_weights)
    return estimated_weight

# Example Usage:
target_size = 500
ref_sizes = [480, 520]
ref_weights = [20, 30]
print("Estimated weight:", estimate_weight(target_size, ref_sizes, ref_weights), "pounds")

Exercise 9.4

Level: * (Easy)

Exercise Types: Copied

References: https://fenix.tecnico.ulisboa.pt/downloadFile/1407993358918464/practical_10.pdf

Question

In this exercise, you will rewrite the attention mechanism without using matrix-matrix multiplications:

1. First, write the output of the dot product attention mechanism zi as a function of the query vector qiRdQ, the keys kjRdK (for j{1,...,L}) and the values vkRdV (for k{1,...,L}). In this exercise, consider only a single head and disregard the projection matrices.

2. Now, write the full multi-head attention mechanism output zi as a function of the input vectors xiRD and xjRD (for i,j{1,...,L}). Consider H heads and the projection matrices WQ(h)RD×dQ , WK(h)RD×dK, WV(h)RD×dV and WO(h)RHdV×dO.

Solution

1. Firstly, we compute dot products for each key-query pair: sij=d=1dQqi(d)kj(d) where qi(d) and kj(d) are the d-th components of qi and kj, respectively.

Then, we apply softmax normalization: αij=exp(sij)m=1Lexp(sim)

Finally, we compute the weighted sum of values: zi(d)=j=1Lαijvj(d) for each component d{1,,dV} of zi.

Thus, we have expressed attention computation in an element-wise fashion without matrix multiplications.

2. Firstly, we compute the projection into queries, keys, and values: qi(h,d)=m=1DWQ,m,d(h)xi(m); kj(h,d)=m=1DWK,m,d(h)xj(m); vj(h,d)=m=1DWV,m,d(h)xj(m) where WQ,m,d(h) is the (m,d)-th element of WQ(h), and similarly for WK(h) and WV(h).

Then, we compute attention for each head: sij(h)=d=1dQqi(h,d)kj(h,d), αij(h)=exp(sij(h))m=1Lexp(sim(h)), zi(h,d)=j=1Lαij(h)vj(h,d).

Finally, we concatenate all heads and apply output projection: zi(d)=h=1Hm=1dVWO,m,d(h)zi(h,m)where WO,m,d(h) is the (m,d)-th element of WO(h).


Exercise 9.5

Level: * (Easy)

Exercise Types: Novel

Question

Consider a self-attention mechanism in a transformer model.

(a) Derive the dimensions of the attention matrix A and the final self-attention output.

(b) If we increase the number of attention heads from h = 4 to h = 8, explain how this affects computational cost and representation power.

(c) If the sequence length n increases from n=10 to n=20, how does this affect the size of the attention matrix A and the computational cost?

Solution

(a) The query matrix Q has shape (n×dk), and the key matrix K has shape (n×dk). The dot-product QK^T results in a matrix of shape (n×n). Applying the softmax function does not change this shape, so the attention matrix A has shape (n×n). The final self-attention output, computed as AV, has shape (n×dk).

(b) Increasing the number of attention heads allows the model to learn more diverse representations but increases the computational cost. The number of parameters in WQ,WK,WV increases, and more dot-products and softmax operations are required. However, the multi-head mechanism enables the model to capture different aspects of dependencies in the sequence.

(c) The attention matrix A has shape (n×n). When n=10, A has size 10×10=100. When n=20, A has size 20×20=400. This results in a 4 times increase in the size of A. Computing QKT involves multiplying Q (n×dk) with KT (dk×n), requiring O(n2dk) operations. When n=10, the cost is proportional to 102dk=100dk. When n=20, the cost becomes 202dk=400dk. The computational cost increases by a factor of 4.

Additional Comments

Note that the increase by a factor of 4 is no coincidence. When n is increase by a factor of k, the computational cost will always be increased by a factor of k2. This is due to the structure of the attention mechanism in transformers, where in the self-attention layer, each token in the sequence must attend to every other token, resulting in a matrix of size n×n for the attention scores. As a result, when the sequence length doubles, the attention matrix grows quadratically in size which makes the computational cost for both memory and processing increase significantly with additional sequence length.

Exercise 9.6

Level: ** (Moderate)

Exercise Types: Application

Question

Explain how a simple Recurrent Neural Network (RNN) processes an input to update its hidden state. Provide a calculation for two consecutive time steps given specific weights and inputs.

Solution

Consider a simple RNN with one input neuron (x1), one recurrent neuron with a hidden state (h0), and given weights: - Weight from input to hidden (wih=0.5) - Recurrent weight from hidden to hidden (whh=0.8) - Initial hidden state (h0=0)

Objective: Calculate the hidden states for two time steps given:x1=1.0 and x2=0.5

step 1: Calculation: 1. Input to Hidden Calculation:

  • h1=tanh(x1wih+h0whh)
  • h1=tanh(1.00.5+0.00.8)
  • h1=tanh(0.5)
  • h10.462

step 2: Calculation: 1. Input to Hidden Calculation:

  • h2=tanh(x2wih+h1whh)
  • h2=tanh(0.50.5+0.4620.8)
  • h2=tanh(0.25+0.37)
  • h20.119

This demonstrates how the RNN updates its hidden state by combining the current input with the previous state's output through a hyperbolic tangent function, which helps to keep the values between -1 and 1.

Thus, after two time steps, the hidden state has evolved from h0=0 to h10.462 and then to h20.119

Exercise 9.7

Level: * (Easy)

Exercise Types: Novel

Question

Attention Mechanism Exercise:

Consider the following simple example where we have:

Query vector (Q): Q=[10]

Key vector (K): K=[11]

Value vector (V): V=[23]

Conduct attention computation.

Solution

QTK=1×1+0×1=1

Scaled Score=1211.4140.707

Softmax(z)=ezez=e0.707e0.707=1

Attention Output=1×[23]=[23]

Exercise 9.8

Level: * (Easy)

Exercise Types: Modified

References: https://www.analyticsvidhya.com/blog/2020/08/top-4-sentence-embedding-techniques-using-python/

Question

Sentence BERT (SBERT) is a modification of the BERT model designed to efficiently generate meaningful sentence embeddings. Unlike BERT, which focuses on token-level embeddings, SBERT is specifically optimized for semantic similarity tasks by producing fixed-size vector representations of entire sentences.

Use Sentence BERT and cosine similarity to calculate the similarity scores of sentences in Python

Solution

Load the pre-trained Sentence BERT model using the sentence_transformers python library. Install sentence_transformers with pip.

$ pip install sentence-transformers

Load the Sentence BERT model

from sentence_transformers import SentenceTransformer
sbert_model = SentenceTransformer('bert-base-nli-mean-tokens')

Import cosine_similarity function from sklearn

from sklearn.metrics.pairwise import cosine_similarity

Define the input sentence and the sentences to calculate the similarity score to. Feel free to modify the sentences to explore similarity scores of different sentences.

input_sentence = ["The FBI is chasing a criminal"]

sentences = [
    "The FBI is investigating a crime",
    "The police arrested a suspect",
    "A person stole a car",
    "A cat is chasing a mouse",
    "A cat is sleeping on the couch"
]

Use the Sentence BERT model to get the sentence embeddings, and then use cosine similarity to calculate the similatities

sentence_embeddings = sbert_model.encode(sentences)
input_embedding = sbert_model.encode(input_sentence)
similarities = cosine_similarity(input_embedding, sentence_embeddings)[0]

Print the results

print(f"\nComparing: {input_sentence[0]}")
print("-" * 50)
for i, _ in enumerate(similarities):
    print(f"Similarity: {similarities[i]:.4f} | \"{sentences[i]}\"")

Supplement: This is the result that I get

Comparing: The FBI is chasing a criminal
--------------------------------------------------
Similarity: 0.8160 | "The FBI is investigating a crime"
Similarity: 0.7057 | "The police arrested a suspect"
Similarity: 0.6137 | "A person stole a car"
Similarity: 0.2972 | "A cat is chasing a mouse"
Similarity: -0.0454 | "A cat is sleeping on the couch"

Exercise 9.9

Level: * (Easy)

Exercise Types: Novel

Question

Suppose you have 2 vectors v1=(1,2,3),v2=(0,1,0), what is the cosine similarity between the two?

Solution

similarity=2/(14)

Extended Question

Consider a set of three vectors:

v1=(1,2,3),v2=(0,1,0),v3=(1,4,2).

Compute the cosine similarity between v1 and v3. Determine which of v2 or v3 is more similar to v1.

Extended Solution

The cosine similarity formula is:

cos(θ)=v1v3|v1||v3|

First, compute the dot product:

v1v3=(1×1)+(2×4)+(3×2)=1+86=1

Next, compute the magnitudes:

|v1|=12+22+32=14

|v3|=(1)2+42+(2)2=21

Thus,

cos(θ)=114×21=12940.058

Comparing with v2:

cos(v1,v2)=2140.535

Since 0.058>0.535, v3 is more similar to v1 than v2.


Exercise 9.10

Level: ** (Moderate)

Exercise Types: Novel

Question

You are given an image of a handwritten mathematical equation, and your task is to build a system that converts the handwritten equation into a LaTeX representation using a Seq2Seq model with attention. The input to the system is an image of a handwritten equation. The encoder extracts visual features from the image. The decoder generates the corresponding LaTeX sequence. The attention mechanism helps the decoder focus on specific parts of the image while generating each LaTeX symbol.


Questions: (a) Explain why a standard Seq2Seq model (without attention) might struggle with this task.

(b) How does attention improve the performance of the decoder in this problem?

(c) Suppose the model outputs an incorrect LaTeX sequence. How can visualizing the attention weights help debug the issue?

Solution

(a) A standard Seq2Seq model without attention processes the entire image into a fixed-length vector representation. This compressed representation may lose important spatial details, making it difficult for the decoder to accurately generate long and complex LaTeX expressions. Also, handwritten equations exhibit significant variability in stroke styles, spacing, and distortions. Without attention, the model has to rely solely on the compressed representation, which may not capture these variations effectively.

(b) Attention allows the decoder to dynamically focus on different parts of the image at each decoding step. Instead of relying on a single fixed representation, the decoder attends to the most relevant regions of the image when predicting each LaTeX token, leading to better accuracy.

(c) Visualizing attention weights can help identify which regions of the image the model is focusing on while generating each LaTeX token. If the model misinterprets a character, checking the attention heatmap can reveal whether it was looking at the wrong part of the image. This can guide improvements, such as refining the attention mechanism or preprocessing the images differently.

Exercise 9.11

Level: ** (Moderate)

Reference: Novel

Question

Consider a sequence-to-sequence model with attention for machine translation. The attention mechanism computes a weighted sum of encoder hidden states to form the context vector for each decoder step. The attention weights are calculated using the softmax function applied to the similarity scores between the decoder state and encoder hidden states:

atj=exp(s(hj,st))jexp(s(hj,st))

where s(hj,st) is a similarity function, commonly defined as a dot product, additive function, or scaled dot product.

Conceptual: Explain why attention improves long-range dependency handling compared to a standard sequence-to-sequence model without attention.

Computational: Given the encoder hidden states

h1=[0.2,0.5],h2=[0.3,0.1]

and the decoder hidden state

s1=[0.4,0.2],

compute the attention weights using the dot product similarity function.

Solution

Conceptual Answer Attention improves long-range dependency handling by dynamically weighting the importance of different encoder hidden states during each decoding step. Without attention, the decoder relies solely on the final hidden state of the encoder, which may lose crucial information from earlier timesteps. With attention, the model can selectively focus on relevant past states, mitigating information bottlenecks and reducing vanishing gradient effects in deep networks.

Computational Answer Using the dot product similarity function, the attention scores are computed as:

s(hj,st)=hjst

For each encoder hidden state:

s(h1,s1)=(0.2×0.4)+(0.5×0.2)=0.08+0.10=0.18

s(h2,s1)=(0.3×0.4)+(0.1×0.2)=0.12+0.02=0.14

Applying the softmax function:

at1=exp(0.18)exp(0.18)+exp(0.14)

at2=exp(0.14)exp(0.18)+exp(0.14)

Approximating exponentials:

exp(0.18)1.197,exp(0.14)1.150

at11.1971.197+1.150=1.1972.3470.51

at21.1502.3470.49

Thus, the attention weights are:

at10.51,at20.49

These values indicate that the decoder slightly favors the first hidden state over the second when forming the context vector for translation.

Exercise 9.12

Level: ** (Easy)

Reference: Novel

Question

This question is relatively simple, but will serve as an additional example of the Query Approximations and SoftMax function applications, and will hopefully reinforce the concepts. Given the following keys and values (which are non linear in nature), approximate the query key Q=170. What properties do the SoftMax alpha coefficients have? Is this a reasonable approximation?

k1=190k2=1150k3=1200 v1=55v2=70v3=100

Solution

Let us begin by calculating the similarities of each key and the query: 1|Qki|

k11|17080|=190 k21|170150|=120 k31|170200|=130

Now, let us calculate the SoftMax of each similarities: s(vi)=eviievi

α1e1/90e1/90+e1/20+e1/30=.3266 α2e1/20e1/90+e1/20+e1/30=.3395 α3e1/30e1/90+e1/20+e1/30=.3339

α1+α2+α3=1

Now, let us calculate the query approximation: α1v1+α2v2+α3v3=55.3266+70.3395+100.3339=75.1187


Now, we can effectively conclude that this is indeed a good approximation. Moreover, the SoftMax function holds its sum to unit property even in the case of non-linear Key-Values relations.

Exercise 9.13

Level: * (Easy)

Reference: Novel

Question

What is the role of the Self-Attention in the Transformer model and why is it more suitable than traditional RNN in terms of long sequence data?

Solution

The self-attention mechanism is used to calculate the relationship of each element in the input sequence to the other elements, thus capturing global dependencies. This mechanism allows Transformer to consider all elements of a sequence at the same time, rather than relying on step-by-step calculations like RNNS.

Compared with RNN, Transformer has the advantages of

1. Stronger interpretability: The influence of input parts on the model can be observed through the distribution of attention.

2. Higher computing efficiency: RNN needs to be calculated step by step while Transformer can be calculated in parallel. Thus, transformer can capture global dependencies more efficiently.

3. Better focus on long-distance information: RNN has gradient disappearance problem is difficult to capture long-distance information, but self-attention can directly consider the global information. Self-attention mechanisms provide a way for each token to focus on relevant words irrespective of their position.

Exercise 9.14

Level: * (Easy)

Exercise Types: Modified

Reference: Modified, STAT 940 Lecture Notes, Lecture 9, Ali Ghodsi, Winter 2025

Question

Consider a machine translation task where the phrase “European Economic Area” is translated into French as “zone économique européenne.”

(a) Describe how the attention mechanism would likely align words between the source and target languages in this case.

(b) How does this alignment impact the generated translation?

(c) Given the softmax-based attention mechanism, calculate the attention weight \(aij\) for the i-th target word given the j-th source word using the formula:

aij=esijkesik

Assume the similarity scores \( s_{ij} \) between the hidden state of the i-th target word and the j-th source word are:

s=[2.51.20.81.02.21.80.91.52.0]

where rows correspond to target words ("Zone", "économique", "européenne") and columns correspond to source words ("The", "European", "Economic Area").


Solution

(a)

In a standard sequence-to-sequence model without attention, the decoder generates words sequentially, relying only on the final context vector produced by the encoder. This can lead to loss of information, especially for long sentences. With the attention mechanism, the model learns to assign weights to different parts of the input sequence while generating each output word. This helps it focus on the most relevant words at each decoding step. For example, in translating “European Economic Area” into French “zone économique européenne”, the attention mechanism learns to align:

- 'European' with 'européenne'

- 'Economic' with 'économique'

- 'Area' with 'zone'


Since the word order in French differs from English, the attention mechanism dynamically shifts focus to the correct word at each step.

(b)

The attention mechanism ensures that words are placed in the correct order according to the target language’s syntax. Without attention, the model might generate incorrect word order or lose important details due to fixed-length context vectors. With attention, each output word is generated based on the most relevant parts of the input sequence, leading to accurate translations that preserve meaning and grammatical structure. For the translation of European Economic Area:

- The attention mechanism recognizes that European comes last in French.

- It correctly generates zone économique européenne instead of a direct word-for-word translation.

Thus, attention allows the model to adapt dynamically to word reordering, improve fluency, and ensure meaning is accurately transferred across languages.


(c)

To compute the attention weights aij, we use the softmax formula:

aij=esijkesik


For the first row:

e2.512.18,e1.23.32,e0.82.23

Sum of exponentials:

12.18+3.32+2.23=17.73

Compute individual attention weights:

a11=12.1817.730.69,a12=3.3217.730.19,a13=2.2317.730.13

For the second row:

e1.02.72,e2.29.03,e1.86.05

Sum:

2.72+9.03+6.05=17.80

Attention weights:

a21=2.7217.800.15,a22=9.0317.800.51,a23=6.0517.800.34

For the third row:

e0.92.46,e1.54.48,e2.07.39

Sum:

2.46+4.48+7.39=14.33

Attention weights:

a31=2.4614.330.17,a32=4.4814.330.31,a33=7.3914.330.52

[0.690.190.130.150.510.340.170.310.52]

This matrix represents the attention weights, where each row sums to 1 and indicates how much each source word contributes to the target words.


Exercise 9.15

Level: * (Easy)

Exercise Types: Modified

Reference: Deep Learning - Foundations and Concepts, by Christopher M. Bishop and Hugh Bishop. Exercise 12.2

Question

Show that the softmax function anm=exp(XnTXm)i=1Nexp(XnTXi) satisfies

anm0m=1Nanm=1

Solution

Note that the exponential function is non-negative, so the first condition is trivial. For the second condition

m=1Nanm=m=1Nexp(XnTXm)i=1Nexp(XnTXi)=m=1Nexp(XnTXm)i=1Nexp(XnTXi)=1

as desired.


Exercise 9.16

Level: * (Easy)

Exercise Types: Modified

Question

Consider a Recurrent Neural Network (RNN) model with a hidden state of size h.
(a) Derive the dimensions of the hidden state and the output at each time step for an RNN model.
(b) If we increase the number of layers in the RNN from L = 1 to L = 2, explain how this affects the computational cost and the model's ability to capture long-term dependencies.
(c) If the sequence length n increases from n = 50 to n = 100, how does this affect the size of the weight matrices and the computational cost?

Solution

(a) In an RNN, at each time step t, the hidden state ht is updated based on the previous hidden state ht-1 and the input at time step xt. The hidden state ht has shape (h), where h is the size of the hidden state. The output yt at each time step has shape (o), where o is the output dimension.

Thus, the hidden state and the output at each time step have shapes:
- Hidden state: ht ∈ ℝh
- Output: yt ∈ ℝo
(b) Increasing the number of layers L in the RNN allows the model to learn more complex representations of the sequence, capturing higher-level abstractions. However, this also increases the computational cost, as more matrix multiplications and hidden state updates are needed. The model's ability to capture long-term dependencies improves with more layers, but there is also an increased risk of vanishing or exploding gradients, especially for deeper networks.
(c) The weight matrices in the RNN model include Whh (size h × h) and Wxh (size d × h), where d is the input dimension. When the sequence length n increases from 50 to 100, the size of the weight matrices remains unchanged, but the number of time steps the RNN must process increases.
Computing the hidden state at each time step involves matrix multiplications, and the computational cost for each time step is proportional to O(h² + dh) (depending on whether the input xt or hidden state ht is dominant).
Thus, the total computational cost for processing a sequence of length n is proportional to O(n ⋅ (h² + dh)).
When n = 50, the cost is proportional to 50 ⋅ (h² + dh), and when n = 100, the cost is proportional to 100 ⋅ (h² + dh). The computational cost increases by a factor of 2.

Exercise 9.17

Level: * (Easy)

Exercise Types: Novel

Question

In the Attention Mechanism, attention scores aij are computed based on the similarity between query vectors and key vectors.These scores are used to compute a weighted sum over the value vectors to form the context vector ci.

1. Computing Attention Scores: Given a query vector q and a set of key vectors K = {k1, k2, k3}, compute similarity using dot product: si = q * ki; and compute the attention weights: ai=exp(si)jexp(sj).

If: q = [1,2], k1 = [2,1], k2 = [0,1], k3 = [1,1], compute s1, s2, s3 and corresponding attention weights a1, a2, a3.

2. Computing the Context Vector: given the value vector set: V = {v1,v2,v3}, v1 = [1,0], v2 = [0,2], v3 = [1,1], compute the context vector: c=iaivi

Solution

1. Computing Attention Scores

(a) Compute Dot-Product Similarity

s1=qk1=(1,2)(2,1)=1×2+2×1=4

s2=qk2=(1,2)(0,1)=1×0+2×1=2

s3=qk3=(1,2)(1,1)=1×1+2×1=3

(b) Compute Softmax Attention Weights

ai=exp(si)jexp(sj)

Compute exponentials: exp(4)54.60,exp(2)7.39,exp(3)20.09

Compute normalization denominator: Z=exp(4)+exp(2)+exp(3)=54.60+7.39+20.09=82.08

Compute attention weights:

a1=54.6082.080.6652, a2=7.3982.080.0900, a3=20.0982.080.2448

2. Computing the Context Vector

c=iaivi

c=(0.6652×[1,0])+(0.0900×[0,2])+(0.2448×[1,1])

c=[0.6652,0]+[0,0.1800]+[0.2448,0.2448]

c=[0.91,0.42]

Exercise 9.18

Level: * (Easy)

Exercise Types: Novel

Question

In a standard sequence-to-sequence (Seq2Seq) model for tasks like machine translation, we often face difficulties when trying to deal with long input sequences. How does adding an attention mechanism help the decoder focus on the most relevant parts of the encoder output at each step, and why does this improve performance compared to a Seq2Seq model without attention?

Solution

In a traditional Seq2Seq model (without attention), we have an encoder (often an RNN) that processes the input sequence to produce a final hidden state (or context vector). However, as the input sequence gets longer, it becomes increasingly difficult for the model to encode all relevant information into one fixed-dimensional vector, leading to potential loss of important context and degraded performance. Attention addresses the bottleneck of a single context vector by allowing the decoder to have direct access to all encoder hidden states rather than only the last one. Each encoder hidden state can be seen as a representation of the input token along with its context in the sequence. At every decoding step, the model learns attention weights that indicate how relevant each encoder hidden state is to predict the next output token. Thus, this improves performance in terms of its ability to handle long sequences and to provide better interpretabilities.

The attention mechanism addresses this bottleneck by allowing the decoder to dynamically focus on different parts of the encoder’s output at each decoding step. Instead of relying only on the final context vector, attention gives the decoder access to all encoder hidden states, treating them as a weighted sum where the weights are learned dynamically for each time step. This is achieved through the following steps:

  • At each decoding step, the decoder computes alignment scores between the current decoder state and each encoder hidden state. These scores measure the relevance of each encoder state to the current decoding step.<uli>
  • The alignment scores are then normalized using a softmax function, producing a set of attention weights that sum to 1.
  • The decoder uses these weights to compute a context vector, which is a weighted sum of all encoder hidden states.
  • This context vector is then combined with the decoder’s current state to generate the next output token.

Exercise 9.19

Level: * (Easy)

Exercise Types: Novel

Question

Use Python to implement a simplified self-attention layer. Assume the input is a matrix

xRnd

Implement self-attention using PyTorch:

Compute Q, K, V (obtained through learnable linear transformations). Compute attention weights and apply them to the value vectors.

Solution

import torch
import torch.nn.functional as F
class SelfAttention(torch.nn.Module):
    def __init__(self, d_model):
        super().__init__()
        self.W_q = torch.nn.Linear(d_model, d_model)
        self.W_k = torch.nn.Linear(d_model, d_model)
        self.W_v = torch.nn.Linear(d_model, d_model)

    def forward(self, X):
        Q = self.W_q(X)
        K = self.W_k(X)
        V = self.W_v(X)

        scores = torch.matmul(Q, K.T) / (X.shape[1] ** 0.5)
        attn_weights = F.softmax(scores, dim=-1)
        output = torch.matmul(attn_weights, V)
        
        return output

X = torch.tensor([[1.0, 0.0, 2.0], [0.5, 1.5, -1.0]])
attention_layer = SelfAttention(d_model=3)
output = attention_layer(X)
print(output)

The output is:

tensor([[-0.4841,  0.1482, -0.1839],
        [-0.3213,  0.7625,  0.4199]], grad_fn=<MmBackward0>)

Exercise 9.20

Level: * (Easy)

Exercise Types: Novel

Question

How does the attention mechanism help overcome the limitations of traditional sequence models like RNNs and LSTMs in handling long-range dependencies?

Solution

The attention mechanism addresses the limitations of traditional sequence models like RNNs and LSTMs by allowing the model to directly focus on relevant parts of the input sequence, regardless of their distance from the current position. In RNNs and LSTMs, information must be passed sequentially through hidden states, making it difficult to capture long-range dependencies due to vanishing gradients and memory constraints. As a result, these models struggle with long sentences or complex relationships between words that are far apart.

In contrast, attention mechanisms, particularly self-attention in Transformers, compute contextual relationships between all words in a sequence simultaneously. This eliminates the need for sequential processing, enabling direct connections between distant words and significantly improving the retention of long-range dependencies. Furthermore, attention mechanisms can dynamically adjust their focus based on contextual importance, making them more flexible and interpretable. By leveraging parallel computation and reducing reliance on recurrent connections, attention-based architectures achieve better performance in tasks such as language modeling, machine translation, and text generation, where capturing global context is essential.

Exercise 9.21

Level: ** (Moderate)

Exercise Types: Copied with modifications

References: https://machinelearningmastery.com/the-attention-mechanism-from-scratch/

Question

Write a Python code to demonstrate the general attention mechanism using NumPy and SciPy libraries in Python. For simplicity, you will initially calculate the attention for the first word in a sequence of four. You will then generalize the code to calculate an attention output for all four words in matrix form.

Solution

Let’s start by defining the word embeddings of the four different words to calculate the attention. In actual practice, these word embeddings would have been generated by an encoder; however, for this particular example, you will define them manually.

# encoder representations of four different words
word_1 = array([1, 0, 0])
word_2 = array([0, 1, 0])
word_3 = array([1, 1, 0])
word_4 = array([0, 0, 1])

Next, generate the weight matrices randomly. In actual practice, these would have been learned during training.

# generating the weight matrices
random.seed(42)  # to allow reproducibility
W_Q = random.randint(3, size=(3, 3))
W_K = random.randint(3, size=(3, 3))
W_V = random.randint(3, size=(3, 3))

Generate the queries, keys, and values:

# generating the queries, keys, and values
query_1 = word_1 @ W_Q
key_1 = word_1 @ W_K
value_1 = word_1 @ W_V
query_2 = word_2 @ W_Q
key_2 = word_2 @ W_K
value_2 = word_2 @ W_V
query_3 = word_3 @ W_Q
key_3 = word_3 @ W_K
value_3 = word_3 @ W_V
query_4 = word_4 @ W_Q
key_4 = word_4 @ W_K
value_4 = word_4 @ W_V

Now, score the first query vector against all key vectors using the dot product operation.

# scoring the first query vector against all key vectors
scores = array([dot(query_1, key_1), dot(query_1, key_2), dot(query_1, key_3), dot(query_1, key_4)])

The score values are subsequently passed through a softmax operation to generate the weights. Before doing so, it is common practice to divide the score values by the square root of the dimensionality of the key vectors (in this case, three) to keep the gradients stable.

# computing the weights using a softmax operation
weights = softmax(scores / key_1.shape[0] ** 0.5)
print("Attention Weights:", weights)

Finally, compute the attention output by a weighted sum of all four value vectors.

# computing the attention output
attention = (weights[0] * value_1) + (weights[1] * value_2) + (weights[2] * value_3) + (weights[3] * value_4)
print("Attention Output:", attention)

For faster processing, the same calculations can be implemented in matrix form to generate an attention output for all four words in one go:

from numpy import array, random, dot
from scipy.special import softmax
# encoder representations of four different words
word_1 = array([1, 0, 0])
word_2 = array([0, 1, 0])
word_3 = array([1, 1, 0])
word_4 = array([0, 0, 1])
# stacking the word embeddings into a single array
words = array([word_1, word_2, word_3, word_4])
# generating the weight matrices
random.seed(42)
W_Q = random.randint(3, size=(3, 3))
W_K = random.randint(3, size=(3, 3))
W_V = random.randint(3, size=(3, 3))
# generating the queries, keys, and values
Q = words @ W_Q
K = words @ W_K
V = words @ W_V
# scoring the query vectors against all key vectors
scores = Q @ K.transpose()
# computing the weights using a softmax operation
weights = softmax(scores / K.shape[1] ** 0.5, axis=1)
# computing the attention output
attention = weights @ V
print("Attention Output:\n", attention)


Exercise 9.21

Level: ** (Moderate)

Exercise Types: Copied with modifications

References: https://machinelearningmastery.com/the-attention-mechanism-from-scratch/

Question

Write a Python code to demonstrate the general attention mechanism using NumPy and SciPy libraries in Python. For simplicity, you will initially calculate the attention for the first word in a sequence of four. You will then generalize the code to calculate an attention output for all four words in matrix form.

Solution

Let’s start by defining the word embeddings of the four different words to calculate the attention. In actual practice, these word embeddings would have been generated by an encoder; however, for this particular example, you will define them manually.

# encoder representations of four different words
word_1 = array([1, 0, 0])
word_2 = array([0, 1, 0])
word_3 = array([1, 1, 0])
word_4 = array([0, 0, 1])

Next, generate the weight matrices randomly. In actual practice, these would have been learned during training.

# generating the weight matrices
random.seed(42)  # to allow reproducibility
W_Q = random.randint(3, size=(3, 3))
W_K = random.randint(3, size=(3, 3))
W_V = random.randint(3, size=(3, 3))

Generate the queries, keys, and values:

# generating the queries, keys, and values
query_1 = word_1 @ W_Q
key_1 = word_1 @ W_K
value_1 = word_1 @ W_V

query_2 = word_2 @ W_Q
key_2 = word_2 @ W_K
value_2 = word_2 @ W_V

query_3 = word_3 @ W_Q
key_3 = word_3 @ W_K
value_3 = word_3 @ W_V

query_4 = word_4 @ W_Q
key_4 = word_4 @ W_K
value_4 = word_4 @ W_V

Now, score the first query vector against all key vectors using the dot product operation.

# scoring the first query vector against all key vectors
scores = array([dot(query_1, key_1), dot(query_1, key_2), dot(query_1, key_3), dot(query_1, key_4)])

The score values are subsequently passed through a softmax operation to generate the weights. Before doing so, it is common practice to divide the score values by the square root of the dimensionality of the key vectors (in this case, three) to keep the gradients stable.

# computing the weights using a softmax operation
weights = softmax(scores / key_1.shape[0] ** 0.5)

print("Attention Weights:", weights)

Finally, compute the attention output by a weighted sum of all four value vectors.

# computing the attention output
attention = (weights[0] * value_1) + (weights[1] * value_2) + (weights[2] * value_3) + (weights[3] * value_4)

print("Attention Output:", attention)

For faster processing, the same calculations can be implemented in matrix form to generate an attention output for all four words in one go:

from numpy import array, random, dot
from scipy.special import softmax

# encoder representations of four different words
word_1 = array([1, 0, 0])
word_2 = array([0, 1, 0])
word_3 = array([1, 1, 0])
word_4 = array([0, 0, 1])

# stacking the word embeddings into a single array
words = array([word_1, word_2, word_3, word_4])

# generating the weight matrices
random.seed(42)
W_Q = random.randint(3, size=(3, 3))
W_K = random.randint(3, size=(3, 3))
W_V = random.randint(3, size=(3, 3))

# generating the queries, keys, and values
Q = words @ W_Q
K = words @ W_K
V = words @ W_V

# scoring the query vectors against all key vectors
scores = Q @ K.transpose()

# computing the weights using a softmax operation
weights = softmax(scores / K.shape[1] ** 0.5, axis=1)

# computing the attention output
attention = weights @ V

print("Attention Output:\n", attention)


Exercise 10.1

Level: * (Easy)

Exercise Types: Novel

Question

A Transformer does not inherently understand word order. Positional encoding helps provide information about sequence position.

Given the positional encoding formula: PE(pos,2i)=sin(pos100002i/d), PE(pos,2i+1)=cos(pos100002i/d)

1. Compute the positional encoding for position 3 with an embedding size of 4.

2. What happens if we remove positional encodings from a Transformer model?

3. How would the positional encoding change if we used a larger embedding size (e.g., 6 instead of 4)?

Solution

1. For the first pair we can compute as follows: PE(3,0)=sin(3/1)=sin(3)0.1411, PE(3,1)=cos(3/1)=cos(3)0.9899.

For the second pair we also have: PE(3,2)=sin(3/100)=sin(0.03)0.03, PE(3,3)=cos(3/100)=cos(0.03)0.9996.

Therefore, final positional encoding vector for pos=3, d=4 is PE(3)=[0.1411,0.9899,0.03,0.9996].

2. If we remove positional encodings, the Transformer loses its ability to distinguish word order, leading to the following issues:

(i) Loss of Sequential Information: Since self-attention treats all tokens equally (it's permutation-invariant), the model wouldn’t know if "The cat caught the fish" or "The fish caught the cat" are different sentences.

(ii) Poor Performance in NLP Tasks: Many NLP tasks require word order understanding, without positional encoding, performance in these tasks would degrade significantly.

(iii) Attention Weights Become Meaningless for Order-Sensitive Tasks: The attention mechanism would still learn token relationships but wouldn’t understand which token comes before or after. This makes tasks like language modelling (predicting the next word) much harder.

3. When using a larger embedding size, the positional encoding formula applies more dimensions for the position encoding. In the case of d=6, the positional encoding will be calculated for 6 values instead of 4, using the same sine and cosine functions for higher dimensions. This allows the model to represent richer, more granular information about the relative positions of tokens.

Exercise 10.2

Level: **(Moderate)

Exercise Types: Novel

Question

1. Why does a Transformer use attention instead of just processing words sequentially like RNNs?

2. What is the purpose of multi-head attention?

3. Why do we need positional encoding in a Transformer model?

Solution

1. Transformers use attention because it allows them to process all words in a sentence at the same time instead of sequentially. This enables faster training and better handling of long-range dependencies, where words that are far apart in a sentence can still influence each other effectively. In contrast, RNNs struggle with vanishing gradients, making it difficult for them to retain information across long sequences.

2. Multi-head attention allows the model to focus on different aspects of the sentence at the same time. Each attention head captures different types of relationships between words, helping the model learn richer and more complex representations. By combining multiple perspectives, the model forms richer, more robust representations of the input sequence, which improves performance on tasks like translation and text generation.It also allows parallelization and makes computation more efficient.

3. Since Transformers do not process words sequentially like RNNs, they need a way to know the order of words in a sentence. Positional encoding adds information about word positions, enabling the model to understand word order and meaning within the sequence. Unlike learned position embeddings, which introduce additional trainable parameters, sinusoidal encodings allow the model to generalize better to longer sequences not seen during training.

Additional comments

For question 1, I would say rather than simply processing all words in a sentence at the same time, the biggest strength of attention is the fact that it is a changing weighted average, rather than just an average. This allows the model to be able to focus more on some words rather than others depending on the situation.

Question

Compute the softmax probabilities for the following attention scores:

s1=2,s2=1,s3=0.

Solution

Softmax function:

ai=esijesj

Computing exponentials:

es1=e27.389,es2=e12.718,es3=e0=1.

Summing these:

jesj=7.389+2.718+1=11.107.

Thus, the probabilities are:

a1=7.38911.1070.665,a2=2.71811.1070.245,a3=111.1070.090.

Question

Given:

Q=[12],K=[34],V=[56],

compute the attention-weighted value using dot-product attention.

Solution

Dot-product attention score:

s=QTK=[12][34]=(1)(3)+(2)(4)=3+8=11.

Attention weight (assuming a single score):

a=e11e11=1.

Weighted value:

aV=1[56]=[56].



Question

A Transformer does not inherently understand word order. Positional encoding helps provide information about sequence position.

Given the positional encoding formula:

PE(pos,2i)=sin(pos100002i/d), PE(pos,2i+1)=cos(pos100002i/d)

1. Compute the positional encoding for position 10 with an embedding size of 512.

2. What happens if we remove positional encodings from a Transformer model?

Solution

1. For pos=10, d=512, and i=5, compute:

100002(5)/512=1000010/512=100000.01951.4678.

Thus,

PE(10,2(5))=sin(101.4678)=sin(6.816)0.480.

PE(10,2(5)+1)=cos(101.4678)=cos(6.816)0.877.

Final positional encoding vector:

PE(10)=[0.480,0.877].

2. If we remove positional encodings, the Transformer loses its ability to distinguish word order, leading to:

(i) **Loss of Sequential Information**: Since self-attention treats all tokens equally, the model wouldn’t know if "The cat caught the fish" or "The fish caught the cat" are different sentences.

(ii) **Poor Performance in NLP Tasks**: Many NLP tasks require word order understanding, without positional encoding, performance in these tasks would degrade significantly.

(iii) **Attention Weights Become Meaningless for Order-Sensitive Tasks**: The attention mechanism would still learn token relationships but wouldn’t understand which token comes before or after. This makes tasks like language modelling (predicting the next word) much harder.

Exercise 10.3

Level: ** (Moderate)

Exercise Types: Novel

Question

A transformer model consists of multiple encoder and decoder layers, where each encoder layer contains a self-attention mechanism and a feed-forward network (FFN).

(a) Explain the purpose of layer normalization in transformer models. Where is it applied within the encoder and decoder layers?

(b) For a transformer with N = 6 encoder layers, if the input sequence has a length of T = 50 and an embedding dimension of d_model = 512, calculate the number of parameters required for the multi-head self-attention layer in one encoder, assuming h = 8 attention heads.

(c) Explain how the residual connections affect gradient flow in deep transformer models.

Solution

(a) Layer normalization is used to stabilize training and improve convergence by normalizing activations across features. It is applied before the self-attention and feed-forward layers in each encoder and decoder block. Unlike batch normalization, it does not depend on the batch size and works well for sequential data.

(b) Each attention head requires three weight matrices: WQ,WK,WV of shape (dmodel×dk). Since dk=dmodel / h = 512 / 8 = 64, each matrix has 512 × 64 = 32,768 parameters. With 8 heads, the total number of parameters is 3 x 32,768 x 8 = 786,432. Additionally, there is an output projection matrix WO of shape (dmodel×dmodel), contributing another 262,144 parameters. Therefore, the total number of parameters in the multi-head self-attention layer of one encoder block is 1,048,576.

(c) Residual connections help combat vanishing gradients by allowing gradients to flow directly through layers. This enables better optimization in deep transformers, preventing degradation of performance as the model depth increases. It is essential for stabilizing training, improving convergence, and enabling deeper models to learn complex representations effectively.


Extended Question

(d) In a transformer model, positional encoding is used to introduce order information into the input sequence. Given the sine-cosine positional encoding formula:

PE(pos,2i)=sin(pos100002i/dmodel)

PE(pos,2i+1)=cos(pos100002i/dmodel)

explain why this encoding allows the model to generalize to longer sequences than seen during training.

Extended Solution

(d) The sine-cosine positional encoding ensures that each position in the sequence has a unique representation, while also encoding relative distances between positions. The key properties that allow generalization to longer sequences are:

Smooth Continuity: Since sine and cosine functions are continuous and periodic, the model can extrapolate positional information beyond the training data. Relative Position Representation: The encoding ensures that nearby positions have similar representations, allowing the model to generalize the learned attention patterns to longer sequences. Scale Invariance: Since the denominators in the exponent scale exponentially, large positional indices still produce meaningful representations within the same functional space. This allows the transformer to handle sequences longer than those encountered during training without requiring additional learned embeddings.

Exercise 10.4

Level: ** (Moderate)

Exercise Types: Novel

Question

Consider a Transformer model with a self-attention mechanism applied to a sequence of three tokens, X=[x1,x2,x3]. The attention mechanism computes the output in the following 3 steps:

1. Similarity scores:

si=qTki

2. Softmax attention weights:

ai=esijesj

3. Final attention output:

iaivi

You are given the following vectors:

Query and key vectors:

q=[12],k1=[11],k2=[22],k3=[13]

Value vectors:

v1=[10],v2=[01],v3=[11]

Find:

1. The similarity scores s1,s2,s3.

2. The attention weights a1,a2,a3.

3. The final attention output.

Solution

Computing the similarity scores:

s1=qTk1=[12][11]=3

s2=qTk2=[12][22]=6

s3=qTk3=[12][13]=7

Computing the attention weights:

a1=e3e3+e6+e7

a2=e6e3+e6+e7

a3=e7e3+e6+e7

Computing the attention output:

iaivi=a1v1+a2v2+a3v3 =(e3e3+e6+e7)[10]+(e6e3+e6+e7)[01]+(e7e3+e6+e7)[11]=[e3+e7e3+e6+e7e6+e7e3+e6+e7]


Exercise 10.5

Level: * (Easy)

Exercise Types: Novel

Question

Given the following sequence of words (represented as indices), calculate the positional encoding for each word at a specific dimension.

· Sequence of words: ["go", "to", "school"]

· Let the embedding dimension d=4

· The position indices pos will be 0, 1, and 2 (corresponding to each word).

Solution

For positionpos=0:

PE(0,0)=sin(0100002×0/4)=sin(0)=0

PE(0,1)=cos(0100002×0/4)=cos(0)=1

PE(0,2)=sin(0100002×2/4)=sin(0)=0

PE(0,3)=cos(0100002×2/4)=cos(0)=1

So, PE(0)=[0,1,0,1]


For positionpos=1:

PE(1,0)=sin(1100002×0/4)0.841

PE(1,1)=cos(1100002×0/4)0.540

PE(1,2)=sin(1100002×2/4)0.01

PE(1,3)=cos(1100002×2/4)0.9999

So, PE(1)[0.841,0.540,0.01,0.9999]


For positionpos=2:

PE(2,0)=sin(2100002×0/4)0.909

PE(2,1)=cos(2100002×0/4)0.416

PE(2,2)=sin(2100002×2/4)0.02

PE(2,3)=cos(2100002×2/4)0.9998

So, PE(2)[0.909,0.416,0.02,0.9998]

The positional encodings for each word in the sequence ["go", "to", "school"] are:

Position 0: [0, 1, 0, 1]

Position 1: [0.841, 0.540, 0.01, 0.9999]

Position 2: [0.909, -0.416, 0.02, 0.9998]

Exercise 10.6

Level: * (Easy)

Exercise Types: Novel

Question

Explain in details the relationship between the binary encoder of position and the cosine/sine function used in a tranformer.

Solution

Suppose we encode n vectors using the binary encoder, and have it repressented in a matrix B where each column vector is the binary encoding for 1 vector, ordering from left to right. Then we look at the resulting matrix row by row. For each row, the frequency where it the elements changes from 0 to 1 decreases as we go down each row. Since we need the functions to be differentiable, we mimic this behavior in the positional embedding through the functions discussed in class. Even rows we use cosine function, and odd rows we use sine function. The position is then the column of the element.

Exercise 10.7

Level: * (Easy)

Exercise Types: Modified

References: Nishad, N. (2024). Positional Encoding: Adding Sequence Awareness to Transformers. DEV. dev.to/nareshnishad/positional-encoding-adding-sequence-awareness-to-transformers-24pg

Question

Describe the connection between the positional encoding used in transformers and the sine/cosine functions, highlighting how the encoding scheme represents position in a differentiable manner.

Solution

Consider a matrix P that contains the positional encodings for n vectors, where each column in P represents the encoding of a vector's position. As we analyze the rows of this matrix, we notice that the rate at which the bits flip from 0 to 1 becomes slower as we move down the rows. To ensure smooth and differentiable transitions between position encodings, we replicate this behaviour using sinusoidal functions. Specifically, the cosine function is applied to even-indexed rows, and the sine function is applied to odd-indexed rows. The positional encoding is then determined by the specific column index, with the sine and cosine functions capturing the gradual change in position. The use of sine and cosine ensures that the model can distinguish between positions without explicitly needing to learn this information. The encoding is also designed to allow the model to handle both short- and long-range dependencies in the sequence.

Exercise 10.8

Level: * (Easy)

Exercise Types: Novel

Question

Given a simple transformer model with the following inputs:

- Query (Q) = [10]

- Key (K) = [1001]

- Value (V) =[1234]

1. Compute the attention weights.
2. Calculate the output of the attention mechanism using the attention weights.

Solution

The attention mechanism in transformers uses a scaled dot-product attention method. We perform the following steps:

1. Compute the Attention Scores:

  We compute the attention scores by taking the dot product of the Query (Q) and the transpose of the Key (K):
  
Q · KT = [1, 0] · [[1, 0], [0, 1]] = [1, 0]

2. Scale the Attention Scores:

  The attention scores are scaled by the square root of the dimension of the key vector (dk = 2):
  
Scaled attention scores = [1, 0] / sqrt(2) = [0.7071, 0]

3. Apply Softmax:

  We apply the softmax function to the scaled attention scores:
  
Softmax([0.7071, 0]) = [0.6682, 0.3318]

4. Compute the Output:

  The final output is computed by multiplying the attention weights with the Value (V) matrix:
  
Output = [0.6682, 0.3318] · [[1, 2], [3, 4]] = [1.6682, 2.6682]

Thus, the final output is:
[1.6682, 2.6682]

Exercise 10.9

Level: * (Easy)

Exercise Types: Novel

Question

This exercise is about processing an input through a multi-headed attention mechanism in a transformer. Suppose the architecture contains 2 attention heads.

(a) Given the following input matrix, X, and learned weight matrices, calculate the scaled dot product attention output, Z1, for the first head:

X=[110021201121], WQ1=[11100110], WK1=[01011011], WV1=[01111101]

(b) The output for the second attention head is given as follows:

Z2=[112312]

Concatenate Z1 and Z2 and apply the following linear transformation:

WO=[01111110]

(c) As a conceptual follow-up question, what are the advantages of having many attention heads in a transformer?

Solution

(a) The query, key, and value matrices are computed below:

Q=WQ1TX=[11011010][110021201121]=[210311]

K=WK1TX=[00111101][110021201121]=[322210]

V=WV1T=[01101111][110021201121]=[222051]

These are used to calculate the attention output, Z1, which is shown below rounded to 2 decimal places. The softmax function is computed over the rows of the matrix Q1TK12.

Z1=V1softmax(Q1TK12)=[3.242.010.752.582.291.13]

(b) Z1 and Z2 are concatenated and multiplied by the given weight matrix.

Z=WOTConcat(Z1,Z2)=[01111110][3.242.010.752.582.291.13112312]=[0.582.291.131.660.721.62]

(c) Having many attention heads can allow the model to learn more complicated patterns in text (or other data). For example, one head might focus on overall sentence structure while another head can focus on word meaning, or distinguishing identical words that have different meanings. The model can also learn long-range dependencies (i.e., the relationships between words that are far apart from each other in an input sentence). Another advantage is the computational speed; each attention head has its computations done in parallel, which is faster than having just one attention head with many weights.

To further elaborate on the benefits of multiple heads, enhancing the X data with various weights and schemes which is fed to a particular weights can help capture additional relationships and details that a singular head could not capture, thereby further increasing the understanding of say, a sentence.

Exercise 10.10

Level: * (Moderate)

Exercise Types: Novel

Question

Multi-head attention in Python

Write a function multi_head_attention(Q, K, V, num_heads) in Python that:

1. Splits the query, key, and value matrices into multiple heads.

2. Applies the Scaled Dot-Product Attention to each head.

3. Concatenates the outputs from all heads.

4. Projects the concatenated output back to the original dimensionality using a linear transformation.

Example input:

Q = np.array([[[1, 0, 1, 0],
               [0, 1, 0, 1]]])  # Shape: (1, 2, 4)

K = np.array([[[1, 1, 0, 0], 
               [0, 1, 1, 0], 
               [1, 0, 1, 0]]])  # Shape: (1, 3, 4)

V = np.array([[[1, 2, 0, 1], 
               [0, 3, 1, 0], 
               [4, 1, 0, 2]]])  # Shape: (1, 3, 4)

num_heads = 2

Function signature:

import numpy as np
def multi_head_attention(Q: np.ndarray, K: np.ndarray, V: np.ndarray, num_heads: int) -> np.ndarray:
    """
    Compute multi-head attention.
    
    Parameters:
    Q (np.ndarray): Query matrix of shape (batch_size, seq_len, d_model)
    K (np.ndarray): Key matrix of shape (batch_size, seq_len, d_model)
    V (np.ndarray): Value matrix of shape (batch_size, seq_len, d_model)
    num_heads (int): Number of attention heads
    
    Returns:
    np.ndarray: Multi-head attention output of shape (batch_size, seq_len, d_model)
    """
    pass

Solution

import numpy as np

def scaled_dot_product_attention(Q, K, V):
    d_k = K.shape[-1]
    scores = np.matmul(Q, K.transpose(0, 1, 3, 2)) / np.sqrt(d_k)
    exp_scores = np.exp(scores - np.max(scores, axis=-1, keepdims=True))  # Stability
    attention_weights = exp_scores / np.sum(exp_scores, axis=-1, keepdims=True)
    return np.matmul(attention_weights, V)

def split_heads(X, num_heads):
    batch_size, seq_len, d_model = X.shape
    d_head = d_model // num_heads
    X = X.reshape(batch_size, seq_len, num_heads, d_head)
    return X.transpose(0, 2, 1, 3)  # (batch_size, num_heads, seq_len, d_head)

def multi_head_attention(Q, K, V, num_heads):
    batch_size, seq_len, d_model = Q.shape
    d_head = d_model // num_heads
    
    # Step 1: Split Q, K, V into multiple heads
    Q_heads = split_heads(Q, num_heads)
    K_heads = split_heads(K, num_heads)
    V_heads = split_heads(V, num_heads)
    
    # Step 2: Apply scaled dot-product attention to each head
    attention_outputs = scaled_dot_product_attention(Q_heads, K_heads, V_heads)
    
    # Step 3: Concatenate heads
    attention_outputs = attention_outputs.transpose(0, 2, 1, 3).reshape(batch_size, seq_len, d_model)
    
    # Step 4: Final linear projection (for simplicity, we use an identity matrix)
    W_o = np.eye(d_model)
    output = np.matmul(attention_outputs, W_o)
    
    return output

# Test Example
Q = np.array([[[1, 0, 1, 0], 
               [0, 1, 0, 1]]])  # (1, 2, 4)
K = np.array([[[1, 1, 0, 0], 
               [0, 1, 1, 0], 
               [1, 0, 1, 0]]])  # (1, 3, 4)
V = np.array([[[1, 2, 0, 1], 
               [0, 3, 1, 0], 
               [4, 1, 0, 2]]])  # (1, 3, 4)

num_heads = 2

output = multi_head_attention(Q, K, V, num_heads)
print("Multi-Head Attention Output:", output)

Explanation:

  • Each of the Q,K,V matrices is split into 2 heads with dimentions (1,2,2) for Q, and (1,3,2) for K and V.
  • Scaled dot-product attention is applied independently to each head, capturing different aspects of the input sequences.
  • The outputs from both heads are concatenated and projected back to the original dimensionality.

Exercise 10.11

Level: ** (Moderate)

Exercise Types: Novel

Question

Positional encoding additively encodes positional information with given input vectors. By using sinusoidal functions to encode positional information, positions are able to be encoded smoothly while retaining the information from the original vector.

To better understand how the positional encoding affects a vector, try visualizing it.

Generate a random vector xR3. Using Python, apply positional encoding for indices 1 through 8 and add them to this vector. Using MatPlotLib, visualize the original vector in 3D and the modified vector after applying positional encoding for various indices.

Solution

The Python code to impliment the solution to this problem is shown below

import numpy as np
import matplotlib.pyplot as plt
from mpl_toolkits.mplot3d import Axes3D

#Generate a random 3D vector 
x = np.random.rand(3)*15

# Create 3D plot
fig = plt.figure(figsize=(10, 7))
ax = fig.add_subplot(111, projection='3d')

# Scatter plot the origin as a black dot
ax.scatter(0, 0, 0, color='black', s=100, label="Origin")

# Plot original vector x
ax.scatter(*x, color='red', s=100, label="Original Vector (Position Encoding 1)")
#Plot an line from origin to X (turns our adding arrowheads to vectors in 3D is not easy in Matplotlib surprisingly)
ax.plot([0, x[0]], [0, x[1]], [0, x[2]], linestyle="solid", alpha=0.5)

#Loop through indicies 2 through 8, generate positinal encoding vectors, add them to x, and plot them
for pos in range(2, 8):

    #Use the same position embedding encoding from the class lecture slides
    #NOTE - RATHER THAN 10000 IN DENOMINATOR WHICH HELPS FOR LONG FEATURES, I USED 1 AS IT'S A SIMPLE R3 VECTOR
    position_embedding = np.array([np.sin(pos/1**(2*1/3)), np.cos(pos/1**(2*1/3)), np.sin(pos/1**(2*2/3))])
    
    #Add the positional encoding to the original vector
    x_position_encoded = x + position_embedding

    #Plot
    ax.scatter(*x_position_encoded, label=f"Position Encoding {pos}", s=50)
    ax.plot([0, x_position_encoded[0]],  [0, x_position_encoded[1]],  [0, x_position_encoded[2]], linestyle="dashed", alpha=0.5)

#Add plot labels
ax.set_xlabel('X')
ax.set_ylabel('Y')
ax.set_zlabel('Z')
ax.set_title('Positional Encoding Visualized for a Random 3D Vector')
ax.legend()

plt.show()
Script output showing randomly generated 3D vector x and how x changes after adding positional encoding for positions 1 through 8

Exercise 10.12

Level: * (Easy)

Exercise Types: Novel

Question

Consider a self-attention mechanism where the attention scores are computed using the scaled dot-product:

si=qTkip,

where q is the query vector, ki is the key vector, and p is the dimensionality of the key vectors. The attention weights are then computed as:

ai=exp(si)jexp(sj).

(a) Show that if all key vectors are orthogonal and have the same norm, the attention scores si are evenly distributed.

(b) If q is aligned with one of the keys, what happens to the attention weight distribution?

(c) What happens to the attention weights if we apply a scaling factor to si? How does this affect the way attention is distributed among different keys?

(d) In a Transformer model, why do we add positional encodings to the input embeddings?

Solution

(a) If all key vectors ki are orthogonal and have the same norm, say |ki|=C, then their dot products satisfy:

kiTkj=C2δij,

where δij is the Kronecker delta. This implies that the attention scores si are of similar magnitude, leading to nearly uniform attention weights.

(b) If q is aligned with one key vector km, then:

sm=qTkmp=|q||km|p.

This value dominates the exponentiation in softmax, leading to am1 while all other attention weights approach zero. Thus, attention concentrates on km.

(c) Applying a scaling factor to si changes how the softmax function distributes attention. If the scaling factor increases, the differences between scores become larger, leading to more focused attention on certain keys. If the scaling factor decreases, the differences between scores shrink, making attention weights more evenly spread across all keys.

(d) Unlike RNNs, Transformers do not have a built-in sense of order since they process tokens in parallel. Positional encodings inject sequential information into token embeddings, allowing the model to learn relative positioning and maintain sentence structure. Without positional encodings, the model would treat all tokens as an unordered set, which is ineffective for structured data like language.

Exercise 10.13

Level: * (Easy)

Exercise Types: Novel

Question

1. Why does Transformer use multi-head attention? (Why not just use a single head?)

2. Why does Transformer use different weight matrices for Q (Query) and K (Key)? Why can't the same value be used for self dot-product?

3. Why does Transformer scale the attention scores before applying softmax (why divide by p)

Solution

1. Multi-head attention can:

(a) Enhances representation power: Different heads can focus on different features, such as long-range dependencies and local information.

(b) Improves learning ability: Multiple heads can learn diverse semantic relationships, improving the model’s performance.

(c) Reduces information loss: A single attention head might overlook crucial details, while multiple heads can capture them.

(d) Maintains computational efficiency: Since each head has a lower dimension than a single head, the total computation remains manageable.

In general, a single attention head is limited in capacity and may fail to learn diverse features effectively. Multi-head attention allows the model to capture richer semantic information.

2. Using different weight matrices for Q (Query) and K (Key) can increase learning capability and prevent degradation.

If Q and K share the same weight matrix, then Q=K, and the attention computation: Attention(Q,K,V)=softmax(QKTp)V results in QKT becoming a symmetric matrix, limiting the flexibility of attention mechanisms and reducing its expressiveness. Using separate weight matrices for Q and K allows the model to project queries and keys into different subspaces, enhancing the flexibility of attention scoring.

3. It can prevent excessively large values that lead to vanishing gradients.

Since QKT values can be large, directly applying softmax can cause extreme probability distributions, making gradient updates ineffective. So, a scaling factor p is required to ensure that attention scores have a variance close to 1, which stabilizing training.

Exercise 10.14

Level: * (Easy)

Exercise Types: Novel

Question

Consider an Attention Mechanism Network with a query matrix Q of size n × dq, a key matrix K of size n × dk, and a value matrix V of size n × dv.
(a)Derive the dimensions of the attention matrix A and the final attention output.
(b)If we increase the number of attention heads from h = 4 to h = 8, explain how this affects computational cost and the model's ability to represent different parts of the input sequence.
(c)If the sequence length n increases from n = 10 to n = 20, how does this affect the size of the attention matrix A and the computational cost?

Solution

(a) In an Attention Mechanism Network, the query matrix Q has shape (n × dq), and the key matrix K has shape (n × dk). The dot-product between Q and KT results in an attention matrix A of shape (n × n), where each element represents the similarity between a pair of positions in the sequence. Applying the softmax function does not change the dimensions, so the attention matrix A remains (n × n).

The final attention output is computed by multiplying the attention matrix A with the value matrix V:

Output = A × V, which has shape (n × dv).

(b) Increasing the number of attention heads from h = 4 to h = 8 allows the model to learn more diverse representations of the input by computing multiple attention distributions for different parts of the sequence. This enables the model to focus on different aspects of the input simultaneously.

However, this comes at the cost of increased computational complexity. Each attention head involves a set of matrix multiplications and softmax operations, so the number of operations increases with the number of heads. In particular, the number of parameters in the projection matrices WQ, WK, WV increases, which leads to higher memory and computational costs. Despite the increased cost, the model's capacity to represent richer information improves.

(c) The attention matrix A has shape (n × n). When the sequence length n increases from 10 to 20, the size of the attention matrix increases as follows:

- When n = 10, the attention matrix has size 10 × 10 = 100.

- When n = 20, the attention matrix has size 20 × 20 = 400. This results in a 4 times increase in the size of the attention matrix.

Computing A = Q × KT involves a matrix multiplication between Q (n × dq) and KT (dk × n), which requires O(n² ⋅ dq) operations.

When n = 10, the cost is proportional to 10² ⋅ dq = 100 ⋅ dq, and when n = 20, the cost becomes 20² ⋅ dq = 400 ⋅ dq. The computational cost increases by a factor of 4.

Exercise 10.15

Level: * (Easy)

Exercise Types: Novel

Question

What is the advantage of positional encoding compared to using the positions in the sequence directly?

Solution

Using raw positions would only yield a scalar output that would not align well with the high-dimensional word embeddings of a transformer model. Sinusoidal positional encoding maps a scalar position to a multi-dimensional vector by computing sine and cosine of varying frequencies. This approach offers us a smooth, continuous representation that captures absolute and relative positions, naturally integrates in embedding space, and generalizing to longer sequences is easy without having to introduce additional parameters. Sinusoidal encodings are based on periodic functions (sine and cosine), which means they extend smoothly to unseen sequence lengths without requiring retraining.

Exercise 10.16

Level: * (Easy)

Exercise Types: Novel

Question

Transformers use self-attention to process sequences, allowing each token to attend to every other token in parallel. However, this structure does not inherently encode information about where a token appears in the sequence.

1) Why do we need a positional encoding mechanism in such models

2) What is the key idea behind sinusoidal positional encoding?

Solution

1) In self-attention, each token “looks at” other tokens via attention weights. However, if the model only sees a set of token embeddings without positional information, it has no inherent notion of how tokens are ordered or spaced. Note that word order is critical for language understanding (e.g “the cat chased the mouse” vs “the mouse chased the cat”). Therefore, to maintain sequence structure, transformers must have a strategy to incorporate position awareness. Without positional encodings, the model would treat the input sequence as a bag of embeddings, losing crucial syntactic/semantic relationships tied to word order.

2) Each position is mapped to a p dimensional vector of sines and cosines with varying wavelengths. Phase shifts encode position because different dimensions advance through sine/cosine waves at different rates, so each position gets a unique pattern of values. Since sine/cosine functions have well-defined phase shifts, the model can infer not just absolute positions but also relative distances (the difference in phases between positions).

Exercise 10.17

Level: * (Easy)

Exercise Types: Modified

Prince, Simon J.D. Understanding Deep Learning. The MIT Press, 2023, p. 239, udlbook.com. Accessed 10 Feb. 2025.

Question

What is the masked multi-head attention and why do we need it? Why do we need to do masked attention instead of non-masked attention? If we add a new token to a precomputed masked mechanism, what is the extra computation we need to do?

Solution

The masked multi-head attention is the self-attention mechanism that is applied in parallel to different aspects of the input, with a mask matrix added to the linear transformation of the input. For each head, there will be a set of queries, keys and values.

This will increase the robustness and improve the results given bad initializations. It can also learn the input from different perspectives. It also increases efficiency by running multiple self attentions in parallel.

The masked attention ensures that the token does not attend to future words.

For the new token, we need to compute its query, key and value matrices. Then we need to expand the dimension of the attention matrix and the masked matrix. Finally compute the weighted sum of the output.

Exercise 10.18

Level: ** (Medium)

Exercise Types: Modified

Question

Show that the positional encoding for a given position n defined by rn,i={sin(nLi/D),if i is even,cos(nL(i1)/D),if i is odd.

has the property that, for a fixed offset k, the encoding at position n+k can be represented as a linear combination of the encoding at position n with coefficients that depend only on k and not on n.

Solution

At position n+k we have rn+k,i={sin(n+kLi/D),if i is even,cos(n+kL(i1)/D),if i is odd.

When i is even, we can use the trigonometric identity sin(A+B)=cosAsinB+sinAcosB and get sin(n+kLi/D)=sin(nLi/D)cos(kLi/D)+cos(nLi/D)sin(kLi/D)=cos(kLi/D)rn,i+sin(kLi/D)rn,i as desired. We can apply the trigonometric identity cos(A+B)=cosAcosBsinAsinB to the case when i is odd and obtain the desired result.

Exercise 10.19

Level: * (Easy)

Exercise Types: Novel

Question

1. Why do Transformer models use a Feed-Forward Network (FFN) after the attention layer?
2. The FFN applies the following transformation to an input vector h:

FFN(h)=max(0,hW+b)

where W is a weight matrix and b is a bias.

(a) What is the purpose of the ReLU activation function max(0,x)?
(b) If the input is:

h=[21]

and the parameters are:

W=[0.50.30.70.2],b=[0.10.2]

Compute the output of FFN(h).


Solution

1. The FFN processes each token independently to refine representations, and it introduces non-linearity and helps learn more complex patterns.

2. ReLU max(0,x) removes negative values, preventing them from propagating. It helps avoid the vanishing gradient problem and speeds up learning.

3. To compute hW+b

hW=[21][0.50.30.70.2]

Multiplication:

=[(2×0.5)+(1×0.7),(2×0.3)+(1×0.2)]

=[1.00.7,0.60.2]

=[0.3,0.8]

Adding bias b:

hW+b=[0.3+0.1,0.8+0.2]

=[0.4,0.6]

Applying ReLU:

max(0,[0.4,0.6])=[0.4,0]

Exercise 10.20

Level: * (Easy)

Exercise Types: Novel

Question

Transformers rely on positional encoding to introduce word order information since they do not inherently process sequences in order. Given the positional encoding formula:

PE(pos,2i)=sin(pos100002i/d),PE(pos,2i+1)=cos(pos100002i/d)

1. Compute the positional encoding for position 5 with an embedding size of 6.


Solution

1. Computing the positional encoding for position 5, d = 6:

import numpy as np

def positional_encoding(pos, d):
    pe = np.zeros(d)
    for i in range(0, d, 2):
        pe[i] = np.sin(pos / (10000 ** (2 * i / d)))
        if i + 1 < d:
            pe[i + 1] = np.cos(pos / (10000 ** (2 * i / d)))
    return pe

# Compute positional encoding for position 5, embedding size 6
pos = 5
d = 6
pe_vector = positional_encoding(pos, d)
print("Positional Encoding for position 5, d=6:", pe_vector)

Exercise 10.21

Level: * (Easy)

Exercise Types: Novel

Question

The Transformer Encoder primarily consists of Multi-Head Attention, Feedforward Network, Layer Normalization, and Residual Connection. Suppose we modify the Encoder so that after computing Multi-Head Attention, the output is passed directly to Layer Normalization without using Residual Connection. What potential issue might arise?

A. Reduced computational complexity, leading to faster training

B. Unstable gradient propagation, making training difficult

C. Gradient vanishing during attention computation

D. Minimal impact, Transformer can still train normally

Solution

B. Unstable gradient propagation, making training difficult

Residual Connection plays a crucial role in balancing information flow, ensuring stable training of the Transformer model. If the residual connection is removed, each layer’s output will fully depend on the Multi-Head Attention computation, potentially leading to unstable gradient propagation. This issue is particularly problematic in deep transformers, where it may result in gradient explosion or vanishing, making training more difficult.



Exercise 10.22

Level: * (Easy)

Exercise Types: Novel

Question

1. Explain how multi-head attention improves the model’s expressive power.

2. Discuss why multi-head attention is better suited than single-head attention for capturing different patterns in sequences.

Solution

1. Multi-head attention enhances a model’s expressive power by allowing multiple attention heads to focus on different aspects of the input simultaneously. Each head captures unique dependencies, such as short-range and long-range relationships, leading to richer feature representations and improved contextual understanding. By applying independent attention mechanisms, multi-head attention ensures that different features are learned in parallel, preventing a single dominant pattern from overpowering the learning process.

2. Compared to single-head attention, multi-head attention is better at capturing diverse patterns in sequences. Each head operates in a different subspace, enabling the model to extract multiple linguistic or structural features. This improves generalization and adaptability, making it particularly effective for tasks like machine translation and sequential modeling. Different attention heads can focus on different syntactic and semantic relationships, making multi-head attention more suitable for complex NLP tasks like coreference resolution, dependency parsing, and named entity recognition.

Exercise 10.23

Level: * (Easy)

Exercise Types: Novel

Question

In a Transformer model, the multi-head attention mechanism applies a learnable weight matrix W to transform the input embeddings. Suppose we model this transformation using a linear system:

X=WX

where

  • X is the original input embeddings of shape (n×d)
  • W is the learned weight matrix of size d×d
  • X is the transformed embedding matrix

A necessary condition for stable training in deep learning is that the spectral norm (largest eigenvalue magnitude) of W remains bounded.

Given the weight matrix:

W=[2112]

  • Compute the eigenvalues of W.
  • Determine if the transformation is stable under the condition |λmax|2.

Solution

The eigenvalues of a matrix W can be computed by solving the characteristic equation

det(WλI)=0

where I is the identity matrix. We leave computing the eigenvalues as an exercise for the reader. The eigenvalues of W are:

λ1=3,λ2=1

The transformation isn't stable since the largest eigenvalue magnitude is 3>2.


This result suggests that in a Transformer, weight normalization or spectral regularization may be needed to control instability during training.


Exercise 11.1

Level: * (Easy)

Exercise Types: Novel

Question

Anwser the following questions:

(a) Explain the CLS token in BERT. Why is it important?

(b) Explain the difference between BERT and GPT.

(c) How do BERT and GPT perform differently on NLP tasks?

Solution

(a) In BERT, CLS is a special classification token that is prepended to every input sequence. BERT inserts a CLS token at the beginning of every input text. The idea is that the final hidden representation of this CLS token will serve as a summary or aggregate representation of the entire sequence. Because BERT's self-attention mechanism can incorporate contextual information from all tokens into the representation of CLS, this single embedding captures information about the entire sentence or document. CLS is crucial because it provides a dedicated, trainable summary representation of the entire input sequence.

Example: The CLS token is primarily used for classification tasks. For instance, in sentiment analysis, a model trained on movie reviews can take the CLS token’s final hidden state and use it to determine whether a review is positive or negative. Similarly, in document classification, the CLS token helps categorize text into predefined classes, such as spam detection in emails.

(b) BERT is built using only the Transformer encoder stack. In the encoder, each token can attend to all other tokens in the sequence simultaneously. This allows BERT to build a bidirectional representation of language. BERT introduces the concept of Masked Language Modeling, where a subset of tokens in the input are randomly masked, and the model learns to predict these masked tokens. In contrast, GPT uses only the Transformer decoder stack. Each token can only attend to the tokens before it, making GPT a left-to-right language model. GPT has the autoregressive feature such that it is trained to predict the next token in the sequence, based on the context of all tokens to the left. They stem from the same fundamental Transformer concept but diverge in how they use attention (bidirectional vs. unidirectional) and which part of the transformer block they rely on (encoder vs. decoder).

(c) BERT excels at tasks that require a deep understanding of the entire input, such as question answering, sentence classification, and named entity recognition (NER). Since it captures bidirectional context, it is particularly useful for tasks where meaning depends on both preceding and following words. For example, in question answering, BERT can analyze both the question and passage simultaneously to locate the most relevant answer span.

Example Applications:

- Search Engines (Google Search): BERT improves search results by understanding the full context of user queries rather than just matching keywords

- Biomedical NLP (PubMedBERT): In medical research, BERT-based models help extract relevant information from clinical texts and research papers

On the other hand, GPT performs well in text generation, dialogue modelling, and creative writing tasks because of its autoregressive nature. Since it generates text token by token from left to right, it is ideal for producing coherent and contextually relevant responses in applications like chatbots, story generation, and machine translation. While BERT is more suited for understanding-based tasks, GPT is better for tasks involving natural language generation.


Exercise 11.2

Level: ** (Moderate)

Exercise Types: Novel

Refrences:

[1] ‘PyTorch-Transformers’, PyTorch. Accessed: Feb. 12, 2025. [Online]. Available: https://pytorch.org/hub/huggingface_pytorch-transformers//

[2] ‘google-bert/bert-base-uncased · Hugging Face’. Accessed: Feb. 12, 2025. [Online]. Available: https://huggingface.co/google-bert/bert-base-uncased

[3] D. Dhami, ‘Understanding BERT — Word Embeddings’, Medium. Accessed: Feb. 12, 2025. [Online]. Available: https://medium.com/@dhartidhami/understanding-bert-word-embeddings-7dc4d2ea54ca

Question

In Lecture 11, we learned about BERT, it's theoretical background, and the types of tasks it is capable of doing.

For this question, try actually loading a BERT model locally on your computer using , and use this model to predict a masked word in the middle of a sentence

Solution

from transformers import pipeline #Refernece [2] Google BERT Hugging Face

#The unmasker pipeline directly allows us to fill in a missing word in a sentence.  

unmasker = pipeline('fill-mask', model='bert-base-uncased')

unmasker("The weather outside is [MASK] so I wore a winter jacket.")

'''Example Output 

[{'score': 0.35114386677742004,
  'token': 3147,
  'token_str': 'cold',
  'sequence': 'the weather outside is cold so i wore a winter jacket.'},
 {'score': 0.1606239229440689,
  'token': 4010,
  'token_str': 'warm',
  'sequence': 'the weather outside is warm so i wore a winter jacket.'},
 {'score': 0.06689444184303284,
  'token': 12809,
  'token_str': 'freezing',
  'sequence': 'the weather outside is freezing so i wore a winter jacket.'},
 {'score': 0.059740614145994186,
  'token': 4658,
  'token_str': 'cool',
  'sequence': 'the weather outside is cool so i wore a winter jacket.'},
 {'score': 0.056616757065057755,
  'token': 10256,
  'token_str': 'mild',
  'sequence': 'the weather outside is mild so i wore a winter jacket.'}]'''
  
  #However, this does not give us much insight about how to tokenizer works or what's going on behind the scenes,
  #So let's try implimenting the tokenization and doing this manually

import torch

#Reference [1] Pytorch Transformers
  
#Load tokenizer
tokenizer = torch.hub.load('huggingface/pytorch-transformers', 'tokenizer', 'bert-base-uncased')   

#Load pretrained BERT model
model = torch.hub.load('huggingface/pytorch-transformers', 'model', 'bert-base-uncased') 

#Tokenize strings
text_1 = "The weather outside is cold."
text_2 = "I wore a winter jacket."

#Using encode_plus gives tokens and token type IDs needed for BERT
indexed_tokens = tokenizer.encode_plus(text_1, text_2, add_special_tokens=True,return_tensors="pt") #Add special tokens adds [CLS] and [SEP] tokens as required by BERT.  Return tensores = 'pt' returns a pytorch tensor

#Get the tensors
segments_tensors = indexed_tokens["token_type_ids"]

masked_index = 5 #Mask the word 'cold'

#Code from Pytorch Documentation [1]
#Re_index tokens directly as a list not a dictionary like encode_plus
indexed_tokens = tokenizer.encode(text_1, text_2, add_special_tokens=True)
indexed_tokens[masked_index] = tokenizer.mask_token_id
tokens_tensor = torch.tensor([indexed_tokens])

masked_lm_model = torch.hub.load('huggingface/pytorch-transformers', 'modelForMaskedLM', 'bert-base-uncased')

with torch.no_grad():
    predictions = masked_lm_model(tokens_tensor, token_type_ids=segments_tensors)

# Get the predicted token
predicted_index = torch.argmax(predictions[0][0], dim=1)[masked_index].item()
predicted_token = tokenizer.convert_ids_to_tokens([predicted_index])[0]

print(predicted_token) 

#Output is 'cold', exactly like we expect!!

#If we change 'winter jacket' to 'swimsuit', the output of the masked word changed to 'warm' too, just like we'd expect!


Exercise 11.3

Level: * (Easy)

Exercise Types: Novel

Question

Here are some-short answer questions about BERT, GPT, T5:

1. How does the size of a Transformer model (e.g., number of parameters) impact its performance and computational cost?

2. How does T5 unify different NLP tasks under a single framework?

3. How does the training process of BERT differ from that of GPT?

4. Which of GPT and BERT is bidirectional, and why is that important?

5. How does fine-tuning impact the performance of large pre-trained Transformer models like BERT, GPT, and T5?

Solution

1. From the size of transformer models like GPT, it’s clear that there’s a trend where the larger the model, the better its generalization. For example, GPT-1 had 117 million parameters, GPT-2 had around 1.5 billion, GPT-3 has 175 billion, and rumors suggest GPT-4 might have about 1.76 trillion parameters. So, the major improvement in GPT’s performance comes from the size of the model, though other factors like multimodal data or new algorithms (such as the chain of thought approach) might also contribute. Empirical studies (e.g., OpenAI’s scaling laws) suggest that performance improves predictably with increases in model size, data, and compute, but diminishing returns set in at extreme scales. However, as the model size increases, so do its computational cost. Larger models need more memory and processing power, and training them can take weeks or months on GPUs/TPUs.

2. T5 (Text-to-Text Transfer Transformer) treats different NLP tasks all as "text-to-text" problems. This means that no matter what the task is, like translation, summarization, or answering questions, the input and output are always just text. E.g., for translation, the input could be “translate English to German: Hello," and the model would give the German translation as output. If the task is summarization, the input might be “summarize: [long text]," and the model would create a short summary. By using the same format for everything, T5 can do a lot of different tasks with the same model, making it easy to train and use for many different applications.

3. BERT is trained by hiding some words in a sentence with a [MASK] and asking the model to guess what the missing word is. It looks at the words before and after the [MASK] to understand the full meaning of the sentence, which makes it bidirectional. GPT, on the other hand, is trained by learning to predict the next word in a sentence based on the words that came before it. It reads the sentence from left to right and tries to guess what comes next, so it only uses the words before the target word, which makes it unidirectional.

4. BERT is bidirectional, which means it looks at the words before and after a word to understand the meaning. E.g., in the sentence “Mona Lisa is a [MASK] by Leonardo da Vinci,” BERT can use the words around the [MASK] like “Mona Lisa is a " and "by Leonardo da Vinci" to guess that the missing word might be “portrait”. This helps BERT understand the whole sentence better. It’s important because it lets BERT use all the context to make a better prediction.

5. Fine-tuning allows large pre-trained Transformer models to specialize in specific tasks by training them further on smaller, task-specific datasets. Instead of training from scratch, the model starts with a strong general understanding of language from its pre-training phase and then adapts to a specific domain, such as medical or legal text, by adjusting its weights based on new data. Fine-tuning helps improve performance on targeted tasks, reduces the need for massive labeled datasets, and allows the model to achieve state-of-the-art results with relatively fewer updates. However, careful tuning is necessary to avoid overfitting, where the model becomes too specialized in the fine-tuning dataset and loses generalization ability.

Exercise 11.4

Level: * (Easy)

Exercise Types: Novel

Question

BERT's input representations consist of three distinct embeddings: token, segment, and position.

(a) Explain the purpose of each of these embeddings.

(b) Using the Hugging Face Transformers library, write a short Python script that:

  - Loads the `bert-base-uncased` tokenizer.
  - Tokenizes the following two-sentence input:
    "BERT is a powerful model architecture."
    "It revolutionized modern natural language processing."
  - Prints out the resulting input IDs and token type IDs (segment IDs).

(c) Discuss a potential limitation of using fixed position embeddings.

Solution

(a) - Token Embeddings: Represent individual words or parts of words, captering the semantic meaning of individual tokens. - Segment Embeddings: Distinguish between different sentences in an input, helping the model determine which tokens belong to which sentence / idea. - Position Embeddings: Encode the position of each token in the sequence such that the order can be accounted for.

(b)

from transformers import BertTokenizer

tokenizer = BertTokenizer.from_pretrained('bert-base-uncased')

# Define the input
text_1 = "BERT is a powerful model architecture."
text_2 =  "It revolutionized modern natural language processing."

# Tokenize the input and get input IDs and token type IDs (segments)
encoded_input = tokenizer.encode_plus(
    text_1, text_2,
    add_special_tokens=True,  # adds [CLS] and [SEP]
    return_token_type_ids=True
)

print("Input IDs:", encoded_input['input_ids'])
print("Token Type IDs:", encoded_input['token_type_ids'])

The result we got is:

Input IDs: [101, 14324, 2003, 1037, 3928, 2944, 4294, 1012, 102, 2009, 4329, 3550, 2715, 3019, 2653, 6364, 1012, 102]
Token Type IDs: [0, 0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1]

(c) Fixed position embeddings dont generalize to sequences longer than those in the training dataset. This can limit a models ability to handle very long sequences or contexts of variable length.

Additional note: Fixed position embeddings give each word a set position, but they don’t consider how words connect based on their distance. This makes it harder for the model to understand long sentences, like matching a pronoun to the right noun or following a thought across multiple sentences. Since these embeddings stay the same no matter the context, they aren’t as flexible as relative position embeddings, which adjust based on how words relate to each other.


Exercise 11.5

Level: ** (Moderate)

Exercise Types: Copied

Reference: https://www.restack.io/p/agentgpt-answer-python-gpt2-cat-ai

Question

Write a Python code that demonstrates how GPT can be used to generate text based on a given prompt using the transformers library. What is the basic functionality of the code, and how does the GPT model generate the continuation of the prompt?

Solution

The code below uses the transformers library by Hugging Face to load a pre-trained GPT-2 model and tokenizer. The model generates text based on a given prompt. The main functionality of the code is to feed the prompt into the GPT-2 model and use the model to predict the next tokens, which are then decoded into readable text.

from transformers import GPT2LMHeadModel, GPT2Tokenizer

# Load pre-trained GPT-2 model and tokenizer
tokenizer = GPT2Tokenizer.from_pretrained("gpt2")
model = GPT2LMHeadModel.from_pretrained("gpt2")

# Define the prompt
prompt = "Once upon a time, in a land far, far away,"

# Encode the prompt into tokens
input_ids = tokenizer.encode(prompt, return_tensors="pt")

# Generate text continuation
output = model.generate(input_ids, max_length=100, num_return_sequences=1, no_repeat_ngram_size=2)

# Decode the output tokens to text
generated_text = tokenizer.decode(output[0], skip_special_tokens=True)

print("Generated Text: ")
print(generated_text)

Output

Generated Text: Once upon a time, in a land far, far away, the world was a place of great beauty and great danger. The world of the gods was the land of darkness and darkness. And the darkness of this world, which was far from the light of day, was not the place where the sun and the moon met. It was in the midst of all the worlds, and in all that was beyond the earth.

Exercise 11.6

Level: ** (Moderate)

Exercise Types: Novel

Question

How to use the o3-mini-high API in Python for a mathematical reasoning task? Provide a complete code example.

Solution

Below is a complete Python example.

import openai

openai.api_key = "YOUR_API_KEY"

# Give the math problem in the code 
messages = [
    {"role": "system", "content": "You are a helpful math assistant."},
    {"role": "user", "content": "Simplify the expression (x^3 - x) / (x^2 - 1)."}
]

# Send a request using API to get the solution
response = openai.ChatCompletion.create(
    model="o3-mini",
    reasoning_effort="high",   # Enables the high reasoning mode
    messages=messages,
    temperature=0.2            # Lower temperature for math problems 
)

# Print the answer.
assistant_message = response.choices[0].message.content
print("Assistant's answer:", assistant_message)

Exercise 11.7

Level: * (Easy)

Exercise Types: Novel

Question

What is the key innovation of the BERT algorithm in natural language processing, and how does its bidirectional context capture improve performance on downstream tasks compared to previous models like Word2Vec or GPT?

Solution

BERT introduces bidirectional context capture through Bidirectional Pre-training using the Transformer architecture.

1) MLM

Unlike traditional left-to-right or right-to-left models, BERT uses a bidirectional training approach by randomly masking some words in a sentence. The model then predicts the masked words using both left and right context. This allows it to learn richer word representations by incorporating dependencies from both directions.

2)Transformer's Self-Attention Mechanism

BERT uses multi-head self-attention in its Transformer encoder, allowing each token to attend to all other tokens in the sentence. This enables deeper contextual understanding, as each word is represented with respect to the full sentence, rather than just previous or next words.

3)Next Sentence Prediction (NSP)

To further enhance contextual learning, BERT also trains on a task where it determines whether one sentence follows another in natural text. This helps it understand longer-range dependencies beyond single sentences.

Unlike Word2Vec (static embeddings) or GPT (unidirectional context), BERT's bidirectional training allows it to understand better word meaning based on full sentence context, leading to superior performance on tasks like question answering, sentiment analysis, and named entity recognition.

Additional Comment

Later researchers realized that the sentence order task was not as significant compared to the cost that it incurred

Exercise 11.8

Level: * (Easy)

Exercise Types: Novel

References: A. Ghodsi, STAT 940 Deep Learning: Lecture 11, University of Waterloo, Winter 2025.

Question

List 5 ways to improve BERT.

BERT uses bidirectional attention, while GPT relies on unidirectional attention. Why does BERT’s bidirectional attention make it better for understanding sentence meaning compared to GPT?

Solution

1. Train BERT with more data, larger batch sizes, and longer training time. (RoBERTa)
2. Train BERT on specific domain. (BioBERT, SciBERT, BERTweet, FinBERT)
3. Use more hidden layers, attention heads and parameters to capture more complex patterns. (BERT large)
4. Use fewer parameters to reduce the resources needed. (TinyBERT)
5. Fine-tuning.


BERT’s bidirectional attention allows it to use both left and right context when encoding words, making it more effective for tasks requiring sentence understanding (e.g., text classification, question answering).

In contrast, GPT’s unidirectional attention processes text from left to right, which is better suited for generative tasks like text completion.

Additional Comment:

Since BERT can take into account the left and right context of the word being encoded, it is able to capture dependencies across the entire sentence, helping the model make sense of the meaning based on the surrounding words. On the other hand, GPT's consideration of previous words only limits the ability to capture the full context in situations where the meaning of a word might depend on future words in a sentence. Since bidirectional models are better able to resolve ambiguities and generate more accurate word representations, including better representation of sentence-level meaning and relationships between words, this results in better results across various linguistic domains such as question answering and sentiment analysis.


Exercise 11.9

Level: * (Easy)

Exercise Types: Novel

Question

How do you decide whether a task is more suited for a GPT or a BERT model?

Solution

Due to the inherent difference between GPT and BERT (unidirectional vs bidirectional), BERT has a lot more weights that is being trained. As a result, tasks that requires less of a bidirectional relationship such as summarization, which can be done by taking into account of the previous words (the words coming after doesn't influence much of what the next word should be), GPT is a great choice. It would be more efficient as there are less weights to train. However, for something like sentimental analysis, BERT would be a better choice as you are trying to extract some sort of understanding/meaning of an entire sentence, so every word should be considered with respect to all the words before and after within the text.

Exercise 11.10

Level: * (Easy)

Exercise Types: Novel

Reference: Lecture 11 on LEARN

Question

Explain the key architectural difference between BERT and GPT in terms of how they process text.

Solution

BERT uses encoder blocks to process text bidirectionally, meaning it considers both left and right context when encoding a sentence. GPT uses decoder blocks and processes text unidirectionally, meaning it only considers past tokens (left-to-right) when generating text. Encoders (BERT) are better for understanding context, while decoders (GPT) are better for generating coherent sequences.

Exercise 11.11

Level: ** (Medium)

Exercise Types: Slightly Modified

Reference: Understanding Deep Learning

Question

Write the mathematical formulation of the Multiple Head Self Attention mechanism and provide code that would calculate this multi-head self attention for 2 heads.

Solution

To begin, let us provide the mathematical formulation of Multiple Head Self Attention:

Vh=βvh1T+ΩvhX Kh=βkh1T+ΩkhX Qh=βqh1T+ΩqhX

Therefore, SAh(X)=VhSoftmax(KhTQhDq)


Where we have different parameters for each head: {βvh,Ωvh},{βkh,Ωkh}$ and ${βqh,Ωqh}

If the dimension of the xm inputs is of D, and there are H heads, the keys, values and queries will all be of size D/H. Let us also note that the outputs of these self-attention mechanisms are vertically concatenated and another linear transformation is applied to combine them. This linear combination Ωc concludes the Multi-head self-attention:

MhSa(X)=Ωc(Sa1(X)T,...,SaH(X)T)T


Now, let is provide the pseudo codes to implement this scheme. Let us begin by defining our softmax function:

def softmax_cols(X):
    exp_values = np.exp(X)
    denom = np.sum(exp_values, axis = 0)
    softmax = exp_values / denom
    return softmax


def multihead_scaled_self_attention(X,omega_v1, omega_q1, omega_k1, beta_v1, beta_q1, beta_k1, omega_v2, omega_q2, omega_k2, beta_v2, beta_q2, beta_k2, omega_c):

    one_vec_T = np.transpose(np.ones(N, dtype=int))

    V1 = np.outer(beta_v1, one_vec_T) + omega_v1 @ X
    Q1 = np.outer(beta_q1, one_vec_T) + omega_q1 @ X
    K1 = np.outer(beta_k1, one_vec_T) + omega_k1 @ X

    V2 = np.outer(beta_v2, one_vec_T) + omega_v2 @ X
    Q2 = np.outer(beta_q2, one_vec_T) + omega_q2 @ X
    K2 = np.outer(beta_k2, one_vec_T) + omega_k2 @ X

    SA_1 = V1 @ softmax_cols((np.transpose(K1) @ Q1)/np.sqrt(D))
    SA_2 = V2 @ softmax_cols((np.transpose(K2) @ Q2)/np.sqrt(D))

    X_prime = omega_c @ np.vstack((SA_1, SA_2))

    return X_prime

Exercise 11.12

Level: * (Easy)

Exercise Types: Novel

Question

Use a pretrained BERT model to perform sentiment analysis on the following review of a wireless keyboard:

“works great, very nice to have the keyboard and the mouse built in. only thing is I wish it was backlit because its hard to see the keys in the dark, otherwise very nice! also very lightweight.”

Output the sentiment label (positive, neutral, or negative) and the model’s confidence in its prediction.

Solution

from transformers import BertForSequenceClassification, BertTokenizer
from transformers import pipeline

# Load the pretrained BERT model for sentiment analysis
model_name = "nlptown/bert-base-multilingual-uncased-sentiment"
model = BertForSequenceClassification.from_pretrained(model_name)
tokenizer = BertTokenizer.from_pretrained(model_name)

# Create a sentiment analysis pipeline
sentiment_pipeline = pipeline("sentiment-analysis", model=model, tokenizer=tokenizer)

# Perform sentiment analysis
sentence = "works great, very nice to have the keyboard and the mouse built in. only thing is I wish it was backlit because its hard to see the keys in the dark, otherwise very nice! also very lightweight."
result = sentiment_pipeline(sentence)

# Output:
print(result)

Output:

[{'label': '4 stars', 'score': 0.8854855895042419}]

Exercise 11.13

Level: * (Easy)

Exercise Types: Modified

Reference: Deep Learning - Foundations and Concepts, by Christopher M. Bishop and Hugh Bishop. Exercise 12.16

Question

The BERT-Large model (Devlin et al., 2018) has a maximum input length of 512 tokens, each of dimensionality D=1024 and taken from a vocabulary of 30,000. It has 24 transformer layers each with 16 self-attention heads with Dq=Dk=Dv=64, and the MLP position-wise networks have two layers with 4096 hidden nodes. Show that the total number of parameters in the BERT encoder transformer language model is approximately 340 million.

Solution

Token embeddings: 30,000 × 1024 = 30.72 million

Position embeddings: 512 × 1024 = 0.524 million

Segment embeddings: typically 2 × 1024 = 0.002 million

Embedding layer total: ~31.25 million

Each transformer layer has:

Query, key, value projection matrices: 1024 × 1024 = 1.048 million

Output projection: 1024 × 1024 = 1.048 million

First dense layer: 1024 × 4096 = 4.194 million

Second dense layer: 4096 × 1024 = 4.194 million

Total per transformer layer: 4 × 1.048 + 4.194 + 4.194 = 12.58 million

24 transformer layers: 24 × 12.58 = 301.92 million

Final classification layer: 1024 × 30000 = 30.72 million

Total number of parameters: 31.25 + 301.92 + 30.72 is approximately 340 million.

Exercise 11.14

Level: * (Easy)

Exercise Types: Novel

Question

1. What was the key improvement in GPT 2 compared to GPT 1?

2. How did GPT 3 enhance the capabilities of GPT 2?

3. In what ways did GPT 4 surpass GPT 3 in terms of performance?

Solution

1. GPT 2 had 48 layers which is significantly more than GPT 1 (14 layers), which improved its ability to generate coherent and contextually relevant text. GPT 1 focuses on unsupervised pre-training, Transformer architecture, large-scale language modeling, while GPT 2 focuses on transformer architecture, self-attention mechanism.

2. GPT3 took the idea of scaling even further with 175 billion parameters, compared to GPT 2's 1.5 billion. This allowed GPT 3 to perform more complex tasks with fewer examples (few-shot learning), and it improved its performance on a variety of NLP tasks without task-specific fine-tuning.

3. GPT 4 has about 1.76 billion parameters and improved upon GPT 3 by incorporating better handling of nuanced language, reducing hallucinations, and providing more reliable and contextually appropriate outputs. It also introduced better multimodal capabilities, meaning it can process and generate both text and images. GPT 4 also enhanced its ability to follow user intent with better alignment and reduced bias compared to GPT 3.


Exercise 11.15

Level: * (Easy)

Exercise Types: Novel

Reference: (Jacob Devlin, Ming-Wei Chang, Kenton Lee, and Kristina Toutanova) BERT: Pre-training of Deep Bidirectional Transformers for Language Understanding (2018)


Question

1. What are the two main tasks of BERT, and what are their purposes?

2. When computing the loss function for the MLM pretraining task, which tokens participate in the calculation? Is it all 15% of the words or only the tokens that are actually masked?

3. How does the implementation of the loss function ensure that unmasked tokens do not participate in loss calculation?

Solution

1.

BERT has two primary tasks:

- Masked Language Model (MLM): This task aims to predict the original form of certain words in a sentence. During training, BERT randomly selects some words and replaces them with the “[MASK]” token. The model's task is to predict the original words that were replaced. This approach allows BERT to learn both the semantics of sentences and the relationships between words.

- Next Sentence Prediction (NSP): This task aims to predict whether one sentence follows another. During training, BERT takes two sentences and determines whether the second sentence is the actual next sentence of the first one. This helps the model better understand the contextual relationship between sentences.

2.

Only the tokens that are actually masked participate in the loss calculation.

Specifically, during training, BERT randomly selects 15% of the tokens and replaces some of them with the “[MASK]” token. The model is then trained to predict the original words. When computing the loss function, only the tokens that were actually replaced by “[MASK]” are included in the calculation, while the others are ignored.

3.

To ensure that only masked tokens contribute to the loss function, a mask vector is used to indicate which tokens are masked and which are not.

The mask vector assigns a value of 1 to masked tokens and 0 to unmasked tokens. When computing the loss, the mask vector is multiplied with the predicted tokens and actual tokens, ensuring that the loss for unmasked tokens is set to 0.

In PyTorch, this can be implemented as follows:

loss_mask = torch.tensor(mask, dtype=torch.float32)  # mask is the mask vector
predictions = model(tokens)  # tokens are the input tokens
loss = loss_function(predictions, labels)
masked_loss = torch.sum(loss * loss_mask) / torch.sum(loss_mask)

This ensures that only masked tokens are included in the loss calculation.


Exercise 12.1

Level: * (Easy)

Exercise Types: Novel

Question

Describe the three phase training approach of RLHF to allow models such as BERT and GPT to be able to interact with users and follow instructions while remaining ethical.

Solution

1. Supervise fine tuning This allows a pre-trained model to understand specific tasks and guidelines through prompts. For example "summarize", "describe the process", etc. These prompts are given to the model along with the desire output to allow the model to understand different tasks. Some examples of types of prompts include brainstorming: e.g "list 5 ideas", classification: e.g "rate on a scale from 1 to 10", generation: e.g "write a story about...".

The model is able to generalize quite well to these types of prompts. For example, when trained on the prompt: Q: "what is the capital of France", A: "Paris", the model is able to generalize and know what token to predict next when asked a prompt such as "what is the capital of Canada", as it is able to generalize what the capital of a country is, and search through its corpus to predict the correct answer "Ottawa".

2. Training a reward model After supervise fine tuning (SFT), we next try to improve this model by rewarding the model for producing good responses. Given a prompt, the SFT model produces different responses. For each possible pair given the different responses, a human than ranks which response is better. We then train a separate model, which follows the same architecture as the SFT, but the last linear layer is removed, and replaced with a different linear layer, which will then output a scalar value, which represents the "reward" of the answer to the prompt. Given a pair of answers, our loss function is then loss(θ)=E[log(σ(rwrl)]. That is, our loss function works to maximize the difference between the winning vs losing responses, in order to tune our reward model.

3. Reinforcement learning from human feedback Now that we have 2 models, a SFT model and a reward model, we can create a new reinforcement learning model that is able to learn on the go.

The first step is to clone the SFT model. We then update the weights of this new model in order to maximize the reward. More specifically, the process goes as follows:

a. The model generates a token xt based on previous tokens xt1,,...,x0, and continues to generate tokens until the sequence is complete.

b. After finishing generating the sequence, the reward model assigns a reward r(x)

c. The weights of the reinforcement learning model are updated using policy gradient update.

The final loss function used to update the reinforcement model is:

ww+αwJ(pw), where J(pw)=Expw[r(x)βKL(pw(x),pSFT(x))]+γExpretrain[log(pw(x))].

Note that the KL divergence term is subtracted so that the reinforcement model does not deviate too much from the SFT model. (KL divergence is closer to 0 if the probability distributions are more similar). The final term is added to ensure the RL model aligns with the original pretrained base. This terms ensure our RL model does not change too drastically. After updating the RL model for some steps, we initialize a new reward model from it and retrain the reward model in order to keep finetuning the RL model.

4. Ethical Considerations and Real-World Applications

Incorporating human feedback in RLHF presents ethical advantages but also challenges:

a. Avoiding Bias: Ensuring feedback is diverse to prevent reinforcing harmful biases is critical to training fair models.

b. Transparency and Accountability: Clear documentation on how feedback is incorporated builds trust and allows for accountability in AI systems.

c. Applications in Sensitive Areas: RLHF is used in areas like healthcare and education, but it’s crucial to ensure AI systems provide accurate, evidence-based information, particularly when patient safety is involved.

d. Ethical User Interaction: Models like BERT and GPT should avoid generating harmful content. The reward model should include ethical guidelines to maintain socially accepted norms.

Conclusion: By considering ethical standards in RLHF, we can ensure that models perform effectively while remaining responsible and beneficial to society.

Exercise 12.2

Level: * (Easy)

Exercise Types: Novel

Question

What is achieved in each of the three phases of reinforcement learning with human feedback (RLHF), how are these 3 phases implimented, and how does direct preference optimzation (DPO) improve upon RLHF as the current state-of-the-art model?

Solution

The first phase of RLHF is Supervised Fine Tuning (SFT). This is done on top of a pre-trained LLM to further refine it's training. Without SFT, LLMs are primarily suited for predicting the statistically most likely next token. However, just predicting the statistically most likely next token isn't well suited for many applications of these models, such as the chat like nature of ChatGPT. To make the LLM more suited for chat-like applications, during SFT the model is refined to be able to respond well to typical human entered prompts with reasonable responses. To do this, prompts and sample responses are generated manually then fed into the model to be trained on. As a result of this, the model better responds to human prompts in an expected conversation-like manner, rather than just predicting the most likely next word based on the training dataset.


The second phase of RLHF is training a Reward Model (RM). Whereas SFT helped the LLM generate a response formatted in the desired manner, it doesn't necessarily always follow the user's intent or ethical requirements. A reward model is therefore developed to predict how a human would rate a given response. To achieve this, the last linear embedding layer is removed from the transformer, and replaced with a new randomly initialized linear layer with a single output value, the predicted reward of the model. This new model is trained based on human feedback of sample generated responses to generate a numeric value for how well a response would be perceived by humans. This reward model is then used in the next phase to optimize the model.


The third phase of RLHF training is the RLHF phase. SFT produces responses to questions, but the responses may not necessarily abide by what is desired by the output of the LLM. The RM model is able to predict a numeric score of the quality of the model output, but does nothing to actually train the LLM and adjust it's weights to produce more preferential outputs. The reinforcement learning model combines these two to train a model which produces responses to the questions which align with the human scored values where were trained during the RM phase. This is handles through a reinforcement-learning approach. The state (previous encoded words), action (next generated word) and rewards (output of the RM) are known. Reinforcement learning is then used to generate a new loss function which maximizes the reward from the RM model while satisfying the SFT tuned model and original model outputs. The model is then retrained with this new loss function and learns to produce better responses which still satisfy the original model, SFT model, while maximizing the RM.


Direct preference optimization uses the same SFT phase as mentioned above like RLHF. Human-labelled pairs of preferred output responses are created, similar to the reward model step in RLHF. However, for DPO, a loss is used which is able to directly update the weights of the LLM without the requirement to generate a RM to numerically score outputs, and without the requirement to use reinforcement learning to update the weights. As a result, DPO reduces the complexity and increases stability over DPO.

Exercise 12.3

Level: ** (Moderate)

Exercise Types: Novel

Reference: https://www.ibm.com/think/topics/rlhf

Question

How does reinforcement learning from human feedback (RLHF) work, and why is it particularly useful for tasks with complex or ill-defined goals?

Solution

Reinforcement learning from human feedback (RLHF) is an advanced machine learning paradigm where the optimization of an artificial intelligence (AI) agent is achieved through a reward model that is trained using direct human feedback. In this approach, human evaluators provide feedback on the AI's actions or outputs, which is then translated into numerical values used to update the agent's behavior. This feedback serves as the basis for refining the model's decision-making process via reinforcement learning algorithms, where the agent learns to maximize rewards over time.

RLHF is particularly advantageous for tasks where the goals or desired outcomes are complex, subjective, or difficult to formally define in a mathematical framework. For example, when dealing with abstract tasks like humor, creativity, or ethical behavior—domains where traditional reinforcement learning struggles due to the absence of well-defined success metrics—human feedback can provide nuanced guidance. Rather than relying on rigid objectives, RLHF allows the system to be trained to align with human preferences and values by incorporating subjective judgments into the reward function.

The process typically involves multiple phases: initially, the model is pre-trained on large datasets, followed by supervised fine-tuning to guide its responses according to human expectations. In the RLHF phase, human evaluators provide comparative feedback on the model’s outputs, which is used to construct a reward model. This reward model translates qualitative human preferences into a scalar reward signal, which the reinforcement learning algorithm uses to adjust the model’s policy and improve performance. Through iterative feedback and optimization, the AI agent refines its responses to better reflect human values and achieve more contextually appropriate outcomes.

RLHF has been instrumental in enhancing large language models (LLMs) by improving their ability to generate coherent, accurate, and contextually sensitive text, surpassing previous limitations in traditional supervised learning. For instance, LLMs such as OpenAI's InstructGPT have shown remarkable improvements in following instructions, avoiding model hallucinations, and maintaining factual accuracy, largely due to the integration of RLHF techniques.

Additional Commments

I think the key that distinguishes the RLHF to DOP for ill defined goals is that usage of a reward model. When we humans are not too sure, the extra complexity of the RLHF architecture may lead us to better results. If the model deviates a bit away from what the humans fine tuned it as, it may be optimal since the labelers are not completely confident either.

Exercise 12.4

Level: ** (Moderate)

Exercise Types: Novel

Question

In reinforcement learning with human feedback (RLHF),wk+1=wk+αwJ(πw),

where: wk represents the policy parameters at step k, α is the learning rate, wJ(πw) is the policy gradient.

However, instead of standard policy gradient updates, we use a reward model (RM) to refine policy updates based on human feedback:

mk+1=βmk+(1β)wJRM(πw)

wk+1=wk+αmk+1

where: mk is the momentum term, which accumulates past gradients, β is the momentum coefficient, JRM(πw) is the reward-adjusted policy gradient based on human feedback.

Given:

- Initial policy weight: w0=1.0

- Initial momentum: m0=0.0

- Learning rate: α=0.1

- Momentum coefficient: β=0.9

- Reward-adjusted policy gradients at each step: wJRM(πw)=[2.0,1.8,1.6,1.5]

a. Compute the first three iterations (w1,w2,w3) using the momentum-based policy gradient ascent with reward-adjusted updates.

b. Compare the results with vanilla gradient ascent (without momentum). Which method converges faster?

c. If the learning rate increases to α=0.5, what risks arise, and how does it affect convergence?

Solution

a. Iteration 1 (k=0): m1=(0.9×0)+(10.9)×2.0=0.2 w1=1.0+0.1×0.2=1.02

Iteration 2 (k=1): m2=(0.9×0.2)+(10.9)×1.8=0.38 w2=1.02+0.1×0.38=1.058

Iteration 3 (k=2): m3=(0.9×0.38)+(10.9)×1.6=0.502 w3=1.058+0.1×0.502=1.1082


b. w3=1.38+0.1×1.6=1.54

Comparison: Momentum-based updates smooth policy updates, avoiding abrupt changes. Vanilla gradient ascent updates faster initially but lacks stability.


c. If α is increased, updates become larger: wk+1=wk+0.5×mk+1

Potential Risks: Divergence: If updates overshoot the optimal value, learning becomes unstable.

Oscillations: The policy may fluctuate between actions without settling.

Exercise 12.5

Level: * (Easy)

Exercise Types: Novel

Question

What are the top models in the world across various tasks—including general reasoning, mathematical reasoning, code generation and how do their performances compare?

Solution

Below is a comparative table outlining key performance metrics for several leading AI models. For language and reasoning tasks, the benchmarks include MMLU (general reasoning), GSM8K (mathematical reasoning), and HumanEval (code generation).

Model Provider MMLU (General Reasoning) GSM8K (Math) HumanEval (Code)
GPT-4 OpenAI ~86.4% 92.0% ~67%
GPT o3‑mini‑high OpenAI ~86.9% ~97.9% Top Code ELO
Claude 2 Anthropic ~80–82% 88% 71.2%
Gemini Ultra Google >88% >92% >88%
LLaMA 2 70B Chat Meta ~70% ~55% ~30%
Mistral 7B Instruct Mistral AI ~65% (est.) ~35% (est.) ~20–30% (est.)
DBRX Databricks 73.7% 66.9% 70.1%
DeepSeek V3 DeepSeek ~88% ~89% ~83%
ChatGPT o1 Pro mode OpenAI 92.3%​ ~95% 92.4%

Exercise 12.6

Level: * (Easy)

Exercise Types: Novel

Question

What are the advantages and disadvantages of Reinforcement Learning from Human Feedback compared to Direct Preference Optimization?

Solution

Due to the architectural differences between the two, RLHF has more flexibility with its reward model. RLHF handles various types of human feedback, such as numerical ratings, textual corrections, or scalar reward values, while DPO requires binary preferences (A vs. B comparisons). This can be an advantage or a disadvantage depending on the situation. But this also means that it takes a lot longer to train using RLHF as it may run into divergence issues due to its complexity. In other words, DPO is simpler and more efficient. This simplicity also ensures that the resulting model sticks to the human preferences inputs rather than deviating too far away which may happen with RLHF.

One of the main differences between RLHF and DPO is how they scale in real-world applications. RLHF requires training and fine-tuning a separate reward model, which increases computational costs and makes the process more resource-intensive. In contrast, DPO directly optimizes policy parameters based on human preferences without requiring a learned reward function, making it more computationally efficient. However, because DPO only relies on explicit preference pairs, it may struggle when preference data is limited or inconsistent, whereas RLHF can generalize better by leveraging soft reward signals that allow for more nuanced learning.

Another key distinction is how each method balances exploration and exploitation during training. Since RLHF continuously refines its policy using an evolving reward model, it can generalize to a wider range of tasks, even when explicit preference labels are not available for every scenario. On the other hand, DPO strictly follows provided human preferences and does not introduce additional reward shaping, which means it is less flexible in adapting to unseen cases. This difference makes RLHF more effective for open-ended tasks like dialogue modeling, where human preferences can be ambiguous or context-dependent, while DPO is better suited for structured ranking tasks where binary preferences provide a clear supervision signal.

Example Applications:

- RLHF: Used in chatbots (ChatGPT, Claude) to refine conversational AI by incorporating diverse human feedback, such as ranking multiple completions or providing free-text corrections

- DPO: Used in ranking systems (search engine results, content recommendations) where pairwise preference data helps optimize content ordering efficiently

Exercise 12.7

Level: * (Easy)

Exercise Types: Novel

References: A. Ghodsi, STAT 940 Deep Learning: Lecture 12, University of Waterloo, Winter 2025.

Question

Explain the purpose of alignment in LLMs and how this affects LLMs ability to complete tasks. List some examples of training methods for alignment.

Solution

The alignment aims to align GPT's responses with users' instructions and ethical standards. It makes sure that the GPT can produce responses that are not only gramatically correct and statistically relevant, but also meet users' intentions and are not harmful. The purpose is to make the model more useful and trustworthy.

The alignment in LMs train the models with users' intentions, it helps to produce accurate and relevant results following users' instructions, and avoids bais, toxicity, or harm.

Some training methods are:
1. Filtering pretraining datasets: remove harmful data from the input to the LLMs.
2. Fine-tuning on value-targeted datasets: train the model with data from a specific domain.
3. Learn from human feedback.
4. Reinforcement learning: using reward functions that optimize for ethicality and factuality.


Additional note:

Adversarial training is another method that can be used to improve alignment: the model is given tough examples that are specifically designed to challenge it, like situations where it might give biased or harmful responses; By training with these tricky examples, the model learns to handle such situations better and becomes stronger at avoiding bad or undesirable outputs.

Exercise 12.8

Level: ** (Moderate)

Exercise Types: Novel

Question

Answer the following 2 questions:

1. How does KL Divergence explain the trade-off between SFT and RL model distributions?

2. How does DPO improve a model with human feedback, and how is it different from RLHF?

Solution

1. KL Divergence measures how different the output distributions of two models are. Here, we’re comparing the SFT model (trained with labeled data) and the RLHF model (trained with human feedback). The formula for KL Divergence is:

DKL(PQ)=xP(x)log(P(x)Q(x))

Where:

- P(x) is the probability distribution of the SFT model.

- Q(x) is the probability distribution of the RLHF model.

So,

- Small KL Divergence: If the KL Divergence is small, it means the RLHF model is very close to the original SFT model. This shows the model hasn’t changed much and still behaves similarly but may not fully reflect human preferences.

- Large KL Divergence: A large KL Divergence means the RLHF model has shifted significantly from the SFT model. This happens because RLHF introduces human feedback, making the model more likely to produce responses that align with human preferences, but it might not be as consistent with the original SFT model anymore.

In short, KL Divergence helps us understand the trade-off between keeping the model close to the original SFT model and adapting to human preferences.


2. The main difference between DPO and RLHF is how they use feedback. In DPO, feedback is gathered through pairwise comparisons. This means humans are shown two responses to the same question and pick the one they like better. The model then adjusts itself based on this feedback to generate answers that better match what people want. On the other hand, RLHF is more complex. It uses a reward system that assigns a score to each response depending on how well it matches human preferences. The model aims to maximize that score. It also requires exploration, where the model tries different responses, gets rewards, and adjusts over time to improve. This makes RLHF slower and more resource-heavy because the model needs to explore a wide range of possible answers before finding the best ones. DPO simplifies the process by focusing on pairwise comparisons only, so it doesn’t need exploration. Instead of giving scores to responses, DPO directly uses the feedback more efficiently. It fine-tunes a pre-trained model, which means it doesn’t need to be retrained from scratch, making DPO a faster way to align the model with human preferences.

Exercise 12.9

Level: * (Medium)

Exercise Types: Novel

Question

What is AI agent? Explain how RLHF and DPO can be useful in training AI agent. Provide a sample python code training AI agent with RLHF.

Solution

AI agents are systems where LLMs dynamically direct their own processes and tool usage, maintaining control over how they accomplish tasks. RLHF and DPO can be useful in the "evaluator-optimizer" workflow in building an AI agent to fine-tuning the original model weights. Below is a python code example:

import gym
from stable_baselines3 import PPO
from stable_baselines3.common.vec_env import DummyVecEnv

# Step 1: Create a Gym environment
env = gym.make("CartPole-v1")
env = DummyVecEnv([lambda: env])  # Wrap for compatibility

# Step 2: Train a base PPO model
model = PPO("MlpPolicy", env, verbose=1)
model.learn(total_timesteps=10000)

# Simulated human feedback function
def human_feedback(obs, action):
    """
    Simulates human feedback: penalizes large pole angles.
    Returns +1 for good actions, -1 for bad ones.
    """
    pole_angle = obs[2]  # Extract pole angle from observation
    return -1 if abs(pole_angle) > 0.2 else 1

# Step 3: Fine-tune the model using human feedback
def train_with_human_feedback(model, env, feedback_epochs=5, episodes_per_epoch=10):
    for epoch in range(feedback_epochs):
        total_human_reward = 0
        observations, actions, rewards = [], [], []
        
        for _ in range(episodes_per_epoch):
            obs = env.reset()
            done = False
            episode_rewards = []
            
            while not done:
                action, _ = model.predict(obs)  # Get action
                obs, reward, done, _ = env.step(action)  # Apply action
                feedback = human_feedback(obs[0], action)  # Get human feedback
                
                adjusted_reward = reward + feedback  # Adjust reward
                
                observations.append(obs)
                actions.append(action)
                rewards.append(adjusted_reward)
                episode_rewards.append(adjusted_reward)

            total_human_reward += sum(episode_rewards)

        print(f"Epoch {epoch + 1}/{feedback_epochs}: Total Adjusted Reward = {total_human_reward}")
        
        # Fine-tune PPO model with new rewards
        model.learn(total_timesteps=2000)

# Step 4: Apply human feedback training
train_with_human_feedback(model, env, feedback_epochs=5)

# Step 5: Test the final agent
obs = env.reset()
done = False
while not done:
    action, _ = model.predict(obs)
    obs, reward, done, _ = env.step(action)
    env.render()

env.close()

Exercise 12.10

Level: * (Easy)

Exercise Types: Novel

Question

Pause and think on the limitations of AI alignment through supervised fine tuning and RLHF. Why can we never be sure that a language model will not behave an unethical way when it is the victim of prompt injection and other more sophisticated techniques? Due to what architectural / fundamental reasons might this be the case?

Solution

1. Distributional Limits:

When fine-tuning language models using RLHF, we are using a finite distribution of human preferences. However, the space in which we deploy them is effectively unbounded. The result is that no matter how comprehensive the RLHF training is, one cannot cover all exploitable gaps. Additionally, adversarial attacks and novel inputs outside the training distribution can still manipulate or trick the model into undesirable behaviors.

2. Problems in optimizing for a proxy objective:

When performing RLHF, we are optimizing for a proxy of human values with our reward model. This is not the same as training on human values themselves. There is no guarantee that this model does not contain spurious optima that might optimize our proxy for human values while actually violating the intended values of the model.

3. Base Capabilities:

No matter what, our core capabilities learned during pre-training are retained in the model weights, including many dangerous pieces of information. The alignment effort amounts to a thin behavioral safeguard, and if bypassed, one has unfettered access to model capabilities. Fine-tuning and RLHF primarily modify the output distribution rather than fundamentally changing the model’s internal knowledge, meaning that misalignment risks persist.

Additional Comment:

Because we do not fully understand how deep learning models are able to generalize knowledge internally, it is difficult to anticipate all possible failure cases, even with rigorous fine-tuning. Additionally, if a model learns to optimize for human values, it may not be truly aligned with those values, leading to unpredictable behavior in new situations.

Exercise 12.11

Level: * (Easy)

Exercise Types: Novel

Question

Deterministic vs Stochastic Policy

Consider a reinforcement learning agent navigating a grid world where the agent can move left or right.

Two policies are defined:

Policy A (Deterministic): Always move right.

Policy B (Stochastic): Move right with probability 0.7 and left with probability 0.3.

Compute the expected return if the agent starts at s0 and receives a reward of +1 for reaching s1 and -1 for reaching s2.

Solution

  • Policy A (Deterministic): Always moves right, so the expected return is +1.
  • Policy B (Stochastic):

With probability 0.7, the agent moves right and gets +1.

With probability 0.3, the agent moves left and gets -1.

Expected return: 0.7×(+1)+0.3×(−1)=0.7−0.3=0.4

Thus, the expected return for:

  • Policy A (Deterministic) = +1
  • Policy B (Stochastic) = +0.4

This highlights that deterministic policies can be optimal but may lack exploration, while stochastic policies balance exploration and exploitation.

Exercise 12.12

Level: ** (Moderate)

Exercise Types: Novel

Question

Provide an example about reinforcement learning

Solution

Reinforcement Learning Example: The Cartpole Problem

Reinforcement learning (RL) is a method where an agent learns to take actions in an environment in order to maximize cumulative rewards. A classic example of RL is the cartpole balancing problem.

Imagine a cart on a track with a pole attached to its top by a hinge. The goal is to keep the pole from falling by moving the cart left or right.

How It Works

The agent receives a state vector that might include the cart's position, velocity, the pole's angle, and its angular velocity.

Actions: Based on the state, the agent decides whether to move the cart left or right.

Reward: The agent gets a positive reward (often +1) for each time step the pole stays upright. If the pole falls, the episode ends.

Learning:Algorithms update the agent's policy. The agent uses the rewards to adjust its strategy, improving over many episodes.

Python example:

import gym
import numpy as np

def run_cartpole_episode(max_steps=500):
    env = gym.make("CartPole-v1")
    state, info = env.reset()
    
    for t in range(max_steps):
        env.render()
        action = env.action_space.sample()
        next_state, reward, done, truncated, info = env.step(action)
        print(f"Time Step {t}: State: {state}, Reward: {reward}")
        state = next_state
        if done or truncated:
            print(f"Episode finished after {t+1} timesteps")
            break
    env.close()
run_cartpole_episode()
  


Exercise 12.13

Level: ** (Moderate)

Exercise Types: Novel

References: Deep Learning Lecture 12 Slide 92, Ali Ghodsi

This problem generalized Problem 4.10 in this textbook to N inputs and M outputs.

Question

As discussed in Lecture 12, provide in on your own a summary of the relationships between the π functions in the DPO loss function. Moreover, provide a description of the functions and what they represent. This will serve as an easy reference for you in the future.

Solution

Let us begin by re-stating the DPO loss function:

LDPO=E(x,yw,yl)D[ln(σ)(βln(πθ(yw|x)πref(yw|x))βln(πθ(yl|x)πref(yl|x)))]=E(x,yw,yl)D[ln(σ)(βln(πθ(yw|x)πref(yw|x)πθ(yl|x)πref(yl|x)))]=E(x,yw,yl)D[ln(σ)(βln(πθ(yw|x)πref(yl|x)πref(yw|x)πθ(yl|x)))]


In the DPO function,


x represents the prompt


yw is the preferred response


yl is the less preferred response


Let us note that response preferences are generated by human rankings.

πθ is the current model's output probabilities


πref is the model's frozen probabilities


β is the scaling factor


It is important to note that πθ(yw|x)+πθ(yl|x)=1 and πref(yw|x)+πref(yl|x)=1.


Now, let us assume that πref(yw|x)=πref(yl|x)=.5 (the reference has no preference) and that we hold β constant:

If πθ(yw|x) increases, which indicates that a models current output probabilities of the prompt given the preferred response:

The Loss function decreases

If πθ(yl|x) increases, which indicates that a models current output probabilities of the prompt given the less preferred response:

The Loss function increases


Now, let us assume that πθ(yw|x)>πθ(yl|x):

If πref(yw|x) increases:

The Loss function increases

If πref(yw|x) decreases:

The Loss function decreases


This allows the model to retain memory, and fine tune adjustments without needing to train a reward model, is more stable, and easier to train.


Exercise 12.14

Level: * (Easy)

Exercise Types: Novel

References: Deep Learning Lecture 12, Ali Ghodsi

Question

What are the key differences between Supervised Fine-Tuning (SFT) and Reinforcement Learning from Human Feedback (RLHF)?

Solution

Key Differences Between Supervised Fine-Tuning (SFT) and Reinforcement Learning from Human Feedback (RLHF)
Feature Supervised Fine-Tuning (SFT) Reinforcement Learning from Human Feedback (RLHF)
Training Method Trains on a labeled dataset where responses are directly provided by human annotators. Uses human feedback to rank model outputs, then optimizes using reinforcement learning.
Feedback Type Direct human-provided labels (e.g., a single "correct" response). Pairwise comparisons or rankings of AI-generated responses.
Learning Approach Supervised learning: The model learns by mimicking human-labeled examples. Reinforcement learning: The model improves by receiving a reward signal based on human preferences.
Flexibility Limited to the quality and diversity of labeled training data. More adaptive—learns from human preferences across diverse interactions.
Response Nuance Tends to be formulaic and limited by training data. Produces more nuanced and context-aware responses.
Training Complexity Simpler: Uses conventional loss functions (e.g., cross-entropy). More complex: Requires training a reward model (RM) and reinforcement learning optimization (e.g., Proximal Policy Optimization, PPO).
Computational Cost Lower: Only requires standard model fine-tuning. Higher: Involves multiple training steps, including reward model learning and RL optimization.
Use Case Best for task-specific improvements (e.g., classification, summarization). Best for aligning AI with human values and preferences (e.g., conversational AI).
Common Weakness Model can overfit to its training data and struggle with open-ended generation. Can develop reward hacking, where the model optimizes for the reward function rather than true alignment.


Exercise 12.15

Level: * (Easy)

Exercise Types: Novel

Question

(a) Explain the main objective of Reinforcement Learning with Human Feedback (RLHF) in the context of training large language models. Why is human feedback important in this setting?

(b) Suppose you have a reward model Rϕ parameterized by ϕ that is trained to predict human preferences between two model outputs. Describe how you would update ϕ using a pairwise ranking loss.

Solution

(a) The main objective of RLHF is to align the model's outputs with human preferences by using human-generated feedback as a reward signal. This helps ensure the model generates helpful, safe, and high-quality responses that match what users expect, particularly in ambiguous or subjective scenarios where traditional supervised learning might fail.

(b) The reward model Rϕ is trained with a pairwise ranking loss. Given two model outputs y1 and y2 with a human preference label indicating which output is better, the loss is: L(ϕ)=logσ(Rϕ(y1)Rϕ(y2)) where σ is the sigmoid function. The model learns to assign higher rewards to preferred outputs.

Exercise 12.16

Level: * (Easy)

Exercise Types: Novel

Question

Assuming we are training an intelligent learning assistant, where the assistant presents a question to a student and rewards the student based on their answer. This reward will be used to induct assistant in future learning and optimizing processes. The data you have is as follows:

A correct answer gets a reward:

rw = 1

A wrong answer gets a reward:

rl = 0

Assume the learning assistant predicts the student's answer with a score of rw = 0.8, meaning the predicted probability of a correct answer is 0.8, and the predicted probability of a wrong answer is 0.2.

1. Calculate the loss value for this example.

2. Based on the loss, compute the gradient and update the model parameter θ.

Solution

1. Calculate the loss value:

Given the loss function: loss(θ) = E[log(σ(r_w - r_l))]

In this case, we know: rw = 1, rl = 0, the predicted reward is rw = 0.8

To calculate rwrl:

rwrl=10=1

Then, σ (1) = 11+e(1) 0.731

To calculate the loss:

loss(θ) = log(0.731) -0.313

2. Calculate the gradient:

Using the gradient formula:

θloss(θ) = (1 - σ(rwrl)) *θ(rwrl)

1 - σ(1) = 1-0.731 = 0.269

σ(rwrl) = 1

θloss(θ) = 0.269 * 1 = 0.269

3. Update the model parameter:

θnew = θold - α * θ, where α is learning rate.




Exercise 12.17

Level: * (Easy)

Exercise Types: Novel


Question

1. What are the key principles for ensuring AI alignment in language models?

2. How does training a Reward Model (RM) improve GPT’s alignment with human preferences?

Solution

1.

Aligned language models should adhere to three core principles:

1. Helpful: The model should provide useful and relevant responses.

2. Honest: It should avoid fabricating information and provide accurate answers.

3. Harmless: The model must avoid generating biased, toxic, or harmful content.

These principles ensure that language models remain reliable and ethical in real-world applications.

2.

A Reward Model (RM) is trained to rank responses based on human feedback. It improves alignment by:

1. Generating multiple responses for a given prompt using a fine-tuned GPT model.

2. Pairing and ranking responses – Humans rank pairs of responses to indicate which one is preferable.

3. Training the Reward Model to predict human preferences, which helps reinforce better responses.

4. Using the RM in Reinforcement Learning (RLHF) – The reward model guides the reinforcement learning process by scoring outputs, ensuring the model learns to prioritize helpful, ethical, and accurate responses.

Exercise 13.1

Level: * (Easy)

Exercise Types: Novel

References: Ou, T. (2022). Variational AutoEncoder, and a bit KL Divergence, with PyTorch. Medium. medium.com/@outerrencedl/variational-autoencoder-and-a-bit-kl-divergence-with-pytorch-ce04fd55d0d7

This is where I got the KL divergence for two Gaussians.

Question

(a) For two Gaussians with means μ1, μ2 and variances σ12, σ22, the KL divergence can be written as:

DKL=logσ2σ1+σ12+(μ1μ2)22σ2212

Suppose the learned latent distribution of a variational autoencoder is the Gaussian N(μ=2,σ2=1). Calculate the KL divergence between this distribution and the standard normal distribution, N(0,1).

(b) Calculate the total loss:

L=Reconstruction loss+βDKL(N(2,1)|N(0,1))

For β=1 and a reconstruction loss of 1.5.

(c) In practice, the KL divergence may be weighted by the hyperparameter β. What might you observe if β is very large? And what might you observe is β is very small?

(d) Suppose the latent dimension is increased, and the KL divergence is now computed as the sum over multiple independent Gaussian dimensions. How does this affect the total loss, and what does it imply for the model’s behavior?

Solution

(a) The KL divergence

DKL(N(2,1)|N(0,1))=0+1+(20)2212=2

(b) The total loss

L=1.5+1×2=2.5

(c) The hyperparameter, β

If β is too large, then the model will learn a latent space that is very similar to the prior (e.g., the standard normal distribution). The reconstructions might be blurry and generic, and look like the average of the training data.

If β is too small, then reconstruction accuracy is prioritized. In this case, the model may memorize individual images from the training data and will not be able to generalize. Furthermore, the latent space might not have a smooth/coherent organization (if you wanted to interpolate between two data points, you would not get a smooth transition).

(d) In a multi-dimensional latent space, the total KL divergence is computed as the sum of the KL divergences for each independent Gaussian dimension: DKL=i=1d(logσ2,iσ1,i+σ1,i2+(μ1,iμ2,i)22σ2,i212)

As the latent dimension increases, the KL divergence term in the total loss increases proportionally. This means that if 𝛽 remains constant, the regularization effect of the prior (forcing the latent space to be similar to the standard normal) will be stronger.

Exercise 13.2

Level: * (Easy)

Exercise Types: Novel

This problem serves as a practice to better understand KL Divergence for discrete distributions.

Question

Suppose you have the following discrete probability distributions:

P=[0.3,0.3,0.4]

Q=[0.25,0.4,0.35]

Now compute the DKL[P||Q]

Solution

DKL[P||Q]=I=13Piln(PiQi)0.0218


Fundamental Problems

Classification

Consider data {(xi,yi)}i=1n where xRd and yi  takes values in some finite set.

Find a function f, such that when we observe a new x we predict y to be f(x).

Regression

Consider data {(xi,yi)}i=1n where xRd and yi takes values in R.

Find a function f, such that when we observe a new x we predict y to be f(x).

Clustering

Consider data {xi}i=1n where xRd.

Find a function f, when we observe a new x we predict y to be f(x), such that for similar x, y is the same.

Perceptron

Define a cost function, ϕ(β,β0), as a summation of the distance between all misclassified points and the hyperplane, or the decision boundary.

To minimize this cost function, we need to estimate β, β0: minβ,β0ϕ(β,β0)={distance of all misclassified points}.

(1) A hyperplane L can be defined as L={x:f(x)=βTx+β0=0}, For any two arbitrary points x1 and x2 on L, we have

βTx1+β0=0, βTx2+β0=0,

such that βT(x1x2)=0.

Therefore, β is orthogonal to the hyperplane and it is the normal vector.

(2) For any point x0 in L,

βTx0+β0=0, which means βTx0=β0.

(3) We set β=ββ as the unit normal vector of the hyperplane L. For simplicity, we call β the norm vector. The distance of point x to L is given by

βT(xx0)=βTxβTx0=βTxβ+β0β=βTx+β0β

Where x0 is any point on L. Hence, βTx+β0 is proportional to the distance of the point x to the hyperplane L.

(4) The distance from a misclassified data point xi to the hyperplane L is

di=yi(βTxi+β0)

where yi is a target value, such that yi=1 if βTxi+β0<0, yi=1 if βTxi+β0>0.

Since we need to find the distance from the hyperplane to the misclassified data points, we need to add a negative sign in front. When the data point is misclassified, βTxi+β0 will produce an opposite sign of yi. Since we need a positive sign for distance, we add a negative sign.

Backpropagation

Backpropagation procedure is done using the following steps:

  • First arbitrarily choose some random weights (preferably close to zero) for your network.
  • Apply x to the FFNN's input layer, and calculate the outputs of all input neurons.
  • Propagate the outputs of each hidden layer forward, one hidden layer at a time, and calculate the outputs of all hidden neurons.
  • Once x reaches the output layer, calculate the output(s) of all output neuron(s) given the outputs of the previous hidden layer.
  • At the output layer, compute δk=2(yky^k) for each output neuron(s).
  • Compute each δi, starting from i=k1 all the way to the first hidden layer, where δi=σ(ai)jδjuji.
  • Compute yy^2uil=δizi for all weights ujl.
  • Then update uilnewuiloldρyy^2uil for all weights uil.
  • Continue for next data points and iterate on the training set until weights converge.
  • Epochs

    It is common to cycle through all of the data points multiple times in order to reach convergence. An epoch represents one cycle in which you feed all of your data points through the neural network. It is good practice to randomize the order you feed the points to the neural network within each epoch; this can prevent your weights from changing in cycles. The number of epochs required for convergence depends greatly on the learning rate and convergence requirements used.

    Stein's Unbiased Risk Estimator

    Model Selection

    • The general task in machine learning is estimating a function.
      • We want to estimate: f^(x) (estimated function).
      • Where there is a true underlying function: f(x) (true function).


    Definitions and Notations

    Assume T={(xi,yi)}i=1n be the training set.

    f(.) True function f^(.) Estimated function

    Also assume: yi=f(xi)+ϵi,

    where ϵiN(0,σ2)

    y^i=f^(xi)
    fif(xi)
    f^if^(xi)

    For point (x0,y0), we are interested in:

    E[(y^0y0)2]=E[(f^0f0ϵ0)2]

    =E[(f^0f0ϵ0)2]

    =E[(f^0f0)2+ϵ022ϵ0(f^0f0)]

    =E[(f^0f0)2]+E[ϵ02]2E[ϵ0(f^0f0)]

    =E[(f^0f0)2]+σ22E[ϵ0(f^0f0)]

    Case 1 Assume: (x0,y0)T

    In this case, since f^ is estimated only based on points in the training set, therefore it is completely independent from (x0,y0).

    E[(y0f)(f^f)]=cov(y0,f^0)=0

    If summing up all m points that are not in T:

    i=1m(y^iyi)2err=i=1m(f^ifi)2Err+mσ2

    Empirical error (err) is a good estimator of true error (Err) if the point (x0,y0) is not in the training set.

    Case 2 Assume: (x0,y0)T

    Then: 2E[ϵ0(f^0f0)]0

    Stein's Lemma

    If: xN(θ,σ2) and g(x) is differentiable,

    then: E[g(x)(xθ)]=σ2E[g(x)x]


    Our problem: E[ϵ0(f^0f0)]=σ2E[(f^0f0)ϵ0]

    =σ2E[f^0ϵ0f0ϵ0]

    =σ2E[f^0ϵ0]

    =σ2E[f^0y0y0ϵ0]

    =σ2E[f^0y0]

    E[(y^0y0)2]=E[(f^0f0)2]+σ22σ2E[D0]


    Sum over all n data points:

    i=1n(y^iyi)2err=i=1n(f^ifi)2Err+nσ22σ2i=1nDi

    Err=errnσ2+2σ2i=1nDiComplexity of model

    Err is Stein's Unbiased Risk Estimator (SURE).

    Regularization in Deep Learning

    Introduction

    Regularization is a fundamental concept in machine learning, particularly in deep learning, where models with a high number of parameters are prone to overfitting. Overfitting occurs when a model learns the noise in the training data rather than the underlying distribution, leading to poor generalization on unseen data. Regularization techniques aim to constrain the model’s capacity, thus preventing overfitting and improving generalization. This chapter will explore various regularization methods in detail, complete with mathematical formulations, intuitive explanations, and practical implementations.

    Classical Regularization: Parameter Norm Penalties

    L2 Regularization (Weight Decay)

    L2 Parameter Regularization (Weight Decay)

    Overview

    L2 parameter regularization, commonly known as weight decay, is a technique used to prevent overfitting in machine learning models by penalizing large weights. This penalty helps in constraining the model's complexity.

    The regularization term is given by:

    R(w)=λ2w22

    where:

    • λ is the regularization strength (a hyperparameter),
    • w represents the model weights,
    • w2 denotes the L2 norm of the weight vector.

    Gradient of the Total Objective Function

    The gradient of the total objective function, which includes both the loss and the regularization term, is given by:

    wLtotal(w;X,y)=λw+wL(w;X,y)

    The weight update rule with L2 regularization using gradient descent is:

    w:=wη(λw+wL(w;X,y))

    where η is the learning rate.

    Quadratic Approximation to the Objective Function

    Consider a quadratic approximation to the objective function:

    L(w)L(w)+12(ww)H(ww)

    where:

    • w is the optimum weight vector,
    • H is the Hessian matrix of second derivatives.

    The modified gradient equation becomes:

    λw+H(ww)=0

    Solving for w, we get:

    w=(H+λI)1Hw

    where I is the identity matrix.

    Eigenvalue Decomposition

    Assume H=QΛQ where Q is the orthogonal matrix of eigenvectors and Λ is the diagonal matrix of eigenvalues.

    Then the weight vector can be expressed as:

    w=Q(Λ+λI)1ΛQw

    The effect of weight decay is to rescale the coefficients of the eigenvectors. The i-th component is rescaled by a factor of λiλi+λ, where λi is the i-th eigenvalue.

    • If λi>λ, the effect of regularization is relatively small.
    • Components with λi<λ will be shrunk to have nearly zero magnitude.

    Effective Number of Parameters

    Directions along which the parameters contribute significantly to reducing the objective function are preserved. A small eigenvalue of the Hessian indicates that movement in this direction will not significantly increase the gradient.

    The effective number of parameters can be defined as:

    Effective Number of Parameters=iλiλi+λ

    As λ increases, the effective number of parameters decreases, which reduces the model's complexity.

    (Placeholder for Image) (Include an image illustrating the effect of weight decay on the eigenvalues and the effective number of parameters)

    Dataset Augmentation

    Overview

    Dataset augmentation is a technique used to improve the generalization ability of machine learning models by artificially increasing the size of the training dataset. This is particularly useful when the amount of available data is limited. The idea is to create new, synthetic data by applying various transformations to the original dataset.

    • Key Idea: The best way to make a machine learning model generalize better is to train it on more data. When the amount of available data is limited, creating synthetic data (e.g., by applying transformations like rotation, translation, and noise addition) and adding it to the training set can be effective.
    • Practical Example: Operations like translating training images a few pixels in each direction can greatly improve generalization. Another approach is to train neural networks with random noise applied to their inputs, which also serves as a form of dataset augmentation. This technique can be applied not only to the input layer but also to hidden layers, effectively performing dataset augmentation at multiple levels of abstraction.

    ---

    Noise Injection

    Overview

    Noise injection is a regularization strategy that can be applied in two main ways:

    1. Adding Noise to the Input: This method can be interpreted as a form of dataset augmentation and also has a direct connection to traditional regularization methods. 2. Adding Noise to the Weights: This method is primarily used in the context of recurrent neural networks and can be viewed as a stochastic implementation of Bayesian inference over the weights.

    Mathematical Proof for Injecting Noise at the Input

    Consider a regression setting where we have an input-output pair \( (x, y) \) and the goal is to minimize the expected loss function:

    J=Ex,y[(f(x)y)2]

    Now, suppose we inject noise into the input \( x \), where the noise \( \epsilon \) is drawn from a distribution with mean zero (e.g., Gaussian noise \( \epsilon \sim \mathcal{N}(0, \sigma^2) \)). The modified objective function with noise-injected inputs becomes:

    Jnoise=Ex,y,ϵ[(f(x+ϵ)y)2]

    To understand the effect of noise injection, we can expand the function \( f(x + \epsilon) \) around \( x \) using a Taylor series:

    f(x+ϵ)=f(x)+ϵxf(x)+12ϵx2f(x)ϵ+O(ϵ3)

    Since the expectation of the noise \( \epsilon \) is zero:

    E[ϵ]=0

    and assuming that the noise is isotropic with covariance matrix \( \sigma^2 I \), the expectation of the second-order term becomes:

    E[ϵϵ]=σ2I

    Substituting the Taylor expansion into the objective function:

    Jnoise=Ex,y[(f(x)y)2]+σ22Ex,y[xf(x)2]+O(σ4)

    This shows that the objective function with noise injection is equivalent to the original objective function plus a regularization term that penalizes large gradients of the function \( f(x) \). Specifically, the added term σ22Ex,y[xf(x)2] reduces the sensitivity of the network's output to small variations in its input.

    Key Result:

    For small noise variance \( \sigma^2 \), the minimization of the loss function with noise-injected input is equivalent to minimizing the original loss function with an additional regularization term that penalizes large gradients:

    JnoiseJ+σ22Ex,y[xf(x)2]

    This regularization term effectively reduces the sensitivity of the output with respect to small changes in the input \( x \), which is beneficial in avoiding overfitting.

    Connection to Weight Decay:

    In linear models, where \( f(x) = w^\top x \), the gradient \( \nabla_x f(x) \) is simply the weight vector \( w \). Therefore, the regularization term becomes:

    σ22w2

    which is equivalent to L2 regularization or weight decay.

    Manifold Tangent Classifier

    Overview

    The Manifold Tangent Classifier (MTC) is a classification technique that leverages the idea that data often lies on a lower-dimensional manifold within the high-dimensional input space. The key assumption is that examples on the same manifold share the same category, and the classifier should be invariant to local factors of variation that correspond to movements on the manifold.

    • Key Idea: The classifier should be invariant to variations along the manifold while being sensitive to changes that move the data off the manifold.

    Tangent Propagation Algorithm

    One approach to achieve invariance to manifold variations is to use the Tangent-Prop algorithm (Simard et al., 1992). The main idea is to add a penalty to the loss function that encourages the neural network's output to be locally invariant to known factors of variation. This is achieved by requiring the gradient of the output with respect to the input to be orthogonal to the known manifold tangent vectors \( v_i \) at each point \( x \).

    The regularization term can be expressed as:

    Regularizer=λi(f(x)xvi)2

    where:

    • \( \frac{\partial f(x)}{\partial x} \) is the gradient of the neural network output with respect to the input,
    • \( v_i \) are the known tangent vectors of the manifold,
    • \( \lambda \) is the regularization strength.

    This regularization ensures that the directional derivative of \( f(x) \) in the directions \( v_i \) is small, promoting invariance along the manifold.

    Manifold Tangent Classifier (MTC)

    A more recent approach, introduced by Rifai et al. (2011), eliminates the need to know the tangent vectors a priori. The Manifold Tangent Classifier automatically learns these tangent vectors during training, making it more flexible and applicable to a wider range of problems.

    ---

    Early Stopping as a Form of Regularization

    Overview

    Early stopping is one of the most commonly used forms of regularization in deep learning. Instead of running the optimization algorithm until it reaches a local minimum of the training error, early stopping involves monitoring the validation error during training and halting the process when the validation error stops improving.

    • Key Idea: During training, whenever the error on the validation set improves, a copy of the model parameters is stored. The training is stopped when the validation error has not improved for a predetermined amount of time, and the best model parameters (those that resulted in the lowest validation error) are returned.

    Mathematical Formulation

    Assume that \( w \) represents the model weights (ignoring bias parameters). We take a quadratic approximation to the objective function \( J(w) \) around the empirically optimal value of the weights \( w^* \):

    J(w)J(w)+12(ww)H(ww)

    where:

    • \( H \) is the Hessian matrix of second derivatives.

    The gradient of the objective function is:

    wJ(w)=H(ww)

    During training, the parameter vector is updated according to:

    w(t+1)=w(t)ηwJ(w(t))

    Substituting the expression for the gradient:

    w(t+1)w=(IηH)(w(t)w)

    where \( \eta \) is the learning rate. If we assume that the initial weights are zero (i.e., \( w^{(0)} = 0 \)), we can express the weight update after \( t \) iterations as:

    w(t)w=(IηH)t(w(0)w)

    If we perform an eigenvalue decomposition of \( H \), we get:

    H=QΛQ

    where \( Q \) is the orthogonal matrix of eigenvectors, and \( \Lambda \) is the diagonal matrix of eigenvalues. The weight update can then be rewritten as:

    w(t)w=Q(IηΛ)tQ(w(0)w)

    Assuming \( w^{(0)} = 0 \) and that \( |1 - \eta \lambda_i| < 1 \) for all eigenvalues \( \lambda_i \), after \( t \) training updates, we have:

    Qw(t)[I(1ηΛ)t]Qw

    Taking the logarithm and using the series expansion for \( \log(1 + x) \), it can be shown that the number of training iterations \( t \) plays a role inversely proportional to the L2 regularization parameter \( \lambda \), and the inverse of \( t \) plays the role of the weight decay coefficient.

    Key Insight:

    This result shows that early stopping can be interpreted as a form of implicit regularization, where the number of training iterations controls the effective complexity of the model.

    Early Stopping as a Form of Regularization

    Overview

    Early stopping is one of the most commonly used forms of regularization in deep learning. Instead of running the optimization algorithm until it reaches a local minimum of the training error, early stopping involves monitoring the validation error during training and halting the process when the validation error stops improving.

    • Key Idea: During training, whenever the error on the validation set improves, a copy of the model parameters is stored. The training is stopped when the validation error has not improved for a predetermined amount of time, and the best model parameters (those that resulted in the lowest validation error) are returned.

    Mathematical Formulation

    Assume that \( w \) represents the model weights (ignoring bias parameters). We take a quadratic approximation to the objective function \( J(w) \) around the empirically optimal value of the weights \( w^* \):

    J(w)J(w)+12(ww)H(ww)

    where:

    \( H \) is the Hessian matrix of second derivatives.
    

    The gradient of the objective function is:

    wJ(w)=H(ww)

    During training, the parameter vector is updated according to:

    w(t+1)=w(t)ηwJ(w(t))

    Substituting the expression for the gradient:

    w(t+1)w=(IηH)(w(t)w)

    where \( \eta \) is the learning rate. If we assume that the initial weights are zero (i.e., \( w^{(0)} = 0 \)), we can express the weight update after \( t \) iterations as:

    w(t)w=(IηH)t(w(0)w)

    If we perform an eigenvalue decomposition of \( H \), we get:

    H=QΛQ

    where \( Q \) is the orthogonal matrix of eigenvectors, and \( \Lambda \) is the diagonal matrix of eigenvalues. The weight update can then be rewritten as:

    w(t)w=Q(IηΛ)tQ(w(0)w)

    Assuming \( w^{(0)} = 0 \) and that \( |1 - \eta \lambda_i| < 1 \) for all eigenvalues \( \lambda_i \), after \( t \) training updates, we have:

    Qw(t)[I(1ηΛ)t]Qw

    Taking the logarithm and using the series expansion for \( \log(1 + x) \), it can be shown that the number of training iterations \( t \) plays a role inversely proportional to the L2 regularization parameter \( \lambda \), and the inverse of \( t \) plays the role of the weight decay coefficient.

    Key Insight:

    This result shows that early stopping can be interpreted as a form of implicit regularization, where the number of training iterations controls the effective complexity of the model.


    Label Smoothing

    Label smoothing is a technique to prevent a model from becoming over-confident on a specific class by not forcing the model to fit the data exactly. This approach provides more flexibility and generalization abilities.

    Suppose the predicted output is y=[0,1,0], then after applying label smoothing, it becomes y=[0.033,0.933,0.033].

    The formula for label smoothing is:

    ysmooth=(1a)y+ak

    where:

    • a is the smoothing factor,
    • y is the original label,
    • k is the number of classes.

    The reason for using label smoothing:

    • Prevents overfitting: By preventing the model from becoming too confident in its predictions, label smoothing reduces the likelihood of overfitting.
    • Improves generalization: Label smoothing can help the model generalize better to unseen data, as it discourages overconfidence in training.

    Bagging/Ensemble

    Bagging (short for bootstrap aggregating) is a machine learning ensemble technique for reducing generalization error by combining several models (Breiman, 1994)

    Explanation: Aggregating is to ombine the predictions of each model, often using voting (for classification) or averaging (for regression).

    It works by training several different models separately, and then have all of the models vote on the output for test examples. For example, random forest, which is a popular bagging algorithm that builds multiple decision trees on different bootstrap samples of the data and aggregates their predictions.

    The reason why bagging works:

    • Variance reduction: By training multiple models on different data subsets, bagging reduces the variance of the predictions. This means that it helps models generalize better to new, unseen data.
    • Handling overfitting: Bagging is particularly useful for high-variance models (e.g., decision trees) as it helps reduce overfitting.


    While bagging is highly useful for traditional machine learning models, it is less commonly used in deep learning because modern neural networks are already highly expressive. Instead, other ensemble methods, such as model ensembling or dropout, are used.

    Code Sample:

    from sklearn.ensemble import RandomForestClassifier

    from sklearn.datasets import load_iris

    from sklearn.model_selection import train_test_split

    - Load a dataset (Iris dataset for example) data = load_iris()

    X_train, X_test, y_train, y_test = train_test_split(data.data, data.target, test_size=0.3, random_state=42)

    - Train a random forest classifier (bagging technique)

    rf_model = RandomForestClassifier(n_estimators=100, random_state=42)

    rf_model.fit(X_train, y_train)

    - Make predictions

    y_pred = rf_model.predict(X_test)

    - Evaluate the model

    accuracy = rf_model.score(X_test, y_test)

    Dropout

    Overview

    Dropout is one of the techniques for preventing overfitting in deepneural network which contains a large number of parameters.

    The key idea is to randomly drop units from the neural networkduring training.

    • During training, dropout samples from number of different “thinned” network.
    • At test time, we approximate the effect of averaging the predictions of all these thinned networks

    Model

    Consider a neural network with L hidden layers:

    • Let z(l) denote the vector inputs into layer l.
    • Let y(l) denote the vector of outputs from layer l.
    • Let W(l) and b(l) represent the weights and biases at layer l.

    With dropout, the feed-forward operation becomes:

    r(l)Bernoulli(p)

    y(l)=r(l)y(l)

    where denotes element-wise multiplication.

    The feed-forward equation for layer l+1 becomes:

    z(l+1)=W(l+1)y(l)+b(l+1)

    y(l+1)=f(z(l+1))

    where f is the activation function.

    For any layer l, r(l) is a vector of independent Bernoulli random variables, each of which has a probability p of being 1. The vector y(l) is the input after some hidden units are dropped. The rest of the model remains the same as a regular feed-forward neural network.

    Training

    Dropout neural network can be trained using stochastic gradient descent. The only difference here is that we only back propagate on eachthinned network. The gradient for each parameter are averaged over the training cases in each mini-batch.

    Test Time

    Use a single neural net without dropout If a unit is retained with probability p during training, the outgoing weights of that unit are multiplied by p at test time. pw

    Additional Regularization

    L1 norm

    L1 norm regularization, also known as Lasso, is a technique that adds a penalty equal to the absolute value of the magnitude of coefficients to the loss function. This encourages sparsity in the learned weights, meaning it forces some of the weights to become exactly zero, effectively selecting important features and reducing model complexity.

    Mixup

    Mixup is a data augmentation technique that creates new training examples by taking convex combinations of pairs of input data and their labels. By blending images and labels together, the model learns smoother decision boundaries and becomes more robust to adversarial examples and noise.

    Cutout

    Cutout is a form of data augmentation where random square regions are masked out (set to zero) in input images during training. This forces the model to focus on a broader range of features across the image rather than relying on any single part, leading to better generalization and robustness.

    Gradient Clipping

    Gradient clipping is a technique used to prevent the gradients from becoming too large during training, which can cause the model to diverge. This is done by capping the gradients at a predefined threshold, ensuring that updates remain stable, especially in models like recurrent neural networks (RNNs) where exploding gradients are a common issue.

    DropConnect

    DropConnect is a variation of Dropout, but instead of dropping neurons, it randomly drops connections (weights) between neurons during training. This prevents the co-adaptation of neurons while allowing individual neurons to contribute to learning.

    Data Augmentation (beyond Mixup and Cutout)

    • Random Flips and Rotations: Randomly flipping (either vertical or horizontal) or rotating images during training to make the model invariant to certain transformations.
    • Color Jittering: Modifying the brightness, contrast, saturation, and hue of images to make the model more robust to variations in color.
    • Random Cropping and Scaling: Randomly cropping and scaling images to force the model to learn from different perspectives and contexts within the data.

    For PyTorch augmentation, one can refer https://pytorch.org/vision/stable/transforms.html

    Generalization Paradox

    • Models with many parameters tend to overfit
    • However, deep neural network, despite using many parameters, works well with unseen data (look up the Double Descent Curve), the reason remains unknown

    This phenomenon is illustrated by the Double Descent Curve, where after reaching a peak in test error (due to overfitting), the error decreases again with further model complexity. The precise reasons remain uncertain, but hypotheses include implicit regularization from optimization methods like SGD, hierarchical feature learning, and the redundancy offered by overparameterization.

    Despite the generalization paradox, applying regularization techniques are still beneficial due to a couple of reasons: Deep neural networks can still overfit in specific cases, especially with small datasets or noisy data. As a result, regularization techniques can act as a safeguard. Moreover, regularization techniques can improve the model consistency, performing well across different datasets and tasks. Finally, regularization helps prevent the model from fitting outliers/data points that should be irrelevant.

    Batch Normalization

    Overview

    Batch normalization is a technique used to improve the training process of deep neural networks by normalizing the inputs of each layer. Despite the initial intuition for the method being somewhat incorrect, it has proven to be highly effective in practice. Batch normalization speeds up convergence, allows for larger learning rates, and makes the model less sensitive to initialization, resulting in more stable and efficient training.

    Batch normalization motivated by internal covariate shift (2015 lofee & Szegedy)

    Internal Covariance Shift

    Batch normalization was originally proposed as a solution to the internal covariance shift problem, where the distribution of inputs to each layer changes during training. This shift complicates training because the model must constantly adapt to new input distributions.

    The transformation of layers can be described as:

    l=F2(F1(u,θ1),θ2)

    For a mini-batch of activations X={x1,x2,,xm} from a specific layer, batch normalization proceeds as follows:

    1. Compute the mean: μB=1mi=1mxi

    2. Compute the variance: σB2=1mi=1m(xiμB)2

    3. Normalize the activations: x^i=xiμBσB2+ϵ

    4. Scale and shift the normalized activations using learned parameters γ (scale) and β (shift): yi=γx^i+β

    where:

    • xi represents the activations in the mini-batch,
    • μB is the mean of the mini-batch,
    • σB2 is the variance of the mini-batch,
    • ϵ is a small constant added for numerical stability,
    • x^i is the normalized activation,
    • γ and β are learned parameters for scaling and shifting.

    The batch normalization improves validation accuracy by removing the dropout and enables higher learning rate

    Batch Normalization

    As mentioned earlier, the original intuition behind batch normalization was found to be incorrect after further research. A paper by Santurkar, S., Tsipras, D., Ilyas, A., & Madry, A. (NeurIPS 2019) contradicted the original 2015 paper on BatchNorm by highlighting the following points:

    • Batch normalization does not fix covariate shift.
    • If we fix covariate shift, it doesn't help.
    • lf we intentionally increase lCS, it doesn't harm.
    • Batch Norm is not the only possible normalization. There are alternatives.

    Instead, they argue that Batch normalization works better due to other factors, particularly related to its effect on the optimization process:

    1. Reparameterization of the loss function:

    • Improved Lipschitzness: Batch normalization improves the Lipschitz continuity of the loss function, meaning that the loss changes at a smaller rate, and the magnitudes of the gradients are smaller. This makes the gradients of the loss more "Lipschitz."
    • Better β-smoothness: The loss exhibits significantly better smoothness, which aids in optimization by preventing large, erratic changes in the gradient.

    2. Variation of the loss function: BatchNorm reduces the variability of the value of the loss. Consider the variation of the loss function: L(x+ηL(x)) where η[0.05,0.4]. A smaller variability of the loss indicates that the steps taken during training are less likely to cause the loss to increase uncontrollably.

    3. Gradient predictiveness: BatchNorm enhances the predictiveness of the gradients, meaning the changes in the loss gradient are more stable and predictable. This can be expressed as: ||L(x)L(x+ηL(x))||, where η[0.05,0.4]. A good gradient predictiveness implies that the gradient evaluated at a given point remains relevant over longer distances, which allows for larger step sizes during training.

    Alternatives to Batch Norm

    Weight Normalization: Weight normalization is a technique where the weights, instead of the activations, are normalized. This method reparameterizes the weight vectors to accelerate the training of deep neural networks.

    Tim Salimans and Diederik P. Kingma, "Weight Normalization: A Simple Reparameterization to Accelerate Training of Deep Neural Networks," 2016.

    ELU (Exponential Linear Unit) and SELU (Scaled Exponential Linear Unit): ELU and SELU are two proposed activation functions that have a decaying slope instead of a sharp saturation. They can be used as alternatives to BatchNorm by providing smoother, non-linear activation without requiring explicit normalization.

    Djork-Arné Clevert, Thomas Unterthiner, and Sepp Hochreiter, "Fast and Accurate Deep Network Learning by Exponential Linear Units (ELUs)," In International Conference on Learning Representations (ICLR), 2016. Günter Klambauer, Thomas Unterthiner, Andreas Mayr, and Sepp Hochreiter, "Self-Normalizing Neural Networks," ICLR, 2017.

    Convolutional Neural Network (CNN)

    Introduction

    Convolutional networks are simply neural networks that use convolution instead of general matrix multiplication in at least one of their layers. CNN is mainly used for image processing.

    Convolution

    In ML, convolution means dot product

    h=σ(x,w+b)

    • Same x, different w -- multi-layer perception (MLP)
    • Different x, same w -- CNN (weight sharing)

    From class, the following operation is called convolution

    s(t)=x(a)w(ta)ds

    The convolution operation is typically denoted with an asterisk:

    s(t)=(xw)(t)

    Discrete Convolution

    If we now assume that x and w are defined only on integer t, we can define the discrete convolution:

    s[t]=(xw)(t)=a=x[a]w[ta]

    w[ta] represents the sequence w[t] shifted by a units.

    In practice

    We often use convolutions over more than one axis at a time.

    s[i,j]=(IK)[i,j]=mnI[m,n]K[im,jn]

    • Input: usually a multidimensional array of data.
    • Kernel: usually a multidimensional array of parameters that should be learned.

    We assume that these functions are zero everywhere but the finite set of points for which we store the values.

    We can implement the infinite summation as a summation over a finite number of array elements.

    Convolution and Cross-Correlation

    Convolution is commutative:

    s[i,j]=(IK)[i,j]=mnI[im,jn]K[m,n]

    Cross-correlation:

    s[i,j]=(IK)[i,j]=mnI[i+m,j+n]K[m,n]

    Many machine learning libraries implement cross-correlation but call it convolution. In the context of backpropagation in neural networks, cross-correlation simplifies the computation of gradients with respect to the input and kernel.

    Visualization of Cross-Correlation and Convolution with Matlab (https://www.youtube.com/v/Ma0YONjMZLI)

    Image to Convolved Feature

    • Kernel\filter size: weight × height, e.g. 3 × 3 in below example
    • Stride: how many pixels to move the filter each time
    • Padding: add zeros (or any other value) around the boundary of the input

    Example

    The following image illustrates a 2D convolution operation between an input image and a filter to produce a convolved feature map.

    Image (Input): The grid on the left represents a 5×5 matrix of pixel values. The orange-highlighted 3×3 region is part of the image currently being convolved with the filter.

    Convolution Operation: The filter values are applied to the selected region in an element-wise multiplication followed by a summation. The operation is as follows:

    (1×1)+(1×0)+(1×1)+(0×0)+(1×1)+(1×0)+(0×1)+(0×0)+(1×1)=4

    Convolved Feature Map: The result value 4, is placed in the corresponding position (top-left) of the convolved feature map on the right.

    One Convolution Example

    This process is repeated as the filter slides across the entire image. The final feature map is shown below.

    Final Feature Map

    Sparse Interactions

    In feed forward neural network every output unit interacts with every input unit.

    • When we have m inputs and n outputs, then matrix multiplication requires (m×n) parameters. and the algorithms used in practice have O(m×n) runtime (per example)

    Convolutional networks, typically have sparse connectivity (sparse weights). This is accomplished by making the kernel smaller than the input.

    • Limit the number of connections each output may have to k, then requires only (k×n) parameters and O(k×n) runtime

    Parameter Sharing

    • In a traditional neural net, each element of the weight matrix is multiplied by one element of the input. i.e. It is used once when computing the output of a layer.
    • In CNNs, each member of the kernel is used at every position of the input
    • Instead of learning a separate set of parameters for every location, we learn only one set

    Equivariance

    A function f(x) is equivaraint to a function g is the following holds:

    f(g(x))=g(f(x))

    In simple terms: Applying the function f after g is equivalent to applying g after f

    Equivariance

    Equivariance in CNNs

    • CNNs are naturally equivariant to translation (Covlution = Shift)
    • If an input image is shifted, the output feature map shifts correspondingly, preserving spatial structure
    • Importance: This property ensures that CNNs can detect features like edges or corners, no matter where they appear in the image

    A convolutional layer has equivariance to translation. For example,

    g(x)[i]=x[i1]


    If we apply this transformation to x, then apply convolution, the result will be the same as if we applied convolution to x, then applied the transformation to the output.

    For images, convolution creates a 2-D map of where certain features appear in the input. Note that convolution is not equivariant to some other transformations, such as changes in the scale (rescaling) or rotation of an image.

    Importance of Data Augmentation

    Data augmentation is commonly used to make CNNs robust against variations in scale, rotation, or other transformations. This involves artificially modifying the training data by applying transformations like flipping, scaling, and rotating to expose the network to different variations of the same object.

    Convolutional Networks

    The first stage (Convolution): The layer performs several convolutions in parallel to produce a set of preactivations. The convolution stage is designed to detect local features in the input image, such as edges and patterns. It does this by applying filters/kernels across the input image.

    The second stage (Detector): Each preactivation is run through a nonlinear activation function (e.g. rectified linear). This stage introduces nonlinearity into the model, enabling it to learn complex patterns. Without this nonlinearity, the model would be limited to learning only linear relationships.

    The third stage (Pooling) Pooling reduces the spatial dimensions of the feature maps (height and width), helping to make the model more invariant to small translations and distortions in the input image. It also reduces computational load and helps prevent overfitting.

    CNN Structure

    Pooling

    Down-sample input size to reduce computation and memory

    Popular Pooling functions

    • The maximum of a rectangular neighborhood (Max pooling operation)
    • The average of a rectangular neighborhood
    • The L2 norm of a rectangular neighborhood
    • A weighted average based on the distance from the central pixel

    Pooling with Downsampling

    Max-pooling with a pool width of 3 and a stride between pools of 2. This reduces the representation size by a factor of 2, which reduces the the computational and statistical burden on the next layer.

    Pooling and Translations

    Pooling helps to make the representation become invariant to small translations of the input. Invariance to local translation can be a very useful property if we care more about whether some feature is present than exactly where it is. For example: In a face, we need not know the exact location of the eyes.

    Input of Varying Size

    Example: we want to classify images of variable size.

    The input to the classification layer must have a fixed size. In the final pooling output (for example) four sets of summary statistics, one for each quadrant of an image, regardless of the image size. Feature after pooling is 2×2.

    It is also possible to dynamically pool features together, for example, by running a clustering algorithm on the locations of interesting features (Boureau et al., 2011).

    i.e. a different set of pooling regions for each image.

    Learn a single pooling structure that is then applied to all images (Jia et al., 2012)

    Convolution and Pooling as an Infinitely Strong Prior

    • Weak Prior: a prior distribution that has high entropy, which means there is a high level of uncertainty or spread in the distribution. An example of this would be a Gaussian distribution with high variance
    • Strong Prior: has very low entropy, which implies a high level of certainty or concentration in the distribution. An example of this would be a Gaussian distribution with low variance
    • Infinitely Strong Prior: places zero probability on some parameters and says a convolutional net is similar to a fully connected net with an infinitely strong prior over its weights


    The weights for one hidden unit must be identical to the weights of its neighbor, but shifted in space. The weights must be zero, except for in the small, spatially contiguous receptive field assigned to that hidden unit.

    Use of convolution as infinitely strong prior probability distribution over the parameters of a layer. This prior says that the function the layer should learn contains only local interactions and is equivariantto translation.

    The use of pooling is infinitely strong prior that each unit should be invariant to small translations. Convolution and pooling can cause underfitting.

    Practical Issues

    The input is usually not just a grid of real values. It is a grid of vector-valued observations. For example, a color image has a red, green, and blue intensity at each pixel.

    When working with images, we usually think of the input and output of the convolution as 3-D tensors. One index into the different channels and two indices into the coordinates of each channel.

    Software implementations usually work in batch mode, so they will actually use 4-D tensors, with the fourth axis indexing different examples in the batch.

    Connection to underfitting

    By so drastically restricting the network’s form (via weight sharing and pooling), we reduce the total number of free parameters. While this often helps regularize the model (and is hugely beneficial in vision tasks), it can also cause underfitting if our task actually needs more flexible, less translation‐invariant representations.

    Training

    Suppose we want to train a convolutional network that incorporates convolution of kernel stack K applied to multi-channel image V with stride s:c(K;V;s)

    Suppose we want to minimize some loss function J(V;K). During forward propagation, we will need to use c itself to output Z.

    Z is propagated through the rest of the network and used to compute J.

    • During backpropagation, we receive a tensor G such that:

    Gi,j,k=Zi,j,kJ(V,K)

    • To train the network, we compute the derivatives with respect to the weights in the kernel:

    g(G,V,s)i,j,k,l=Zi,j,kJ(V,K)=m,nGi,m,nVj,ms+k,ns+l

    • If this layer is not the bottom layer of the network, we compute the gradient with respect to V to backpropagate the error further:

    h(K,G,s)i,j,k=Vi,j,kJ(V,K)=l,m|sl+m=jn,p|sn+p=kqKq,i,m,pGi,l,n


    Random or Unsupervised Features

    The most computationally expensive part of training a convolutional network is learning the features.

    • Supervised training with gradient descent requires full forward and backward propagation through the entire network for every gradient update.
    • One approach to reduce this cost is to use features that are not learned in a supervised manner, such as random or unsupervised features.

    Random Initilizations

    Simply initialize the convolution kernels randomly. In high-dimension space, random vectors are almost orthogonal to each other (correlated). Features captured by different kernels are independent.

    Unsupervised Learning

    Learn the convolution kernels using an unsupervised criterion.

    Key insight

    Random filters can perform surprisingly well in convolutional networks.

    • Layers composed of convolution followed by pooling naturally become frequency-selective and translation-invariant, even with random weights.

    Inexpensive architecture selection

    • Evaluate multiple convolutional architectures by training only the last layer.
    • Choose the best-performing architecture and then fully train it using a more intensive method.


    Residual Networks (ResNet)

    Overview

    Deeper models are harder to train due to vanishing/exploding gradients and can be worse than shallower networks if not properly trained. There are advanced networks to deal with the degradation problem.

    ResNet, short for Residual Networks, was introduced by Kaiming He et al. from Microsoft Research in 2015. It brought a significant breakthrough in deep learning by enabling the training of much deeper networks, addressing the vanishing gradient problem.

    ResNet Structure
    • ResNet introduces the concept of skip connections (or residual connections) that allow the gradient to be directly backpropagated to earlier layers
    • Skip connections help in overcoming the degradation problem, where the accuracy saturates and then degrades rapidly as the network depth increases

    Markovian Assumption

    In vanilla RNNs, we update the hidden state by st=f(st1,xt)

    so that st depends only on the previous hidden state st1 and the current input xt. This means that, once we know {st1,xt} , the model treats any earlier time steps as irrelevant.

    In other words, the conditional distribution over st given all past hidden states and inputs {st1,st2,,xt,xt1,} , actually reduces to only {st1,xt} . That is the Markov assumption: future states depend on the past only through the immediately preceding state (plus the new input).

    Under this assumption, an RNN can be viewed as a first‐order Markov chain in terms of its hidden state. Of course, in practice the hidden state st is supposed to encode or “remember” all relevant historical information, so that even though the update has a Markov form, it can (in principle) capture dependencies over long time spans. But mathematically, the recurrency is first‐order Markov: the history “feeds forward” only via the state transition from (st1,xt) to st.

    Variants

    Several variants of ResNet have been developed, including ResNet-50, ResNet-101, and ResNet-152, differing in the number of layers.

    Application

    ResNet has been widely adopted for various computer vision tasks, including image classification, object detection, and facial recognition.

    DenseNet

    Overview

    • DenseNet, short for Densely Connected Networks, was introduced by Gao Huang et al. in 2017.
    • It is known for its efficient connectivity between layers, which enhances feature propagation and reduces the number of parameters
    DenseNet Structure

    Key Feature

    The key feature is Dense Connectivity.

    • In DenseNet, each layer receives feature maps from all preceding layers and passes its own feature maps to all subsequent layers
    • This dense connectivity improves the flow of information and gradients throughout the network, mitigating the vanishing gradient problem

    Echo State Network

    In RNNs, the ability to capture long-term dependencies is crucial. Set the recurrent and input weights such that the recurrent hidden units do a good job of capturing the history of past inputs, and only learn the output weights. The goal is to access the information from the past implicitly.

    The hidden state at time t can be expressed as:

    st=σ(Wst1+Uxt)

    where:

    • W represents the recurrent weight matrix, which connects previous hidden states to the current state,
    • U is the input weight matrix, responsible for incorporating the current input xt,
    • σ is an activation function, like a non-linear function such as a sigmoid or tanh.

    It is important to control how small changes in the hidden state propagate through time to ensure the network does not become unstable.

    If a change Δs in the state at time t is aligned with an eigenvector v of the Jacobian J with eigenvalue λ>1, then the small change Δs becomes λΔs after one-time step, and λtΔs after t time steps.

    If the largest eigenvalue λ<1, the map from t to t+1 is contractive.

    The network forgets information about the long-term past.

    Set the weights to make the Jacobians slightly contractive. This allows the network to gradually forget irrelevant information while still remembering key long-term dependencies.

    Echo State Network

    Long Delays

    RNNs often fail to capture these dependencies due to the vanishing gradient problem. Long delays use recurrent connections. It knows something from the past, help vanishing gradient - even if gradient get vanished during the path, it still has the direct information from the past.

    Long Delays

    Leaky Units

    In some cases, we do need to forget the path while in some we do not since we do not want to remember redundant information.

    Recall that:

    st=σ(Wst1+Uxt)

    Then consider the following refined form of the equation (convex combination of the current state and previous through a new parameter):

    st,i=(11τi)st1+1τiσ(Wst1+Uxt)

    where

    • 1τi
    • τi=1 corresponds to an ordinary RNN
    • τi>1 allows gradients to propagate more easily
    • τi1 means the state changes very slowly, integrating past values associated with the input sequence over a long duration

    Infinity means the current state is the previous state while one means completely forgetting the previous steps and only depends on the current observations.

    Gated RNNs

    Defnition

    It might be useful for the neural network to forget the old state in some cases like if we only care about if the current letter is a or b.

    Example: a a b b b b a a a a b a b

    It might be useful to keep the memory of the past.

    Example:

    Instead of manually deciding when to clear the state, we want the neural network to learn to decide when to do it.

    Long-Short-Term-Memory (LSTM)

    The Long-Short-Term-Memory (LSTM) algorithm was proposed in 1997 (Hochreiter and Schmidhuber, 1997). It is a type of recurrent neural network designed for approaching the vanishing gradient problem.

    Several variants of the LSTM are found in the literature:

    • Hochreiter and Schmidhuber, 1997
    • Graves, 2012
    • Graves et al., 2013
    • Sutskever et al., 2014

    The principle is always to have a linear self-loop through which gradients can flow for a long duration.

    Gated Recurrent Units (GRU)

    Here is the plain text version of the new image content:

    Recent work on gated RNNs, Gated Recurrent Units (GRU), was proposed in 2014.

    • Cho et al., 2014
    • Chung et al., 2014, 2015
    • Jozefowicz et al., 2015
    • Chrupala et al., 2015

    Standard RNN computes the hidden layer at the next time step directly:

    st=σ(Wst1+Uxt)

    There are two gates: the update gate and the reset gate. Update gate for the case that we want to keep the information around while reset gate is the case when forgetting. A temporary state locks down some of the values of the current state.

    GRU first computes an update gate (another layer) based on the current input vector and hidden state:

    zt=σ(U(z)xt+W(z)st1)

    It also computes the reset gate similarly but with different weights:

    rt=σ(U(r)xt+W(r)st1)

    New memory content is calculated as:

    st~=tanh(Uxt+rtWst1)

    which has current observations and forgetting something from the past

    If the reset gate is close to 0, this causes the network to ignore the previous hidden state, effectively allowing the model to drop irrelevant information.

    The final memory at time step t is a combination of the current and previous time steps:

    st=ztst1+(1zt)st~

    If the reset gate is close to 0, it will ignore the previous hidden state, allowing the model to discard irrelevant information.

    The update gate zt controls how much of the past state should matter in the current time step. If zt is close to 1, then we can effectively copy information from the past state across multiple time steps.

    Units that need to capture short-term dependencies often have highly active reset gates.

    Cliping Gradients

    A simple solution for clipping the gradient. (Mikolov, 2012; Pascanu et al., 2013):

    • Clip the parameter gradient from a mini-batch element-wise (Mikolov, 2012) just before the parameter update.
    • Clip the norm g of the gradient g (Pascanu et al., 2013a) just before the parameter update.

    The formula for clipping the gradient is:

    g=min(1,c|g|)g

    where c is a constant.

    Attention

    The attention mechanism was introduced to improve the performance of the encoder-decoder model for machine translation.

    Common Representation

    A single 'concept' is universally represented, transcending specific languages or forms.

    • Encoder: Processes the word 'elephant' from its original source.
    • Output: A universal representation vector (the abstract 'concept' of an elephant).
    • Decoders: Translate this concept into various domains or applications.

    The 'concept' is an abstract entity that exists independently of any particular language or representation.

    For example, if we want to translate from English to Spanish

    • Encoder (English Input): The system processes the word "elephant."
    • Output (Universal Representation): The system generates an abstract concept or vector representing an "elephant," independent of any specific language.
    • Decoder (Spanish Output): The system decodes this concept and outputs the equivalent Spanish word: "elefante."
    Common Representation


    Sequence-to-Sequence Model

    In the sequence-to-sequence model, every word xi produces a hidden vector hi in the encoder part of the autoencoder. The hidden vector of every word, hi, is fed to the next hidden vector, hi+1, by a projection matrix W.

    In this model, for the whole sequence, there is only one context vector c, which is equal to the last hidden vector of the encoder, i.e., c=hn.

    Sequence-to-Sequence Model

    Challenges:

    1. Long-range dependencies: As the model processes long sequences, it can struggle to remember and utilize information from earlier steps, especially in cases where long-term context is crucial.

    2. Sequential processing: Since these models process data step by step in sequence, they can't take full advantage of parallel processing, which limits the speed and efficiency of training.

    These are the core challenges that newer architectures, such as transformers, aim to address.

    Attention Definition

    The basic idea behind the attention mechanism is directing the focus on important factors when processing data. Attention is a fancy name for weighted average.

    Sequence-to-Sequence Model with Attention

    • Sequence-to-sequence models:

    Multiple RNN units serve as the encoder. They encode information into the context vectors. Multiple RNN units decode the concept in the context vector to different domain information. The limitations of this approach are long-range dependencies and prevention of parallelization.

    p(yi|y1,,yi1)=g(yi1,li,c)

    • Sequence-to-sequence with attention:

    Pass multiple context vectors to the decoder.

    p(yi|y1,,yi1)=g(yi1,li,ci)


    Sequence-to-Sequence Model with Attention

    There are some calculations:

    1. Similarity score: sij=similarity(li1,hj)

    2. Attention weight: aij=esijk=1Tesik

    The attention weight aij is obtained by applying a softmax function to the similarity scores. This normalizes the scores across all encoder hidden states, turning them into a probability distribution.

    3. Context vector: ci=j=1Taijhj

    The effectiveness of the correlation between inputs around position j and the output at position i is crucial.

    This score is determined based on:

    • The RNN hidden state li1 just before emitting yi.
    • The jth hidden state hj of the input sentence.

    CNN Kernels VS Attention Mechanism

    CNN Kernels:

    • They only consider local neighborhoods.
    • The weights of the kernel are learned during training but remain fixed when applied across the entire input.
    • This weight-sharing gives CNNs their translation invariance (the ability to detect the same feature anywhere in the input).
    • Computationally efficient because they only operate on local regions.

    Attention Mechanisms:

    • Attention computes relationships between all pairs of elements in the input, regardless of their positions.
    • There’s no fixed-size window—the model dynamically learns which parts of the input to focus on for each output.
    • Attention is data-dependent —the focus shifts based on the current input, enabling the model to adapt flexibly.
    • Computationally more expensive because they involve operations between all pairs of elements (quadratic complexity).


    Transformer Architecture

    The basic concept behind transformers is attention as summarized in the paper by Vaswani et. al 'Attention is all you need'. This paper claims that all you need is attention and with the structure of attentions, basically you can handle the sequential data. It was based on GPT and many other models that we use in LLM and imaging processing. Transformer is an example of an encoder-decoder architecture. Unlike RNNs, Transformers can process sequences in parallel, making them faster to train on large datasets. Transformers have applications beyond NLP, such as Vision Transformers (ViT) in computer vision and protein structure prediction in biology (AlphaFold). Transformers' ability to capture long-range dependencies efficiently has made them the standard for many modern AI models.

    Encoder

    The encoder consists of two main components: Self Attention and Feed Forward Neural Network. The architecture of the Encoder is given below:

    Encoder architecture of the Transformer

    Self Attention

    Understanding the individual words in a sentence is not enough to understand the whole sentence and one needs to understand how the words relate to each other. The attention mechanism forms composite representations. We aim to have embeddings of words and embeddings of compositions at the same time in different levels. Unlike word2vec introduced in 2013 by Mikolov et al., which captures the vector representations of words in an embedding space such that words that are similar are represented closer to each other, self-attention aims to capture the similarity between words based on context and in relation to each other. Self-attention captures the similarity within the same sequence. Multiple layers help form complex concept representations. For example, the context of the word "bank" differs based on if the surrounding words involve "money" or "river".

    Illustration of word2vec where "King" - "Man" + "Woman" produces a vector close to the word "Queen"

    Self-attention is analogous to the fundamental retrieval strategy in databases where given a query, and key-value pairs, we use the query to identify the key and retrieve the corresponding value. The generalized definition for calculating the attention of a target word with respect to the input word: use the Query of the target and the Key of the input and then calculate a matching score. These matching scores act as the weights of the Value vectors.


    Then we look at the definition if matrix form. Given an input vector xRd, the weights for the query, key, and value transformations are defined as:

    • Query weight matrix: WqRd×p
    • Key weight matrix: WkRd×p
    • Value weight matrix: WvRd×r

    The transformations for the query (q), key (k), and value (v) vectors are given by:

    • Query vector: q=WqTx where qRp×1, since WqTRp×d, and xRd×1
    • Key vector: k=WkTx where kRp×1, since WkTRp×d, and xRd×1
    • Value vector: v=WvTx where vRr×1, since WvTRr×d, and xRd×1

    The transformations allow the attention mechanism to compute similarity scores between the query and key vectors and to use the value vectors to produce the final weighted output as z1=α1v1+α2v2++αnvn, where vi are similar to the input in CNNs, and αi are similar to the kernels in CNNs.

    However, unlike the kernels in CNNs, the αi's are data-dependent and given by: αi=softmax(qTkip).

    Extending this to the entire dataset, the equations are:

    X=[x1,x2,,xn]Rd×n

    Q=[q1,q2,,qn]Rp×n

    K=[k1,k2,,kn]Rp×n

    V=[v1,v2,,vn]Rr×n

    The transformations are defined as:

    Qp×n=WqTp×dXd×n

    Kp×n=WkTp×dXd×n

    Vr×n=WvTr×dXd×n

    Therefore the output, Zr×n=Vr×nsoftmax(QTKp)n×n

    Additionally, we have:

    QTK=XTWqWkTX(an asymmetric kernel extracting the global similarity between words)

    Let us take a closer look at how one word is processed in the encoder.

    Deeper view of the Encoder

    The input vector x is passed through a linear transformation layer which transforms the input into query q, key k, and value v vectors, given by the equations above. This is passed through a stacked multi-head self-attention layer which extracts global information across pairwise sequence of words to produce the output vector Z also given by the equation above. The equation for Z can be compared to how similarity is computed between the key and value pairs in databases. This output is added to the residual input x to preserve the meaning of individual words in addition to the pairwise representations. This is normalized to produce the output (Z+x)Rh×r. This serves as the input to the feed forward neural network.

    Feed Forward Neural Network

    The structure of the feed forward network (FFN) is Linear Layer 1, followed by ReLU activation and then another linear layer 2. While the attention mechanism captures global information between words and hence aggregates across columns, the feed forward neural network aggregates across rows and takes a more broader look at each word independently. Depsite the individual processing, all positions share the same set of weights and biases in the FFN. In a classroom environment, the attention mechanism is similar to the teacher observing the interactions among students in a group, whereas the feed forward neural network resembles the teacher evaluating each student independently for their understanding of the assignment. The output of the feed forward layer r also has a residual connection from the previous layer which is normalized and passed as the input of the decoder as (r+(z+x)). The encoder also has a positional encoding component which captures information about the position of words in a sequence.

    While the above figure zooms in at how a word vector x is processed by the encoder, the major advantage of the transformer architecture is its ability to handle multiple words in a sequence in parallel and so in practice, the above zoomed in version of the encoder is usually stacked to handle a group of words in parallel.

    ==== Global v.s. Local Information

    For Attention Mechanism:

    • Global Understanding: Captures relationships among different positions in the sequence.
    • Context Aggregation: Spreads relevant information across the sequence, enabling each position to see a broader context.

    For Feed-Forward Networks (FFN):

    • Local Processing: While attention looks across the entire sequence, FFN zooms back in to process each position independently.
    • Individual Refinement: Enhances the representation of each position based on its own value, refining the local information gathered so far.

    Decoder

    The decoder consist of three main components: Masked Self Attention, Cross Attention and Linear Layer. The architecture of the Decoder is given below:

    Decoder architecture of the Transformer

    Masked Self Attention

    In masked self attention, we add a mask matrix MRn×n to the normalized argument within the softmax of Z given by Zr×n=Vr×nsoftmax(QTK+Mp)n×n The reason for adding a mask matrix M is to ensure that the output is informed only by the past words and not by the words further along in the sequence. The mask matrix therefore is given by:

    M(i,j)={0if jiif j>i

    This is because Z is an upper triangular matrix with values for previous words since softmax(x+0) is the same as softmax(x), but softmax(x) will be equal to 0.

    Cross Attention

    The intuition behind cross attention is similar to sequence-to-sequence models where the context vector is passed from the encoder to the decoder capturing relevant information from the input sequence. The residual connection plus the output of the masked self attention is passed as the query to the cross attention block, whereas the key and value pairs are the same as the output of the encoder. The relationship and relevance between words in different sentences are captured.

    Linear Layer

    The linear layer is applied to the output of the feed forward neural network of the decoder and its primary role is to adjust the dimensionality of the network to match the size of the vocabulary. It involves learning a set of parameters - a matrix of dimension equal to p×len(vocab). This results in a p×1 vector which is then passed through a probabilistic softmax layer to predict the next word in the sequence.

    Softmax Activation

    The function transforms the linear layer's output into probabilities as mentioned above. The output represents the likelihood of a respective word being the next word in the sequence.

    Positional Encoding

    So far, the encoder and decoder has no sense of the order of the words in the sequence. The sentences "I am a teacher", "Teacher I am", "Am I a teacher?" are processed the same way, even though the meaning may not be the same. To circumvent this issue, and due to the lack of the convolution or recurrence operations, a positional encoding scheme is embedded within the encoder and decoder. In this encoding, the position of the words in a sequence is encoded by a vector. The even positions are represented by a sinusoidal wave with 1 representing the peaks and 0 representing the troughs. Similarly, the odd positions are represented by a cosine wave. Thus, each position is encoded by a unique binary vector and each unique binary vector represents a specific position.

    Why use Sine and Cosine?

    1. Sine and cosine functions provide a smooth, continuous representation of position. Smootheness ensures that gradient can be found( i. e. can't find a gradient of a discrete binary encoding).

    2. Relative positions can be easily derived. Model can learn relationships like sin(a+b)=sin(a)cos(b)+cos(a)sin(b) .This property allows the model to learn the relative distance between words. For example, in the sentence "The cat sat on the mat", the difference between "The cat" and "cat sat" can be inferred by the shift in sine and cosine values.

    3. Because sine and cosine functions are periodic, positional encodings can generalize to longer sequences even if they weren’t seen during training.

    4. Multi-frequency approach allows the model to learn both local (short-term) and global (long-term) dependencies: High-frequency components might help the model distinguish words that are close together. Low-frequency components help capture the broader structure of the sentence.


    Bidirectional Encoder Representations from Transformers (BERT)

    BERT introduced by Google is built by repeating the encoder of the transformer multiple times. The Bidirectional in BERT refers to its ability to attend to the future and past words in the sequence unlike Transformers which only looks at the past to make predictions about the future. The fundamental principles behind BERT are Masked Language Modeling, and Next Sentence Prediction. The architecture of BERT is given below.

    Masked Language Modeling

    Masked Language Modeling

    BERT masks words in a corpus as shown in the figure below and makes the model learn to predict these words. It thereby pays attention to both words before and after the masked word and fills in the blank given the entire context. It is the same as a Transformer Encoder where 12 encoders (in contrast to the 6 in the original paper of Transformers) are stacked on top of each other. The output of the encoder is passed to s linear dense layer and softmax to predict the most probable word from the vocabulary of the corpus.

    Masked Language Modeling

    Next Sentence Prediction

    It was also used to identify if given two sentences A and B, B logically follows the sentence A. This is possible due to the ability to fine-tune the weights of the pretrained BERT model for downstream prediction tasks. The pre-trained model can also be used to represent the input of a sentiment analysis task (for example) to a neural network in a better manner. The [CLS] token is prepended to the input sequence and is used to capture the context of the whole sentence such that during fine-tuning, the prediction may be conditioned on the representation of the [CLS] token. For sentence-level tasks, the final hidden state of the [CLS] token is used as the sentence representation.

    There are various flavors of BERT based on slight modifications to the original architecture and training processes. The advantage of fine tuning pretrained models is the opportunity to finetune them on a domain specific corpus leading to additional variants of BERT as BioBERT retrained on a biomedical corpus, BERTweet trained on around 850 million tweets and so on.

    Transformers and GPT Models

    Overview of Transformers

    • Transformers consist of two main components:
      • Encoder
      • Decoder
    • BERT utilizes a stack of encoders, while GPT uses a stack of decoders.
    • GPT models are neural network-based language prediction models built on Transformer architecture.

    Decoder Structure

    • The decoder has three parts:
      1. Masked Multi-Head Attention: Attends only to the left.
      2. Cross Attention: Attends to encoded inputs (removed in GPT).
      3. Feed Forward Neural Network.

    Differences Between BERT and GPT

    • Both BERT and GPT use masked multi-head attention, but unlike BERT that masks a word in the middle of the sentence, and tries to predict the mask, GPT masks all the future words and tries to predict them.
    • Training methods differ:
      • BERT masks tokens in sentences.
      • GPT predicts the next token in a sequence.

    Training Process

    • In GPT, the model predicts the next token based on the previous tokens, treating the input as a sequence.
    • The first GPT model (2018) had 117 million parameters and was trained on 7,000 books.
    • It was seen that larger models tend to generalize better and have better "emergent abilities", although the reason is still unclear.

    Evolution of GPT Models

    GPT-1

    • Released: 2018
    • Parameters: 117 Million
    • Layers: 12
    • Training Data: Books1 Corpus (7,000 books)
    • Focus: Unsupervised pre-training, Transformer architecture, large-scale language modeling.

    GPT-2

    • Released: 2019
    • Parameters: ~1.5 Billion
    • Layers: 48
    • Training Data: 40GB (English)
    • Focus: Transformer architecture, self-attention mechanism.

    GPT-3

    • Released: 2020
    • Parameters: 175 Billion
    • Layers: 175
    • Training Data: 570GB (Multilingual)
    • Focus: Few-shot learning, prompt engineering, Python support.

    GPT-4

    • Release: March 2023 (ChatGPT Plus, Microsoft Copilot)
    • Parameters: ~1.76 Trillion (rumored, Mixture of Experts)
    • Layers: Unknown
    • Training Data: More diverse, larger scale
    • Focus: Multimodal (text and image inputs), improved few-shot learning, reasoning, and NLU/NLG.

    GPT-4o and GPT-4o1

    • Release: GPT-4o is currently available; GPT-4o1 is in preview.
    • Capabilities:
     * GPT-4o: Enhanced multimodal capabilities for text, image, and voice. Improved speed and refined reasoning.
     * GPT-4o1: Designed for deeper reasoning, particularly for complex science, math, and coding challenges.
    
    • Training Data: Utilizes an expanded and diverse dataset to improve understanding and adaptability.


    Larger models tend to generalize better. This trend suggests that increasing model size allows for deeper contextual understanding.

    Chain of Thought Reasoning

    • GPT-4 introduced a method called “chain of thought,” allowing the model to predict intermediate steps in reasoning tasks. It involves multi-step thinking: The model generates a series of logical steps to arrive at the final answer, rather than answering in a single sentence.
    • Example: Problem: What is the result of 5 + 5 + 5? It is clear to see the answer is 15. With the chain of thought reasoning - Step 1: The first 5 plus the second 5 gives 10 (i.e. 5+5=10). Step 2: add the last 5 to the result from Step 1 (i.e. 10+5=15).

    Alignment and Instruction Following

    • ChatGPT is designed to follow instructions and align with user preferences, addressing issues like harmful or politically incorrect outputs.
    • InstructGPT is a variant of GPT that focuses on following instructions using human feedback via Reinforcement Learning from Human Feedback (RLHF).

    Text-Text Transfer Transformer (T5)

    • T5 combines encoder and decoder structures and treats various NLP tasks as text-to-text problems, allowing for diverse applications like translation and summarization.
    • NLP tasks such as sentiment analysis which were primarily treated as classification problems are cast as text-to-text problems.
    • Next span prediction is used where a set of sequential tokens are removed and replaced with sentinel tokens.
    • T5 architecture operates on an encoder-decoder model and encoder input padding can be performed on both left and right.

    Training Techniques in T5

    • T5 masks spans of tokens rather than individual tokens, focusing on global context rather than local dependencies. 15% of tokens are randomly removed and replaced with sentinel tokens.

    Benchmarking and Performance

    • Models are often evaluated against benchmarks like GLUE and SuperGLUE, which consist of various NLP tasks.

    Training and Fine-Tuning LLMs

    • LLMs are trained on massive datasets of unlabeled text using unsupervised learning.
    • The training process involves predicting the next token in a sequence.
    • Fine-tuning is done on labeled data to align the model with specific tasks or instructions. This process is called Supervised Fine-Tuning (SFT).

    Aligning LLMs with Human Feedback

    • Reinforcement Learning with Human Feedback (RLHF) is used to ensure LLMs produce safe and ethical outputs.
    • RLHF involves generating multiple responses for a given prompt and having humans rank them.
    • A reward model is trained on this ranked data to predict the quality of a response.
    • The original LLM is then fine-tuned using this reward model.
    • RLHF was introduced in 2017 and has been widely used in LLMs like ChatGPT.

    Direct Preference Optimization (DPO)

    • DPO is a newer approach that aims to replace RLHF.
    • It directly collects user preferences for different responses, eliminating the need for a reward model.
    • DPO is easier to implement and more stable than RLHF.

    Direct policy optimization directly optimizes the policy based on preferred human ranked responses without required the application of a reward model (RM) or reinforcement learning (RL).

    The loss function for direct policy optimization is given by

    LDPO=E(x,yw,yl)D[logσ(βlogπθ(yw|x)πref(yw|x)βlogπθ(yl|x)πref(yl|x))]

    Where

    x is the prompt used to generate the two responses

    yw is the winning response chosen by human rankers to be superior

    yl is the losing response generated by the LLM deemed worse by human rankers

    πθ is the model's output probabilities of the current model being trained

    πref is the frozen probabilities of the reference model prior to DPO training

    β is the temperature scaling factor.

    This loss function can be rearranged to the form below, due to the laws of logarithms

    LDPO=E(x,yw,yl)D[logσ(βlog(πθ(yw|x)πref(yw|x)πθ(yl|x)πref(yl|x)))]

    And in the case where the reference probabilities are equal, they can be cancelled out and the equation can be written as

    LDPO=E(x,yw,yl)D[logσ(βlog(πθ(yw|x)πθ(yl|x)))]

    This produces a gradient which adjusts the models weights in the direction of producing human preferred responses directly.

    Project Ideas for Deep Learning

    1. Enhancing Speculative Decoding for Faster Large Language Modeling
      • This project aims to improve the speed of LLMs by using techniques like rejection sampling and importance sampling.
      • The goal is to find alternative sampling methods to rejection sampling, which is computationally expensive.
    2. Reducing the Computational Complexity of Transformers
      • Transformers are computationally expensive, especially for long sequences.
      • This project explores methods like ORCID, which uses data-dependent convolution to reduce complexity.
      • The goal is to develop more efficient transformers that can handle longer sequences.
    3. Diffusion Decoding for Peptide De Novo Sequencing
      • Peptide sequencing is a crucial problem in bioinformatics, involving determining the amino acid sequence of a peptide.
      • This project proposes using diffusion models for peptide sequencing, replacing the traditional GPT-based approach.
      • Diffusion models can potentially improve accuracy by predicting all tokens simultaneously, rather than sequentially.
    4. Using ORCID for DNA Analysis
      • This project explores using ORCID, a model that can handle larger sequences, for DNA analysis.
      • The goal is to leverage ORCID’s ability to handle long sequences to improve DNA analysis tasks.
    5. Symbolic Regression with Diffusion Models
      • Symbolic regression involves finding a mathematical formula that best fits a given dataset.
      • This project proposes using diffusion models for symbolic regression, potentially improving the accuracy and efficiency of the process.


    Transformers and Variational Autoencoders

    Large Language Models (LLMs) and Transformers

    Key Components of Transformers

    • Attention Mechanism Formula: The core of the attention mechanism is computed using the following formula:
    Vsoftmax(QTKp)(n x n)
    • Dimensions:
      • X as a d×n matrix, n as sequence length, and d as data dimensionality.
      • Q, K and V are the query, key, and value matrices, respectively, and they are derived from WQ, WK and WV.
      • Given a sequence X=[x1xn]d×n we define:
        • Q=WQTX(p x n),WQTRp×d,XRd×n
        • K=WKTX(p x n),WKTRp×d
        • V=WVTX(m x n),WVTRm×d

    Recap of Transformers

    • Building Blocks of LLMs: Transformers.
    • Computational Complexity:
      • Issue: Transformers have quadratic complexity concerning sequence length.
      • Reason: Complexity arises due to calculations in the attention mechanism.

    Approaches to Reduce Complexity

    • Issue: Long sequences result in an n×n matrix, making computation demanding.
    • Solution: Techniques like the Performer model approximate attention, reducing complexity to linear time.

    Performer Model

    Overview

    • Objective: Address quadratic complexity in transformers by approximating attention using kernel methods.
    • Kernel Approximation: Utilizes random features to approximate kernels, e.g., Gaussian kernels. The kernel function K(x,y) is defined as:
    KGauss(x,y)=φ(x)Tφ(y)
    • For the Gaussian kernel approximation, the transformation φGauss(x) is given by:
    φGauss(x)=1r(sin(ω1Tx),sin(ω2Tx),,sin(ωrTx),cos(ω1Tx),cos(ω2Tx),,cos(ωrTx))
    • In general for kernel K:
    ϕ(x)=h(x)r(f1(w1Tx)f1(wrTx)fl(w1Tx)fl(wrTx))(l x r)

    Advantage

    Scalability: Performers are highly scalable for very long sequences.

    Memory Efficiency: Performers drastically reduce memory usage by linearizing attention.

    Robust Performance: Despite the approximation, Performers retain high accuracy and performance, comparable to standard transformers.

    Application

    Performers are beneficial in applications requiring efficient processing of long sequences, such as natural language processing, DNA sequence analysis, and other domains where traditional transformers are computationally prohibitive.

    Softmax and Attention Mechanism in Transformers

    Softmax Formula

    • In the context of transformers, the softmax function is used to normalize the attention scores:
    SM[s]i=esijesj
    • To calculate the softmax numerically, we can consider:

    eQTK=A

    d=[]n×n[111]n×1

    D=diag(d)=[d1000d2000dn]n×n

    SM[s]i=esijesj=AD1

    • We want to be able to do the matrix multiplication in the following way, which has linear time complexity for long sequences in transformers:
    [VΦTΦ]with dimensions:[m×nn×rr×n]=m×n

    Steps in Kernel Approximation

    • Kernel Formulation: Approximate ϕ(x)Tϕ(y) as a function of random vectors.
    • Random Feature Transformation: Performers use sinusoidal functions (sine and cosine) as random features for approximating similarity between sequences.
    • The softmax can also be approximated using random features, with a specific φ(x) tailored for softmax.
    e12xy2=e(xy)T(xy)2=exTx+yTy2xTy2=exTx2eyTy2exTy
    exTy=exy2exTx2eyTy2=φGauss(x)TφGauss(y)exTx2eyTy2=φGauss(x)TexTx2φGauss(y)eyTy2
    • So, the kernel approximation for the softmax is:
    φSM(x)=exTx2r(sin(ω1Tx),sin(ω2Tx),,sin(ωrTx),cos(ω1Tx),cos(ω2Tx),,cos(ωrTx))

    Variational Auto-encoders (VAEs)

    • Overview: VAEs are a type of generative model that extends traditional auto-encoders by introducing stochastic elements. While traditional auto-encoders are deterministic and focus on reconstructing inputs, VAEs aim to learn a distribution over the latent space. This approach extends traditional autoencoders by introducing a probabilistic framework that enables them to capture complex data distributions.

    Background: Auto-encoders

    • Basic Structure: Consists of an encoder, a bottleneck layer, and a decoder.
    • Objective: Maps input x into a lower-dimensional representation (z=uTx) by compressing it and reconstructs it. It minimizes the differences in x and the reconstructed version of it (x^=uz): min|xx^|
    • PCA Connection: A simple, linear auto-encoder resembles PCA in dimensionality reduction.
    • Limitation: While VAEs are powerful, they may struggle to capture highly complex data distributions compared to more recent generative models like GANs.

    Moving to Variational Auto-encoders

    • Generative Model Aspect: Variational Auto-encoders enforce a specific distribution on z, allowing them to generate new samples.
    • Gaussian Distribution Constraint: By enforcing a Gaussian distribution on z, the model can generate new samples in the learned data distribution. So Variational Auto-encoder introduces a prior distribution (typically Gaussian) on z and maximizes the Evidence Lower Bound (ELBO) instead of reconstruction alone.

    Approximation of the Posterior Distribution

    p(z|x)=p(x|z),p(z)p(x)
    p(x)=zp(x|z),p(z),dz
    • qθ(z) is the approximate posterior distribution of the latent variable z, parameterized by θ.
    • Purpose of qθ(z): In a VAE, we aim to learn a latent variable z that represents the underlying structure of the data x. Ideally, we want the true posterior p(z|x), which is often intractable to compute directly. To address this, we approximate p(z|x) with a simpler distribution qθ(z|x), where θ represents the parameters (typically learned through a neural network).
    • Key Points about qθ(z):
      • Approximate Posterior: qθ(z|x) is an approximation of the true posterior p(z|x).
      • Parameterized by θ: The parameters θ define the structure of this distribution, often through a neural network in a VAE.
      • Optimization: During training, we optimize θ to make qθ(z|x) as close as possible to p(z|x) by minimizing the KL divergence between qθ(z|x) and p(z|x): minθKL(qθ(z)||p(z|x))

    Information Theory

    In VAEs, the model learns a latent space where each data point is mapped not to a single point, but to a probability distribution. This design choice allows the VAE to: Capture the information content of the input data in a compressed, structured form. Represent the uncertainty in the data by encoding it as a distribution rather than as a single deterministic vector. The VAE learns this by balancing reconstruction accuracy with the information-theoretic regularization of the latent space, which enforces a smooth and organized representation.

    • Information content:
      • I, represents the information content or self-information of an event with probability p(x). It quantifies how much “surprise” or “information” is associated with a specific outcome x occurring.
      • The formula for information content I of an event x is: I=logp(x)
      • I is higher for less probable events (low p(x)), indicating more “surprise” or “information” content when that event occurs.
      • In information theory, this concept helps quantify the amount of information gained from observing an event, with rare events providing more information than common ones.
      • For example, given a sentence "Tomorrow, it either rains, or not." p(x)=1 and so I=log(1)=0 since there is no insight to glean in that sentence.
    • Entropy:
      • H represents entropy. Entropy measures the average amount of information (or “uncertainty”) contained in a random variable. It is often used to quantify the uncertainty or unpredictability of a probability distribution.
      • The formula for entropy H of a discrete random variable x with a probability distribution p(x) is: H=p(x)logp(x)
      • H is maximized when the distribution is most uncertain (e.g., in a uniform distribution).
      • In the context of VAEs, entropy is used to understand the distribution of latent variables and how much “information” or “uncertainty” they contain.
    • KL divergence:
      • KL divergence, stands for the Kullback-Leibler divergence between two probability distributions q and p. It is a measure of how one probability distribution q diverges from a second, reference probability distribution p.
      • The KL divergence from q(x) to p(x) is defined as: KL(q||p)=q(x)logq(x)q(x)logp(x)=xq(x)logq(x)p(x)
      • KL divergence is not symmetric; KL(qp)KL(pq). This means that it matters which distribution we consider as the reference.
      • KL divergence is always non-negative, KL(qp)0, and equals zero if and only if q=p (almost everywhere). This is known as Gibbs’ inequality.
      • In variational inference and variational auto-encoders (VAEs), KL divergence is used to measure the difference between the approximate posterior qθ(z|x) and the true posterior p(z|x). Minimizing KL(qθ(z|x)|p(z|x)) helps make the approximation qθ(z|x) closer to the true posterior.
      • KL divergence quantifies the “information loss” if we approximate p(x) with q(x). In essence, it tells us how much extra information (or “surprise”) is needed to describe samples from q as if they were from p.
      • For the continuous space:
    KL(q(z)p(z|x))=q(z)logp(z|x)q(z)dz
    p(z|x)=p(x|z)p(z)p(x)
    p(x|z)p(z)=p(x,z)
    KL(q(z)p(z|x))=q(z)logp(x,z)q(z)p(x)dz
    =q(z)[logp(x,z)q(z)+log1p(x)]dz
    =q(z)logp(x,z)q(z)dz+q(z)logp(x)dz=q(z)logp(x,z)q(z)dz+logp(x)q(z)dz
    q(z)dz=1
    logp(x)=KL(q(z)p(z|x))+q(z)logp(x,z)q(z)dz=KL(q(z)p(z|x))+ELBO
    ELBO=q(z)logp(x,z)q(z)dz
    =q(z)logp(x|z)p(z)q(z)dz
    =q(z)[logp(x|z)+logp(z)q(z)]dz
    =q(z)logp(x|z)dz+q(z)logp(z)q(z)dz
    =Eq(z)[logp(x|z)]KL(q(z)p(z))
    ELBO=Eqθ(z|x)[logp(x|z)]KL(qθ(z|x)|p(z))

    KL Divergence and Evidence Lower Bound (ELBO)

    • KL Divergence: Measures the similarity between two distributions; minimized to bring q close to p.
    • Evidence Lower Bound (ELBO):
      • Variational auto-encoders maximize ELBO which is similar to minimizing KL divergence since log(p(x)) is a constant.
      • Maximizing ELBO ensures q closely approximates p, meaning maximizing ELBO ensures that the learned latent distribution is close to the target distribution. This approach allows VAEs to generate new samples by sampling from the latent space.

    DPO (Direct Preference Optimization)

    DPO is a technique for fine-tuning LLMs using human preference data without reinforcement learning.

    Core Concept of DPO

    • Directly aligns the model's behavior with human preferences without using Reinforcement Learning.
    • Uses pairwise comparisons between preferred and less-preferred responses for optimization.
    • Avoids the need for a separate reward model.

    How DPO Works

    1. Collect Preference Data: Like RLHF, DPO starts with human preference rankings for model outputs.

    2. Train Directly on Preferences: Instead of training a separate reward model and running PPO, DPO adjusts the model's logits directly to prefer responses that humans ranked higher.

    3. Implicitly Regularized: DPO ensures that the model doesn’t deviate too much from its original state without needing an explicit KL term.

    Advantages of DPO over RLHF

    ✅ No Reinforcement Learning → Eliminates PPO instability and reward hacking

    ✅ More Stable and Predictable Outputs → Avoids mode collapse and nonsensical generations

    ✅ Simpler & Cheaper → Does not require a separate reward model or reinforcement learning

    ✅ Better Balance Between Diversity & Preference Matching → Produces more natural and useful responses

    DPO Loss Function The DPO loss function is defined as:

    LDPO=E(x,yw,yl)D[logσ(βlogπθ(yw|x)πref(yw|x)βlogπθ(yl|x)πref(yl|x))]

    • x (prompt): e.g., What is Ice?
    • yw (preferred response): e.g., It's the solid form of water.
    • yl (less preferred response): e.g., Water that has turned solid due to low temperatures.
    • πθ: Current model's output probabilities.
    • πref: Reference model's frozen probabilities.
    • β: Temperature scaling factor.

    LDPO=E(x,yw,yl)D[logσ(βlogπθ(yw|x)πref(yw|x)βlogπθ(yl|x)πref(yl|x))]

    LDPO=E(x,yw,yl)D[logσ(βlogπθ(yw|x)πref(yw|x)πθ(yl|x)πref(yl|x))]

    ELBO Decomposition

    • ELBO Equation: ELBO=q(z)logp(x|z)KL[q(z)||p(z)]
    • First Term: Reconstruction likelihood (maximize this).
    • Second Term: Ensures latent variable z approximates the desired distribution.

    Practical Implementation: Reconstruction Loss and Gaussian Constraint

    • Objective in VAE Training:
      • Minimize reconstruction loss (similar to traditional auto-encoders).
      • Ensure z follows a Gaussian distribution.
    • Regularization Term in ELBO: In VAEs, the Evidence Lower Bound (ELBO) includes a KL divergence term to ensure that the learned latent distribution remains close to a prior distribution (e.g., a Gaussian p(z)=N(0,I)).

    Re-parameterization Trick

    • Challenge: The stochastic nature of z complicates backpropagation.
    • Solution: To make the stochastic layer differentiable, VAEs use the re-parameterization trick, where z is expressed as a deterministic function with a noise component. So we use re-parameterization to enable gradient-based optimization and we minimize:
    min(|xx^|2+KL(q(z)N(0,1)))


    Reverse Processes

    • We need to know the reverse diffusion process pθ(xt1|xt)=N(xt1;μθ(xt,t),Σθ(xt,t))
    • Mean of q(x_{t-1}|x_t,x_0):

    q(xt1|xt,x0)=q(xt|xt1,x0)q(xt1|x0)q(xt|x0)exp(12((xtαtxt1)2βt+(xt1α¯t1x0)21α¯t1(xtα¯tx0)21α¯t))=exp(12((αtβt+11αt1¯)xt12(2αtβtxt+2αt1¯1αt1¯x0)xt1+C(xt,x0)))

    , where C(xt,x0) is not a function of xt1

    Define αt=1βt,αt¯=i=1Tαi,

    μt~(xt,x0)=αt(1αt1¯)1αt¯xt+αt1¯βt1αt¯x0

    Since x0=1αt¯(xt1αt¯ϵt), we have

    μt~(xt,x0)=1αt¯(xt1αt1αt¯ϵt)

    • KL for two Gaussian

    Between forward process and backward process:

    DKL(q(xt1|xt,x0)|pθ(xt1|xt))

    For the distributions:

    q(x)=N(x;μq,Σq) and p(x)=N(x;μp,Σp),

    The KL divergence formula is:

    DKL(q|p)=12(tr(Σp1Σq)+(μpμq)TΣp1(μpμq)k+ln(detΣpdetΣq))

    For q:

    μ~t(xt,x0)=1αt(xtβt1α¯tϵ)

    For p:

    μθ(xt,t)=1αt(xtβt1α¯tϵθ(xt,t))

    • Loss function

    The loss function is defined as:

    Lt=Ex0,ϵ[12|Σθ(xt,t)|22|μ~t(xt,x0)μθ(xt,t)|2]

    Substituting μ~t and μθ:

    Lt=Ex0,ϵ[12|Σθ|22|1αt(xt1αt1α¯tϵt)1αt(xt1αt1α¯tϵθ(xt,t))|2]

    Simplifying:

    Lt=Ex0,ϵ[(1αt)22αt(1α¯t)|Σθ|22|ϵtϵθ(xt,t)|2]

    Expressing xt in terms of x0 and ϵ:

    Lt=Ex0,ϵ[(1αt)22αt(1α¯t)|Σθ|22|ϵtϵθ(α¯tx0+1α¯tϵ,t)|2]

    Graph Neural Network (GNN)

    Graph Neural Networks are a class of deep learning methods designed to perform inference on data described by graphs.

    Application

    • Graphs are Structured Data: Many real-world datasets can be represented as graphs. Examples: social networks, protein-interaction networks, the World Wide Web, and molecules, where entities and their relationships are mapped as nodes and edges. In social networks, each user can be represented as a node and the relationships or interactions between them — such as friendships and follows — are represented as edges connecting the nodes. GNN can be used to recommend friends and content by learning from the network structure. Also, GNN can help to track the spread of information or behaviors across the network.
    • Images as Graphs: Images can be considered as graphs where each pixel acts as a node. In this representation, each pixel node connects to its adjacent pixels through edges and form a grid-like graph structure that captures the spatial relationships in the image.
    • Text as Graphs: Text data can also be represented as graphs. Here, each token or word is a node, and each node is connected by edges to the preceding and following tokens, which can capture the sequential dependencies in the text.
    • CNN as GNN: Convolutional Neural Networks (CNNs) can be viewed as a specialized form of Graph Neural Networks (GNNs) applied to grid-like structures. Each pixel in an image represents a node connected to its neighbors, with convolutions aggregating features across the whole grid. The main goal is to check if convolution can be defined on random graphs.

    Tasks

    There are 3 different levels of tasks.

    • Graph-Level Tasks: These involve predicting a property of the entire graph. For example, in molecular graphs, we may predict whether a particular molecule will bind to a receptor based on the graph structure. Examples: Images, Differentiate between molecules.
    • Node-Level Tasks: These focus on predicting the identity or role of each individual node within the graph. This could involve classifying nodes based on their attributes or their position within the network. Example: Node belonging to a network.
    • Edge-Level Tasks: These involve analyzing or predicting relationships between pairs of nodes, such as determining whether two nodes in a social network graph are friends or not. Example: Recommender Systems.

    Graph

    Definition

    A graph, denoted as G, can be defined by a set of vertices (or nodes) V and edges (connections between the vertices) V, along with an adjacency matrix A. This matrix represents the relationships between vertices in a binary format.

    In graph notation, we write this as G=(V,E,A), where:

    • V: Vertices or nodes in the graph.
    • E: Edges, which indicate connections between pairs of vertices.
    • A: Adjacency matrix, a binary matrix that indicates the presence (1) or absence (0) of an edge between vertex pairs.

    The adjacency matrix is a binary matrix indicating whether pairs of vertices are adjacent and is structured so that:

    The entry Aij=1 if there is an edge between vertex i and vertex j. The entry Aij=0 if there is no edge between vertex i and vertex j.

    In this way, the adjacency matrix provides a clear view of the connections within the graph.

    Laplacian of a Graph

    Laplacian Matrix Definition

    L=DA

    D: Degree matrix, which is a diagonal matrix where each diagonal entry represents the degree of each vertex.

    A: Adjacency matrix, as previously defined.


    Degree Matrix Notation

    The degree matrix D is a square matrix in which each diagonal element di represents the degree of the corresponding vertex i. D=[d1000d2000dn]n×n

    Degree of a Vertex is defined as di=jAij. The degree di is the sum of the elements in the i-th row of A, representing the number of edges connected to vertex i.

    Example

    For an adjacency matrix A as follows:

    A=[0110101011010010]

    The sum of each row (representing each vertex's degree) results in:

    Sum=[A1jA2jA3jA4j]=[2231]

    This yields the degree matrix D as:

    D=[2000020000300001]

    The Laplacian matrix L is then calculated as:

    L=DA

    Graph Cut Optimization Problem

    The graph cut optimization problem aims to partition a graph into segments with minimal interconnections between them.

    • Objective: The goal is to find a cut that divides the graph into distinct segments while minimizing the connections between them.
    • Minimization Target: The target function to minimize is Aij(yiyj)2, which captures the cost associated with the "cut" between segments.
    • Equation: The minimization can be expressed as yTLy, where L is the Laplacian matrix, and y is a vector representing the segment assignment of each node.
    • Constraint Applied: The constraint yTy=1 is applied to ensure non-trivial solutions.
    • Vector y: This vector represents the assignment of nodes to segments, with dimensions n×1, where n is the number of nodes.
    • Solution Method: Optimal partitioning is achieved by performing eigen decomposition on the Laplacian matrix L.
    Eigen Decomposition of Laplacian

    The Laplacian matrix L can be decomposed as L=UΛUT, where:

    U represents the orthonormal eigenvectors. These eigenvectors are both orthogonal to each other and normalized. Λ is a diagonal matrix containing the eigenvalues. Each diagonal entry in Λ corresponds to an eigenvalue that pairs with an eigenvector in U.

    Starting with the standard Laplacian, defined as L=DA:

    D is the degree matrix. A is the adjacency matrix. The normalized Laplacian is given by: L~=D12(DA)D12

    This expression can be simplified to: L~=ID12AD12, where I is the identity matrix.

    Laplacian Eigenvectors and Fourier Analysis Analogy
    • Mathematical Definition: Decomposition of a signal into sinusoidal components.
    • Frequency Domain: A signal is transformed to represent it as a sum of its frequency components.
    • Basis Functions: Sine and cosine functions serve as the basis for this transformation.
    • Orthogonality: These basis functions are orthogonal, ensuring unique frequency representation.
    • Graph Signals: Functions defined over the nodes of a graph.
    • Spectral Domain: Eigenvectors of L transform graph signals into the spectral domain.
    • Eigenvector Basis: Analogous to sines and cosines, eigenvectors form a basis for graph signals.
    • Orthogonality: Eigenvectors are orthogonal, providing a unique spectral representation for graph signals.
    • Low Eigenvalues: Correspond to "low-frequency" eigenvectors. These eigenvectors change slowly over the graph. Represent large-scale, smooth structures in the graph.
    • High Eigenvalues: Correspond to "high-frequency" eigenvectors. These eigenvectors change rapidly between connected nodes. Capture fine details or irregularities in the graph.
    • Ordering: Eigenvalues (and eigenvectors) are ordered from lowest to highest.

    Fourier Transform

    The eigen-decomposition of the graph Laplacian L can be written as: L=UTΛU, where:

    • U=[u1,...,un] is the matrix of orthonormal eigenvectors.
    • Λ is a diagonal matrix where each entry Λii=λi represents an eigenvalue (also known as the spectrum of the Laplacian).
    • The equation UTU=I indicates that the eigenvectors are orthonormal.

    The eigenvectors from u1 to un are also called Fourier functions, as they serve as a basis for transforming signals on the graph.

    The Fourier transform projects a signal x onto the Fourier functions, resulting in coefficients that form the Fourier series.

    In the context of graphs, the graph Fourier transform projects an input graph signal onto an orthonormal basis formed by the eigenvectors of the normalized graph Laplacian.

    Suppose xRn is a feature vector containing the values of all nodes in a graph, where xi represents the value at the i-th node.

    • The graph Fourier transform of a signal x is given by: f(x)=UTx=x^
    • The inverse graph Fourier transform is defined as: f1(x^)=Ux^=UUTx=x

    ConvGNNs

    The graph convolution of an input signal x with a filter gRn is defined as follows:

    Convolution Theorem: f(xg)=(f(x)f(g))

    This can be expanded as:

    • xg=f1(f(x)f(g))
    • =U(UTxUTg)
    • =UgθUTx

    Where gθ=diag(UTg).

    Neural Network Layers
    • Feedforward Neural Networks (FFNN):

    Computation proceeds in layers, with each layer represented as h=σ(Wh). The output of each layer h serves as the input for the next layer. The initial input h0 is the feature vector x.

    • Convolutional Neural Networks (CNN):

    Layer computation involves convolution, with each layer defined as h=σ(wh). w represents the learned filters or kernels that slide over h.

    Vanilla Spectral GNN

    The graph convolutional layer of the Spectral CNN is defined as:

    xg=f1(f(x)f(g)) =U(UTxUTg) =UgθUTx

    With:

    • H=σ(UΘUTH)
    • X=H(0)
    • gθ=Θ

    Here, Θ is a diagonal matrix with learnable parameters, where UTg=[u1Tg  unTg] and Θ=[u1TgunTg].

    Limitation: Eigen-decomposition requires O(n2) computational complexity.

    ChebNet

    Approximates the filter gθ by Chebyshev [*] polynomials of the diagonal matrix of eigenvalues Λ.

    Chebyshev Polynomials of the first kind
    • T0(x)=1
    • T1(x)=x
    • For i2, the polynomials are defined as: Ti(x)=2xTi1(x)Ti2(x)


    ChebNet Graph Convolution
    • gθ=iθiTi(A~).
    • gθ is a Graph convolutional filter with parameter θ.
    • A~ is are scaled eigenvalues of the Laplacian matrix: A~=2AλmaxIn, which makes the normalized eigenvalues fall into [-1,1].
    • xg=UgθUTx
    • xg=iθiUTi(A~)UTx
    • xgθ=U(iθiTi(A~))UTx
    • This is equal to: xgθ=i=1kθiTi(L~)x, where L~=2LλmaxIn